--- /dev/null
+* text=false
--- /dev/null
+# Auto generated files\r
+build/*\r
+*.slo\r
+*.lo\r
+*.o\r
+*.obj\r
+*.suo\r
+*.tlog\r
+*.ilk\r
+*.log\r
+*.pdb\r
+*.idb\r
+*.iobj\r
+*.ipdb\r
+*.opensdf\r
+*.sdf\r
+\r
+# Compiled Dynamic libraries\r
+*.so\r
+*.dylib\r
+*.dll\r
+\r
+# Compiled Static libraries\r
+*.lai\r
+*.la\r
+*.a\r
+*.lib\r
+\r
+# Executables\r
+*.exe\r
+*.out\r
+*.app\r
+\r
+# Codelite\r
+.codelite\r
+\r
+# KDevelop\r
+*.kdev4\r
+\r
+# .orig files\r
+*.orig\r
+\r
+# example files\r
+example/*\r
+!example/example.cpp\r
+!example/bench.cpp\r
+!example/utils.h\r
+!example/Makefile*\r
+!example/example.sln\r
+!example/example.vcxproj\r
+!example/CMakeLists.txt\r
+!example/meson.build\r
+!example/multisink.cpp\r
+!example/jni\r
+\r
+# generated files\r
+generated\r
+\r
+# Cmake\r
+CMakeCache.txt\r
+CMakeFiles\r
+CMakeScripts\r
+Makefile\r
+cmake_install.cmake\r
+install_manifest.txt\r
+/tests/tests.VC.VC.opendb\r
+/tests/tests.VC.db\r
+/tests/tests\r
+/tests/logs/*\r
+\r
+# idea\r
+.idea/\r
+cmake-build-*/\r
+*.db\r
+*.ipch\r
+*.filters\r
+*.db-wal\r
+*.opendb\r
+*.db-shm\r
+*.vcxproj\r
+*.tcl\r
+*.user\r
+*.sln\r
--- /dev/null
+# Adapted from various sources, including:
+# - Louis Dionne's Hana: https://github.com/ldionne/hana
+# - Paul Fultz II's FIT: https://github.com/pfultz2/Fit
+# - Eric Niebler's range-v3: https://github.com/ericniebler/range-v3
+sudo: required
+language: cpp
+
+# gcc 4.8
+addons: &gcc48
+ apt:
+ packages:
+ - g++-4.8
+ sources:
+ - ubuntu-toolchain-r-test
+
+# gcc 7.0
+addons: &gcc7
+ apt:
+ packages:
+ - g++-7
+ sources:
+ - ubuntu-toolchain-r-test
+
+# Clang 3.5
+addons: &clang35
+ apt:
+ packages:
+ - clang-3.5
+ sources:
+ - ubuntu-toolchain-r-test
+ - llvm-toolchain-precise-3.5
+
+# Clang 7.0
+addons: &clang70
+ apt:
+ packages:
+ - clang-7
+ sources:
+ - ubuntu-toolchain-r-test
+ - llvm-toolchain-trusty-7
+
+
+
+matrix:
+ include:
+ # Test gcc-4.8: C++11, Build=Debug/Release
+ - env: GCC_VERSION=4.8 BUILD_TYPE=Debug CPP=11
+ os: linux
+ addons: *gcc48
+
+ - env: GCC_VERSION=4.8 BUILD_TYPE=Release CPP=11
+ os: linux
+ addons: *gcc48
+
+ - env: GCC_VERSION=7 BUILD_TYPE=Release CPP=11
+ os: linux
+ addons: *gcc7
+
+ # Test clang-3.5: C++11, Build=Debug/Release
+ - env: CLANG_VERSION=3.5 BUILD_TYPE=Debug CPP=11
+ os: linux
+ addons: *clang35
+
+ - env: CLANG_VERSION=3.5 BUILD_TYPE=Release CPP=11
+ os: linux
+ addons: *clang35
+
+ # Test clang-7.0: C++11, Build=Debug, ASAN=On
+ - env: CLANG_VERSION=7 BUILD_TYPE=Debug CPP=11 ASAN=On TSAN=Off
+ dist: bionic
+
+ - env: CLANG_VERSION=7 BUILD_TYPE=Release CPP=11 ASAN=On TSAN=Off
+ dist: bionic
+
+ # osx
+ - env: BUILD_TYPE=Release CPP=11 ASAN=Off TSAN=Off
+ os: osx
+
+
+
+before_script:
+ - if [ -n "$GCC_VERSION" ]; then export CXX="g++-${GCC_VERSION}" CC="gcc-${GCC_VERSION}"; fi
+ - if [ -n "$CLANG_VERSION" ]; then export CXX="clang++-${CLANG_VERSION}" CC="clang-${CLANG_VERSION}"; fi
+ - if [[ "$TRAVIS_OS_NAME" == "osx" ]]; then export CXX="clang++" CC="clang"; fi
+ - which $CXX
+ - which $CC
+ - $CXX --version
+ - cmake --version
+
+script:
+ - cd ${TRAVIS_BUILD_DIR}
+ - mkdir -p build && cd build
+ - |
+ cmake .. \
+ --warn-uninitialized \
+ -DCMAKE_BUILD_TYPE=$BUILD_TYPE \
+ -DCMAKE_CXX_STANDARD=$CPP \
+ -DSPDLOG_BUILD_EXAMPLE=ON \
+ -DSPDLOG_BUILD_EXAMPLE_HO=ON \
+ -DSPDLOG_BUILD_BENCH=OFF \
+ -DSPDLOG_BUILD_TESTS=ON \
+ -DSPDLOG_BUILD_TESTS_HO=OFf \
+ -DSPDLOG_SANITIZE_ADDRESS=$ASAN
+
+ - make VERBOSE=1 -j2
+ - ctest -j2 --output-on-failure
+
+
+
+notifications:
+ email: false
--- /dev/null
+# Copyright(c) 2019 spdlog authors
+# Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+cmake_minimum_required(VERSION 3.2)
+
+#---------------------------------------------------------------------------------------
+# Start spdlog project
+#---------------------------------------------------------------------------------------
+include(GNUInstallDirs)
+include(cmake/utils.cmake)
+include(cmake/ide.cmake)
+
+spdlog_extract_version()
+
+#---------------------------------------------------------------------------------------
+# Set default build to release
+#---------------------------------------------------------------------------------------
+if(NOT CMAKE_BUILD_TYPE)
+ set(CMAKE_BUILD_TYPE "Release" CACHE STRING "Choose Release or Debug" FORCE)
+endif()
+
+project(spdlog VERSION ${SPDLOG_VERSION} LANGUAGES CXX)
+message(STATUS "Build spdlog: ${SPDLOG_VERSION}")
+
+#---------------------------------------------------------------------------------------
+# Compiler config
+#---------------------------------------------------------------------------------------
+if (NOT CMAKE_CXX_STANDARD)
+ set(CMAKE_CXX_STANDARD 11)
+ set(CMAKE_CXX_STANDARD_REQUIRED ON)
+endif()
+
+set(CMAKE_CXX_EXTENSIONS OFF)
+
+if(CMAKE_SYSTEM_NAME MATCHES "CYGWIN")
+ set(CMAKE_CXX_EXTENSIONS ON)
+endif()
+
+
+#---------------------------------------------------------------------------------------
+# Set SPDLOG_MASTER_PROJECT to ON if we are building spdlog
+#---------------------------------------------------------------------------------------
+# Check if spdlog is being used directly or via add_subdirectory, but allow overriding
+if (NOT DEFINED SPDLOG_MASTER_PROJECT)
+ if (CMAKE_CURRENT_SOURCE_DIR STREQUAL CMAKE_SOURCE_DIR)
+ set(SPDLOG_MASTER_PROJECT ON)
+ else()
+ set(SPDLOG_MASTER_PROJECT OFF)
+ endif()
+endif ()
+
+# build shared option
+if(NOT WIN32)
+ option(SPDLOG_BUILD_SHARED "Build shared library" OFF)
+endif()
+
+# example options
+option(SPDLOG_BUILD_EXAMPLE "Build example" ${SPDLOG_MASTER_PROJECT})
+option(SPDLOG_BUILD_EXAMPLE_HO "Build header only example" OFF)
+
+# testing options
+option(SPDLOG_BUILD_TESTS "Build tests" ${SPDLOG_MASTER_PROJECT})
+option(SPDLOG_BUILD_TESTS_HO "Build tests using the header only version" OFF)
+
+# bench options
+option(SPDLOG_BUILD_BENCH "Build benchmarks (Requires https://github.com/google/benchmark.git to be installed)" OFF)
+
+# sanitizer options
+option(SPDLOG_SANITIZE_ADDRESS "Enable address sanitizer in tests" OFF)
+
+# install options
+option(SPDLOG_INSTALL "Generate the install target" ${SPDLOG_MASTER_PROJECT})
+option(SPDLOG_FMT_EXTERNAL "Use external fmt library instead of bundled" OFF)
+option(SPDLOG_FMT_EXTERNAL_HO "Use external fmt header-only library instead of bundled" OFF)
+option(SPDLOG_NO_EXCEPTIONS "Compile with -fno-exceptions. Call abort() on any spdlog exceptions" OFF)
+
+if (SPDLOG_FMT_EXTERNAL AND SPDLOG_FMT_EXTERNAL_HO)
+ message(FATAL_ERROR "SPDLOG_FMT_EXTERNAL and SPDLOG_FMT_EXTERNAL_HO are mutually exclusive")
+endif()
+
+# misc tweakme options
+if(WIN32)
+ option(SPDLOG_WCHAR_SUPPORT "Support wchar api" OFF)
+ option(SPDLOG_WCHAR_FILENAMES "Support wchar filenames" OFF)
+endif()
+if(${CMAKE_SYSTEM_NAME} STREQUAL "Linux")
+ option(SPDLOG_CLOCK_COARSE "Use the much faster (but much less accurate) CLOCK_REALTIME_COARSE instead of the regular clock," OFF)
+endif()
+
+option(SPDLOG_PREVENT_CHILD_FD "Prevent from child processes to inherit log file descriptors" OFF)
+option(SPDLOG_NO_THREAD_ID "prevent spdlog from querying the thread id on each log call if thread id is not needed" OFF)
+option(SPDLOG_NO_TLS "prevent spdlog from using thread local storage" OFF)
+option(SPDLOG_NO_ATOMIC_LEVELS "prevent spdlog from using of std::atomic log levels (use only if your code never modifies log levels concurrently" OFF)
+
+find_package(Threads REQUIRED)
+message(STATUS "Build type: " ${CMAKE_BUILD_TYPE})
+#---------------------------------------------------------------------------------------
+# Static/Shared library (shared not supported in windows yet)
+#---------------------------------------------------------------------------------------
+set(SPDLOG_SRCS
+ src/spdlog.cpp
+ src/stdout_sinks.cpp
+ src/color_sinks.cpp
+ src/file_sinks.cpp
+ src/async.cpp)
+
+
+if(NOT SPDLOG_FMT_EXTERNAL AND NOT SPDLOG_FMT_EXTERNAL_HO)
+ list(APPEND SPDLOG_SRCS src/fmt.cpp)
+endif()
+
+if (SPDLOG_BUILD_SHARED)
+ if(WIN32)
+ message(FATAL_ERROR "spdlog shared lib is not yet supported under windows")
+ endif()
+ add_library(spdlog SHARED ${SPDLOG_SRCS} ${SPDLOG_ALL_HEADERS})
+else()
+ add_library(spdlog STATIC ${SPDLOG_SRCS} ${SPDLOG_ALL_HEADERS})
+endif()
+
+add_library(spdlog::spdlog ALIAS spdlog)
+
+target_compile_definitions(spdlog PUBLIC SPDLOG_COMPILED_LIB)
+target_include_directories(spdlog PUBLIC
+ "$<BUILD_INTERFACE:${CMAKE_CURRENT_LIST_DIR}/include>"
+ "$<INSTALL_INTERFACE:${CMAKE_INSTALL_INCLUDEDIR}>")
+target_link_libraries(spdlog PUBLIC Threads::Threads)
+spdlog_enable_warnings(spdlog)
+
+set_target_properties(spdlog PROPERTIES VERSION ${SPDLOG_VERSION} SOVERSION ${SPDLOG_VERSION_MAJOR})
+set_target_properties(spdlog PROPERTIES DEBUG_POSTFIX d)
+
+#---------------------------------------------------------------------------------------
+# Header only version
+#---------------------------------------------------------------------------------------
+add_library(spdlog_header_only INTERFACE)
+add_library(spdlog::spdlog_header_only ALIAS spdlog_header_only)
+
+target_include_directories(spdlog_header_only INTERFACE
+ "$<BUILD_INTERFACE:${CMAKE_CURRENT_LIST_DIR}/include>"
+ "$<INSTALL_INTERFACE:${CMAKE_INSTALL_INCLUDEDIR}>")
+target_link_libraries(spdlog_header_only INTERFACE Threads::Threads)
+
+
+#---------------------------------------------------------------------------------------
+# Use fmt package if using external fmt
+#---------------------------------------------------------------------------------------
+if(SPDLOG_FMT_EXTERNAL OR SPDLOG_FMT_EXTERNAL_HO)
+ if (NOT TARGET fmt::fmt)
+ find_package(fmt REQUIRED)
+ endif ()
+ target_compile_definitions(spdlog PUBLIC SPDLOG_FMT_EXTERNAL)
+ target_compile_definitions(spdlog_header_only INTERFACE SPDLOG_FMT_EXTERNAL)
+
+ # use external fmt-header-nly
+ if(SPDLOG_FMT_EXTERNAL_HO)
+ target_link_libraries(spdlog PUBLIC fmt::fmt-header-only)
+ target_link_libraries(spdlog_header_only INTERFACE fmt::fmt-header-only)
+ else() # use external compile fmt
+ target_link_libraries(spdlog PUBLIC fmt::fmt)
+ target_link_libraries(spdlog_header_only INTERFACE fmt::fmt)
+ endif()
+
+ set(PKG_CONFIG_REQUIRES fmt) # add dependency to pkg-config
+endif()
+
+#---------------------------------------------------------------------------------------
+# Misc definitions according to tweak options
+#---------------------------------------------------------------------------------------
+if(SPDLOG_WCHAR_SUPPORT)
+ target_compile_definitions(spdlog PUBLIC SPDLOG_WCHAR_TO_UTF8_SUPPORT)
+ target_compile_definitions(spdlog_header_only INTERFACE SPDLOG_WCHAR_TO_UTF8_SUPPORT)
+ endif()
+
+ if(SPDLOG_WCHAR_FILENAMES)
+ target_compile_definitions(spdlog PUBLIC SPDLOG_WCHAR_FILENAMES)
+ target_compile_definitions(spdlog_header_only INTERFACE SPDLOG_WCHAR_FILENAMES)
+ endif()
+
+ if(SPDLOG_NO_EXCEPTIONS)
+ target_compile_definitions(spdlog PUBLIC SPDLOG_NO_EXCEPTIONS)
+
+ target_compile_definitions(spdlog_header_only INTERFACE SPDLOG_NO_EXCEPTIONS)
+
+ if(NOT MSVC)
+ target_compile_options(spdlog PRIVATE -fno-exceptions)
+ endif()
+endif()
+
+if(SPDLOG_CLOCK_COARSE)
+ target_compile_definitions(spdlog PRIVATE SPDLOG_CLOCK_COARSE)
+ target_compile_definitions(spdlog_header_only INTERFACE SPDLOG_CLOCK_COARSE)
+endif()
+
+if(SPDLOG_PREVENT_CHILD_FD)
+ target_compile_definitions(spdlog PRIVATE SPDLOG_PREVENT_CHILD_FD)
+ target_compile_definitions(spdlog_header_only INTERFACE SPDLOG_PREVENT_CHILD_FD)
+endif()
+
+if(SPDLOG_NO_THREAD_ID)
+ target_compile_definitions(spdlog PRIVATE SPDLOG_NO_THREAD_ID)
+ target_compile_definitions(spdlog_header_only INTERFACE SPDLOG_NO_THREAD_ID)
+endif()
+
+if(SPDLOG_NO_TLS)
+ target_compile_definitions(spdlog PRIVATE SPDLOG_NO_TLS)
+ target_compile_definitions(spdlog_header_only INTERFACE SPDLOG_NO_TLS)
+endif()
+
+if(SPDLOG_NO_ATOMIC_LEVELS)
+ target_compile_definitions(spdlog PUBLIC SPDLOG_NO_ATOMIC_LEVELS)
+ target_compile_definitions(spdlog_header_only INTERFACE SPDLOG_NO_ATOMIC_LEVELS)
+endif()
+
+
+#---------------------------------------------------------------------------------------
+# Build binaries
+#---------------------------------------------------------------------------------------
+if(SPDLOG_BUILD_EXAMPLE OR SPDLOG_BUILD_EXAMPLE_HO)
+ message(STATUS "Generating examples")
+ add_subdirectory(example)
+endif()
+
+if(SPDLOG_BUILD_TESTS OR SPDLOG_BUILD_TESTS_HO)
+ message(STATUS "Generating tests")
+ enable_testing()
+ add_subdirectory(tests)
+endif()
+
+if(SPDLOG_BUILD_BENCH)
+ message(STATUS "Generating benchmarks")
+ add_subdirectory(bench)
+endif()
+
+#---------------------------------------------------------------------------------------
+# Install
+#---------------------------------------------------------------------------------------
+if (SPDLOG_INSTALL)
+ message(STATUS "Generating install")
+ set(project_config_in "${CMAKE_CURRENT_LIST_DIR}/cmake/spdlogConfig.cmake.in")
+ set(project_config_out "${CMAKE_CURRENT_BINARY_DIR}/spdlogConfig.cmake")
+ set(config_targets_file "spdlogConfigTargets.cmake")
+ set(version_config_file "${CMAKE_CURRENT_BINARY_DIR}/spdlogConfigVersion.cmake")
+ set(export_dest_dir "${CMAKE_INSTALL_LIBDIR}/cmake/spdlog")
+ set(pkgconfig_install_dir "${CMAKE_INSTALL_LIBDIR}/pkgconfig")
+ set(pkg_config "${CMAKE_BINARY_DIR}/${PROJECT_NAME}.pc")
+
+ #---------------------------------------------------------------------------------------
+ # Include files
+ #---------------------------------------------------------------------------------------
+ install(DIRECTORY include/ DESTINATION "${CMAKE_INSTALL_INCLUDEDIR}" PATTERN "fmt/bundled" EXCLUDE)
+ install(TARGETS spdlog spdlog_header_only EXPORT spdlog DESTINATION "${CMAKE_INSTALL_LIBDIR}")
+
+ if(NOT SPDLOG_FMT_EXTERNAL AND NOT SPDLOG_FMT_EXTERNAL_HO)
+ install(DIRECTORY include/${PROJECT_NAME}/fmt/bundled/
+ DESTINATION "${CMAKE_INSTALL_INCLUDEDIR}/${PROJECT_NAME}/fmt/bundled/")
+ endif()
+
+ #---------------------------------------------------------------------------------------
+ # Install pkg-config file
+ #---------------------------------------------------------------------------------------
+ get_target_property(PKG_CONFIG_DEFINES spdlog INTERFACE_COMPILE_DEFINITIONS)
+ string(REPLACE ";" " -D" PKG_CONFIG_DEFINES "${PKG_CONFIG_DEFINES}")
+ string(CONCAT PKG_CONFIG_DEFINES "-D" "${PKG_CONFIG_DEFINES}")
+ configure_file("cmake/${PROJECT_NAME}.pc.in" "${pkg_config}" @ONLY)
+ install(FILES "${pkg_config}" DESTINATION "${pkgconfig_install_dir}")
+
+ #---------------------------------------------------------------------------------------
+ # Install CMake config files
+ #---------------------------------------------------------------------------------------
+ install(EXPORT spdlog
+ DESTINATION ${export_dest_dir}
+ NAMESPACE spdlog::
+ FILE ${config_targets_file})
+
+ include(CMakePackageConfigHelpers)
+ configure_file("${project_config_in}" "${project_config_out}" @ONLY)
+
+ write_basic_package_version_file("${version_config_file}" COMPATIBILITY SameMajorVersion)
+ install(FILES
+ "${project_config_out}"
+ "${version_config_file}" DESTINATION "${export_dest_dir}")
+
+ #---------------------------------------------------------------------------------------
+ # Support creation of installable packages
+ #---------------------------------------------------------------------------------------
+ include(cmake/spdlogCPack.cmake)
+
+endif ()
+
--- /dev/null
+Header only version:\r
+==================================================================\r
+Just copy the files to your build tree and use a C++11 compiler.\r
+Or use CMake:\r
+ add_executable(example_header_only example.cpp)\r
+ target_link_libraries(example_header_only spdlog::spdlog_header_only)\r
+\r
+\r
+Compiled library version:\r
+==================================================================\r
+CMake:\r
+ add_executable(example example.cpp)\r
+ target_link_libraries(example spdlog::spdlog)\r
+\r
+Or copy src/spdlog.cpp to your build tree and pass the -DSPDLOG_COMPILED_LIB to the compiler.\r
+\r
+Tested on:\r
+gcc 4.8.1 and above\r
+clang 3.5\r
+Visual Studio 2013\r
+\r
+\r
+\r
+\r
--- /dev/null
+The MIT License (MIT)\r
+\r
+Copyright (c) 2016 Gabi Melman. \r
+\r
+Permission is hereby granted, free of charge, to any person obtaining a copy\r
+of this software and associated documentation files (the "Software"), to deal\r
+in the Software without restriction, including without limitation the rights\r
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell\r
+copies of the Software, and to permit persons to whom the Software is\r
+furnished to do so, subject to the following conditions:\r
+\r
+The above copyright notice and this permission notice shall be included in\r
+all copies or substantial portions of the Software.\r
+\r
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\r
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\r
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\r
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\r
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\r
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN\r
+THE SOFTWARE.\r
+\r
--- /dev/null
+# spdlog\r
+\r
+Very fast, header-only/compiled, C++ logging library. [](https://travis-ci.org/gabime/spdlog) [](https://ci.appveyor.com/project/gabime/spdlog)\r
+\r
+\r
+\r
+## Install \r
+#### Header only version\r
+Copy the source [folder](https://github.com/gabime/spdlog/tree/v1.x/include/spdlog) to your build tree and use a C++11 compiler.\r
+\r
+#### Static lib version (recommended - much faster compile times)\r
+```console\r
+$ git clone https://github.com/gabime/spdlog.git\r
+$ cd spdlog && mkdir build && cd build\r
+$ cmake .. && make -j\r
+```\r
+ \r
+ see example [CMakeLists.txt](https://github.com/gabime/spdlog/blob/v1.x/example/CMakeLists.txt) on how to use.\r
+\r
+## Platforms\r
+ * Linux, FreeBSD, OpenBSD, Solaris, AIX\r
+ * Windows (msvc 2013+, cygwin)\r
+ * macOS (clang 3.5+)\r
+ * Android\r
+\r
+## Package managers:\r
+* Homebrew: `brew install spdlog`\r
+* FreeBSD: `cd /usr/ports/devel/spdlog/ && make install clean`\r
+* Fedora: `yum install spdlog`\r
+* Gentoo: `emerge dev-libs/spdlog`\r
+* Arch Linux: `yaourt -S spdlog-git`\r
+* vcpkg: `vcpkg install spdlog`\r
+* conan: `spdlog/[>=1.4.1]`\r
+\r
+\r
+## Features\r
+* Very fast (see [benchmarks](#benchmarks) below).\r
+* Headers only, just copy and use. Or use as a compiled library.\r
+* Feature rich formatting, using the excellent [fmt](https://github.com/fmtlib/fmt) library.\r
+* **New!** [Backtrace](#backtrace-support) support - store debug messages in a ring buffer and display later on demand.\r
+* Fast asynchronous mode (optional)\r
+* [Custom](https://github.com/gabime/spdlog/wiki/3.-Custom-formatting) formatting.\r
+* Multi/Single threaded loggers.\r
+* Various log targets:\r
+ * Rotating log files.\r
+ * Daily log files.\r
+ * Console logging (colors supported).\r
+ * syslog.\r
+ * Windows debugger (```OutputDebugString(..)```)\r
+ * Easily extendable with custom log targets (just implement a single function in the [sink](include/spdlog/sinks/sink.h) interface).\r
+* Severity based filtering - threshold levels can be modified in runtime as well as in compile time.\r
+\r
+ \r
+## Usage samples\r
+\r
+#### Basic usage\r
+```c++\r
+#include "spdlog/spdlog.h"\r
+#include "spdlog/sinks/basic_file_sink.h"\r
+\r
+int main() \r
+{\r
+ spdlog::info("Welcome to spdlog!");\r
+ spdlog::error("Some error message with arg: {}", 1);\r
+ \r
+ spdlog::warn("Easy padding in numbers like {:08d}", 12);\r
+ spdlog::critical("Support for int: {0:d}; hex: {0:x}; oct: {0:o}; bin: {0:b}", 42);\r
+ spdlog::info("Support for floats {:03.2f}", 1.23456);\r
+ spdlog::info("Positional args are {1} {0}..", "too", "supported");\r
+ spdlog::info("{:<30}", "left aligned");\r
+ \r
+ spdlog::set_level(spdlog::level::debug); // Set global log level to debug\r
+ spdlog::debug("This message should be displayed.."); \r
+ \r
+ // change log pattern\r
+ spdlog::set_pattern("[%H:%M:%S %z] [%n] [%^---%L---%$] [thread %t] %v");\r
+ \r
+ // Compile time log levels\r
+ // define SPDLOG_ACTIVE_LEVEL to desired level\r
+ SPDLOG_TRACE("Some trace message with param {}", 42);\r
+ SPDLOG_DEBUG("Some debug message");\r
+ \r
+ // Set the default logger to file logger\r
+ auto file_logger = spdlog::basic_logger_mt("basic_logger", "logs/basic.txt");\r
+ spdlog::set_default_logger(file_logger); \r
+}\r
+```\r
+#### create stdout/stderr logger object\r
+```c++\r
+#include "spdlog/spdlog.h"\r
+#include "spdlog/sinks/stdout_color_sinks.h"\r
+void stdout_example()\r
+{\r
+ // create color multi threaded logger\r
+ auto console = spdlog::stdout_color_mt("console"); \r
+ auto err_logger = spdlog::stderr_color_mt("stderr"); \r
+ spdlog::get("console")->info("loggers can be retrieved from a global registry using the spdlog::get(logger_name)");\r
+}\r
+```\r
+---\r
+#### Basic file logger\r
+```c++\r
+#include "spdlog/sinks/basic_file_sink.h"\r
+void basic_logfile_example()\r
+{\r
+ try \r
+ {\r
+ auto my_logger = spdlog::basic_logger_mt("basic_logger", "logs/basic-log.txt");\r
+ }\r
+ catch (const spdlog::spdlog_ex &ex)\r
+ {\r
+ std::cout << "Log init failed: " << ex.what() << std::endl;\r
+ }\r
+}\r
+```\r
+---\r
+#### Rotating files\r
+```c++\r
+#include "spdlog/sinks/rotating_file_sink.h"\r
+void rotating_example()\r
+{\r
+ // Create a file rotating logger with 5mb size max and 3 rotated files\r
+ auto rotating_logger = spdlog::rotating_logger_mt("some_logger_name", "logs/rotating.txt", 1048576 * 5, 3);\r
+}\r
+```\r
+\r
+---\r
+#### Daily files\r
+```c++\r
+\r
+#include "spdlog/sinks/daily_file_sink.h"\r
+void daily_example()\r
+{\r
+ // Create a daily logger - a new file is created every day on 2:30am\r
+ auto daily_logger = spdlog::daily_logger_mt("daily_logger", "logs/daily.txt", 2, 30);\r
+}\r
+\r
+```\r
+\r
+---\r
+#### Backtrace support\r
+```c++\r
+// Loggers can store in a ring buffer all messages (including debug/trace) and display later on demand.\r
+// When needed, call dump_backtrace() to see them\r
+spdlog::enable_backtrace(32); // create ring buffer with capacity of 32 messages\r
+// or my_logger->enable_backtrace(32)..\r
+for(int i = 0; i < 100; i++)\r
+{\r
+ spdlog::debug("Backtrace message {}", i); // not logged yet..\r
+}\r
+// e.g. if some error happened:\r
+spdlog::dump_backtrace(); // log them now! show the last 32 messages\r
+\r
+// or my_logger->dump_backtrace(32)..\r
+```\r
+\r
+---\r
+#### Periodic flush\r
+```c++\r
+// periodically flush all *registered* loggers every 3 seconds:\r
+// warning: only use if all your loggers are thread safe ("_mt" loggers)\r
+spdlog::flush_every(std::chrono::seconds(3));\r
+\r
+```\r
+\r
+---\r
+#### Log binary data in hex\r
+```c++\r
+// many types of std::container<char> types can be used.\r
+// ranges are supported too.\r
+// format flags:\r
+// {:X} - print in uppercase.\r
+// {:s} - don't separate each byte with space.\r
+// {:p} - don't print the position on each line start.\r
+// {:n} - don't split the output to lines.\r
+\r
+#include "spdlog/fmt/bin_to_hex.h"\r
+\r
+void binary_example()\r
+{\r
+ auto console = spdlog::get("console");\r
+ std::array<char, 80> buf;\r
+ console->info("Binary example: {}", spdlog::to_hex(buf));\r
+ console->info("Another binary example:{:n}", spdlog::to_hex(std::begin(buf), std::begin(buf) + 10));\r
+ // more examples:\r
+ // logger->info("uppercase: {:X}", spdlog::to_hex(buf));\r
+ // logger->info("uppercase, no delimiters: {:Xs}", spdlog::to_hex(buf));\r
+ // logger->info("uppercase, no delimiters, no position info: {:Xsp}", spdlog::to_hex(buf));\r
+}\r
+\r
+```\r
+\r
+---\r
+#### Logger with multi sinks - each with different format and log level\r
+```c++\r
+\r
+// create logger with 2 targets with different log levels and formats.\r
+// the console will show only warnings or errors, while the file will log all.\r
+void multi_sink_example()\r
+{\r
+ auto console_sink = std::make_shared<spdlog::sinks::stdout_color_sink_mt>();\r
+ console_sink->set_level(spdlog::level::warn);\r
+ console_sink->set_pattern("[multi_sink_example] [%^%l%$] %v");\r
+\r
+ auto file_sink = std::make_shared<spdlog::sinks::basic_file_sink_mt>("logs/multisink.txt", true);\r
+ file_sink->set_level(spdlog::level::trace);\r
+\r
+ spdlog::logger logger("multi_sink", {console_sink, file_sink});\r
+ logger.set_level(spdlog::level::debug);\r
+ logger.warn("this should appear in both console and file");\r
+ logger.info("this message should not appear in the console, only in the file");\r
+}\r
+```\r
+\r
+---\r
+#### Asynchronous logging\r
+```c++\r
+#include "spdlog/async.h"\r
+#include "spdlog/sinks/basic_file_sink.h"\r
+void async_example()\r
+{\r
+ // default thread pool settings can be modified *before* creating the async logger:\r
+ // spdlog::init_thread_pool(8192, 1); // queue with 8k items and 1 backing thread.\r
+ auto async_file = spdlog::basic_logger_mt<spdlog::async_factory>("async_file_logger", "logs/async_log.txt");\r
+ // alternatively:\r
+ // auto async_file = spdlog::create_async<spdlog::sinks::basic_file_sink_mt>("async_file_logger", "logs/async_log.txt"); \r
+}\r
+\r
+```\r
+\r
+---\r
+#### Asynchronous logger with multi sinks \r
+```c++\r
+#include "spdlog/sinks/stdout_color_sinks.h"\r
+#include "spdlog/sinks/rotating_file_sink.h"\r
+\r
+void multi_sink_example2()\r
+{\r
+ spdlog::init_thread_pool(8192, 1);\r
+ auto stdout_sink = std::make_shared<spdlog::sinks::stdout_color_sink_mt >();\r
+ auto rotating_sink = std::make_shared<spdlog::sinks::rotating_file_sink_mt>("mylog.txt", 1024*1024*10, 3);\r
+ std::vector<spdlog::sink_ptr> sinks {stdout_sink, rotating_sink};\r
+ auto logger = std::make_shared<spdlog::async_logger>("loggername", sinks.begin(), sinks.end(), spdlog::thread_pool(), spdlog::async_overflow_policy::block);\r
+ spdlog::register_logger(logger);\r
+}\r
+```\r
+ \r
+---\r
+#### User defined types\r
+```c++\r
+// user defined types logging by implementing operator<<\r
+#include "spdlog/fmt/ostr.h" // must be included\r
+struct my_type\r
+{\r
+ int i;\r
+ template<typename OStream>\r
+ friend OStream &operator<<(OStream &os, const my_type &c)\r
+ {\r
+ return os << "[my_type i=" << c.i << "]";\r
+ }\r
+};\r
+\r
+void user_defined_example()\r
+{\r
+ spdlog::get("console")->info("user defined type: {}", my_type{14});\r
+}\r
+\r
+```\r
+---\r
+#### Custom error handler\r
+```c++\r
+void err_handler_example()\r
+{\r
+ // can be set globally or per logger(logger->set_error_handler(..))\r
+ spdlog::set_error_handler([](const std::string &msg) { spdlog::get("console")->error("*** LOGGER ERROR ***: {}", msg); });\r
+ spdlog::get("console")->info("some invalid message to trigger an error {}{}{}{}", 3);\r
+}\r
+\r
+```\r
+---\r
+#### syslog \r
+```c++\r
+#include "spdlog/sinks/syslog_sink.h"\r
+void syslog_example()\r
+{\r
+ std::string ident = "spdlog-example";\r
+ auto syslog_logger = spdlog::syslog_logger_mt("syslog", ident, LOG_PID);\r
+ syslog_logger->warn("This is warning that will end up in syslog.");\r
+}\r
+```\r
+---\r
+#### Android example \r
+```c++\r
+#include "spdlog/sinks/android_sink.h"\r
+void android_example()\r
+{\r
+ std::string tag = "spdlog-android";\r
+ auto android_logger = spdlog::android_logger_mt("android", tag);\r
+ android_logger->critical("Use \"adb shell logcat\" to view this message.");\r
+}\r
+```\r
+\r
+## Benchmarks\r
+\r
+Below are some [benchmarks](https://github.com/gabime/spdlog/blob/v1.x/bench/bench.cpp) done in Ubuntu 64 bit, Intel i7-4770 CPU @ 3.40GHz\r
+\r
+#### Synchronous mode\r
+```\r
+[info] **************************************************************\r
+[info] Single thread, 1,000,000 iterations\r
+[info] **************************************************************\r
+[info] basic_st Elapsed: 0.17 secs 5,777,626/sec\r
+[info] rotating_st Elapsed: 0.18 secs 5,475,894/sec\r
+[info] daily_st Elapsed: 0.20 secs 5,062,659/sec\r
+[info] empty_logger Elapsed: 0.07 secs 14,127,300/sec\r
+[info] **************************************************************\r
+[info] C-string (400 bytes). Single thread, 1,000,000 iterations\r
+[info] **************************************************************\r
+[info] basic_st Elapsed: 0.41 secs 2,412,483/sec\r
+[info] rotating_st Elapsed: 0.72 secs 1,389,196/sec\r
+[info] daily_st Elapsed: 0.42 secs 2,393,298/sec\r
+[info] null_st Elapsed: 0.04 secs 27,446,957/sec\r
+[info] **************************************************************\r
+[info] 10 threads, competing over the same logger object, 1,000,000 iterations\r
+[info] **************************************************************\r
+[info] basic_mt Elapsed: 0.60 secs 1,659,613/sec\r
+[info] rotating_mt Elapsed: 0.62 secs 1,612,493/sec\r
+[info] daily_mt Elapsed: 0.61 secs 1,638,305/sec\r
+[info] null_mt Elapsed: 0.16 secs 6,272,758/sec\r
+```\r
+#### ASynchronous mode\r
+```\r
+[info] -------------------------------------------------\r
+[info] Messages : 1,000,000\r
+[info] Threads : 10\r
+[info] Queue : 8,192 slots\r
+[info] Queue memory : 8,192 x 272 = 2,176 KB \r
+[info] -------------------------------------------------\r
+[info] \r
+[info] *********************************\r
+[info] Queue Overflow Policy: block\r
+[info] *********************************\r
+[info] Elapsed: 1.70784 secs 585,535/sec\r
+[info] Elapsed: 1.69805 secs 588,910/sec\r
+[info] Elapsed: 1.7026 secs 587,337/sec\r
+[info] \r
+[info] *********************************\r
+[info] Queue Overflow Policy: overrun\r
+[info] *********************************\r
+[info] Elapsed: 0.372816 secs 2,682,285/sec\r
+[info] Elapsed: 0.379758 secs 2,633,255/sec\r
+[info] Elapsed: 0.373532 secs 2,677,147/sec\r
+\r
+```\r
+\r
+## Documentation\r
+Documentation can be found in the [wiki](https://github.com/gabime/spdlog/wiki/1.-QuickStart) pages.\r
--- /dev/null
+version: 1.0.{build}
+image: Visual Studio 2017
+environment:
+ matrix:
+ - GENERATOR: '"Visual Studio 14 2015"'
+ BUILD_TYPE: Debug
+ WCHAR: 'OFF'
+ - GENERATOR: '"Visual Studio 14 2015"'
+ BUILD_TYPE: Release
+ WCHAR: 'ON'
+ - GENERATOR: '"Visual Studio 14 2015 Win64"'
+ BUILD_TYPE: Debug
+ WCHAR: 'ON'
+ - GENERATOR: '"Visual Studio 14 2015 Win64"'
+ BUILD_TYPE: Release
+ WCHAR: 'ON'
+ - GENERATOR: '"Visual Studio 15 2017 Win64"'
+ BUILD_TYPE: Debug
+ WCHAR: 'ON'
+ - GENERATOR: '"Visual Studio 15 2017 Win64"'
+ BUILD_TYPE: Release
+ WCHAR: 'OFf'
+build_script:
+- cmd: >-
+ set
+
+ mkdir build
+
+ cd build
+
+ set PATH=%PATH%:C:\Program Files\Git\usr\bin
+
+ cmake .. -G %GENERATOR% -DCMAKE_BUILD_TYPE=%BUILD_TYPE% -DSPDLOG_WCHAR_SUPPORT=%WCHAR% -DSPDLOG_BUILD_EXAMPLE=ON -DSPDLOG_BUILD_EXAMPLE_HO=ON -DSPDLOG_BUILD_TESTS=ON -DSPDLOG_BUILD_TESTS_HO=OFF
+
+ cmake --build . --config %BUILD_TYPE%
+
+test_script:
+- ctest -VV -C "%BUILD_TYPE%"
--- /dev/null
+# Copyright(c) 2019 spdlog authors
+# Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+cmake_minimum_required(VERSION 3.1)
+project(spdlog_bench CXX)
+
+if(NOT TARGET spdlog)
+ # Stand-alone build
+ find_package(spdlog CONFIG REQUIRED)
+endif()
+
+find_package(Threads REQUIRED)
+find_package(benchmark CONFIG REQUIRED)
+
+add_executable(bench bench.cpp)
+spdlog_enable_warnings(bench)
+target_link_libraries(bench PRIVATE spdlog::spdlog)
+
+add_executable(async_bench async_bench.cpp)
+target_link_libraries(async_bench PRIVATE spdlog::spdlog)
+
+add_executable(latency latency.cpp)
+target_link_libraries(latency PRIVATE benchmark::benchmark spdlog::spdlog)
+
+add_executable(formatter-bench formatter-bench.cpp)
+target_link_libraries(formatter-bench PRIVATE benchmark::benchmark spdlog::spdlog)
--- /dev/null
+//
+// Copyright(c) 2015 Gabi Melman.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+//
+
+//
+// bench.cpp : spdlog benchmarks
+//
+#include "spdlog/spdlog.h"
+#include "spdlog/async.h"
+#include "spdlog/sinks/basic_file_sink.h"
+#include "spdlog/sinks/stdout_color_sinks.h"
+
+#include "utils.h"
+#include <atomic>
+#include <iostream>
+#include <memory>
+#include <string>
+#include <thread>
+
+using namespace std;
+using namespace std::chrono;
+using namespace spdlog;
+using namespace spdlog::sinks;
+using namespace utils;
+
+void bench_mt(int howmany, std::shared_ptr<spdlog::logger> log, int thread_count);
+
+#ifdef _MSC_VER
+#pragma warning(push)
+#pragma warning(disable : 4996) // disable fopen warning under msvc
+#endif // _MSC_VER
+
+int count_lines(const char *filename)
+{
+ int counter = 0;
+ auto *infile = fopen(filename, "r");
+ int ch;
+ while (EOF != (ch = getc(infile)))
+ {
+ if ('\n' == ch)
+ counter++;
+ }
+ fclose(infile);
+
+ return counter;
+}
+
+void verify_file(const char *filename, int expected_count)
+{
+ spdlog::info("Verifying {} to contain {:n} line..", filename, expected_count);
+ auto count = count_lines(filename);
+ if (count != expected_count)
+ {
+ spdlog::error("Test failed. {} has {:n} lines instead of {:n}", filename, count, expected_count);
+ exit(1);
+ }
+ spdlog::info("Line count OK ({:n})\n", count);
+}
+
+#ifdef _MSC_VER
+#pragma warning(pop)
+#endif
+
+int main(int argc, char *argv[])
+{
+
+ int howmany = 1000000;
+ int queue_size = std::min(howmany + 2, 8192);
+ int threads = 10;
+ int iters = 3;
+
+ try
+ {
+ spdlog::set_pattern("[%^%l%$] %v");
+ if (argc == 1)
+ {
+ spdlog::info("Usage: {} <message_count> <threads> <q_size> <iterations>", argv[0]);
+ return 0;
+ }
+
+ if (argc > 1)
+ howmany = atoi(argv[1]);
+ if (argc > 2)
+ threads = atoi(argv[2]);
+ if (argc > 3)
+ {
+ queue_size = atoi(argv[3]);
+ if (queue_size > 500000)
+ {
+ spdlog::error("Max queue size allowed: 500,000");
+ exit(1);
+ }
+ }
+
+ if (argc > 4)
+ iters = atoi(argv[4]);
+
+ auto slot_size = sizeof(spdlog::details::async_msg);
+ spdlog::info("-------------------------------------------------");
+ spdlog::info("Messages : {:n}", howmany);
+ spdlog::info("Threads : {:n}", threads);
+ spdlog::info("Queue : {:n} slots", queue_size);
+ spdlog::info("Queue memory : {:n} x {} = {:n} KB ", queue_size, slot_size, (queue_size * slot_size) / 1024);
+ spdlog::info("Total iters : {:n}", iters);
+ spdlog::info("-------------------------------------------------");
+
+ const char *filename = "logs/basic_async.log";
+ spdlog::info("");
+ spdlog::info("*********************************");
+ spdlog::info("Queue Overflow Policy: block");
+ spdlog::info("*********************************");
+ for (int i = 0; i < iters; i++)
+ {
+ auto tp = std::make_shared<details::thread_pool>(queue_size, 1);
+ auto file_sink = std::make_shared<spdlog::sinks::basic_file_sink_mt>(filename, true);
+ auto logger = std::make_shared<async_logger>("async_logger", std::move(file_sink), std::move(tp), async_overflow_policy::block);
+ bench_mt(howmany, std::move(logger), threads);
+ // verify_file(filename, howmany);
+ }
+
+ spdlog::info("");
+ spdlog::info("*********************************");
+ spdlog::info("Queue Overflow Policy: overrun");
+ spdlog::info("*********************************");
+ // do same test but discard oldest if queue is full instead of blocking
+ filename = "logs/basic_async-overrun.log";
+ for (int i = 0; i < iters; i++)
+ {
+ auto tp = std::make_shared<details::thread_pool>(queue_size, 1);
+ auto file_sink = std::make_shared<spdlog::sinks::basic_file_sink_mt>(filename, true);
+ auto logger =
+ std::make_shared<async_logger>("async_logger", std::move(file_sink), std::move(tp), async_overflow_policy::overrun_oldest);
+ bench_mt(howmany, std::move(logger), threads);
+ }
+ spdlog::shutdown();
+ }
+ catch (std::exception &ex)
+ {
+ std::cerr << "Error: " << ex.what() << std::endl;
+ perror("Last error");
+ return 1;
+ }
+ return 0;
+}
+
+void thread_fun(std::shared_ptr<spdlog::logger> logger, int howmany)
+{
+ for (int i = 0; i < howmany; i++)
+ {
+ logger->info("Hello logger: msg number {}", i);
+ }
+}
+
+void bench_mt(int howmany, std::shared_ptr<spdlog::logger> logger, int thread_count)
+{
+ using std::chrono::high_resolution_clock;
+ vector<thread> threads;
+ auto start = high_resolution_clock::now();
+
+ int msgs_per_thread = howmany / thread_count;
+ int msgs_per_thread_mod = howmany % thread_count;
+ for (int t = 0; t < thread_count; ++t)
+ {
+ if (t == 0 && msgs_per_thread_mod)
+ threads.push_back(std::thread(thread_fun, logger, msgs_per_thread + msgs_per_thread_mod));
+ else
+ threads.push_back(std::thread(thread_fun, logger, msgs_per_thread));
+ }
+
+ for (auto &t : threads)
+ {
+ t.join();
+ };
+
+ auto delta = high_resolution_clock::now() - start;
+ auto delta_d = duration_cast<duration<double>>(delta).count();
+ spdlog::info("Elapsed: {} secs\t {:n}/sec", delta_d, int(howmany / delta_d));
+}
--- /dev/null
+//
+// Copyright(c) 2015 Gabi Melman.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+//
+
+//
+// bench.cpp : spdlog benchmarks
+//
+#include "spdlog/spdlog.h"
+#include "spdlog/sinks/basic_file_sink.h"
+#include "spdlog/sinks/daily_file_sink.h"
+#include "spdlog/sinks/null_sink.h"
+#include "spdlog/sinks/rotating_file_sink.h"
+
+#include "utils.h"
+#include <atomic>
+#include <cstdlib> // EXIT_FAILURE
+#include <memory>
+#include <string>
+#include <thread>
+
+using namespace std;
+using namespace std::chrono;
+using namespace spdlog;
+using namespace spdlog::sinks;
+using namespace utils;
+
+void bench(int howmany, std::shared_ptr<spdlog::logger> log);
+void bench_mt(int howmany, std::shared_ptr<spdlog::logger> log, int thread_count);
+void bench_default_api(int howmany, std::shared_ptr<spdlog::logger> log);
+void bench_c_string(int howmany, std::shared_ptr<spdlog::logger> log);
+
+static size_t file_size = 30 * 1024 * 1024;
+static size_t rotating_files = 5;
+
+void bench_threaded_logging(int threads, int iters)
+{
+ spdlog::info("**************************************************************");
+ spdlog::info("Multi threaded: {:n} threads, {:n} messages", threads, iters);
+ spdlog::info("**************************************************************");
+
+ auto basic_mt = spdlog::basic_logger_mt("basic_mt", "logs/basic_mt.log", true);
+ bench_mt(iters, std::move(basic_mt), threads);
+ auto basic_mt_tracing = spdlog::basic_logger_mt("basic_mt/backtrace-on", "logs/basic_mt.log", true);
+ basic_mt_tracing->enable_backtrace(32);
+ bench_mt(iters, std::move(basic_mt_tracing), threads);
+
+ spdlog::info("");
+ auto rotating_mt = spdlog::rotating_logger_mt("rotating_mt", "logs/rotating_mt.log", file_size, rotating_files);
+ bench_mt(iters, std::move(rotating_mt), threads);
+ auto rotating_mt_tracing = spdlog::rotating_logger_mt("rotating_mt/backtrace-on", "logs/rotating_mt.log", file_size, rotating_files);
+ rotating_mt_tracing->enable_backtrace(32);
+ bench_mt(iters, std::move(rotating_mt_tracing), threads);
+
+ spdlog::info("");
+ auto daily_mt = spdlog::daily_logger_mt("daily_mt", "logs/daily_mt.log");
+ bench_mt(iters, std::move(daily_mt), threads);
+ auto daily_mt_tracing = spdlog::daily_logger_mt("daily_mt/backtrace-on", "logs/daily_mt.log");
+ daily_mt_tracing->enable_backtrace(32);
+ bench_mt(iters, std::move(daily_mt_tracing), threads);
+
+ spdlog::info("");
+ auto empty_logger = std::make_shared<spdlog::logger>("level-off");
+ empty_logger->set_level(spdlog::level::off);
+ bench(iters, empty_logger);
+ auto empty_logger_tracing = std::make_shared<spdlog::logger>("level-off/backtrace-on");
+ empty_logger_tracing->set_level(spdlog::level::off);
+ empty_logger_tracing->enable_backtrace(32);
+ bench(iters, empty_logger_tracing);
+}
+
+void bench_single_threaded(int iters)
+{
+ spdlog::info("**************************************************************");
+ spdlog::info("Single threaded: {:n} messages", iters);
+ spdlog::info("**************************************************************");
+
+ auto basic_st = spdlog::basic_logger_st("basic_st", "logs/basic_st.log", true);
+ bench(iters, std::move(basic_st));
+
+ auto basic_st_tracing = spdlog::basic_logger_st("basic_st/backtrace-on", "logs/basic_st.log", true);
+ bench(iters, std::move(basic_st_tracing));
+
+ spdlog::info("");
+ auto rotating_st = spdlog::rotating_logger_st("rotating_st", "logs/rotating_st.log", file_size, rotating_files);
+ bench(iters, std::move(rotating_st));
+ auto rotating_st_tracing = spdlog::rotating_logger_st("rotating_st/backtrace-on", "logs/rotating_st.log", file_size, rotating_files);
+ rotating_st_tracing->enable_backtrace(32);
+ bench(iters, std::move(rotating_st_tracing));
+
+ spdlog::info("");
+ auto daily_st = spdlog::daily_logger_st("daily_st", "logs/daily_st.log");
+ bench(iters, std::move(daily_st));
+ auto daily_st_tracing = spdlog::daily_logger_st("daily_st/backtrace-on", "logs/daily_st.log");
+ daily_st_tracing->enable_backtrace(32);
+ bench(iters, std::move(daily_st_tracing));
+
+ spdlog::info("");
+ auto empty_logger = std::make_shared<spdlog::logger>("level-off");
+ empty_logger->set_level(spdlog::level::off);
+ bench(iters, empty_logger);
+
+ auto empty_logger_tracing = std::make_shared<spdlog::logger>("level-off/backtrace-on");
+ empty_logger_tracing->set_level(spdlog::level::off);
+ empty_logger_tracing->enable_backtrace(32);
+ bench(iters, empty_logger_tracing);
+}
+
+int main(int argc, char *argv[])
+{
+ spdlog::set_automatic_registration(false);
+ spdlog::default_logger()->set_pattern("[%^%l%$] %v");
+ int iters = 250000;
+ int threads = 4;
+ try
+ {
+
+ if (argc > 1)
+ iters = atoi(argv[1]);
+ if (argc > 2)
+ threads = atoi(argv[2]);
+
+ bench_single_threaded(iters);
+ bench_threaded_logging(1, iters);
+ bench_threaded_logging(threads, iters);
+ }
+ catch (std::exception &ex)
+ {
+ spdlog::error(ex.what());
+ return EXIT_FAILURE;
+ }
+ return EXIT_SUCCESS;
+}
+
+void bench(int howmany, std::shared_ptr<spdlog::logger> log)
+{
+ using std::chrono::high_resolution_clock;
+ auto start = high_resolution_clock::now();
+ for (auto i = 0; i < howmany; ++i)
+ {
+ log->info("Hello logger: msg number {}", i);
+ }
+
+ auto delta = high_resolution_clock::now() - start;
+ auto delta_d = duration_cast<duration<double>>(delta).count();
+
+ spdlog::info("{:<30} Elapsed: {:0.2f} secs {:>16n}/sec", log->name(), delta_d, int(howmany / delta_d));
+ spdlog::drop(log->name());
+}
+
+void bench_mt(int howmany, std::shared_ptr<spdlog::logger> log, int thread_count)
+{
+ using std::chrono::high_resolution_clock;
+ vector<thread> threads;
+ auto start = high_resolution_clock::now();
+ for (int t = 0; t < thread_count; ++t)
+ {
+ threads.push_back(std::thread([&]() {
+ for (int j = 0; j < howmany / thread_count; j++)
+ {
+ log->info("Hello logger: msg number {}", j);
+ }
+ }));
+ }
+
+ for (auto &t : threads)
+ {
+ t.join();
+ };
+
+ auto delta = high_resolution_clock::now() - start;
+ auto delta_d = duration_cast<duration<double>>(delta).count();
+ spdlog::info("{:<30} Elapsed: {:0.2f} secs {:>16n}/sec", log->name(), delta_d, int(howmany / delta_d));
+ spdlog::drop(log->name());
+}
+
+void bench_default_api(int howmany, std::shared_ptr<spdlog::logger> log)
+{
+ using std::chrono::high_resolution_clock;
+ auto orig_default = spdlog::default_logger();
+ spdlog::set_default_logger(log);
+ auto start = high_resolution_clock::now();
+ for (auto i = 0; i < howmany; ++i)
+ {
+ spdlog::info("Hello logger: msg number {}", i);
+ }
+
+ auto delta = high_resolution_clock::now() - start;
+ auto delta_d = duration_cast<duration<double>>(delta).count();
+ spdlog::drop(log->name());
+ spdlog::set_default_logger(std::move(orig_default));
+ spdlog::info("{:<30} Elapsed: {:0.2f} secs {:>16n}/sec", log->name(), delta_d, int(howmany / delta_d));
+}
+
+void bench_c_string(int howmany, std::shared_ptr<spdlog::logger> log)
+{
+ const char *msg = "Lorem ipsum dolor sit amet, consectetur adipiscing elit. Vestibulum pharetra metus cursus "
+ "lacus placerat congue. Nulla egestas, mauris a tincidunt tempus, enim lectus volutpat mi, eu consequat sem "
+ "libero nec massa. In dapibus ipsum a diam rhoncus gravida. Etiam non dapibus eros. Donec fringilla dui sed "
+ "augue pretium, nec scelerisque est maximus. Nullam convallis, sem nec blandit maximus, nisi turpis ornare "
+ "nisl, sit amet volutpat neque massa eu odio. Maecenas malesuada quam ex, posuere congue nibh turpis duis.";
+ using std::chrono::high_resolution_clock;
+ auto orig_default = spdlog::default_logger();
+ spdlog::set_default_logger(log);
+ auto start = high_resolution_clock::now();
+ for (auto i = 0; i < howmany; ++i)
+ {
+ spdlog::log(level::info, msg);
+ }
+
+ auto delta = high_resolution_clock::now() - start;
+ auto delta_d = duration_cast<duration<double>>(delta).count();
+ spdlog::drop(log->name());
+ spdlog::set_default_logger(std::move(orig_default));
+ spdlog::info("{:<30} Elapsed: {:0.2f} secs {:>16n}/sec", log->name(), delta_d, int(howmany / delta_d));
+}
--- /dev/null
+//
+// Copyright(c) 2018 Gabi Melman.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+//
+
+#include "benchmark/benchmark.h"
+
+#include "spdlog/spdlog.h"
+#include "spdlog/details/pattern_formatter.h"
+
+void bench_formatter(benchmark::State &state, std::string pattern)
+{
+ auto formatter = spdlog::details::make_unique<spdlog::pattern_formatter>(pattern);
+ spdlog::memory_buf_t dest;
+ std::string logger_name = "logger-name";
+ const char *text = "Hello. This is some message with length of 80 ";
+
+ spdlog::source_loc source_loc{"a/b/c/d/myfile.cpp", 123, "some_func()"};
+ spdlog::details::log_msg msg(source_loc, logger_name, spdlog::level::info, text);
+
+ for (auto _ : state)
+ {
+ dest.clear();
+ formatter->format(msg, dest);
+ benchmark::DoNotOptimize(dest);
+ }
+}
+
+void bench_formatters()
+{
+ // basic patterns(single flag)
+ std::string all_flags = "+vtPnlLaAbBcCYDmdHIMSefFprRTXzEisg@luioO%";
+ std::vector<std::string> basic_patterns;
+ for (auto &flag : all_flags)
+ {
+ auto pattern = std::string("%") + flag;
+ benchmark::RegisterBenchmark(pattern.c_str(), bench_formatter, pattern);
+
+ // pattern = std::string("%16") + flag;
+ // benchmark::RegisterBenchmark(pattern.c_str(), bench_formatter, pattern);
+ //
+ // // bench center padding
+ // pattern = std::string("%=16") + flag;
+ // benchmark::RegisterBenchmark(pattern.c_str(), bench_formatter, pattern);
+ }
+
+ // complex patterns
+ std::vector<std::string> patterns = {
+ "[%D %X] [%l] [%n] %v",
+ "[%Y-%m-%d %H:%M:%S.%e] [%l] [%n] %v",
+ "[%Y-%m-%d %H:%M:%S.%e] [%l] [%n] [%t] %v",
+ };
+ for (auto &pattern : patterns)
+ {
+ benchmark::RegisterBenchmark(pattern.c_str(), bench_formatter, pattern)->Iterations(2500000);
+ }
+}
+
+int main(int argc, char *argv[])
+{
+
+ spdlog::set_pattern("[%^%l%$] %v");
+ if (argc != 2)
+ {
+ spdlog::error("Usage: {} <pattern> (or \"all\" to bench all)", argv[0]);
+ exit(1);
+ }
+
+ std::string pattern = argv[1];
+ if (pattern == "all")
+ {
+ bench_formatters();
+ }
+ else
+ {
+ benchmark::RegisterBenchmark(pattern.c_str(), bench_formatter, pattern);
+ }
+ benchmark::Initialize(&argc, argv);
+ benchmark::RunSpecifiedBenchmarks();
+}
--- /dev/null
+//
+// Copyright(c) 2018 Gabi Melman.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+//
+
+//
+// latency.cpp : spdlog latency benchmarks
+//
+
+#include "benchmark/benchmark.h"
+
+#include "spdlog/spdlog.h"
+#include "spdlog/async.h"
+#include "spdlog/sinks/basic_file_sink.h"
+#include "spdlog/sinks/daily_file_sink.h"
+#include "spdlog/sinks/null_sink.h"
+#include "spdlog/sinks/rotating_file_sink.h"
+
+void bench_c_string(benchmark::State &state, std::shared_ptr<spdlog::logger> logger)
+{
+ const char *msg = "Lorem ipsum dolor sit amet, consectetur adipiscing elit. Vestibulum pharetra metus cursus "
+ "lacus placerat congue. Nulla egestas, mauris a tincidunt tempus, enim lectus volutpat mi, eu consequat sem "
+ "libero nec massa. In dapibus ipsum a diam rhoncus gravida. Etiam non dapibus eros. Donec fringilla dui sed "
+ "augue pretium, nec scelerisque est maximus. Nullam convallis, sem nec blandit maximus, nisi turpis ornare "
+ "nisl, sit amet volutpat neque massa eu odio. Maecenas malesuada quam ex, posuere congue nibh turpis duis.";
+
+ for (auto _ : state)
+ {
+ logger->info(msg);
+ }
+}
+
+void bench_logger(benchmark::State &state, std::shared_ptr<spdlog::logger> logger)
+{
+ int i = 0;
+ for (auto _ : state)
+ {
+ logger->info("Hello logger: msg number {}...............", ++i);
+ }
+}
+
+void bench_disabled_macro(benchmark::State &state, std::shared_ptr<spdlog::logger> logger)
+{
+ int i = 0;
+ benchmark::DoNotOptimize(i); // prevent unused warnings
+ benchmark::DoNotOptimize(logger); // prevent unused warnings
+ for (auto _ : state)
+ {
+ SPDLOG_LOGGER_DEBUG(logger, "Hello logger: msg number {}...............", i++);
+ SPDLOG_DEBUG("Hello logger: msg number {}...............", i++);
+ }
+}
+
+int main(int argc, char *argv[])
+{
+
+ using spdlog::sinks::basic_file_sink_mt;
+ using spdlog::sinks::basic_file_sink_st;
+ using spdlog::sinks::null_sink_mt;
+ using spdlog::sinks::null_sink_st;
+
+ size_t file_size = 30 * 1024 * 1024;
+ size_t rotating_files = 5;
+ int n_threads = benchmark::CPUInfo::Get().num_cpus;
+
+ // disabled loggers
+ auto disabled_logger = std::make_shared<spdlog::logger>("bench", std::make_shared<null_sink_mt>());
+ disabled_logger->set_level(spdlog::level::off);
+ benchmark::RegisterBenchmark("disabled-at-compile-time", bench_disabled_macro, disabled_logger);
+ benchmark::RegisterBenchmark("disabled-at-runtime", bench_logger, disabled_logger);
+ // with backtrace of 64
+ auto tracing_disabled_logger = std::make_shared<spdlog::logger>("bench", std::make_shared<null_sink_mt>());
+ tracing_disabled_logger->enable_backtrace(64);
+ benchmark::RegisterBenchmark("disabled-at-runtime/backtrace", bench_logger, tracing_disabled_logger);
+
+ auto null_logger_st = std::make_shared<spdlog::logger>("bench", std::make_shared<null_sink_st>());
+ benchmark::RegisterBenchmark("null_sink_st (500_bytes c_str)", bench_c_string, std::move(null_logger_st));
+ benchmark::RegisterBenchmark("null_sink_st", bench_logger, null_logger_st);
+ // with backtrace of 64
+ auto tracing_null_logger_st = std::make_shared<spdlog::logger>("bench", std::make_shared<null_sink_st>());
+ tracing_null_logger_st->enable_backtrace(64);
+ benchmark::RegisterBenchmark("null_sink_st/backtrace", bench_logger, tracing_null_logger_st);
+
+ // basic_st
+ auto basic_st = spdlog::basic_logger_st("basic_st", "latency_logs/basic_st.log", true);
+ benchmark::RegisterBenchmark("basic_st", bench_logger, std::move(basic_st))->UseRealTime();
+ spdlog::drop("basic_st");
+ // with backtrace of 64
+ auto tracing_basic_st = spdlog::basic_logger_st("tracing_basic_st", "latency_logs/tracing_basic_st.log", true);
+ tracing_basic_st->enable_backtrace(64);
+ benchmark::RegisterBenchmark("basic_st/backtrace", bench_logger, std::move(tracing_basic_st))->UseRealTime();
+ spdlog::drop("tracing_basic_st");
+
+ // rotating st
+ auto rotating_st = spdlog::rotating_logger_st("rotating_st", "latency_logs/rotating_st.log", file_size, rotating_files);
+ benchmark::RegisterBenchmark("rotating_st", bench_logger, std::move(rotating_st))->UseRealTime();
+ spdlog::drop("rotating_st");
+ // with backtrace of 64
+ auto tracing_rotating_st =
+ spdlog::rotating_logger_st("tracing_rotating_st", "latency_logs/tracing_rotating_st.log", file_size, rotating_files);
+ benchmark::RegisterBenchmark("rotating_st/backtrace", bench_logger, std::move(tracing_rotating_st))->UseRealTime();
+ spdlog::drop("tracing_rotating_st");
+
+ // daily st
+ auto daily_st = spdlog::daily_logger_mt("daily_st", "latency_logs/daily_st.log");
+ benchmark::RegisterBenchmark("daily_st", bench_logger, std::move(daily_st))->UseRealTime();
+ spdlog::drop("daily_st");
+ auto tracing_daily_st = spdlog::daily_logger_mt("tracing_daily_st", "latency_logs/daily_st.log");
+ benchmark::RegisterBenchmark("daily_st/backtrace", bench_logger, std::move(tracing_daily_st))->UseRealTime();
+ spdlog::drop("tracing_daily_st");
+
+ //
+ // Multi threaded bench, 10 loggers using same logger concurrently
+ //
+ auto null_logger_mt = std::make_shared<spdlog::logger>("bench", std::make_shared<null_sink_mt>());
+ benchmark::RegisterBenchmark("null_sink_mt", bench_logger, null_logger_mt)->Threads(n_threads)->UseRealTime();
+
+ // basic_mt
+ auto basic_mt = spdlog::basic_logger_mt("basic_mt", "latency_logs/basic_mt.log", true);
+ benchmark::RegisterBenchmark("basic_mt", bench_logger, std::move(basic_mt))->Threads(n_threads)->UseRealTime();
+ spdlog::drop("basic_mt");
+
+ // rotating mt
+ auto rotating_mt = spdlog::rotating_logger_mt("rotating_mt", "latency_logs/rotating_mt.log", file_size, rotating_files);
+ benchmark::RegisterBenchmark("rotating_mt", bench_logger, std::move(rotating_mt))->Threads(n_threads)->UseRealTime();
+ spdlog::drop("rotating_mt");
+
+ // daily mt
+ auto daily_mt = spdlog::daily_logger_mt("daily_mt", "latency_logs/daily_mt.log");
+ benchmark::RegisterBenchmark("daily_mt", bench_logger, std::move(daily_mt))->Threads(n_threads)->UseRealTime();
+ spdlog::drop("daily_mt");
+
+ // async
+ auto queue_size = 1024 * 1024 * 3;
+ auto tp = std::make_shared<spdlog::details::thread_pool>(queue_size, 1);
+ auto async_logger = std::make_shared<spdlog::async_logger>(
+ "async_logger", std::make_shared<null_sink_mt>(), std::move(tp), spdlog::async_overflow_policy::overrun_oldest);
+ benchmark::RegisterBenchmark("async_logger", bench_logger, async_logger)->Threads(n_threads)->UseRealTime();
+
+ auto async_logger_tracing = std::make_shared<spdlog::async_logger>(
+ "async_logger_tracing", std::make_shared<null_sink_mt>(), std::move(tp), spdlog::async_overflow_policy::overrun_oldest);
+ async_logger_tracing->enable_backtrace(32);
+ benchmark::RegisterBenchmark("async_logger/tracing", bench_logger, async_logger_tracing)->Threads(n_threads)->UseRealTime();
+
+ benchmark::Initialize(&argc, argv);
+ benchmark::RunSpecifiedBenchmarks();
+}
--- /dev/null
+benchmark = dependency('benchmark')
+
+bench_matrix = [
+ ['bench', [spdlog_dep], []],
+ ['async_bench', [spdlog_dep], []],
+ ['formatter-bench', [spdlog_dep, benchmark], ['all']],
+ ['latency', [spdlog_dep, benchmark], []],
+]
+
+foreach i : bench_matrix
+ bench_exe = executable(i[0], i[0] + '.cpp', dependencies: i[1])
+ benchmark('bench_' + i[0], bench_exe, args: i[2])
+endforeach
+
--- /dev/null
+//
+// Copyright(c) 2015 Gabi Melman.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+//
+
+#pragma once
+
+#include <iomanip>
+#include <locale>
+#include <sstream>
+
+namespace utils {
+
+template<typename T>
+inline std::string format(const T &value)
+{
+ static std::locale loc("");
+ std::stringstream ss;
+ ss.imbue(loc);
+ ss << value;
+ return ss.str();
+}
+
+template<>
+inline std::string format(const double &value)
+{
+ static std::locale loc("");
+ std::stringstream ss;
+ ss.imbue(loc);
+ ss << std::fixed << std::setprecision(1) << value;
+ return ss.str();
+}
+
+} // namespace utils
--- /dev/null
+#---------------------------------------------------------------------------------------
+# IDE support for headers
+#---------------------------------------------------------------------------------------
+set(SPDLOG_HEADERS_DIR "${CMAKE_CURRENT_LIST_DIR}/../include")
+
+file(GLOB SPDLOG_TOP_HEADERS "${SPDLOG_HEADERS_DIR}/spdlog/*.h")
+file(GLOB SPDLOG_DETAILS_HEADERS "${SPDLOG_HEADERS_DIR}/spdlog/details/*.h")
+file(GLOB SPDLOG_SINKS_HEADERS "${SPDLOG_HEADERS_DIR}/spdlog/sinks/*.h")
+file(GLOB SPDLOG_FMT_HEADERS "${SPDLOG_HEADERS_DIR}/spdlog/fmt/*.h")
+file(GLOB SPDLOG_FMT_BUNDELED_HEADERS "${SPDLOG_HEADERS_DIR}/spdlog/fmt/bundled/*.h")
+set(SPDLOG_ALL_HEADERS ${SPDLOG_TOP_HEADERS} ${SPDLOG_DETAILS_HEADERS} ${SPDLOG_SINKS_HEADERS} ${SPDLOG_FMT_HEADERS} ${SPDLOG_FMT_BUNDELED_HEADERS})
+
+source_group("Header Files\\spdlog" FILES ${SPDLOG_TOP_HEADERS})
+source_group("Header Files\\spdlog\\details" FILES ${SPDLOG_DETAILS_HEADERS})
+source_group("Header Files\\spdlog\\sinks" FILES ${SPDLOG_SINKS_HEADERS})
+source_group("Header Files\\spdlog\\fmt" FILES ${SPDLOG_FMT_HEADERS})
+source_group("Header Files\\spdlog\\fmt\\bundled\\" FILES ${SPDLOG_FMT_BUNDELED_HEADERS})
+
--- /dev/null
+prefix=@CMAKE_INSTALL_PREFIX@
+exec_prefix=${prefix}
+includedir=${prefix}/include
+libdir=${exec_prefix}/@CMAKE_INSTALL_LIBDIR@
+
+Name: lib@PROJECT_NAME@
+Description: Fast C++ logging library.
+URL: https://github.com/gabime/@PROJECT_NAME@
+Version: @SPDLOG_VERSION@
+CFlags: -I${includedir} @PKG_CONFIG_DEFINES@
+Libs: -L${libdir} -lspdlog -pthread
+Requires: @PKG_CONFIG_REQUIRES@
+
--- /dev/null
+set(CPACK_GENERATOR
+ TGZ
+ ZIP
+ )
+
+set(CPACK_INCLUDE_TOPLEVEL_DIRECTORY 0)
+set(CPACK_INSTALL_CMAKE_PROJECTS
+ "${CMAKE_BINARY_DIR}"
+ "${PROJECT_NAME}"
+ ALL
+ .
+ )
+
+set(CPACK_PROJECT_URL "https://github.com/gabime/spdlog")
+set(CPACK_PACKAGE_VENDOR "Gabi Melman")
+set(CPACK_PACKAGE_CONTACT "Gabi Melman <gmelman1@gmail.com>")
+set(CPACK_PACKAGE_DESCRIPTION_SUMMARY "Fast C++ logging library")
+set(CPACK_PACKAGE_VERSION_MAJOR ${PROJECT_VERSION_MAJOR})
+set(CPACK_PACKAGE_VERSION_MINOR ${PROJECT_VERSION_MINOR})
+set(CPACK_PACKAGE_VERSION_PATCH ${PROJECT_VERSION_PATCH})
+set(CPACK_PACKAGE_VERSION ${PROJECT_VERSION_MAJOR}.${PROJECT_VERSION_MINOR}.${PROJECT_VERSION_PATCH})
+if (PROJECT_VERSION_TWEAK)
+ set(CPACK_PACKAGE_VERSION ${CPACK_PACKAGE_VERSION}.${PROJECT_VERSION_TWEAK})
+endif ()
+set(CPACK_PACKAGE_RELOCATABLE ON)
+
+set(CPACK_RPM_PACKAGE_LICENSE "MIT")
+set(CPACK_RPM_PACKAGE_GROUP "System Environment/Libraries")
+set(CPACK_RPM_PACKAGE_URL ${CPACK_PROJECT_URL})
+set(CPACK_RPM_PACKAGE_DESCRIPTION "Very fast, header-only/compiled, C++ logging library.")
+
+include(CPack)
--- /dev/null
+# Copyright(c) 2019 spdlog authors\r
+# Distributed under the MIT License (http://opensource.org/licenses/MIT)\r
+\r
+find_package(Threads REQUIRED)\r
+\r
+set(SPDLOG_FMT_EXTERNAL @SPDLOG_FMT_EXTERNAL@)\r
+set(config_targets_file @config_targets_file@)\r
+\r
+if(SPDLOG_FMT_EXTERNAL)\r
+ include(CMakeFindDependencyMacro)\r
+ find_dependency(fmt CONFIG)\r
+endif()\r
+\r
+\r
+include("${CMAKE_CURRENT_LIST_DIR}/${config_targets_file}")\r
--- /dev/null
+# Get spdlog version from include/spdlog/version.h and put it in SPDLOG_VERSION\r
+function(spdlog_extract_version)\r
+ file(READ "${CMAKE_CURRENT_LIST_DIR}/include/spdlog/version.h" file_contents)\r
+ string(REGEX MATCH "SPDLOG_VER_MAJOR ([0-9]+)" _ "${file_contents}")\r
+ if(NOT CMAKE_MATCH_COUNT EQUAL 1)\r
+ message(FATAL_ERROR "Could not extract major version number from spdlog/version.h")\r
+ endif()\r
+ set(ver_major ${CMAKE_MATCH_1})\r
+\r
+ string(REGEX MATCH "SPDLOG_VER_MINOR ([0-9]+)" _ "${file_contents}")\r
+ if(NOT CMAKE_MATCH_COUNT EQUAL 1)\r
+ message(FATAL_ERROR "Could not extract minor version number from spdlog/version.h")\r
+ endif()\r
+\r
+ set(ver_minor ${CMAKE_MATCH_1})\r
+ string(REGEX MATCH "SPDLOG_VER_PATCH ([0-9]+)" _ "${file_contents}")\r
+ if(NOT CMAKE_MATCH_COUNT EQUAL 1)\r
+ message(FATAL_ERROR "Could not extract patch version number from spdlog/version.h")\r
+ endif()\r
+ set(ver_patch ${CMAKE_MATCH_1})\r
+\r
+ set(SPDLOG_VERSION_MAJOR ${ver_major} PARENT_SCOPE)\r
+ set (SPDLOG_VERSION "${ver_major}.${ver_minor}.${ver_patch}" PARENT_SCOPE)\r
+endfunction()\r
+\r
+\r
+# Turn on warnings on the given target\r
+function(spdlog_enable_warnings target_name)\r
+ target_compile_options(${target_name} PRIVATE\r
+ $<$<OR:$<CXX_COMPILER_ID:Clang>,$<CXX_COMPILER_ID:AppleClang>,$<CXX_COMPILER_ID:GNU>>:\r
+ -Wall -Wextra -Wconversion -pedantic -Wfatal-errors>\r
+ $<$<CXX_COMPILER_ID:MSVC>:/W4>)\r
+ if(MSVC_VERSION GREATER 1900) #Allow non fatal security wanrnings for msvc 2015\r
+ target_compile_options(${target_name} PRIVATE /WX)\r
+ endif()\r
+endfunction()\r
+\r
+\r
+# Enable address sanitizer (gcc/clang only)\r
+function(spdlog_enable_sanitizer target_name)\r
+ if (NOT CMAKE_CXX_COMPILER_ID MATCHES "GNU|Clang")\r
+ message(FATAL_ERROR "Sanitizer supported only for gcc/clang")\r
+ endif()\r
+ message(STATUS "Address sanitizer enabled")\r
+ target_compile_options(${target_name} PRIVATE -fsanitize=address,undefined)\r
+ target_compile_options(${target_name} PRIVATE -fno-sanitize=signed-integer-overflow)\r
+ target_compile_options(${target_name} PRIVATE -fno-sanitize-recover=all)\r
+ target_compile_options(${target_name} PRIVATE -fno-omit-frame-pointer)\r
+ target_link_libraries(${target_name} PRIVATE -fsanitize=address,undefined -fuse-ld=gold)\r
+endfunction()\r
--- /dev/null
+# Copyright(c) 2019 spdlog authors
+# Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+cmake_minimum_required(VERSION 3.1)
+project(spdlog_examples CXX)
+
+if(NOT TARGET spdlog)
+ # Stand-alone build
+ find_package(spdlog REQUIRED)
+endif()
+
+#---------------------------------------------------------------------------------------
+# Example of using pre-compiled library
+#---------------------------------------------------------------------------------------
+add_executable(example example.cpp)
+spdlog_enable_warnings(example)
+target_link_libraries(example PRIVATE spdlog::spdlog)
+
+#---------------------------------------------------------------------------------------
+# Example of using header-only library
+#---------------------------------------------------------------------------------------
+if(SPDLOG_BUILD_EXAMPLE_HO)
+ add_executable(example_header_only example.cpp)
+ spdlog_enable_warnings(example_header_only)
+ target_link_libraries(example_header_only PRIVATE spdlog::spdlog_header_only)
+endif()
+
--- /dev/null
+//
+// Copyright(c) 2015 Gabi Melman.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+// spdlog usage example
+
+#include <cstdio>
+
+void stdout_logger_example();
+void basic_example();
+void rotating_example();
+void daily_example();
+void async_example();
+void binary_example();
+void trace_example();
+void multi_sink_example();
+void user_defined_example();
+void err_handler_example();
+void syslog_example();
+
+#include "spdlog/spdlog.h"
+
+int main(int, char *[])
+{
+ spdlog::info("Welcome to spdlog version {}.{}.{} !", SPDLOG_VER_MAJOR, SPDLOG_VER_MINOR, SPDLOG_VER_PATCH);
+ spdlog::warn("Easy padding in numbers like {:08d}", 12);
+ spdlog::critical("Support for int: {0:d}; hex: {0:x}; oct: {0:o}; bin: {0:b}", 42);
+ spdlog::info("Support for floats {:03.2f}", 1.23456);
+ spdlog::info("Positional args are {1} {0}..", "too", "supported");
+ spdlog::info("{:>8} aligned, {:<8} aligned", "right", "left");
+
+ // Runtime log levels
+ spdlog::set_level(spdlog::level::info); // Set global log level to info
+ spdlog::debug("This message should not be displayed!");
+ spdlog::set_level(spdlog::level::trace); // Set specific logger's log level
+ spdlog::debug("This message should be displayed..");
+
+ // Customize msg format for all loggers
+ spdlog::set_pattern("[%H:%M:%S %z] [%^%L%$] [thread %t] %v");
+ spdlog::info("This an info message with custom format");
+ spdlog::set_pattern("%+"); // back to default format
+ spdlog::set_level(spdlog::level::info);
+
+ // Backtrace support
+ // Loggers can store in a ring buffer all messages (including debug/trace) for later inspection.
+ // When needed, call dump_backtrace() to see what happened:
+ spdlog::enable_backtrace(10); // create ring buffer with capacity of 10 messages
+ for (int i = 0; i < 100; i++)
+ {
+ spdlog::debug("Backtrace message {}", i); // not logged..
+ }
+ // e.g. if some error happened:
+ spdlog::dump_backtrace(); // log them now!
+
+ try
+ {
+ stdout_logger_example();
+ basic_example();
+ rotating_example();
+ daily_example();
+ async_example();
+ binary_example();
+ multi_sink_example();
+ user_defined_example();
+ err_handler_example();
+ trace_example();
+
+ // Flush all *registered* loggers using a worker thread every 3 seconds.
+ // note: registered loggers *must* be thread safe for this to work correctly!
+ spdlog::flush_every(std::chrono::seconds(3));
+
+ // Apply some function on all registered loggers
+ spdlog::apply_all([&](std::shared_ptr<spdlog::logger> l) { l->info("End of example."); });
+
+ // Release all spdlog resources, and drop all loggers in the registry.
+ // This is optional (only mandatory if using windows + async log).
+ spdlog::shutdown();
+ }
+
+ // Exceptions will only be thrown upon failed logger or sink construction (not during logging).
+ catch (const spdlog::spdlog_ex &ex)
+ {
+ std::printf("Log initialization failed: %s\n", ex.what());
+ return 1;
+ }
+}
+
+#include "spdlog/sinks/stdout_color_sinks.h"
+// or #include "spdlog/sinks/stdout_sinks.h" if no colors needed.
+void stdout_logger_example()
+{
+ // Create color multi threaded logger.
+ auto console = spdlog::stdout_color_mt("console");
+ // or for stderr:
+ // auto console = spdlog::stderr_color_mt("error-logger");
+}
+
+#include "spdlog/sinks/basic_file_sink.h"
+void basic_example()
+{
+ // Create basic file logger (not rotated).
+ auto my_logger = spdlog::basic_logger_mt("file_logger", "logs/basic-log.txt");
+}
+
+#include "spdlog/sinks/rotating_file_sink.h"
+void rotating_example()
+{
+ // Create a file rotating logger with 5mb size max and 3 rotated files.
+ auto rotating_logger = spdlog::rotating_logger_mt("some_logger_name", "logs/rotating.txt", 1048576 * 5, 3);
+}
+
+#include "spdlog/sinks/daily_file_sink.h"
+void daily_example()
+{
+ // Create a daily logger - a new file is created every day on 2:30am.
+ auto daily_logger = spdlog::daily_logger_mt("daily_logger", "logs/daily.txt", 2, 30);
+}
+
+#include "spdlog/async.h"
+void async_example()
+{
+ // Default thread pool settings can be modified *before* creating the async logger:
+ // spdlog::init_thread_pool(32768, 1); // queue with max 32k items 1 backing thread.
+ auto async_file = spdlog::basic_logger_mt<spdlog::async_factory>("async_file_logger", "logs/async_log.txt");
+ // alternatively:
+ // auto async_file = spdlog::create_async<spdlog::sinks::basic_file_sink_mt>("async_file_logger", "logs/async_log.txt");
+
+ for (int i = 1; i < 101; ++i)
+ {
+ async_file->info("Async message #{}", i);
+ }
+}
+
+// Log binary data as hex.
+// Many types of std::container<char> types can be used.
+// Iterator ranges are supported too.
+// Format flags:
+// {:X} - print in uppercase.
+// {:s} - don't separate each byte with space.
+// {:p} - don't print the position on each line start.
+// {:n} - don't split the output to lines.
+
+#include "spdlog/fmt/bin_to_hex.h"
+void binary_example()
+{
+ std::vector<char> buf(80);
+ for (int i = 0; i < 80; i++)
+ {
+ buf.push_back(static_cast<char>(i & 0xff));
+ }
+ spdlog::info("Binary example: {}", spdlog::to_hex(buf));
+ spdlog::info("Another binary example:{:n}", spdlog::to_hex(std::begin(buf), std::begin(buf) + 10));
+ // more examples:
+ // logger->info("uppercase: {:X}", spdlog::to_hex(buf));
+ // logger->info("uppercase, no delimiters: {:Xs}", spdlog::to_hex(buf));
+ // logger->info("uppercase, no delimiters, no position info: {:Xsp}", spdlog::to_hex(buf));
+}
+
+// Compile time log levels.
+// define SPDLOG_ACTIVE_LEVEL to required level (e.g. SPDLOG_LEVEL_TRACE)
+void trace_example()
+{
+ // trace from default logger
+ SPDLOG_TRACE("Some trace message.. {} ,{}", 1, 3.23);
+ // debug from default logger
+ SPDLOG_DEBUG("Some debug message.. {} ,{}", 1, 3.23);
+
+ // trace from logger object
+ auto logger = spdlog::get("file_logger");
+ SPDLOG_LOGGER_TRACE(logger, "another trace message");
+}
+
+// A logger with multiple sinks (stdout and file) - each with a different format and log level.
+void multi_sink_example()
+{
+ auto console_sink = std::make_shared<spdlog::sinks::stdout_color_sink_mt>();
+ console_sink->set_level(spdlog::level::warn);
+ console_sink->set_pattern("[multi_sink_example] [%^%l%$] %v");
+
+ auto file_sink = std::make_shared<spdlog::sinks::basic_file_sink_mt>("logs/multisink.txt", true);
+ file_sink->set_level(spdlog::level::trace);
+
+ spdlog::logger logger("multi_sink", {console_sink, file_sink});
+ logger.set_level(spdlog::level::debug);
+ logger.warn("this should appear in both console and file");
+ logger.info("this message should not appear in the console, only in the file");
+}
+
+// User defined types logging by implementing operator<<
+#include "spdlog/fmt/ostr.h" // must be included
+struct my_type
+{
+ int i;
+ template<typename OStream>
+ friend OStream &operator<<(OStream &os, const my_type &c)
+ {
+ return os << "[my_type i=" << c.i << "]";
+ }
+};
+
+void user_defined_example()
+{
+ spdlog::info("user defined type: {}", my_type{14});
+}
+
+// Custom error handler. Will be triggered on log failure.
+void err_handler_example()
+{
+ // can be set globally or per logger(logger->set_error_handler(..))
+ spdlog::set_error_handler([](const std::string &msg) { printf("*** Custom log error handler: %s ***\n", msg.c_str()); });
+}
+
+// syslog example (linux/osx/freebsd)
+#ifndef _WIN32
+#include "spdlog/sinks/syslog_sink.h"
+void syslog_example()
+{
+ std::string ident = "spdlog-example";
+ auto syslog_logger = spdlog::syslog_logger_mt("syslog", ident, LOG_PID);
+ syslog_logger->warn("This is warning that will end up in syslog.");
+}
+#endif
+
+// Android example.
+#if defined(__ANDROID__)
+#include "spdlog/sinks/android_sink.h"
+void android_example()
+{
+ std::string tag = "spdlog-android";
+ auto android_logger = spdlog::android_logger_mt("android", tag);
+ android_logger->critical("Use \"adb shell logcat\" to view this message.");
+}
+
+#endif
--- /dev/null
+executable('example', 'example.cpp', dependencies: spdlog_dep)
+executable('example_header_only', 'example.cpp', dependencies: spdlog_headeronly_dep)
+
+
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+//
+// Async logging using global thread pool
+// All loggers created here share same global thread pool.
+// Each log message is pushed to a queue along with a shared pointer to the
+// logger.
+// If a logger deleted while having pending messages in the queue, it's actual
+// destruction will defer
+// until all its messages are processed by the thread pool.
+// This is because each message in the queue holds a shared_ptr to the
+// originating logger.
+
+#include <spdlog/async_logger.h>
+#include <spdlog/details/registry.h>
+#include <spdlog/details/thread_pool.h>
+
+#include <memory>
+#include <mutex>
+#include <functional>
+
+namespace spdlog {
+
+namespace details {
+static const size_t default_async_q_size = 8192;
+}
+
+// async logger factory - creates async loggers backed with thread pool.
+// if a global thread pool doesn't already exist, create it with default queue
+// size of 8192 items and single thread.
+template<async_overflow_policy OverflowPolicy = async_overflow_policy::block>
+struct async_factory_impl
+{
+ template<typename Sink, typename... SinkArgs>
+ static std::shared_ptr<async_logger> create(std::string logger_name, SinkArgs &&... args)
+ {
+ auto ®istry_inst = details::registry::instance();
+
+ // create global thread pool if not already exists..
+
+ auto &mutex = registry_inst.tp_mutex();
+ std::lock_guard<std::recursive_mutex> tp_lock(mutex);
+ auto tp = registry_inst.get_tp();
+ if (tp == nullptr)
+ {
+ tp = std::make_shared<details::thread_pool>(details::default_async_q_size, 1);
+ registry_inst.set_tp(tp);
+ }
+
+ auto sink = std::make_shared<Sink>(std::forward<SinkArgs>(args)...);
+ auto new_logger = std::make_shared<async_logger>(std::move(logger_name), std::move(sink), std::move(tp), OverflowPolicy);
+ registry_inst.initialize_logger(new_logger);
+ return new_logger;
+ }
+};
+
+using async_factory = async_factory_impl<async_overflow_policy::block>;
+using async_factory_nonblock = async_factory_impl<async_overflow_policy::overrun_oldest>;
+
+template<typename Sink, typename... SinkArgs>
+inline std::shared_ptr<spdlog::logger> create_async(std::string logger_name, SinkArgs &&... sink_args)
+{
+ return async_factory::create<Sink>(std::move(logger_name), std::forward<SinkArgs>(sink_args)...);
+}
+
+template<typename Sink, typename... SinkArgs>
+inline std::shared_ptr<spdlog::logger> create_async_nb(std::string logger_name, SinkArgs &&... sink_args)
+{
+ return async_factory_nonblock::create<Sink>(std::move(logger_name), std::forward<SinkArgs>(sink_args)...);
+}
+
+// set global thread pool.
+inline void init_thread_pool(size_t q_size, size_t thread_count, std::function<void()> on_thread_start)
+{
+ auto tp = std::make_shared<details::thread_pool>(q_size, thread_count, on_thread_start);
+ details::registry::instance().set_tp(std::move(tp));
+}
+
+// set global thread pool.
+inline void init_thread_pool(size_t q_size, size_t thread_count)
+{
+ init_thread_pool(q_size, thread_count, [] {});
+}
+
+// get the global thread pool.
+inline std::shared_ptr<spdlog::details::thread_pool> thread_pool()
+{
+ return details::registry::instance().get_tp();
+}
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/async_logger.h>
+#endif
+
+#include <spdlog/sinks/sink.h>
+#include <spdlog/details/thread_pool.h>
+
+#include <memory>
+#include <string>
+
+SPDLOG_INLINE spdlog::async_logger::async_logger(
+ std::string logger_name, sinks_init_list sinks_list, std::weak_ptr<details::thread_pool> tp, async_overflow_policy overflow_policy)
+ : async_logger(std::move(logger_name), sinks_list.begin(), sinks_list.end(), std::move(tp), overflow_policy)
+{}
+
+SPDLOG_INLINE spdlog::async_logger::async_logger(
+ std::string logger_name, sink_ptr single_sink, std::weak_ptr<details::thread_pool> tp, async_overflow_policy overflow_policy)
+ : async_logger(std::move(logger_name), {std::move(single_sink)}, std::move(tp), overflow_policy)
+{}
+
+// send the log message to the thread pool
+SPDLOG_INLINE void spdlog::async_logger::sink_it_(const details::log_msg &msg)
+{
+ if (auto pool_ptr = thread_pool_.lock())
+ {
+ pool_ptr->post_log(shared_from_this(), msg, overflow_policy_);
+ }
+ else
+ {
+ SPDLOG_THROW(spdlog_ex("async log: thread pool doesn't exist anymore"));
+ }
+}
+
+// send flush request to the thread pool
+SPDLOG_INLINE void spdlog::async_logger::flush_()
+{
+ if (auto pool_ptr = thread_pool_.lock())
+ {
+ pool_ptr->post_flush(shared_from_this(), overflow_policy_);
+ }
+ else
+ {
+ SPDLOG_THROW(spdlog_ex("async flush: thread pool doesn't exist anymore"));
+ }
+}
+
+//
+// backend functions - called from the thread pool to do the actual job
+//
+SPDLOG_INLINE void spdlog::async_logger::backend_sink_it_(const details::log_msg &msg)
+{
+ for (auto &sink : sinks_)
+ {
+ if (sink->should_log(msg.level))
+ {
+ SPDLOG_TRY
+ {
+ sink->log(msg);
+ }
+ SPDLOG_LOGGER_CATCH()
+ }
+ }
+
+ if (should_flush_(msg))
+ {
+ backend_flush_();
+ }
+}
+
+SPDLOG_INLINE void spdlog::async_logger::backend_flush_()
+{
+ for (auto &sink : sinks_)
+ {
+ SPDLOG_TRY
+ {
+ sink->flush();
+ }
+ SPDLOG_LOGGER_CATCH()
+ }
+}
+
+SPDLOG_INLINE std::shared_ptr<spdlog::logger> spdlog::async_logger::clone(std::string new_name)
+{
+ auto cloned = std::make_shared<spdlog::async_logger>(*this);
+ cloned->name_ = std::move(new_name);
+ return cloned;
+}
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+// Fast asynchronous logger.
+// Uses pre allocated queue.
+// Creates a single back thread to pop messages from the queue and log them.
+//
+// Upon each log write the logger:
+// 1. Checks if its log level is enough to log the message
+// 2. Push a new copy of the message to a queue (or block the caller until
+// space is available in the queue)
+// Upon destruction, logs all remaining messages in the queue before
+// destructing..
+
+#include <spdlog/logger.h>
+
+namespace spdlog {
+
+// Async overflow policy - block by default.
+enum class async_overflow_policy
+{
+ block, // Block until message can be enqueued
+ overrun_oldest // Discard oldest message in the queue if full when trying to
+ // add new item.
+};
+
+namespace details {
+class thread_pool;
+}
+
+class async_logger final : public std::enable_shared_from_this<async_logger>, public logger
+{
+ friend class details::thread_pool;
+
+public:
+ template<typename It>
+ async_logger(std::string logger_name, It begin, It end, std::weak_ptr<details::thread_pool> tp,
+ async_overflow_policy overflow_policy = async_overflow_policy::block)
+ : logger(std::move(logger_name), begin, end)
+ , thread_pool_(std::move(tp))
+ , overflow_policy_(overflow_policy)
+ {}
+
+ async_logger(std::string logger_name, sinks_init_list sinks_list, std::weak_ptr<details::thread_pool> tp,
+ async_overflow_policy overflow_policy = async_overflow_policy::block);
+
+ async_logger(std::string logger_name, sink_ptr single_sink, std::weak_ptr<details::thread_pool> tp,
+ async_overflow_policy overflow_policy = async_overflow_policy::block);
+
+ std::shared_ptr<logger> clone(std::string new_name) override;
+
+protected:
+ void sink_it_(const details::log_msg &msg) override;
+ void flush_() override;
+ void backend_sink_it_(const details::log_msg &incoming_log_msg);
+ void backend_flush_();
+
+private:
+ std::weak_ptr<details::thread_pool> thread_pool_;
+ async_overflow_policy overflow_policy_;
+};
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "async_logger-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/common.h>
+#endif
+
+namespace spdlog {
+namespace level {
+static string_view_t level_string_views[] SPDLOG_LEVEL_NAMES;
+
+static const char *short_level_names[] SPDLOG_SHORT_LEVEL_NAMES;
+
+SPDLOG_INLINE string_view_t &to_string_view(spdlog::level::level_enum l) SPDLOG_NOEXCEPT
+{
+ return level_string_views[l];
+}
+
+SPDLOG_INLINE const char *to_short_c_str(spdlog::level::level_enum l) SPDLOG_NOEXCEPT
+{
+ return short_level_names[l];
+}
+
+SPDLOG_INLINE spdlog::level::level_enum from_str(const std::string &name) SPDLOG_NOEXCEPT
+{
+ int level = 0;
+ for (const auto &level_str : level_string_views)
+ {
+ if (level_str == name)
+ {
+ return static_cast<level::level_enum>(level);
+ }
+ level++;
+ }
+ return level::off;
+}
+} // namespace level
+
+SPDLOG_INLINE spdlog_ex::spdlog_ex(std::string msg)
+ : msg_(std::move(msg))
+{}
+
+SPDLOG_INLINE spdlog_ex::spdlog_ex(const std::string &msg, int last_errno)
+{
+ memory_buf_t outbuf;
+ fmt::format_system_error(outbuf, last_errno, msg);
+ msg_ = fmt::to_string(outbuf);
+}
+
+SPDLOG_INLINE const char *spdlog_ex::what() const SPDLOG_NOEXCEPT
+{
+ return msg_.c_str();
+}
+
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/tweakme.h>
+#include <spdlog/details/null_mutex.h>
+
+#include <atomic>
+#include <chrono>
+#include <initializer_list>
+#include <memory>
+#include <exception>
+#include <string>
+#include <type_traits>
+#include <functional>
+
+#ifdef _WIN32
+#ifndef NOMINMAX
+#define NOMINMAX // prevent windows redefining min/max
+#endif
+
+#ifndef WIN32_LEAN_AND_MEAN
+#define WIN32_LEAN_AND_MEAN
+#endif
+
+#include <windows.h>
+#endif //_WIN32
+
+#ifdef SPDLOG_COMPILED_LIB
+#undef SPDLOG_HEADER_ONLY
+#define SPDLOG_INLINE
+#else
+#define SPDLOG_HEADER_ONLY
+#define SPDLOG_INLINE inline
+#endif
+
+#include <spdlog/fmt/fmt.h>
+
+// visual studio upto 2013 does not support noexcept nor constexpr
+#if defined(_MSC_VER) && (_MSC_VER < 1900)
+#define SPDLOG_NOEXCEPT _NOEXCEPT
+#define SPDLOG_CONSTEXPR
+#else
+#define SPDLOG_NOEXCEPT noexcept
+#define SPDLOG_CONSTEXPR constexpr
+#endif
+
+#if defined(__GNUC__) || defined(__clang__)
+#define SPDLOG_DEPRECATED __attribute__((deprecated))
+#elif defined(_MSC_VER)
+#define SPDLOG_DEPRECATED __declspec(deprecated)
+#else
+#define SPDLOG_DEPRECATED
+#endif
+
+// disable thread local on msvc 2013
+#ifndef SPDLOG_NO_TLS
+#if (defined(_MSC_VER) && (_MSC_VER < 1900)) || defined(__cplusplus_winrt)
+#define SPDLOG_NO_TLS 1
+#endif
+#endif
+
+#ifndef SPDLOG_FUNCTION
+#define SPDLOG_FUNCTION static_cast<const char *>(__FUNCTION__)
+#endif
+
+#ifdef SPDLOG_NO_EXCEPTIONS
+#define SPDLOG_TRY
+#define SPDLOG_THROW(ex) \
+ do \
+ { \
+ printf("spdlog fatal error: %s\n", ex.what()); \
+ std::abort(); \
+ } while (0)
+#define SPDLOG_CATCH_ALL()
+#else
+#define SPDLOG_TRY try
+#define SPDLOG_THROW(ex) throw(ex)
+#define SPDLOG_CATCH_ALL() catch (...)
+#endif
+
+namespace spdlog {
+
+class formatter;
+
+namespace sinks {
+class sink;
+}
+
+#if defined(_WIN32) && defined(SPDLOG_WCHAR_FILENAMES)
+using filename_t = std::wstring;
+#define SPDLOG_FILENAME_T(s) L##s
+#else
+using filename_t = std::string;
+#define SPDLOG_FILENAME_T(s) s
+#endif
+
+using log_clock = std::chrono::system_clock;
+using sink_ptr = std::shared_ptr<sinks::sink>;
+using sinks_init_list = std::initializer_list<sink_ptr>;
+using err_handler = std::function<void(const std::string &err_msg)>;
+using string_view_t = fmt::basic_string_view<char>;
+using wstring_view_t = fmt::basic_string_view<wchar_t>;
+using memory_buf_t = fmt::basic_memory_buffer<char, 250>;
+
+#ifdef SPDLOG_WCHAR_TO_UTF8_SUPPORT
+#ifndef _WIN32
+#error SPDLOG_WCHAR_TO_UTF8_SUPPORT only supported on windows
+#else
+template<typename T>
+struct is_convertible_to_wstring_view : std::is_convertible<T, wstring_view_t>
+{};
+#endif // _WIN32
+#else
+template<typename>
+struct is_convertible_to_wstring_view : std::false_type
+{};
+#endif // SPDLOG_WCHAR_TO_UTF8_SUPPORT
+
+#if defined(SPDLOG_NO_ATOMIC_LEVELS)
+using level_t = details::null_atomic_int;
+#else
+using level_t = std::atomic<int>;
+#endif
+
+#define SPDLOG_LEVEL_TRACE 0
+#define SPDLOG_LEVEL_DEBUG 1
+#define SPDLOG_LEVEL_INFO 2
+#define SPDLOG_LEVEL_WARN 3
+#define SPDLOG_LEVEL_ERROR 4
+#define SPDLOG_LEVEL_CRITICAL 5
+#define SPDLOG_LEVEL_OFF 6
+
+#if !defined(SPDLOG_ACTIVE_LEVEL)
+#define SPDLOG_ACTIVE_LEVEL SPDLOG_LEVEL_INFO
+#endif
+
+// Log level enum
+namespace level {
+enum level_enum
+{
+ trace = SPDLOG_LEVEL_TRACE,
+ debug = SPDLOG_LEVEL_DEBUG,
+ info = SPDLOG_LEVEL_INFO,
+ warn = SPDLOG_LEVEL_WARN,
+ err = SPDLOG_LEVEL_ERROR,
+ critical = SPDLOG_LEVEL_CRITICAL,
+ off = SPDLOG_LEVEL_OFF,
+};
+
+#if !defined(SPDLOG_LEVEL_NAMES)
+#define SPDLOG_LEVEL_NAMES \
+ { \
+ "trace", "debug", "info", "warning", "error", "critical", "off" \
+ }
+#endif
+
+#if !defined(SPDLOG_SHORT_LEVEL_NAMES)
+
+#define SPDLOG_SHORT_LEVEL_NAMES \
+ { \
+ "T", "D", "I", "W", "E", "C", "O" \
+ }
+#endif
+
+string_view_t &to_string_view(spdlog::level::level_enum l) SPDLOG_NOEXCEPT;
+const char *to_short_c_str(spdlog::level::level_enum l) SPDLOG_NOEXCEPT;
+spdlog::level::level_enum from_str(const std::string &name) SPDLOG_NOEXCEPT;
+
+using level_hasher = std::hash<int>;
+} // namespace level
+
+//
+// Color mode used by sinks with color support.
+//
+enum class color_mode
+{
+ always,
+ automatic,
+ never
+};
+
+//
+// Pattern time - specific time getting to use for pattern_formatter.
+// local time by default
+//
+enum class pattern_time_type
+{
+ local, // log localtime
+ utc // log utc
+};
+
+//
+// Log exception
+//
+class spdlog_ex : public std::exception
+{
+public:
+ explicit spdlog_ex(std::string msg);
+ spdlog_ex(const std::string &msg, int last_errno);
+ const char *what() const SPDLOG_NOEXCEPT override;
+
+private:
+ std::string msg_;
+};
+
+struct source_loc
+{
+ SPDLOG_CONSTEXPR source_loc() = default;
+ SPDLOG_CONSTEXPR source_loc(const char *filename_in, int line_in, const char *funcname_in)
+ : filename{filename_in}
+ , line{line_in}
+ , funcname{funcname_in}
+ {}
+
+ SPDLOG_CONSTEXPR bool empty() const SPDLOG_NOEXCEPT
+ {
+ return line == 0;
+ }
+ const char *filename{nullptr};
+ int line{0};
+ const char *funcname{nullptr};
+};
+
+namespace details {
+// make_unique support for pre c++14
+
+#if __cplusplus >= 201402L // C++14 and beyond
+using std::make_unique;
+#else
+template<typename T, typename... Args>
+std::unique_ptr<T> make_unique(Args &&... args)
+{
+ static_assert(!std::is_array<T>::value, "arrays not supported");
+ return std::unique_ptr<T>(new T(std::forward<Args>(args)...));
+}
+#endif
+} // namespace details
+
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "common-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/details/backtracer.h>
+#endif
+namespace spdlog {
+namespace details {
+SPDLOG_INLINE backtracer::backtracer(const backtracer &other)
+{
+ std::lock_guard<std::mutex> lock(other.mutex_);
+ enabled_ = other.enabled();
+ messages_ = other.messages_;
+}
+
+SPDLOG_INLINE backtracer::backtracer(backtracer &&other) SPDLOG_NOEXCEPT
+{
+ std::lock_guard<std::mutex> lock(other.mutex_);
+ enabled_ = other.enabled();
+ messages_ = std::move(other.messages_);
+}
+
+SPDLOG_INLINE backtracer &backtracer::operator=(backtracer other)
+{
+ std::lock_guard<std::mutex> lock(mutex_);
+ enabled_ = other.enabled();
+ messages_ = std::move(other.messages_);
+ return *this;
+}
+
+SPDLOG_INLINE void backtracer::enable(size_t size)
+{
+ std::lock_guard<std::mutex> lock{mutex_};
+ enabled_.store(true, std::memory_order_relaxed);
+ messages_ = circular_q<log_msg_buffer>{size};
+}
+
+SPDLOG_INLINE void backtracer::disable()
+{
+ std::lock_guard<std::mutex> lock{mutex_};
+ enabled_.store(false, std::memory_order_relaxed);
+}
+
+SPDLOG_INLINE bool backtracer::enabled() const
+{
+ return enabled_.load(std::memory_order_relaxed);
+}
+
+SPDLOG_INLINE void backtracer::push_back(const log_msg &msg)
+{
+ std::lock_guard<std::mutex> lock{mutex_};
+ messages_.push_back(log_msg_buffer{msg});
+}
+
+// pop all items in the q and apply the given fun on each of them.
+SPDLOG_INLINE void backtracer::foreach_pop(std::function<void(const details::log_msg &)> fun)
+{
+ std::lock_guard<std::mutex> lock{mutex_};
+ while (!messages_.empty())
+ {
+ auto &front_msg = messages_.front();
+ fun(front_msg);
+ messages_.pop_front();
+ }
+}
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/details/log_msg_buffer.h>
+#include <spdlog/details/circular_q.h>
+
+#include <atomic>
+#include <mutex>
+#include <functional>
+
+// Store log messages in circular buffer.
+// Useful for storing debug data in case of error/warning happens.
+
+namespace spdlog {
+namespace details {
+class backtracer
+{
+ mutable std::mutex mutex_;
+ std::atomic<bool> enabled_{false};
+ circular_q<log_msg_buffer> messages_;
+
+public:
+ backtracer() = default;
+ backtracer(const backtracer &other);
+
+ backtracer(backtracer &&other) SPDLOG_NOEXCEPT;
+ backtracer &operator=(backtracer other);
+
+ void enable(size_t size);
+ void disable();
+ bool enabled() const;
+ void push_back(const log_msg &msg);
+
+ // pop all items in the q and apply the given fun on each of them.
+ void foreach_pop(std::function<void(const details::log_msg &)> fun);
+};
+
+} // namespace details
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "backtracer-inl.h"
+#endif
\ No newline at end of file
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+// circular q view of std::vector.
+#pragma once
+
+#include <vector>
+#include <cassert>
+
+namespace spdlog {
+namespace details {
+template<typename T>
+class circular_q
+{
+ size_t max_items_ = 0;
+ typename std::vector<T>::size_type head_ = 0;
+ typename std::vector<T>::size_type tail_ = 0;
+ size_t overrun_counter_ = 0;
+ std::vector<T> v_;
+
+public:
+ using value_type = T;
+
+ // empty ctor - create a disabled queue with no elements allocated at all
+ circular_q() = default;
+
+ explicit circular_q(size_t max_items)
+ : max_items_(max_items + 1) // one item is reserved as marker for full q
+ , v_(max_items_)
+ {}
+
+ circular_q(const circular_q &) = default;
+ circular_q &operator=(const circular_q &) = default;
+
+ // move cannot be default,
+ // since we need to reset head_, tail_, etc to zero in the moved object
+ circular_q(circular_q &&other) SPDLOG_NOEXCEPT
+ {
+ copy_moveable(std::move(other));
+ }
+
+ circular_q &operator=(circular_q &&other) SPDLOG_NOEXCEPT
+ {
+ copy_moveable(std::move(other));
+ return *this;
+ }
+
+ // push back, overrun (oldest) item if no room left
+ void push_back(T &&item)
+ {
+ if (max_items_ > 0)
+ {
+ v_[tail_] = std::move(item);
+ tail_ = (tail_ + 1) % max_items_;
+
+ if (tail_ == head_) // overrun last item if full
+ {
+ head_ = (head_ + 1) % max_items_;
+ ++overrun_counter_;
+ }
+ }
+ }
+
+ // Return reference to the front item.
+ // If there are no elements in the container, the behavior is undefined.
+ const T &front() const
+ {
+ return v_[head_];
+ }
+
+ T &front()
+ {
+ return v_[head_];
+ }
+
+ // Return number of elements actually stored
+ size_t size() const
+ {
+ if (tail_ >= head_)
+ {
+ return tail_ - head_;
+ }
+ else
+ {
+ return max_items_ - (head_ - tail_);
+ }
+ }
+
+ // Return const reference to item by index.
+ // If index is out of range 0…size()-1, the behavior is undefined.
+ const T &at(size_t i) const
+ {
+ assert(i < size());
+ return v_[(head_ + i) % max_items_];
+ }
+
+ // Pop item from front.
+ // If there are no elements in the container, the behavior is undefined.
+ void pop_front()
+ {
+ head_ = (head_ + 1) % max_items_;
+ }
+
+ bool empty() const
+ {
+ return tail_ == head_;
+ }
+
+ bool full() const
+ {
+ // head is ahead of the tail by 1
+ if (max_items_ > 0)
+ {
+ return ((tail_ + 1) % max_items_) == head_;
+ }
+ return false;
+ }
+
+ size_t overrun_counter() const
+ {
+ return overrun_counter_;
+ }
+
+private:
+ // copy from other&& and reset it to disabled state
+ void copy_moveable(circular_q &&other) SPDLOG_NOEXCEPT
+ {
+ max_items_ = other.max_items_;
+ head_ = other.head_;
+ tail_ = other.tail_;
+ overrun_counter_ = other.overrun_counter_;
+ v_ = std::move(other.v_);
+
+ // put &&other in disabled, but valid state
+ other.max_items_ = 0;
+ other.head_ = other.tail_ = 0;
+ other.overrun_counter_ = 0;
+ }
+};
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/details/null_mutex.h>
+#include <mutex>
+
+namespace spdlog {
+namespace details {
+
+struct console_mutex
+{
+ using mutex_t = std::mutex;
+ static mutex_t &mutex()
+ {
+ static mutex_t s_mutex;
+ return s_mutex;
+ }
+};
+
+struct console_nullmutex
+{
+ using mutex_t = null_mutex;
+ static mutex_t &mutex()
+ {
+ static mutex_t s_mutex;
+ return s_mutex;
+ }
+};
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/details/file_helper.h>
+#endif
+
+#include <spdlog/details/os.h>
+#include <spdlog/common.h>
+
+#include <cerrno>
+#include <chrono>
+#include <cstdio>
+#include <string>
+#include <thread>
+#include <tuple>
+
+namespace spdlog {
+namespace details {
+
+SPDLOG_INLINE file_helper::~file_helper()
+{
+ close();
+}
+
+SPDLOG_INLINE void file_helper::open(const filename_t &fname, bool truncate)
+{
+ close();
+ filename_ = fname;
+ auto *mode = truncate ? SPDLOG_FILENAME_T("wb") : SPDLOG_FILENAME_T("ab");
+
+ for (int tries = 0; tries < open_tries_; ++tries)
+ {
+ // create containing folder if not exists already.
+ os::create_dir(os::dir_name(fname));
+ if (!os::fopen_s(&fd_, fname, mode))
+ {
+ return;
+ }
+
+ details::os::sleep_for_millis(open_interval_);
+ }
+
+ SPDLOG_THROW(spdlog_ex("Failed opening file " + os::filename_to_str(filename_) + " for writing", errno));
+}
+
+SPDLOG_INLINE void file_helper::reopen(bool truncate)
+{
+ if (filename_.empty())
+ {
+ SPDLOG_THROW(spdlog_ex("Failed re opening file - was not opened before"));
+ }
+ this->open(filename_, truncate);
+}
+
+SPDLOG_INLINE void file_helper::flush()
+{
+ std::fflush(fd_);
+}
+
+SPDLOG_INLINE void file_helper::close()
+{
+ if (fd_ != nullptr)
+ {
+ std::fclose(fd_);
+ fd_ = nullptr;
+ }
+}
+
+SPDLOG_INLINE void file_helper::write(const memory_buf_t &buf)
+{
+ size_t msg_size = buf.size();
+ auto data = buf.data();
+ if (std::fwrite(data, 1, msg_size, fd_) != msg_size)
+ {
+ SPDLOG_THROW(spdlog_ex("Failed writing to file " + os::filename_to_str(filename_), errno));
+ }
+}
+
+SPDLOG_INLINE size_t file_helper::size() const
+{
+ if (fd_ == nullptr)
+ {
+ SPDLOG_THROW(spdlog_ex("Cannot use size() on closed file " + os::filename_to_str(filename_)));
+ }
+ return os::filesize(fd_);
+}
+
+SPDLOG_INLINE const filename_t &file_helper::filename() const
+{
+ return filename_;
+}
+
+//
+// return file path and its extension:
+//
+// "mylog.txt" => ("mylog", ".txt")
+// "mylog" => ("mylog", "")
+// "mylog." => ("mylog.", "")
+// "/dir1/dir2/mylog.txt" => ("/dir1/dir2/mylog", ".txt")
+//
+// the starting dot in filenames is ignored (hidden files):
+//
+// ".mylog" => (".mylog". "")
+// "my_folder/.mylog" => ("my_folder/.mylog", "")
+// "my_folder/.mylog.txt" => ("my_folder/.mylog", ".txt")
+SPDLOG_INLINE std::tuple<filename_t, filename_t> file_helper::split_by_extension(const filename_t &fname)
+{
+ auto ext_index = fname.rfind('.');
+
+ // no valid extension found - return whole path and empty string as
+ // extension
+ if (ext_index == filename_t::npos || ext_index == 0 || ext_index == fname.size() - 1)
+ {
+ return std::make_tuple(fname, filename_t());
+ }
+
+ // treat cases like "/etc/rc.d/somelogfile or "/abc/.hiddenfile"
+ auto folder_index = fname.rfind(details::os::folder_sep);
+ if (folder_index != filename_t::npos && folder_index >= ext_index - 1)
+ {
+ return std::make_tuple(fname, filename_t());
+ }
+
+ // finally - return a valid base and extension tuple
+ return std::make_tuple(fname.substr(0, ext_index), fname.substr(ext_index));
+}
+
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/common.h>
+#include <tuple>
+
+namespace spdlog {
+namespace details {
+
+// Helper class for file sinks.
+// When failing to open a file, retry several times(5) with a delay interval(10 ms).
+// Throw spdlog_ex exception on errors.
+
+class file_helper
+{
+public:
+ explicit file_helper() = default;
+
+ file_helper(const file_helper &) = delete;
+ file_helper &operator=(const file_helper &) = delete;
+ ~file_helper();
+
+ void open(const filename_t &fname, bool truncate = false);
+ void reopen(bool truncate);
+ void flush();
+ void close();
+ void write(const memory_buf_t &buf);
+ size_t size() const;
+ const filename_t &filename() const;
+
+ //
+ // return file path and its extension:
+ //
+ // "mylog.txt" => ("mylog", ".txt")
+ // "mylog" => ("mylog", "")
+ // "mylog." => ("mylog.", "")
+ // "/dir1/dir2/mylog.txt" => ("/dir1/dir2/mylog", ".txt")
+ //
+ // the starting dot in filenames is ignored (hidden files):
+ //
+ // ".mylog" => (".mylog". "")
+ // "my_folder/.mylog" => ("my_folder/.mylog", "")
+ // "my_folder/.mylog.txt" => ("my_folder/.mylog", ".txt")
+ static std::tuple<filename_t, filename_t> split_by_extension(const filename_t &fname);
+
+private:
+ const int open_tries_ = 5;
+ const int open_interval_ = 10;
+ std::FILE *fd_{nullptr};
+ filename_t filename_;
+};
+} // namespace details
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "file_helper-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+#pragma once
+
+#include <chrono>
+#include <type_traits>
+#include <spdlog/fmt/fmt.h>
+#include <spdlog/common.h>
+
+// Some fmt helpers to efficiently format and pad ints and strings
+namespace spdlog {
+namespace details {
+namespace fmt_helper {
+
+inline spdlog::string_view_t to_string_view(const memory_buf_t &buf) SPDLOG_NOEXCEPT
+{
+ return spdlog::string_view_t{buf.data(), buf.size()};
+}
+
+inline void append_string_view(spdlog::string_view_t view, memory_buf_t &dest)
+{
+ auto *buf_ptr = view.data();
+ if (buf_ptr != nullptr)
+ {
+ dest.append(buf_ptr, buf_ptr + view.size());
+ }
+}
+
+template<typename T>
+inline void append_int(T n, memory_buf_t &dest)
+{
+ fmt::format_int i(n);
+ dest.append(i.data(), i.data() + i.size());
+}
+
+template<typename T>
+inline unsigned count_digits(T n)
+{
+ using count_type = typename std::conditional<(sizeof(T) > sizeof(uint32_t)), uint64_t, uint32_t>::type;
+ return static_cast<unsigned>(fmt::internal::count_digits(static_cast<count_type>(n)));
+}
+
+inline void pad2(int n, memory_buf_t &dest)
+{
+ if (n > 99)
+ {
+ append_int(n, dest);
+ }
+ else if (n > 9) // 10-99
+ {
+ dest.push_back(static_cast<char>('0' + n / 10));
+ dest.push_back(static_cast<char>('0' + n % 10));
+ }
+ else if (n >= 0) // 0-9
+ {
+ dest.push_back('0');
+ dest.push_back(static_cast<char>('0' + n));
+ }
+ else // negatives (unlikely, but just in case, let fmt deal with it)
+ {
+ fmt::format_to(dest, "{:02}", n);
+ }
+}
+
+template<typename T>
+inline void pad_uint(T n, unsigned int width, memory_buf_t &dest)
+{
+ static_assert(std::is_unsigned<T>::value, "pad_uint must get unsigned T");
+ auto digits = count_digits(n);
+ if (width > digits)
+ {
+ const char *zeroes = "0000000000000000000";
+ dest.append(zeroes, zeroes + width - digits);
+ }
+ append_int(n, dest);
+}
+
+template<typename T>
+inline void pad3(T n, memory_buf_t &dest)
+{
+ pad_uint(n, 3, dest);
+}
+
+template<typename T>
+inline void pad6(T n, memory_buf_t &dest)
+{
+ pad_uint(n, 6, dest);
+}
+
+template<typename T>
+inline void pad9(T n, memory_buf_t &dest)
+{
+ pad_uint(n, 9, dest);
+}
+
+// return fraction of a second of the given time_point.
+// e.g.
+// fraction<std::milliseconds>(tp) -> will return the millis part of the second
+template<typename ToDuration>
+inline ToDuration time_fraction(log_clock::time_point tp)
+{
+ using std::chrono::duration_cast;
+ using std::chrono::seconds;
+ auto duration = tp.time_since_epoch();
+ auto secs = duration_cast<seconds>(duration);
+ return duration_cast<ToDuration>(duration) - duration_cast<ToDuration>(secs);
+}
+
+} // namespace fmt_helper
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/details/log_msg.h>
+#endif
+
+#include <spdlog/details/os.h>
+
+namespace spdlog {
+namespace details {
+
+SPDLOG_INLINE log_msg::log_msg(
+ spdlog::source_loc loc, string_view_t a_logger_name, spdlog::level::level_enum lvl, spdlog::string_view_t msg)
+ : logger_name(a_logger_name)
+ , level(lvl)
+ , time(os::now())
+#ifndef SPDLOG_NO_THREAD_ID
+ , thread_id(os::thread_id())
+#endif
+ , source(loc)
+ , payload(msg)
+{}
+
+SPDLOG_INLINE log_msg::log_msg(string_view_t a_logger_name, spdlog::level::level_enum lvl, spdlog::string_view_t msg)
+ : log_msg(source_loc{}, a_logger_name, lvl, msg)
+{}
+
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/common.h>
+#include <string>
+
+namespace spdlog {
+namespace details {
+struct log_msg
+{
+ log_msg() = default;
+ log_msg(source_loc loc, string_view_t logger_name, level::level_enum lvl, string_view_t msg);
+ log_msg(string_view_t logger_name, level::level_enum lvl, string_view_t msg);
+ log_msg(const log_msg &other) = default;
+
+ string_view_t logger_name;
+ level::level_enum level{level::off};
+ log_clock::time_point time;
+ size_t thread_id{0};
+
+ // wrapping the formatted text with color (updated by pattern_formatter).
+ mutable size_t color_range_start{0};
+ mutable size_t color_range_end{0};
+
+ source_loc source;
+ string_view_t payload;
+};
+} // namespace details
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "log_msg-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/details/log_msg_buffer.h>
+#endif
+
+namespace spdlog {
+namespace details {
+
+SPDLOG_INLINE log_msg_buffer::log_msg_buffer(const log_msg &orig_msg)
+ : log_msg{orig_msg}
+{
+ buffer.append(logger_name.begin(), logger_name.end());
+ buffer.append(payload.begin(), payload.end());
+ update_string_views();
+}
+
+SPDLOG_INLINE log_msg_buffer::log_msg_buffer(const log_msg_buffer &other)
+ : log_msg{other}
+{
+ buffer.append(logger_name.begin(), logger_name.end());
+ buffer.append(payload.begin(), payload.end());
+ update_string_views();
+}
+
+SPDLOG_INLINE log_msg_buffer::log_msg_buffer(log_msg_buffer &&other) SPDLOG_NOEXCEPT : log_msg{other}, buffer{std::move(other.buffer)}
+{
+ update_string_views();
+}
+
+SPDLOG_INLINE log_msg_buffer &log_msg_buffer::operator=(const log_msg_buffer &other)
+{
+ log_msg::operator=(other);
+ buffer.clear();
+ buffer.append(other.buffer.data(), other.buffer.data() + other.buffer.size());
+ update_string_views();
+ return *this;
+}
+
+SPDLOG_INLINE log_msg_buffer &log_msg_buffer::operator=(log_msg_buffer &&other) SPDLOG_NOEXCEPT
+{
+ log_msg::operator=(other);
+ buffer = std::move(other.buffer);
+ update_string_views();
+ return *this;
+}
+
+SPDLOG_INLINE void log_msg_buffer::update_string_views()
+{
+ logger_name = string_view_t{buffer.data(), logger_name.size()};
+ payload = string_view_t{buffer.data() + logger_name.size(), payload.size()};
+}
+
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/details/log_msg.h>
+
+namespace spdlog {
+namespace details {
+
+// Extend log_msg with internal buffer to store its payload.
+// THis is needed since log_msg holds string_views that points to stack data.
+
+class log_msg_buffer : public log_msg
+{
+ memory_buf_t buffer;
+ void update_string_views();
+
+public:
+ log_msg_buffer() = default;
+ explicit log_msg_buffer(const log_msg &orig_msg);
+ log_msg_buffer(const log_msg_buffer &other);
+ log_msg_buffer(log_msg_buffer &&other) SPDLOG_NOEXCEPT;
+ log_msg_buffer &operator=(const log_msg_buffer &other);
+ log_msg_buffer &operator=(log_msg_buffer &&other) SPDLOG_NOEXCEPT;
+};
+
+} // namespace details
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "log_msg_buffer-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+// multi producer-multi consumer blocking queue.
+// enqueue(..) - will block until room found to put the new message.
+// enqueue_nowait(..) - will return immediately with false if no room left in
+// the queue.
+// dequeue_for(..) - will block until the queue is not empty or timeout have
+// passed.
+
+#include <spdlog/details/circular_q.h>
+
+#include <condition_variable>
+#include <mutex>
+
+namespace spdlog {
+namespace details {
+
+template<typename T>
+class mpmc_blocking_queue
+{
+public:
+ using item_type = T;
+ explicit mpmc_blocking_queue(size_t max_items)
+ : q_(max_items)
+ {}
+
+#ifndef __MINGW32__
+ // try to enqueue and block if no room left
+ void enqueue(T &&item)
+ {
+ {
+ std::unique_lock<std::mutex> lock(queue_mutex_);
+ pop_cv_.wait(lock, [this] { return !this->q_.full(); });
+ q_.push_back(std::move(item));
+ }
+ push_cv_.notify_one();
+ }
+
+ // enqueue immediately. overrun oldest message in the queue if no room left.
+ void enqueue_nowait(T &&item)
+ {
+ {
+ std::unique_lock<std::mutex> lock(queue_mutex_);
+ q_.push_back(std::move(item));
+ }
+ push_cv_.notify_one();
+ }
+
+ // try to dequeue item. if no item found. wait upto timeout and try again
+ // Return true, if succeeded dequeue item, false otherwise
+ bool dequeue_for(T &popped_item, std::chrono::milliseconds wait_duration)
+ {
+ {
+ std::unique_lock<std::mutex> lock(queue_mutex_);
+ if (!push_cv_.wait_for(lock, wait_duration, [this] { return !this->q_.empty(); }))
+ {
+ return false;
+ }
+ popped_item = std::move(q_.front());
+ q_.pop_front();
+ }
+ pop_cv_.notify_one();
+ return true;
+ }
+
+#else
+ // apparently mingw deadlocks if the mutex is released before cv.notify_one(),
+ // so release the mutex at the very end each function.
+
+ // try to enqueue and block if no room left
+ void enqueue(T &&item)
+ {
+ std::unique_lock<std::mutex> lock(queue_mutex_);
+ pop_cv_.wait(lock, [this] { return !this->q_.full(); });
+ q_.push_back(std::move(item));
+ push_cv_.notify_one();
+ }
+
+ // enqueue immediately. overrun oldest message in the queue if no room left.
+ void enqueue_nowait(T &&item)
+ {
+ std::unique_lock<std::mutex> lock(queue_mutex_);
+ q_.push_back(std::move(item));
+ push_cv_.notify_one();
+ }
+
+ // try to dequeue item. if no item found. wait upto timeout and try again
+ // Return true, if succeeded dequeue item, false otherwise
+ bool dequeue_for(T &popped_item, std::chrono::milliseconds wait_duration)
+ {
+ std::unique_lock<std::mutex> lock(queue_mutex_);
+ if (!push_cv_.wait_for(lock, wait_duration, [this] { return !this->q_.empty(); }))
+ {
+ return false;
+ }
+ popped_item = std::move(q_.front());
+ q_.pop_front();
+ pop_cv_.notify_one();
+ return true;
+ }
+
+#endif
+
+ size_t overrun_counter()
+ {
+ std::unique_lock<std::mutex> lock(queue_mutex_);
+ return q_.overrun_counter();
+ }
+
+private:
+ std::mutex queue_mutex_;
+ std::condition_variable push_cv_;
+ std::condition_variable pop_cv_;
+ spdlog::details::circular_q<T> q_;
+};
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <atomic>
+#include <utility>
+// null, no cost dummy "mutex" and dummy "atomic" int
+
+namespace spdlog {
+namespace details {
+struct null_mutex
+{
+ void lock() const {}
+ void unlock() const {}
+ bool try_lock() const
+ {
+ return true;
+ }
+};
+
+struct null_atomic_int
+{
+ int value;
+ null_atomic_int() = default;
+
+ explicit null_atomic_int(int new_value)
+ : value(new_value)
+ {}
+
+ int load(std::memory_order = std::memory_order_relaxed) const
+ {
+ return value;
+ }
+
+ void store(int new_value, std::memory_order = std::memory_order_relaxed)
+ {
+ value = new_value;
+ }
+
+ int exchange(int new_value, std::memory_order = std::memory_order_relaxed)
+ {
+ std::swap(new_value, value);
+ return new_value; // return value before the call
+ }
+};
+
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/details/os.h>
+#endif
+
+#include <spdlog/common.h>
+
+#include <algorithm>
+#include <chrono>
+#include <cstdio>
+#include <cstdlib>
+#include <cstring>
+#include <ctime>
+#include <string>
+#include <thread>
+#include <array>
+#include <sys/stat.h>
+#include <sys/types.h>
+
+#ifdef _WIN32
+
+#ifndef NOMINMAX
+#define NOMINMAX // prevent windows redefining min/max
+#endif
+
+#ifndef WIN32_LEAN_AND_MEAN
+#define WIN32_LEAN_AND_MEAN
+#endif
+#include <io.h> // _get_osfhandle and _isatty support
+#include <process.h> // _get_pid support
+#include <windows.h>
+
+#ifdef __MINGW32__
+#include <share.h>
+#endif
+
+#if defined(SPDLOG_WCHAR_TO_UTF8_SUPPORT) || defined(SPDLOG_WCHAR_FILENAMES)
+#include <limits>
+#endif
+
+#include <direct.h> // for _mkdir/_wmkdir
+
+#else // unix
+
+#include <fcntl.h>
+#include <unistd.h>
+
+#ifdef __linux__
+#include <sys/syscall.h> //Use gettid() syscall under linux to get thread id
+
+#elif defined(_AIX)
+#include <pthread.h> // for pthread_getthreadid_np
+
+#elif defined(__DragonFly__) || defined(__FreeBSD__)
+#include <pthread_np.h> // for pthread_getthreadid_np
+
+#elif defined(__NetBSD__)
+#include <lwp.h> // for _lwp_self
+
+#elif defined(__sun)
+#include <thread.h> // for thr_self
+#endif
+
+#endif // unix
+
+#ifndef __has_feature // Clang - feature checking macros.
+#define __has_feature(x) 0 // Compatibility with non-clang compilers.
+#endif
+
+namespace spdlog {
+namespace details {
+namespace os {
+
+SPDLOG_INLINE spdlog::log_clock::time_point now() SPDLOG_NOEXCEPT
+{
+
+#if defined __linux__ && defined SPDLOG_CLOCK_COARSE
+ timespec ts;
+ ::clock_gettime(CLOCK_REALTIME_COARSE, &ts);
+ return std::chrono::time_point<log_clock, typename log_clock::duration>(
+ std::chrono::duration_cast<typename log_clock::duration>(std::chrono::seconds(ts.tv_sec) + std::chrono::nanoseconds(ts.tv_nsec)));
+
+#else
+ return log_clock::now();
+#endif
+}
+SPDLOG_INLINE std::tm localtime(const std::time_t &time_tt) SPDLOG_NOEXCEPT
+{
+
+#ifdef _WIN32
+ std::tm tm;
+ ::localtime_s(&tm, &time_tt);
+#else
+ std::tm tm;
+ ::localtime_r(&time_tt, &tm);
+#endif
+ return tm;
+}
+
+SPDLOG_INLINE std::tm localtime() SPDLOG_NOEXCEPT
+{
+ std::time_t now_t = ::time(nullptr);
+ return localtime(now_t);
+}
+
+SPDLOG_INLINE std::tm gmtime(const std::time_t &time_tt) SPDLOG_NOEXCEPT
+{
+
+#ifdef _WIN32
+ std::tm tm;
+ ::gmtime_s(&tm, &time_tt);
+#else
+ std::tm tm;
+ ::gmtime_r(&time_tt, &tm);
+#endif
+ return tm;
+}
+
+SPDLOG_INLINE std::tm gmtime() SPDLOG_NOEXCEPT
+{
+ std::time_t now_t = ::time(nullptr);
+ return gmtime(now_t);
+}
+
+#ifdef SPDLOG_PREVENT_CHILD_FD
+SPDLOG_INLINE void prevent_child_fd(FILE *f)
+{
+#ifdef _WIN32
+ auto file_handle = reinterpret_cast<HANDLE>(_get_osfhandle(::_fileno(f)));
+ if (!::SetHandleInformation(file_handle, HANDLE_FLAG_INHERIT, 0))
+ SPDLOG_THROW(spdlog_ex("SetHandleInformation failed", errno));
+#else
+ auto fd = ::fileno(f);
+ if (::fcntl(fd, F_SETFD, FD_CLOEXEC) == -1)
+ {
+ SPDLOG_THROW(spdlog_ex("fcntl with FD_CLOEXEC failed", errno));
+ }
+#endif
+}
+#endif // SPDLOG_PREVENT_CHILD_FD
+
+// fopen_s on non windows for writing
+SPDLOG_INLINE bool fopen_s(FILE **fp, const filename_t &filename, const filename_t &mode)
+{
+#ifdef _WIN32
+#ifdef SPDLOG_WCHAR_FILENAMES
+ *fp = ::_wfsopen((filename.c_str()), mode.c_str(), _SH_DENYNO);
+#else
+ *fp = ::_fsopen((filename.c_str()), mode.c_str(), _SH_DENYNO);
+#endif
+#else // unix
+ *fp = ::fopen((filename.c_str()), mode.c_str());
+#endif
+
+#ifdef SPDLOG_PREVENT_CHILD_FD
+ // prevent child processes from inheriting log file descriptors
+ if (*fp != nullptr)
+ {
+ prevent_child_fd(*fp);
+ }
+#endif
+ return *fp == nullptr;
+}
+
+SPDLOG_INLINE int remove(const filename_t &filename) SPDLOG_NOEXCEPT
+{
+#if defined(_WIN32) && defined(SPDLOG_WCHAR_FILENAMES)
+ return ::_wremove(filename.c_str());
+#else
+ return std::remove(filename.c_str());
+#endif
+}
+
+SPDLOG_INLINE int remove_if_exists(const filename_t &filename) SPDLOG_NOEXCEPT
+{
+ return path_exists(filename) ? remove(filename) : 0;
+}
+
+SPDLOG_INLINE int rename(const filename_t &filename1, const filename_t &filename2) SPDLOG_NOEXCEPT
+{
+#if defined(_WIN32) && defined(SPDLOG_WCHAR_FILENAMES)
+ return ::_wrename(filename1.c_str(), filename2.c_str());
+#else
+ return std::rename(filename1.c_str(), filename2.c_str());
+#endif
+}
+
+// Return true if path exists (file or directory)
+SPDLOG_INLINE bool path_exists(const filename_t &filename) SPDLOG_NOEXCEPT
+{
+#ifdef _WIN32
+#ifdef SPDLOG_WCHAR_FILENAMES
+ auto attribs = ::GetFileAttributesW(filename.c_str());
+#else
+ auto attribs = ::GetFileAttributesA(filename.c_str());
+#endif
+ return attribs != INVALID_FILE_ATTRIBUTES;
+#else // common linux/unix all have the stat system call
+ struct stat buffer;
+ return (::stat(filename.c_str(), &buffer) == 0);
+#endif
+}
+
+// Return file size according to open FILE* object
+SPDLOG_INLINE size_t filesize(FILE *f)
+{
+ if (f == nullptr)
+ {
+ SPDLOG_THROW(spdlog_ex("Failed getting file size. fd is null"));
+ }
+#if defined(_WIN32) && !defined(__CYGWIN__)
+ int fd = ::_fileno(f);
+#if _WIN64 // 64 bits
+ __int64 ret = ::_filelengthi64(fd);
+ if (ret >= 0)
+ {
+ return static_cast<size_t>(ret);
+ }
+
+#else // windows 32 bits
+ long ret = ::_filelength(fd);
+ if (ret >= 0)
+ {
+ return static_cast<size_t>(ret);
+ }
+#endif
+
+#else // unix
+// OpenBSD doesn't compile with :: before the fileno(..)
+#if defined(__OpenBSD__)
+ int fd = fileno(f);
+#else
+ int fd = ::fileno(f);
+#endif
+// 64 bits(but not in osx or cygwin, where fstat64 is deprecated)
+#if (defined(__linux__) || defined(__sun) || defined(_AIX)) && (defined(__LP64__) || defined(_LP64))
+ struct stat64 st;
+ if (::fstat64(fd, &st) == 0)
+ {
+ return static_cast<size_t>(st.st_size);
+ }
+#else // other unix or linux 32 bits or cygwin
+ struct stat st;
+ if (::fstat(fd, &st) == 0)
+ {
+ return static_cast<size_t>(st.st_size);
+ }
+#endif
+#endif
+ SPDLOG_THROW(spdlog_ex("Failed getting file size from fd", errno));
+}
+
+// Return utc offset in minutes or throw spdlog_ex on failure
+SPDLOG_INLINE int utc_minutes_offset(const std::tm &tm)
+{
+
+#ifdef _WIN32
+#if _WIN32_WINNT < _WIN32_WINNT_WS08
+ TIME_ZONE_INFORMATION tzinfo;
+ auto rv = ::GetTimeZoneInformation(&tzinfo);
+#else
+ DYNAMIC_TIME_ZONE_INFORMATION tzinfo;
+ auto rv = ::GetDynamicTimeZoneInformation(&tzinfo);
+#endif
+ if (rv == TIME_ZONE_ID_INVALID)
+ SPDLOG_THROW(spdlog::spdlog_ex("Failed getting timezone info. ", errno));
+
+ int offset = -tzinfo.Bias;
+ if (tm.tm_isdst)
+ {
+ offset -= tzinfo.DaylightBias;
+ }
+ else
+ {
+ offset -= tzinfo.StandardBias;
+ }
+ return offset;
+#else
+
+#if defined(sun) || defined(__sun) || defined(_AIX) || (!defined(_BSD_SOURCE) && !defined(_GNU_SOURCE))
+ // 'tm_gmtoff' field is BSD extension and it's missing on SunOS/Solaris
+ struct helper
+ {
+ static long int calculate_gmt_offset(const std::tm &localtm = details::os::localtime(), const std::tm &gmtm = details::os::gmtime())
+ {
+ int local_year = localtm.tm_year + (1900 - 1);
+ int gmt_year = gmtm.tm_year + (1900 - 1);
+
+ long int days = (
+ // difference in day of year
+ localtm.tm_yday -
+ gmtm.tm_yday
+
+ // + intervening leap days
+ + ((local_year >> 2) - (gmt_year >> 2)) - (local_year / 100 - gmt_year / 100) +
+ ((local_year / 100 >> 2) - (gmt_year / 100 >> 2))
+
+ // + difference in years * 365 */
+ + (long int)(local_year - gmt_year) * 365);
+
+ long int hours = (24 * days) + (localtm.tm_hour - gmtm.tm_hour);
+ long int mins = (60 * hours) + (localtm.tm_min - gmtm.tm_min);
+ long int secs = (60 * mins) + (localtm.tm_sec - gmtm.tm_sec);
+
+ return secs;
+ }
+ };
+
+ auto offset_seconds = helper::calculate_gmt_offset(tm);
+#else
+ auto offset_seconds = tm.tm_gmtoff;
+#endif
+
+ return static_cast<int>(offset_seconds / 60);
+#endif
+}
+
+// Return current thread id as size_t
+// It exists because the std::this_thread::get_id() is much slower(especially
+// under VS 2013)
+SPDLOG_INLINE size_t _thread_id() SPDLOG_NOEXCEPT
+{
+#ifdef _WIN32
+ return static_cast<size_t>(::GetCurrentThreadId());
+#elif defined(__linux__)
+#if defined(__ANDROID__) && defined(__ANDROID_API__) && (__ANDROID_API__ < 21)
+#define SYS_gettid __NR_gettid
+#endif
+ return static_cast<size_t>(::syscall(SYS_gettid));
+#elif defined(_AIX) || defined(__DragonFly__) || defined(__FreeBSD__)
+ return static_cast<size_t>(::pthread_getthreadid_np());
+#elif defined(__NetBSD__)
+ return static_cast<size_t>(::_lwp_self());
+#elif defined(__OpenBSD__)
+ return static_cast<size_t>(::getthrid());
+#elif defined(__sun)
+ return static_cast<size_t>(::thr_self());
+#elif __APPLE__
+ uint64_t tid;
+ pthread_threadid_np(nullptr, &tid);
+ return static_cast<size_t>(tid);
+#else // Default to standard C++11 (other Unix)
+ return static_cast<size_t>(std::hash<std::thread::id>()(std::this_thread::get_id()));
+#endif
+}
+
+// Return current thread id as size_t (from thread local storage)
+SPDLOG_INLINE size_t thread_id() SPDLOG_NOEXCEPT
+{
+#if defined(SPDLOG_NO_TLS)
+ return _thread_id();
+#else // cache thread id in tls
+ static thread_local const size_t tid = _thread_id();
+ return tid;
+#endif
+}
+
+// This is avoid msvc issue in sleep_for that happens if the clock changes.
+// See https://github.com/gabime/spdlog/issues/609
+SPDLOG_INLINE void sleep_for_millis(int milliseconds) SPDLOG_NOEXCEPT
+{
+#if defined(_WIN32)
+ ::Sleep(milliseconds);
+#else
+ std::this_thread::sleep_for(std::chrono::milliseconds(milliseconds));
+#endif
+}
+
+// wchar support for windows file names (SPDLOG_WCHAR_FILENAMES must be defined)
+#if defined(_WIN32) && defined(SPDLOG_WCHAR_FILENAMES)
+SPDLOG_INLINE std::string filename_to_str(const filename_t &filename)
+{
+ memory_buf_t buf;
+ wstr_to_utf8buf(filename, buf);
+ return fmt::to_string(buf);
+}
+#else
+SPDLOG_INLINE std::string filename_to_str(const filename_t &filename)
+{
+ return filename;
+}
+#endif
+
+SPDLOG_INLINE int pid() SPDLOG_NOEXCEPT
+{
+
+#ifdef _WIN32
+ return static_cast<int>(::GetCurrentProcessId());
+#else
+ return static_cast<int>(::getpid());
+#endif
+}
+
+// Determine if the terminal supports colors
+// Source: https://github.com/agauniyal/rang/
+SPDLOG_INLINE bool is_color_terminal() SPDLOG_NOEXCEPT
+{
+#ifdef _WIN32
+ return true;
+#else
+ static constexpr std::array<const char *, 14> Terms = {
+ {"ansi", "color", "console", "cygwin", "gnome", "konsole", "kterm", "linux", "msys", "putty", "rxvt", "screen", "vt100", "xterm"}};
+
+ const char *env_p = std::getenv("TERM");
+ if (env_p == nullptr)
+ {
+ return false;
+ }
+
+ static const bool result =
+ std::any_of(std::begin(Terms), std::end(Terms), [&](const char *term) { return std::strstr(env_p, term) != nullptr; });
+ return result;
+#endif
+}
+
+// Detrmine if the terminal attached
+// Source: https://github.com/agauniyal/rang/
+SPDLOG_INLINE bool in_terminal(FILE *file) SPDLOG_NOEXCEPT
+{
+
+#ifdef _WIN32
+ return ::_isatty(_fileno(file)) != 0;
+#else
+ return ::isatty(fileno(file)) != 0;
+#endif
+}
+
+#if (defined(SPDLOG_WCHAR_TO_UTF8_SUPPORT) || defined(SPDLOG_WCHAR_FILENAMES)) && defined(_WIN32)
+SPDLOG_INLINE void wstr_to_utf8buf(wstring_view_t wstr, memory_buf_t &target)
+{
+ if (wstr.size() > static_cast<size_t>((std::numeric_limits<int>::max)()))
+ {
+ SPDLOG_THROW(spdlog::spdlog_ex("UTF-16 string is too big to be converted to UTF-8"));
+ }
+
+ int wstr_size = static_cast<int>(wstr.size());
+ if (wstr_size == 0)
+ {
+ target.resize(0);
+ return;
+ }
+
+ int result_size = static_cast<int>(target.capacity());
+ if ((wstr_size + 1) * 2 > result_size)
+ {
+ result_size = ::WideCharToMultiByte(CP_UTF8, 0, wstr.data(), wstr_size, NULL, 0, NULL, NULL);
+ }
+
+ if (result_size > 0)
+ {
+ target.resize(result_size);
+ result_size = ::WideCharToMultiByte(CP_UTF8, 0, wstr.data(), wstr_size, target.data(), result_size, NULL, NULL);
+
+ if (result_size > 0)
+ {
+ target.resize(result_size);
+ return;
+ }
+ }
+
+ SPDLOG_THROW(spdlog::spdlog_ex(fmt::format("WideCharToMultiByte failed. Last error: {}", ::GetLastError())));
+}
+#endif // (defined(SPDLOG_WCHAR_TO_UTF8_SUPPORT) || defined(SPDLOG_WCHAR_FILENAMES)) && defined(_WIN32)
+
+// return true on success
+static SPDLOG_INLINE bool mkdir_(const filename_t &path)
+{
+#ifdef _WIN32
+#ifdef SPDLOG_WCHAR_FILENAMES
+ return ::_wmkdir(path.c_str()) == 0;
+#else
+ return ::_mkdir(path.c_str()) == 0;
+#endif
+#else
+ return ::mkdir(path.c_str(), mode_t(0755)) == 0;
+#endif
+}
+
+// create the given directory - and all directories leading to it
+// return true on success or if the directory already exists
+SPDLOG_INLINE bool create_dir(filename_t path)
+{
+ if (path_exists(path))
+ {
+ return true;
+ }
+
+ if (path.empty())
+ {
+ return false;
+ }
+
+#ifdef _WIN32
+ // support forward slash in windows
+ std::replace(path.begin(), path.end(), '/', folder_sep);
+#endif
+
+ size_t search_offset = 0;
+ do
+ {
+ auto token_pos = path.find(folder_sep, search_offset);
+ // treat the entire path as a folder if no folder separator not found
+ if (token_pos == filename_t::npos)
+ {
+ token_pos = path.size();
+ }
+
+ auto subdir = path.substr(0, token_pos);
+
+ if (!subdir.empty() && !path_exists(subdir) && !mkdir_(subdir))
+ {
+ return false; // return error if failed creating dir
+ }
+ search_offset = token_pos + 1;
+ } while (search_offset < path.size());
+
+ return true;
+}
+
+// Return directory name from given path or empty string
+// "abc/file" => "abc"
+// "abc/" => "abc"
+// "abc" => ""
+// "abc///" => "abc//"
+SPDLOG_INLINE filename_t dir_name(filename_t path)
+{
+#ifdef _WIN32
+ // support forward slash in windows
+ std::replace(path.begin(), path.end(), '/', folder_sep);
+#endif
+ auto pos = path.find_last_of(folder_sep);
+ return pos != filename_t::npos ? path.substr(0, pos) : filename_t{};
+}
+
+} // namespace os
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/common.h>
+#include <ctime> // std::time_t
+
+namespace spdlog {
+namespace details {
+namespace os {
+
+spdlog::log_clock::time_point now() SPDLOG_NOEXCEPT;
+
+std::tm localtime(const std::time_t &time_tt) SPDLOG_NOEXCEPT;
+
+std::tm localtime() SPDLOG_NOEXCEPT;
+
+std::tm gmtime(const std::time_t &time_tt) SPDLOG_NOEXCEPT;
+
+std::tm gmtime() SPDLOG_NOEXCEPT;
+
+// eol definition
+#if !defined(SPDLOG_EOL)
+#ifdef _WIN32
+#define SPDLOG_EOL "\r\n"
+#else
+#define SPDLOG_EOL "\n"
+#endif
+#endif
+
+SPDLOG_CONSTEXPR static const char *default_eol = SPDLOG_EOL;
+
+// folder separator
+#ifdef _WIN32
+static const char folder_sep = '\\';
+#else
+SPDLOG_CONSTEXPR static const char folder_sep = '/';
+#endif
+
+#ifdef SPDLOG_PREVENT_CHILD_FD
+void prevent_child_fd(FILE *f);
+#endif
+
+// fopen_s on non windows for writing
+bool fopen_s(FILE **fp, const filename_t &filename, const filename_t &mode);
+
+// Remove filename. return 0 on success
+int remove(const filename_t &filename) SPDLOG_NOEXCEPT;
+
+// Remove file if exists. return 0 on success
+// Note: Non atomic (might return failure to delete if concurrently deleted by other process/thread)
+int remove_if_exists(const filename_t &filename) SPDLOG_NOEXCEPT;
+
+int rename(const filename_t &filename1, const filename_t &filename2) SPDLOG_NOEXCEPT;
+
+// Return if file exists.
+bool path_exists(const filename_t &filename) SPDLOG_NOEXCEPT;
+
+// Return file size according to open FILE* object
+size_t filesize(FILE *f);
+
+// Return utc offset in minutes or throw spdlog_ex on failure
+int utc_minutes_offset(const std::tm &tm = details::os::localtime());
+
+// Return current thread id as size_t
+// It exists because the std::this_thread::get_id() is much slower(especially
+// under VS 2013)
+size_t _thread_id() SPDLOG_NOEXCEPT;
+
+// Return current thread id as size_t (from thread local storage)
+size_t thread_id() SPDLOG_NOEXCEPT;
+
+// This is avoid msvc issue in sleep_for that happens if the clock changes.
+// See https://github.com/gabime/spdlog/issues/609
+void sleep_for_millis(int milliseconds) SPDLOG_NOEXCEPT;
+
+std::string filename_to_str(const filename_t &filename);
+
+int pid() SPDLOG_NOEXCEPT;
+
+// Determine if the terminal supports colors
+// Source: https://github.com/agauniyal/rang/
+bool is_color_terminal() SPDLOG_NOEXCEPT;
+
+// Determine if the terminal attached
+// Source: https://github.com/agauniyal/rang/
+bool in_terminal(FILE *file) SPDLOG_NOEXCEPT;
+
+#if (defined(SPDLOG_WCHAR_TO_UTF8_SUPPORT) || defined(SPDLOG_WCHAR_FILENAMES)) && defined(_WIN32)
+void wstr_to_utf8buf(wstring_view_t wstr, memory_buf_t &target);
+#endif
+
+// Return directory name from given path or empty string
+// "abc/file" => "abc"
+// "abc/" => "abc"
+// "abc" => ""
+// "abc///" => "abc//"
+filename_t dir_name(filename_t path);
+
+// Create a dir from the given path.
+// Return true if succeeded or if this dir already exists.
+bool create_dir(filename_t path);
+
+} // namespace os
+} // namespace details
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "os-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/details/pattern_formatter.h>
+#endif
+
+#include <spdlog/details/fmt_helper.h>
+#include <spdlog/details/log_msg.h>
+#include <spdlog/details/os.h>
+#include <spdlog/fmt/fmt.h>
+#include <spdlog/formatter.h>
+
+#include <array>
+#include <chrono>
+#include <ctime>
+#include <cctype>
+#include <cstring>
+#include <memory>
+#include <mutex>
+#include <string>
+#include <thread>
+#include <utility>
+#include <vector>
+
+namespace spdlog {
+namespace details {
+
+///////////////////////////////////////////////////////////////////////
+// name & level pattern appender
+///////////////////////////////////////////////////////////////////////
+
+class scoped_padder
+{
+public:
+ scoped_padder(size_t wrapped_size, const padding_info &padinfo, memory_buf_t &dest)
+ : padinfo_(padinfo)
+ , dest_(dest)
+ {
+ remaining_pad_ = static_cast<long>(padinfo.width_) - static_cast<long>(wrapped_size);
+ if (remaining_pad_ <= 0)
+ {
+ return;
+ }
+
+ if (padinfo_.side_ == padding_info::left)
+ {
+ pad_it(remaining_pad_);
+ remaining_pad_ = 0;
+ }
+ else if (padinfo_.side_ == padding_info::center)
+ {
+ auto half_pad = remaining_pad_ / 2;
+ auto reminder = remaining_pad_ & 1;
+ pad_it(half_pad);
+ remaining_pad_ = half_pad + reminder; // for the right side
+ }
+ }
+
+ ~scoped_padder()
+ {
+ if (remaining_pad_ >= 0)
+ {
+ pad_it(remaining_pad_);
+ }
+ else if (padinfo_.truncate_)
+ {
+ long new_size = static_cast<long>(dest_.size()) + remaining_pad_;
+ dest_.resize(static_cast<size_t>(new_size));
+ }
+ }
+
+private:
+ void pad_it(long count)
+ {
+ fmt_helper::append_string_view(string_view_t(spaces_.data(), static_cast<size_t>(count)), dest_);
+ }
+
+ const padding_info &padinfo_;
+ memory_buf_t &dest_;
+ long remaining_pad_;
+ string_view_t spaces_{" ", 64};
+};
+
+struct null_scoped_padder
+{
+ null_scoped_padder(size_t /*wrapped_size*/, const padding_info & /*padinfo*/, memory_buf_t & /*dest*/) {}
+};
+
+template<typename ScopedPadder>
+class name_formatter : public flag_formatter
+{
+public:
+ explicit name_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ ScopedPadder p(msg.logger_name.size(), padinfo_, dest);
+ fmt_helper::append_string_view(msg.logger_name, dest);
+ }
+};
+
+// log level appender
+template<typename ScopedPadder>
+class level_formatter : public flag_formatter
+{
+public:
+ explicit level_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ string_view_t &level_name = level::to_string_view(msg.level);
+ ScopedPadder p(level_name.size(), padinfo_, dest);
+ fmt_helper::append_string_view(level_name, dest);
+ }
+};
+
+// short log level appender
+template<typename ScopedPadder>
+class short_level_formatter : public flag_formatter
+{
+public:
+ explicit short_level_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ string_view_t level_name{level::to_short_c_str(msg.level)};
+ ScopedPadder p(level_name.size(), padinfo_, dest);
+ fmt_helper::append_string_view(level_name, dest);
+ }
+};
+
+///////////////////////////////////////////////////////////////////////
+// Date time pattern appenders
+///////////////////////////////////////////////////////////////////////
+
+static const char *ampm(const tm &t)
+{
+ return t.tm_hour >= 12 ? "PM" : "AM";
+}
+
+static int to12h(const tm &t)
+{
+ return t.tm_hour > 12 ? t.tm_hour - 12 : t.tm_hour;
+}
+
+// Abbreviated weekday name
+static std::array<const char *, 7> days{{"Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"}};
+
+template<typename ScopedPadder>
+class a_formatter : public flag_formatter
+{
+public:
+ explicit a_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ string_view_t field_value{days[static_cast<size_t>(tm_time.tm_wday)]};
+ ScopedPadder p(field_value.size(), padinfo_, dest);
+ fmt_helper::append_string_view(field_value, dest);
+ }
+};
+
+// Full weekday name
+static std::array<const char *, 7> full_days{{"Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"}};
+
+template<typename ScopedPadder>
+class A_formatter : public flag_formatter
+{
+public:
+ explicit A_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ string_view_t field_value{full_days[static_cast<size_t>(tm_time.tm_wday)]};
+ ScopedPadder p(field_value.size(), padinfo_, dest);
+ fmt_helper::append_string_view(field_value, dest);
+ }
+};
+
+// Abbreviated month
+static const std::array<const char *, 12> months{{"Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sept", "Oct", "Nov", "Dec"}};
+
+template<typename ScopedPadder>
+class b_formatter : public flag_formatter
+{
+public:
+ explicit b_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ string_view_t field_value{months[static_cast<size_t>(tm_time.tm_mon)]};
+ ScopedPadder p(field_value.size(), padinfo_, dest);
+ fmt_helper::append_string_view(field_value, dest);
+ }
+};
+
+// Full month name
+static const std::array<const char *, 12> full_months{
+ {"January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"}};
+
+template<typename ScopedPadder>
+class B_formatter : public flag_formatter
+{
+public:
+ explicit B_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ string_view_t field_value{full_months[static_cast<size_t>(tm_time.tm_mon)]};
+ ScopedPadder p(field_value.size(), padinfo_, dest);
+ fmt_helper::append_string_view(field_value, dest);
+ }
+};
+
+// Date and time representation (Thu Aug 23 15:35:46 2014)
+template<typename ScopedPadder>
+class c_formatter final : public flag_formatter
+{
+public:
+ explicit c_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 24;
+ ScopedPadder p(field_size, padinfo_, dest);
+
+ fmt_helper::append_string_view(days[static_cast<size_t>(tm_time.tm_wday)], dest);
+ dest.push_back(' ');
+ fmt_helper::append_string_view(months[static_cast<size_t>(tm_time.tm_mon)], dest);
+ dest.push_back(' ');
+ fmt_helper::append_int(tm_time.tm_mday, dest);
+ dest.push_back(' ');
+ // time
+
+ fmt_helper::pad2(tm_time.tm_hour, dest);
+ dest.push_back(':');
+ fmt_helper::pad2(tm_time.tm_min, dest);
+ dest.push_back(':');
+ fmt_helper::pad2(tm_time.tm_sec, dest);
+ dest.push_back(' ');
+ fmt_helper::append_int(tm_time.tm_year + 1900, dest);
+ }
+};
+
+// year - 2 digit
+template<typename ScopedPadder>
+class C_formatter final : public flag_formatter
+{
+public:
+ explicit C_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 2;
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::pad2(tm_time.tm_year % 100, dest);
+ }
+};
+
+// Short MM/DD/YY date, equivalent to %m/%d/%y 08/23/01
+template<typename ScopedPadder>
+class D_formatter final : public flag_formatter
+{
+public:
+ explicit D_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 10;
+ ScopedPadder p(field_size, padinfo_, dest);
+
+ fmt_helper::pad2(tm_time.tm_mon + 1, dest);
+ dest.push_back('/');
+ fmt_helper::pad2(tm_time.tm_mday, dest);
+ dest.push_back('/');
+ fmt_helper::pad2(tm_time.tm_year % 100, dest);
+ }
+};
+
+// year - 4 digit
+template<typename ScopedPadder>
+class Y_formatter final : public flag_formatter
+{
+public:
+ explicit Y_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 4;
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::append_int(tm_time.tm_year + 1900, dest);
+ }
+};
+
+// month 1-12
+template<typename ScopedPadder>
+class m_formatter final : public flag_formatter
+{
+public:
+ explicit m_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 2;
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::pad2(tm_time.tm_mon + 1, dest);
+ }
+};
+
+// day of month 1-31
+template<typename ScopedPadder>
+class d_formatter final : public flag_formatter
+{
+public:
+ explicit d_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 2;
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::pad2(tm_time.tm_mday, dest);
+ }
+};
+
+// hours in 24 format 0-23
+template<typename ScopedPadder>
+class H_formatter final : public flag_formatter
+{
+public:
+ explicit H_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 2;
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::pad2(tm_time.tm_hour, dest);
+ }
+};
+
+// hours in 12 format 1-12
+template<typename ScopedPadder>
+class I_formatter final : public flag_formatter
+{
+public:
+ explicit I_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 2;
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::pad2(to12h(tm_time), dest);
+ }
+};
+
+// minutes 0-59
+template<typename ScopedPadder>
+class M_formatter final : public flag_formatter
+{
+public:
+ explicit M_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 2;
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::pad2(tm_time.tm_min, dest);
+ }
+};
+
+// seconds 0-59
+template<typename ScopedPadder>
+class S_formatter final : public flag_formatter
+{
+public:
+ explicit S_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 2;
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::pad2(tm_time.tm_sec, dest);
+ }
+};
+
+// milliseconds
+template<typename ScopedPadder>
+class e_formatter final : public flag_formatter
+{
+public:
+ explicit e_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ auto millis = fmt_helper::time_fraction<std::chrono::milliseconds>(msg.time);
+ const size_t field_size = 3;
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::pad3(static_cast<uint32_t>(millis.count()), dest);
+ }
+};
+
+// microseconds
+template<typename ScopedPadder>
+class f_formatter final : public flag_formatter
+{
+public:
+ explicit f_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ auto micros = fmt_helper::time_fraction<std::chrono::microseconds>(msg.time);
+
+ const size_t field_size = 6;
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::pad6(static_cast<size_t>(micros.count()), dest);
+ }
+};
+
+// nanoseconds
+template<typename ScopedPadder>
+class F_formatter final : public flag_formatter
+{
+public:
+ explicit F_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ auto ns = fmt_helper::time_fraction<std::chrono::nanoseconds>(msg.time);
+ const size_t field_size = 9;
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::pad9(static_cast<size_t>(ns.count()), dest);
+ }
+};
+
+// seconds since epoch
+template<typename ScopedPadder>
+class E_formatter final : public flag_formatter
+{
+public:
+ explicit E_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ const size_t field_size = 10;
+ ScopedPadder p(field_size, padinfo_, dest);
+ auto duration = msg.time.time_since_epoch();
+ auto seconds = std::chrono::duration_cast<std::chrono::seconds>(duration).count();
+ fmt_helper::append_int(seconds, dest);
+ }
+};
+
+// AM/PM
+template<typename ScopedPadder>
+class p_formatter final : public flag_formatter
+{
+public:
+ explicit p_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 2;
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::append_string_view(ampm(tm_time), dest);
+ }
+};
+
+// 12 hour clock 02:55:02 pm
+template<typename ScopedPadder>
+class r_formatter final : public flag_formatter
+{
+public:
+ explicit r_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 11;
+ ScopedPadder p(field_size, padinfo_, dest);
+
+ fmt_helper::pad2(to12h(tm_time), dest);
+ dest.push_back(':');
+ fmt_helper::pad2(tm_time.tm_min, dest);
+ dest.push_back(':');
+ fmt_helper::pad2(tm_time.tm_sec, dest);
+ dest.push_back(' ');
+ fmt_helper::append_string_view(ampm(tm_time), dest);
+ }
+};
+
+// 24-hour HH:MM time, equivalent to %H:%M
+template<typename ScopedPadder>
+class R_formatter final : public flag_formatter
+{
+public:
+ explicit R_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 5;
+ ScopedPadder p(field_size, padinfo_, dest);
+
+ fmt_helper::pad2(tm_time.tm_hour, dest);
+ dest.push_back(':');
+ fmt_helper::pad2(tm_time.tm_min, dest);
+ }
+};
+
+// ISO 8601 time format (HH:MM:SS), equivalent to %H:%M:%S
+template<typename ScopedPadder>
+class T_formatter final : public flag_formatter
+{
+public:
+ explicit T_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 8;
+ ScopedPadder p(field_size, padinfo_, dest);
+
+ fmt_helper::pad2(tm_time.tm_hour, dest);
+ dest.push_back(':');
+ fmt_helper::pad2(tm_time.tm_min, dest);
+ dest.push_back(':');
+ fmt_helper::pad2(tm_time.tm_sec, dest);
+ }
+};
+
+// ISO 8601 offset from UTC in timezone (+-HH:MM)
+template<typename ScopedPadder>
+class z_formatter final : public flag_formatter
+{
+public:
+ explicit z_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ z_formatter() = default;
+ z_formatter(const z_formatter &) = delete;
+ z_formatter &operator=(const z_formatter &) = delete;
+
+ void format(const details::log_msg &msg, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ const size_t field_size = 6;
+ ScopedPadder p(field_size, padinfo_, dest);
+
+ auto total_minutes = get_cached_offset(msg, tm_time);
+ bool is_negative = total_minutes < 0;
+ if (is_negative)
+ {
+ total_minutes = -total_minutes;
+ dest.push_back('-');
+ }
+ else
+ {
+ dest.push_back('+');
+ }
+
+ fmt_helper::pad2(total_minutes / 60, dest); // hours
+ dest.push_back(':');
+ fmt_helper::pad2(total_minutes % 60, dest); // minutes
+ }
+
+private:
+ log_clock::time_point last_update_{std::chrono::seconds(0)};
+ int offset_minutes_{0};
+
+ int get_cached_offset(const log_msg &msg, const std::tm &tm_time)
+ {
+ // refresh every 10 seconds
+ if (msg.time - last_update_ >= std::chrono::seconds(10))
+ {
+ offset_minutes_ = os::utc_minutes_offset(tm_time);
+ last_update_ = msg.time;
+ }
+ return offset_minutes_;
+ }
+};
+
+// Thread id
+template<typename ScopedPadder>
+class t_formatter final : public flag_formatter
+{
+public:
+ explicit t_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ const auto field_size = fmt_helper::count_digits(msg.thread_id);
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::append_int(msg.thread_id, dest);
+ }
+};
+
+// Current pid
+template<typename ScopedPadder>
+class pid_formatter final : public flag_formatter
+{
+public:
+ explicit pid_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &, const std::tm &, memory_buf_t &dest) override
+ {
+ const auto pid = static_cast<uint32_t>(details::os::pid());
+ auto field_size = fmt_helper::count_digits(pid);
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::append_int(pid, dest);
+ }
+};
+
+template<typename ScopedPadder>
+class v_formatter final : public flag_formatter
+{
+public:
+ explicit v_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ ScopedPadder p(msg.payload.size(), padinfo_, dest);
+ fmt_helper::append_string_view(msg.payload, dest);
+ }
+};
+
+class ch_formatter final : public flag_formatter
+{
+public:
+ explicit ch_formatter(char ch)
+ : ch_(ch)
+ {}
+
+ void format(const details::log_msg &, const std::tm &, memory_buf_t &dest) override
+ {
+ dest.push_back(ch_);
+ }
+
+private:
+ char ch_;
+};
+
+// aggregate user chars to display as is
+class aggregate_formatter final : public flag_formatter
+{
+public:
+ aggregate_formatter() = default;
+
+ void add_ch(char ch)
+ {
+ str_ += ch;
+ }
+ void format(const details::log_msg &, const std::tm &, memory_buf_t &dest) override
+ {
+ fmt_helper::append_string_view(str_, dest);
+ }
+
+private:
+ std::string str_;
+};
+
+// mark the color range. expect it to be in the form of "%^colored text%$"
+class color_start_formatter final : public flag_formatter
+{
+public:
+ explicit color_start_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ msg.color_range_start = dest.size();
+ }
+};
+
+class color_stop_formatter final : public flag_formatter
+{
+public:
+ explicit color_stop_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ msg.color_range_end = dest.size();
+ }
+};
+
+// print source location
+template<typename ScopedPadder>
+class source_location_formatter final : public flag_formatter
+{
+public:
+ explicit source_location_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ if (msg.source.empty())
+ {
+ return;
+ }
+
+ size_t text_size =
+ padinfo_.enabled() ? std::char_traits<char>::length(msg.source.filename) + fmt_helper::count_digits(msg.source.line) + 1 : 0;
+
+ ScopedPadder p(text_size, padinfo_, dest);
+ fmt_helper::append_string_view(msg.source.filename, dest);
+ dest.push_back(':');
+ fmt_helper::append_int(msg.source.line, dest);
+ }
+};
+
+// print source filename
+template<typename ScopedPadder>
+class source_filename_formatter final : public flag_formatter
+{
+public:
+ explicit source_filename_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ if (msg.source.empty())
+ {
+ return;
+ }
+ size_t text_size = padinfo_.enabled() ? std::char_traits<char>::length(msg.source.filename) : 0;
+ ScopedPadder p(text_size, padinfo_, dest);
+ fmt_helper::append_string_view(msg.source.filename, dest);
+ }
+};
+
+template<typename ScopedPadder>
+class short_filename_formatter final : public flag_formatter
+{
+public:
+ explicit short_filename_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ static const char *basename(const char *filename)
+ {
+ const char *rv = std::strrchr(filename, os::folder_sep);
+ return rv != nullptr ? rv + 1 : filename;
+ }
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ if (msg.source.empty())
+ {
+ return;
+ }
+ auto filename = basename(msg.source.filename);
+ size_t text_size = padinfo_.enabled() ? std::char_traits<char>::length(filename) : 0;
+ ScopedPadder p(text_size, padinfo_, dest);
+ fmt_helper::append_string_view(filename, dest);
+ }
+};
+
+template<typename ScopedPadder>
+class source_linenum_formatter final : public flag_formatter
+{
+public:
+ explicit source_linenum_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ if (msg.source.empty())
+ {
+ return;
+ }
+
+ auto field_size = fmt_helper::count_digits(msg.source.line);
+ ScopedPadder p(field_size, padinfo_, dest);
+ fmt_helper::append_int(msg.source.line, dest);
+ }
+};
+
+// print source funcname
+template<typename ScopedPadder>
+class source_funcname_formatter final : public flag_formatter
+{
+public:
+ explicit source_funcname_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ if (msg.source.empty())
+ {
+ return;
+ }
+ size_t text_size = padinfo_.enabled() ? std::char_traits<char>::length(msg.source.funcname) : 0;
+ ScopedPadder p(text_size, padinfo_, dest);
+ fmt_helper::append_string_view(msg.source.funcname, dest);
+ }
+};
+
+// print elapsed time since last message
+template<typename ScopedPadder, typename Units>
+
+class elapsed_formatter final : public flag_formatter
+{
+public:
+ using DurationUnits = Units;
+
+ explicit elapsed_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ , last_message_time_(log_clock::now())
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &, memory_buf_t &dest) override
+ {
+ auto delta = (std::max)(msg.time - last_message_time_, log_clock::duration::zero());
+ auto delta_units = std::chrono::duration_cast<DurationUnits>(delta);
+ last_message_time_ = msg.time;
+ auto delta_count = static_cast<size_t>(delta_units.count());
+ auto n_digits = static_cast<size_t>(fmt_helper::count_digits(delta_count));
+ ScopedPadder p(n_digits, padinfo_, dest);
+ fmt_helper::append_int(delta_count, dest);
+ }
+
+private:
+ log_clock::time_point last_message_time_;
+};
+
+// Full info formatter
+// pattern: [%Y-%m-%d %H:%M:%S.%e] [%n] [%l] %v
+class full_formatter final : public flag_formatter
+{
+public:
+ explicit full_formatter(padding_info padinfo)
+ : flag_formatter(padinfo)
+ {}
+
+ void format(const details::log_msg &msg, const std::tm &tm_time, memory_buf_t &dest) override
+ {
+ using std::chrono::duration_cast;
+ using std::chrono::milliseconds;
+ using std::chrono::seconds;
+
+ // cache the date/time part for the next second.
+ auto duration = msg.time.time_since_epoch();
+ auto secs = duration_cast<seconds>(duration);
+
+ if (cache_timestamp_ != secs || cached_datetime_.size() == 0)
+ {
+ cached_datetime_.clear();
+ cached_datetime_.push_back('[');
+ fmt_helper::append_int(tm_time.tm_year + 1900, cached_datetime_);
+ cached_datetime_.push_back('-');
+
+ fmt_helper::pad2(tm_time.tm_mon + 1, cached_datetime_);
+ cached_datetime_.push_back('-');
+
+ fmt_helper::pad2(tm_time.tm_mday, cached_datetime_);
+ cached_datetime_.push_back(' ');
+
+ fmt_helper::pad2(tm_time.tm_hour, cached_datetime_);
+ cached_datetime_.push_back(':');
+
+ fmt_helper::pad2(tm_time.tm_min, cached_datetime_);
+ cached_datetime_.push_back(':');
+
+ fmt_helper::pad2(tm_time.tm_sec, cached_datetime_);
+ cached_datetime_.push_back('.');
+
+ cache_timestamp_ = secs;
+ }
+ dest.append(cached_datetime_.begin(), cached_datetime_.end());
+
+ auto millis = fmt_helper::time_fraction<milliseconds>(msg.time);
+ fmt_helper::pad3(static_cast<uint32_t>(millis.count()), dest);
+ dest.push_back(']');
+ dest.push_back(' ');
+
+#ifndef SPDLOG_NO_NAME
+ if (msg.logger_name.size() > 0)
+ {
+ dest.push_back('[');
+ // fmt_helper::append_str(*msg.logger_name, dest);
+ fmt_helper::append_string_view(msg.logger_name, dest);
+ dest.push_back(']');
+ dest.push_back(' ');
+ }
+#endif
+ dest.push_back('[');
+ // wrap the level name with color
+ msg.color_range_start = dest.size();
+ // fmt_helper::append_string_view(level::to_c_str(msg.level), dest);
+ fmt_helper::append_string_view(level::to_string_view(msg.level), dest);
+ msg.color_range_end = dest.size();
+ dest.push_back(']');
+ dest.push_back(' ');
+
+ // add source location if present
+ if (!msg.source.empty())
+ {
+ dest.push_back('[');
+ const char *filename = details::short_filename_formatter<details::null_scoped_padder>::basename(msg.source.filename);
+ fmt_helper::append_string_view(filename, dest);
+ dest.push_back(':');
+ fmt_helper::append_int(msg.source.line, dest);
+ dest.push_back(']');
+ dest.push_back(' ');
+ }
+ // fmt_helper::append_string_view(msg.msg(), dest);
+ fmt_helper::append_string_view(msg.payload, dest);
+ }
+
+private:
+ std::chrono::seconds cache_timestamp_{0};
+ memory_buf_t cached_datetime_;
+};
+
+} // namespace details
+
+SPDLOG_INLINE pattern_formatter::pattern_formatter(std::string pattern, pattern_time_type time_type, std::string eol)
+ : pattern_(std::move(pattern))
+ , eol_(std::move(eol))
+ , pattern_time_type_(time_type)
+ , last_log_secs_(0)
+{
+ std::memset(&cached_tm_, 0, sizeof(cached_tm_));
+ compile_pattern_(pattern_);
+}
+
+// use by default full formatter for if pattern is not given
+SPDLOG_INLINE pattern_formatter::pattern_formatter(pattern_time_type time_type, std::string eol)
+ : pattern_("%+")
+ , eol_(std::move(eol))
+ , pattern_time_type_(time_type)
+ , last_log_secs_(0)
+{
+ std::memset(&cached_tm_, 0, sizeof(cached_tm_));
+ formatters_.push_back(details::make_unique<details::full_formatter>(details::padding_info{}));
+}
+
+SPDLOG_INLINE std::unique_ptr<formatter> pattern_formatter::clone() const
+{
+ return details::make_unique<pattern_formatter>(pattern_, pattern_time_type_, eol_);
+}
+
+SPDLOG_INLINE void pattern_formatter::format(const details::log_msg &msg, memory_buf_t &dest)
+{
+ auto secs = std::chrono::duration_cast<std::chrono::seconds>(msg.time.time_since_epoch());
+ if (secs != last_log_secs_)
+ {
+ cached_tm_ = get_time_(msg);
+ last_log_secs_ = secs;
+ }
+
+ for (auto &f : formatters_)
+ {
+ f->format(msg, cached_tm_, dest);
+ }
+ // write eol
+ details::fmt_helper::append_string_view(eol_, dest);
+}
+
+SPDLOG_INLINE std::tm pattern_formatter::get_time_(const details::log_msg &msg)
+{
+ if (pattern_time_type_ == pattern_time_type::local)
+ {
+ return details::os::localtime(log_clock::to_time_t(msg.time));
+ }
+ return details::os::gmtime(log_clock::to_time_t(msg.time));
+}
+
+template<typename Padder>
+SPDLOG_INLINE void pattern_formatter::handle_flag_(char flag, details::padding_info padding)
+{
+ switch (flag)
+ {
+
+ case ('+'): // default formatter
+ formatters_.push_back(details::make_unique<details::full_formatter>(padding));
+ break;
+
+ case 'n': // logger name
+ formatters_.push_back(details::make_unique<details::name_formatter<Padder>>(padding));
+ break;
+
+ case 'l': // level
+ formatters_.push_back(details::make_unique<details::level_formatter<Padder>>(padding));
+ break;
+
+ case 'L': // short level
+ formatters_.push_back(details::make_unique<details::short_level_formatter<Padder>>(padding));
+ break;
+
+ case ('t'): // thread id
+ formatters_.push_back(details::make_unique<details::t_formatter<Padder>>(padding));
+ break;
+
+ case ('v'): // the message text
+ formatters_.push_back(details::make_unique<details::v_formatter<Padder>>(padding));
+ break;
+
+ case ('a'): // weekday
+ formatters_.push_back(details::make_unique<details::a_formatter<Padder>>(padding));
+ break;
+
+ case ('A'): // short weekday
+ formatters_.push_back(details::make_unique<details::A_formatter<Padder>>(padding));
+ break;
+
+ case ('b'):
+ case ('h'): // month
+ formatters_.push_back(details::make_unique<details::b_formatter<Padder>>(padding));
+ break;
+
+ case ('B'): // short month
+ formatters_.push_back(details::make_unique<details::B_formatter<Padder>>(padding));
+ break;
+
+ case ('c'): // datetime
+ formatters_.push_back(details::make_unique<details::c_formatter<Padder>>(padding));
+ break;
+
+ case ('C'): // year 2 digits
+ formatters_.push_back(details::make_unique<details::C_formatter<Padder>>(padding));
+ break;
+
+ case ('Y'): // year 4 digits
+ formatters_.push_back(details::make_unique<details::Y_formatter<Padder>>(padding));
+ break;
+
+ case ('D'):
+ case ('x'): // datetime MM/DD/YY
+ formatters_.push_back(details::make_unique<details::D_formatter<Padder>>(padding));
+ break;
+
+ case ('m'): // month 1-12
+ formatters_.push_back(details::make_unique<details::m_formatter<Padder>>(padding));
+ break;
+
+ case ('d'): // day of month 1-31
+ formatters_.push_back(details::make_unique<details::d_formatter<Padder>>(padding));
+ break;
+
+ case ('H'): // hours 24
+ formatters_.push_back(details::make_unique<details::H_formatter<Padder>>(padding));
+ break;
+
+ case ('I'): // hours 12
+ formatters_.push_back(details::make_unique<details::I_formatter<Padder>>(padding));
+ break;
+
+ case ('M'): // minutes
+ formatters_.push_back(details::make_unique<details::M_formatter<Padder>>(padding));
+ break;
+
+ case ('S'): // seconds
+ formatters_.push_back(details::make_unique<details::S_formatter<Padder>>(padding));
+ break;
+
+ case ('e'): // milliseconds
+ formatters_.push_back(details::make_unique<details::e_formatter<Padder>>(padding));
+ break;
+
+ case ('f'): // microseconds
+ formatters_.push_back(details::make_unique<details::f_formatter<Padder>>(padding));
+ break;
+
+ case ('F'): // nanoseconds
+ formatters_.push_back(details::make_unique<details::F_formatter<Padder>>(padding));
+ break;
+
+ case ('E'): // seconds since epoch
+ formatters_.push_back(details::make_unique<details::E_formatter<Padder>>(padding));
+ break;
+
+ case ('p'): // am/pm
+ formatters_.push_back(details::make_unique<details::p_formatter<Padder>>(padding));
+ break;
+
+ case ('r'): // 12 hour clock 02:55:02 pm
+ formatters_.push_back(details::make_unique<details::r_formatter<Padder>>(padding));
+ break;
+
+ case ('R'): // 24-hour HH:MM time
+ formatters_.push_back(details::make_unique<details::R_formatter<Padder>>(padding));
+ break;
+
+ case ('T'):
+ case ('X'): // ISO 8601 time format (HH:MM:SS)
+ formatters_.push_back(details::make_unique<details::T_formatter<Padder>>(padding));
+ break;
+
+ case ('z'): // timezone
+ formatters_.push_back(details::make_unique<details::z_formatter<Padder>>(padding));
+ break;
+
+ case ('P'): // pid
+ formatters_.push_back(details::make_unique<details::pid_formatter<Padder>>(padding));
+ break;
+
+ case ('^'): // color range start
+ formatters_.push_back(details::make_unique<details::color_start_formatter>(padding));
+ break;
+
+ case ('$'): // color range end
+ formatters_.push_back(details::make_unique<details::color_stop_formatter>(padding));
+ break;
+
+ case ('@'): // source location (filename:filenumber)
+ formatters_.push_back(details::make_unique<details::source_location_formatter<Padder>>(padding));
+ break;
+
+ case ('s'): // short source filename - without directory name
+ formatters_.push_back(details::make_unique<details::short_filename_formatter<Padder>>(padding));
+ break;
+
+ case ('g'): // full source filename
+ formatters_.push_back(details::make_unique<details::source_filename_formatter<Padder>>(padding));
+ break;
+
+ case ('#'): // source line number
+ formatters_.push_back(details::make_unique<details::source_linenum_formatter<Padder>>(padding));
+ break;
+
+ case ('!'): // source funcname
+ formatters_.push_back(details::make_unique<details::source_funcname_formatter<Padder>>(padding));
+ break;
+
+ case ('%'): // % char
+ formatters_.push_back(details::make_unique<details::ch_formatter>('%'));
+ break;
+
+ case ('u'): // elapsed time since last log message in nanos
+ formatters_.push_back(details::make_unique<details::elapsed_formatter<Padder, std::chrono::nanoseconds>>(padding));
+ break;
+
+ case ('i'): // elapsed time since last log message in micros
+ formatters_.push_back(details::make_unique<details::elapsed_formatter<Padder, std::chrono::microseconds>>(padding));
+ break;
+
+ case ('o'): // elapsed time since last log message in millis
+ formatters_.push_back(details::make_unique<details::elapsed_formatter<Padder, std::chrono::milliseconds>>(padding));
+ break;
+
+ case ('O'): // elapsed time since last log message in seconds
+ formatters_.push_back(details::make_unique<details::elapsed_formatter<Padder, std::chrono::seconds>>(padding));
+ break;
+
+ default: // Unknown flag appears as is
+ auto unknown_flag = details::make_unique<details::aggregate_formatter>();
+ unknown_flag->add_ch('%');
+ unknown_flag->add_ch(flag);
+ formatters_.push_back((std::move(unknown_flag)));
+ break;
+ }
+}
+
+// Extract given pad spec (e.g. %8X, %=8X, %-8!X, %8!X, %=8!X, %-8!X, %+8!X)
+// Advance the given it pass the end of the padding spec found (if any)
+// Return padding.
+SPDLOG_INLINE details::padding_info pattern_formatter::handle_padspec_(std::string::const_iterator &it, std::string::const_iterator end)
+{
+ using details::padding_info;
+ using details::scoped_padder;
+ const size_t max_width = 64;
+ if (it == end)
+ {
+ return padding_info{};
+ }
+
+ padding_info::pad_side side;
+ switch (*it)
+ {
+ case '-':
+ side = padding_info::right;
+ ++it;
+ break;
+ case '=':
+ side = padding_info::center;
+ ++it;
+ break;
+ default:
+ side = details::padding_info::left;
+ break;
+ }
+
+ if (it == end || !std::isdigit(static_cast<unsigned char>(*it)))
+ {
+ return padding_info{}; // no padding if no digit found here
+ }
+
+ auto width = static_cast<size_t>(*it) - '0';
+ for (++it; it != end && std::isdigit(static_cast<unsigned char>(*it)); ++it)
+ {
+ auto digit = static_cast<size_t>(*it) - '0';
+ width = width * 10 + digit;
+ }
+
+ // search for the optional truncate marker '!'
+ bool truncate;
+ if (it != end && *it == '!')
+ {
+ truncate = true;
+ ++it;
+ }
+ else
+ {
+ truncate = false;
+ }
+
+ return details::padding_info{std::min<size_t>(width, max_width), side, truncate};
+}
+
+SPDLOG_INLINE void pattern_formatter::compile_pattern_(const std::string &pattern)
+{
+ auto end = pattern.end();
+ std::unique_ptr<details::aggregate_formatter> user_chars;
+ formatters_.clear();
+ for (auto it = pattern.begin(); it != end; ++it)
+ {
+ if (*it == '%')
+ {
+ if (user_chars) // append user chars found so far
+ {
+ formatters_.push_back(std::move(user_chars));
+ }
+
+ auto padding = handle_padspec_(++it, end);
+
+ if (it != end)
+ {
+ if (padding.enabled())
+ {
+ handle_flag_<details::scoped_padder>(*it, padding);
+ }
+ else
+ {
+ handle_flag_<details::null_scoped_padder>(*it, padding);
+ }
+ }
+ else
+ {
+ break;
+ }
+ }
+ else // chars not following the % sign should be displayed as is
+ {
+ if (!user_chars)
+ {
+ user_chars = details::make_unique<details::aggregate_formatter>();
+ }
+ user_chars->add_ch(*it);
+ }
+ }
+ if (user_chars) // append raw chars found so far
+ {
+ formatters_.push_back(std::move(user_chars));
+ }
+}
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/common.h>
+#include <spdlog/details/log_msg.h>
+#include <spdlog/details/os.h>
+#include <spdlog/formatter.h>
+
+#include <chrono>
+#include <ctime>
+#include <memory>
+
+#include <string>
+#include <vector>
+
+namespace spdlog {
+namespace details {
+
+// padding information.
+struct padding_info
+{
+ enum pad_side
+ {
+ left,
+ right,
+ center
+ };
+
+ padding_info() = default;
+ padding_info(size_t width, padding_info::pad_side side, bool truncate)
+ : width_(width)
+ , side_(side)
+ , truncate_(truncate)
+ , enabled_(true)
+ {}
+
+ bool enabled() const
+ {
+ return enabled_;
+ }
+ const size_t width_ = 0;
+ const pad_side side_ = left;
+ bool truncate_ = false;
+ bool enabled_ = false;
+};
+
+class flag_formatter
+{
+public:
+ explicit flag_formatter(padding_info padinfo)
+ : padinfo_(padinfo)
+ {}
+ flag_formatter() = default;
+ virtual ~flag_formatter() = default;
+ virtual void format(const details::log_msg &msg, const std::tm &tm_time, memory_buf_t &dest) = 0;
+
+protected:
+ padding_info padinfo_;
+};
+
+} // namespace details
+
+class pattern_formatter final : public formatter
+{
+public:
+ explicit pattern_formatter(
+ std::string pattern, pattern_time_type time_type = pattern_time_type::local, std::string eol = spdlog::details::os::default_eol);
+
+ // use default pattern is not given
+ explicit pattern_formatter(pattern_time_type time_type = pattern_time_type::local, std::string eol = spdlog::details::os::default_eol);
+
+ pattern_formatter(const pattern_formatter &other) = delete;
+ pattern_formatter &operator=(const pattern_formatter &other) = delete;
+
+ std::unique_ptr<formatter> clone() const override;
+ void format(const details::log_msg &msg, memory_buf_t &dest) override;
+
+private:
+ std::string pattern_;
+ std::string eol_;
+ pattern_time_type pattern_time_type_;
+ std::tm cached_tm_;
+ std::chrono::seconds last_log_secs_;
+ std::vector<std::unique_ptr<details::flag_formatter>> formatters_;
+
+ std::tm get_time_(const details::log_msg &msg);
+ template<typename Padder>
+ void handle_flag_(char flag, details::padding_info padding);
+
+ // Extract given pad spec (e.g. %8X)
+ // Advance the given it pass the end of the padding spec found (if any)
+ // Return padding.
+ details::padding_info handle_padspec_(std::string::const_iterator &it, std::string::const_iterator end);
+
+ void compile_pattern_(const std::string &pattern);
+};
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "pattern_formatter-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/details/periodic_worker.h>
+#endif
+
+namespace spdlog {
+namespace details {
+
+SPDLOG_INLINE periodic_worker::periodic_worker(const std::function<void()> &callback_fun, std::chrono::seconds interval)
+{
+ active_ = (interval > std::chrono::seconds::zero());
+ if (!active_)
+ {
+ return;
+ }
+
+ worker_thread_ = std::thread([this, callback_fun, interval]() {
+ for (;;)
+ {
+ std::unique_lock<std::mutex> lock(this->mutex_);
+ if (this->cv_.wait_for(lock, interval, [this] { return !this->active_; }))
+ {
+ return; // active_ == false, so exit this thread
+ }
+ callback_fun();
+ }
+ });
+}
+
+// stop the worker thread and join it
+SPDLOG_INLINE periodic_worker::~periodic_worker()
+{
+ if (worker_thread_.joinable())
+ {
+ {
+ std::lock_guard<std::mutex> lock(mutex_);
+ active_ = false;
+ }
+ cv_.notify_one();
+ worker_thread_.join();
+ }
+}
+
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+// periodic worker thread - periodically executes the given callback function.
+//
+// RAII over the owned thread:
+// creates the thread on construction.
+// stops and joins the thread on destruction (if the thread is executing a callback, wait for it to finish first).
+
+#include <chrono>
+#include <condition_variable>
+#include <functional>
+#include <mutex>
+#include <thread>
+namespace spdlog {
+namespace details {
+
+class periodic_worker
+{
+public:
+ periodic_worker(const std::function<void()> &callback_fun, std::chrono::seconds interval);
+ periodic_worker(const periodic_worker &) = delete;
+ periodic_worker &operator=(const periodic_worker &) = delete;
+ // stop the worker thread and join it
+ ~periodic_worker();
+
+private:
+ bool active_;
+ std::thread worker_thread_;
+ std::mutex mutex_;
+ std::condition_variable cv_;
+};
+} // namespace details
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "periodic_worker-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/details/registry.h>
+#endif
+
+#include <spdlog/common.h>
+#include <spdlog/details/periodic_worker.h>
+#include <spdlog/logger.h>
+#include <spdlog/details/pattern_formatter.h>
+
+#ifndef SPDLOG_DISABLE_DEFAULT_LOGGER
+// support for the default stdout color logger
+#ifdef _WIN32
+#include <spdlog/sinks/wincolor_sink.h>
+#else
+#include <spdlog/sinks/ansicolor_sink.h>
+#endif
+#endif // SPDLOG_DISABLE_DEFAULT_LOGGER
+
+#include <chrono>
+#include <functional>
+#include <memory>
+#include <string>
+#include <unordered_map>
+
+namespace spdlog {
+namespace details {
+
+SPDLOG_INLINE registry::registry()
+ : formatter_(new pattern_formatter())
+{
+
+#ifndef SPDLOG_DISABLE_DEFAULT_LOGGER
+ // create default logger (ansicolor_stdout_sink_mt or wincolor_stdout_sink_mt in windows).
+#ifdef _WIN32
+ auto color_sink = std::make_shared<sinks::wincolor_stdout_sink_mt>();
+#else
+ auto color_sink = std::make_shared<sinks::ansicolor_stdout_sink_mt>();
+#endif
+
+ const char *default_logger_name = "";
+ default_logger_ = std::make_shared<spdlog::logger>(default_logger_name, std::move(color_sink));
+ loggers_[default_logger_name] = default_logger_;
+
+#endif // SPDLOG_DISABLE_DEFAULT_LOGGER
+}
+SPDLOG_INLINE void registry::register_logger(std::shared_ptr<logger> new_logger)
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ register_logger_(std::move(new_logger));
+}
+
+SPDLOG_INLINE void registry::initialize_logger(std::shared_ptr<logger> new_logger)
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ new_logger->set_formatter(formatter_->clone());
+
+ if (err_handler_)
+ {
+ new_logger->set_error_handler(err_handler_);
+ }
+
+ new_logger->set_level(level_);
+ new_logger->flush_on(flush_level_);
+
+ if (backtrace_n_messages_ > 0)
+ {
+ new_logger->enable_backtrace(backtrace_n_messages_);
+ }
+
+ if (automatic_registration_)
+ {
+ register_logger_(std::move(new_logger));
+ }
+}
+
+SPDLOG_INLINE std::shared_ptr<logger> registry::get(const std::string &logger_name)
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ auto found = loggers_.find(logger_name);
+ return found == loggers_.end() ? nullptr : found->second;
+}
+
+SPDLOG_INLINE std::shared_ptr<logger> registry::default_logger()
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ return default_logger_;
+}
+
+// Return raw ptr to the default logger.
+// To be used directly by the spdlog default api (e.g. spdlog::info)
+// This make the default API faster, but cannot be used concurrently with set_default_logger().
+// e.g do not call set_default_logger() from one thread while calling spdlog::info() from another.
+SPDLOG_INLINE logger *registry::get_default_raw()
+{
+ return default_logger_.get();
+}
+
+// set default logger.
+// default logger is stored in default_logger_ (for faster retrieval) and in the loggers_ map.
+SPDLOG_INLINE void registry::set_default_logger(std::shared_ptr<logger> new_default_logger)
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ // remove previous default logger from the map
+ if (default_logger_ != nullptr)
+ {
+ loggers_.erase(default_logger_->name());
+ }
+ if (new_default_logger != nullptr)
+ {
+ loggers_[new_default_logger->name()] = new_default_logger;
+ }
+ default_logger_ = std::move(new_default_logger);
+}
+
+SPDLOG_INLINE void registry::set_tp(std::shared_ptr<thread_pool> tp)
+{
+ std::lock_guard<std::recursive_mutex> lock(tp_mutex_);
+ tp_ = std::move(tp);
+}
+
+SPDLOG_INLINE std::shared_ptr<thread_pool> registry::get_tp()
+{
+ std::lock_guard<std::recursive_mutex> lock(tp_mutex_);
+ return tp_;
+}
+
+// Set global formatter. Each sink in each logger will get a clone of this object
+SPDLOG_INLINE void registry::set_formatter(std::unique_ptr<formatter> formatter)
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ formatter_ = std::move(formatter);
+ for (auto &l : loggers_)
+ {
+ l.second->set_formatter(formatter_->clone());
+ }
+}
+
+SPDLOG_INLINE void registry::enable_backtrace(size_t n_messages)
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ backtrace_n_messages_ = n_messages;
+
+ for (auto &l : loggers_)
+ {
+ l.second->enable_backtrace(n_messages);
+ }
+}
+
+SPDLOG_INLINE void registry::disable_backtrace()
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ backtrace_n_messages_ = 0;
+ for (auto &l : loggers_)
+ {
+ l.second->disable_backtrace();
+ }
+}
+
+SPDLOG_INLINE void registry::set_level(level::level_enum log_level)
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ for (auto &l : loggers_)
+ {
+ l.second->set_level(log_level);
+ }
+ level_ = log_level;
+}
+
+SPDLOG_INLINE void registry::flush_on(level::level_enum log_level)
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ for (auto &l : loggers_)
+ {
+ l.second->flush_on(log_level);
+ }
+ flush_level_ = log_level;
+}
+
+SPDLOG_INLINE void registry::flush_every(std::chrono::seconds interval)
+{
+ std::lock_guard<std::mutex> lock(flusher_mutex_);
+ std::function<void()> clbk = std::bind(®istry::flush_all, this);
+ periodic_flusher_ = details::make_unique<periodic_worker>(clbk, interval);
+}
+
+SPDLOG_INLINE void registry::set_error_handler(void (*handler)(const std::string &msg))
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ for (auto &l : loggers_)
+ {
+ l.second->set_error_handler(handler);
+ }
+ err_handler_ = handler;
+}
+
+SPDLOG_INLINE void registry::apply_all(const std::function<void(const std::shared_ptr<logger>)> &fun)
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ for (auto &l : loggers_)
+ {
+ fun(l.second);
+ }
+}
+
+SPDLOG_INLINE void registry::flush_all()
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ for (auto &l : loggers_)
+ {
+ l.second->flush();
+ }
+}
+
+SPDLOG_INLINE void registry::drop(const std::string &logger_name)
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ loggers_.erase(logger_name);
+ if (default_logger_ && default_logger_->name() == logger_name)
+ {
+ default_logger_.reset();
+ }
+}
+
+SPDLOG_INLINE void registry::drop_all()
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ loggers_.clear();
+ default_logger_.reset();
+}
+
+// clean all resources and threads started by the registry
+SPDLOG_INLINE void registry::shutdown()
+{
+ {
+ std::lock_guard<std::mutex> lock(flusher_mutex_);
+ periodic_flusher_.reset();
+ }
+
+ drop_all();
+
+ {
+ std::lock_guard<std::recursive_mutex> lock(tp_mutex_);
+ tp_.reset();
+ }
+}
+
+SPDLOG_INLINE std::recursive_mutex ®istry::tp_mutex()
+{
+ return tp_mutex_;
+}
+
+SPDLOG_INLINE void registry::set_automatic_registration(bool automatic_registration)
+{
+ std::lock_guard<std::mutex> lock(logger_map_mutex_);
+ automatic_registration_ = automatic_registration;
+}
+
+SPDLOG_INLINE registry ®istry::instance()
+{
+ static registry s_instance;
+ return s_instance;
+}
+
+SPDLOG_INLINE void registry::throw_if_exists_(const std::string &logger_name)
+{
+ if (loggers_.find(logger_name) != loggers_.end())
+ {
+ SPDLOG_THROW(spdlog_ex("logger with name '" + logger_name + "' already exists"));
+ }
+}
+
+SPDLOG_INLINE void registry::register_logger_(std::shared_ptr<logger> new_logger)
+{
+ auto logger_name = new_logger->name();
+ throw_if_exists_(logger_name);
+ loggers_[logger_name] = std::move(new_logger);
+}
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+// Loggers registry of unique name->logger pointer
+// An attempt to create a logger with an already existing name will result with spdlog_ex exception.
+// If user requests a non existing logger, nullptr will be returned
+// This class is thread safe
+
+#include <spdlog/common.h>
+
+#include <chrono>
+#include <functional>
+#include <memory>
+#include <string>
+#include <unordered_map>
+#include <mutex>
+
+namespace spdlog {
+class logger;
+
+namespace details {
+class thread_pool;
+class periodic_worker;
+
+class registry
+{
+public:
+ registry(const registry &) = delete;
+ registry &operator=(const registry &) = delete;
+
+ void register_logger(std::shared_ptr<logger> new_logger);
+ void initialize_logger(std::shared_ptr<logger> new_logger);
+ std::shared_ptr<logger> get(const std::string &logger_name);
+ std::shared_ptr<logger> default_logger();
+
+ // Return raw ptr to the default logger.
+ // To be used directly by the spdlog default api (e.g. spdlog::info)
+ // This make the default API faster, but cannot be used concurrently with set_default_logger().
+ // e.g do not call set_default_logger() from one thread while calling spdlog::info() from another.
+ logger *get_default_raw();
+
+ // set default logger.
+ // default logger is stored in default_logger_ (for faster retrieval) and in the loggers_ map.
+ void set_default_logger(std::shared_ptr<logger> new_default_logger);
+
+ void set_tp(std::shared_ptr<thread_pool> tp);
+
+ std::shared_ptr<thread_pool> get_tp();
+
+ // Set global formatter. Each sink in each logger will get a clone of this object
+ void set_formatter(std::unique_ptr<formatter> formatter);
+
+ void enable_backtrace(size_t n_messages);
+
+ void disable_backtrace();
+
+ void set_level(level::level_enum log_level);
+
+ void flush_on(level::level_enum log_level);
+
+ void flush_every(std::chrono::seconds interval);
+
+ void set_error_handler(void (*handler)(const std::string &msg));
+
+ void apply_all(const std::function<void(const std::shared_ptr<logger>)> &fun);
+
+ void flush_all();
+
+ void drop(const std::string &logger_name);
+
+ void drop_all();
+
+ // clean all resources and threads started by the registry
+ void shutdown();
+
+ std::recursive_mutex &tp_mutex();
+
+ void set_automatic_registration(bool automatic_registration);
+
+ static registry &instance();
+
+private:
+ registry();
+ ~registry() = default;
+
+ void throw_if_exists_(const std::string &logger_name);
+ void register_logger_(std::shared_ptr<logger> new_logger);
+ std::mutex logger_map_mutex_, flusher_mutex_;
+ std::recursive_mutex tp_mutex_;
+ std::unordered_map<std::string, std::shared_ptr<logger>> loggers_;
+ std::unique_ptr<formatter> formatter_;
+ level::level_enum level_ = level::info;
+ level::level_enum flush_level_ = level::off;
+ void (*err_handler_)(const std::string &msg);
+ std::shared_ptr<thread_pool> tp_;
+ std::unique_ptr<periodic_worker> periodic_flusher_;
+ std::shared_ptr<logger> default_logger_;
+ bool automatic_registration_ = true;
+ size_t backtrace_n_messages_ = 0;
+};
+
+} // namespace details
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "registry-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include "registry.h"
+
+namespace spdlog {
+
+// Default logger factory- creates synchronous loggers
+class logger;
+
+struct synchronous_factory
+{
+ template<typename Sink, typename... SinkArgs>
+ static std::shared_ptr<spdlog::logger> create(std::string logger_name, SinkArgs &&... args)
+ {
+ auto sink = std::make_shared<Sink>(std::forward<SinkArgs>(args)...);
+ auto new_logger = std::make_shared<spdlog::logger>(std::move(logger_name), std::move(sink));
+ details::registry::instance().initialize_logger(new_logger);
+ return new_logger;
+ }
+};
+} // namespace spdlog
\ No newline at end of file
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/details/thread_pool.h>
+#endif
+
+#include <spdlog/common.h>
+#include <cassert>
+
+namespace spdlog {
+namespace details {
+
+SPDLOG_INLINE thread_pool::thread_pool(size_t q_max_items, size_t threads_n, std::function<void()> on_thread_start)
+ : q_(q_max_items)
+{
+ if (threads_n == 0 || threads_n > 1000)
+ {
+ SPDLOG_THROW(spdlog_ex("spdlog::thread_pool(): invalid threads_n param (valid "
+ "range is 1-1000)"));
+ }
+ for (size_t i = 0; i < threads_n; i++)
+ {
+ threads_.emplace_back([this, on_thread_start] {
+ on_thread_start();
+ this->thread_pool::worker_loop_();
+ });
+ }
+}
+
+SPDLOG_INLINE thread_pool::thread_pool(size_t q_max_items, size_t threads_n)
+ : thread_pool(q_max_items, threads_n, [] {})
+{}
+
+// message all threads to terminate gracefully join them
+SPDLOG_INLINE thread_pool::~thread_pool()
+{
+ SPDLOG_TRY
+ {
+ for (size_t i = 0; i < threads_.size(); i++)
+ {
+ post_async_msg_(async_msg(async_msg_type::terminate), async_overflow_policy::block);
+ }
+
+ for (auto &t : threads_)
+ {
+ t.join();
+ }
+ }
+ SPDLOG_CATCH_ALL() {}
+}
+
+void SPDLOG_INLINE thread_pool::post_log(async_logger_ptr &&worker_ptr, const details::log_msg &msg, async_overflow_policy overflow_policy)
+{
+ async_msg async_m(std::move(worker_ptr), async_msg_type::log, msg);
+ post_async_msg_(std::move(async_m), overflow_policy);
+}
+
+void SPDLOG_INLINE thread_pool::post_flush(async_logger_ptr &&worker_ptr, async_overflow_policy overflow_policy)
+{
+ post_async_msg_(async_msg(std::move(worker_ptr), async_msg_type::flush), overflow_policy);
+}
+
+size_t SPDLOG_INLINE thread_pool::overrun_counter()
+{
+ return q_.overrun_counter();
+}
+
+void SPDLOG_INLINE thread_pool::post_async_msg_(async_msg &&new_msg, async_overflow_policy overflow_policy)
+{
+ if (overflow_policy == async_overflow_policy::block)
+ {
+ q_.enqueue(std::move(new_msg));
+ }
+ else
+ {
+ q_.enqueue_nowait(std::move(new_msg));
+ }
+}
+
+void SPDLOG_INLINE thread_pool::worker_loop_()
+{
+ while (process_next_msg_()) {}
+}
+
+// process next message in the queue
+// return true if this thread should still be active (while no terminate msg
+// was received)
+bool SPDLOG_INLINE thread_pool::process_next_msg_()
+{
+ async_msg incoming_async_msg;
+ bool dequeued = q_.dequeue_for(incoming_async_msg, std::chrono::seconds(10));
+ if (!dequeued)
+ {
+ return true;
+ }
+
+ switch (incoming_async_msg.msg_type)
+ {
+ case async_msg_type::log: {
+ incoming_async_msg.worker_ptr->backend_sink_it_(incoming_async_msg);
+ return true;
+ }
+ case async_msg_type::flush: {
+ incoming_async_msg.worker_ptr->backend_flush_();
+ return true;
+ }
+
+ case async_msg_type::terminate: {
+ return false;
+ }
+
+ default: {
+ assert(false && "Unexpected async_msg_type");
+ }
+ }
+
+ return true;
+}
+
+} // namespace details
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/details/log_msg_buffer.h>
+#include <spdlog/details/mpmc_blocking_q.h>
+#include <spdlog/details/os.h>
+
+#include <chrono>
+#include <memory>
+#include <thread>
+#include <vector>
+#include <functional>
+
+namespace spdlog {
+class async_logger;
+
+namespace details {
+
+using async_logger_ptr = std::shared_ptr<spdlog::async_logger>;
+
+enum class async_msg_type
+{
+ log,
+ flush,
+ terminate
+};
+
+#include <spdlog/details/log_msg_buffer.h>
+// Async msg to move to/from the queue
+// Movable only. should never be copied
+struct async_msg : log_msg_buffer
+{
+ async_msg_type msg_type{async_msg_type::log};
+ async_logger_ptr worker_ptr;
+
+ async_msg() = default;
+ ~async_msg() = default;
+
+ // should only be moved in or out of the queue..
+ async_msg(const async_msg &) = delete;
+
+// support for vs2013 move
+#if defined(_MSC_VER) && _MSC_VER <= 1800
+ async_msg(async_msg &&other)
+ : log_msg_buffer(std::move(other))
+ , msg_type(other.msg_type)
+ , worker_ptr(std::move(other.worker_ptr))
+ {}
+
+ async_msg &operator=(async_msg &&other)
+ {
+ *static_cast<log_msg_buffer *>(this) = std::move(other);
+ msg_type = other.msg_type;
+ worker_ptr = std::move(other.worker_ptr);
+ return *this;
+ }
+#else // (_MSC_VER) && _MSC_VER <= 1800
+ async_msg(async_msg &&) = default;
+ async_msg &operator=(async_msg &&) = default;
+#endif
+
+ // construct from log_msg with given type
+ async_msg(async_logger_ptr &&worker, async_msg_type the_type, const details::log_msg &m)
+ : log_msg_buffer{m}
+ , msg_type{the_type}
+ , worker_ptr{std::move(worker)}
+ {}
+
+ async_msg(async_logger_ptr &&worker, async_msg_type the_type)
+ : log_msg_buffer{}
+ , msg_type{the_type}
+ , worker_ptr{std::move(worker)}
+ {}
+
+ explicit async_msg(async_msg_type the_type)
+ : async_msg{nullptr, the_type}
+ {}
+};
+
+class thread_pool
+{
+public:
+ using item_type = async_msg;
+ using q_type = details::mpmc_blocking_queue<item_type>;
+
+ thread_pool(size_t q_max_items, size_t threads_n, std::function<void()> on_thread_start);
+ thread_pool(size_t q_max_items, size_t threads_n);
+
+ // message all threads to terminate gracefully join them
+ ~thread_pool();
+
+ thread_pool(const thread_pool &) = delete;
+ thread_pool &operator=(thread_pool &&) = delete;
+
+ void post_log(async_logger_ptr &&worker_ptr, const details::log_msg &msg, async_overflow_policy overflow_policy);
+ void post_flush(async_logger_ptr &&worker_ptr, async_overflow_policy overflow_policy);
+ size_t overrun_counter();
+
+private:
+ q_type q_;
+
+ std::vector<std::thread> threads_;
+
+ void post_async_msg_(async_msg &&new_msg, async_overflow_policy overflow_policy);
+ void worker_loop_();
+
+ // process next message in the queue
+ // return true if this thread should still be active (while no terminate msg
+ // was received)
+ bool process_next_msg_();
+};
+
+} // namespace details
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "thread_pool-inl.h"
+#endif
--- /dev/null
+//
+// Copyright(c) 2015 Gabi Melman.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+//
+
+#pragma once
+
+//
+// Support for logging binary data as hex
+// format flags:
+// {:X} - print in uppercase.
+// {:s} - don't separate each byte with space.
+// {:p} - don't print the position on each line start.
+// {:n} - don't split the output to lines.
+
+//
+// Examples:
+//
+// std::vector<char> v(200, 0x0b);
+// logger->info("Some buffer {}", spdlog::to_hex(v));
+// char buf[128];
+// logger->info("Some buffer {:X}", spdlog::to_hex(std::begin(buf), std::end(buf)));
+
+namespace spdlog {
+namespace details {
+
+template<typename It>
+class bytes_range
+{
+public:
+ bytes_range(It range_begin, It range_end)
+ : begin_(range_begin)
+ , end_(range_end)
+ {}
+
+ It begin() const
+ {
+ return begin_;
+ }
+ It end() const
+ {
+ return end_;
+ }
+
+private:
+ It begin_, end_;
+};
+} // namespace details
+
+// create a bytes_range that wraps the given container
+template<typename Container>
+inline details::bytes_range<typename Container::const_iterator> to_hex(const Container &container)
+{
+ static_assert(sizeof(typename Container::value_type) == 1, "sizeof(Container::value_type) != 1");
+ using Iter = typename Container::const_iterator;
+ return details::bytes_range<Iter>(std::begin(container), std::end(container));
+}
+
+// create bytes_range from ranges
+template<typename It>
+inline details::bytes_range<It> to_hex(const It range_begin, const It range_end)
+{
+ return details::bytes_range<It>(range_begin, range_end);
+}
+
+} // namespace spdlog
+
+namespace fmt {
+
+template<typename T>
+struct formatter<spdlog::details::bytes_range<T>>
+{
+ const std::size_t line_size = 100;
+ const char delimiter = ' ';
+
+ bool put_newlines = true;
+ bool put_delimiters = true;
+ bool use_uppercase = false;
+ bool put_positions = true; // position on start of each line
+
+ // parse the format string flags
+ template<typename ParseContext>
+ auto parse(ParseContext &ctx) -> decltype(ctx.begin())
+ {
+ auto it = ctx.begin();
+ while (*it && *it != '}')
+ {
+ switch (*it)
+ {
+ case 'X':
+ use_uppercase = true;
+ break;
+ case 's':
+ put_delimiters = false;
+ break;
+ case 'p':
+ put_positions = false;
+ break;
+ case 'n':
+ put_newlines = false;
+ break;
+ }
+
+ ++it;
+ }
+ return it;
+ }
+
+ // format the given bytes range as hex
+ template<typename FormatContext, typename Container>
+ auto format(const spdlog::details::bytes_range<Container> &the_range, FormatContext &ctx) -> decltype(ctx.out())
+ {
+ SPDLOG_CONSTEXPR const char *hex_upper = "0123456789ABCDEF";
+ SPDLOG_CONSTEXPR const char *hex_lower = "0123456789abcdef";
+ const char *hex_chars = use_uppercase ? hex_upper : hex_lower;
+
+ std::size_t pos = 0;
+ std::size_t column = line_size;
+#if FMT_VERSION < 60000
+ auto inserter = ctx.begin();
+#else
+ auto inserter = ctx.out();
+#endif
+
+ for (auto &item : the_range)
+ {
+ auto ch = static_cast<unsigned char>(item);
+ pos++;
+
+ if (put_newlines && column >= line_size)
+ {
+ column = put_newline(inserter, pos);
+
+ // put first byte without delimiter in front of it
+ *inserter++ = hex_chars[(ch >> 4) & 0x0f];
+ *inserter++ = hex_chars[ch & 0x0f];
+ column += 2;
+ continue;
+ }
+
+ if (put_delimiters)
+ {
+ *inserter++ = delimiter;
+ ++column;
+ }
+
+ *inserter++ = hex_chars[(ch >> 4) & 0x0f];
+ *inserter++ = hex_chars[ch & 0x0f];
+ column += 2;
+ }
+ return inserter;
+ }
+
+ // put newline(and position header)
+ // return the next column
+ template<typename It>
+ std::size_t put_newline(It inserter, std::size_t pos)
+ {
+#ifdef _WIN32
+ *inserter++ = '\r';
+#endif
+ *inserter++ = '\n';
+
+ if (put_positions)
+ {
+ fmt::format_to(inserter, "{:<04X}: ", pos - 1);
+ return 7;
+ }
+ else
+ {
+ return 1;
+ }
+ }
+};
+} // namespace fmt
--- /dev/null
+Copyright (c) 2012 - present, Victor Zverovich
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+--- Optional exception to the license ---
+
+As an exception, if, as a result of your compiling your source code, portions
+of this Software are embedded into a machine-executable object form of such
+source code, you may redistribute such embedded portions in such object form
+without including the above copyright and permission notices.
--- /dev/null
+// Formatting library for C++ - chrono support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_CHRONO_H_
+#define FMT_CHRONO_H_
+
+#include "format.h"
+#include "locale.h"
+
+#include <chrono>
+#include <ctime>
+#include <locale>
+#include <sstream>
+
+FMT_BEGIN_NAMESPACE
+
+// Enable safe chrono durations, unless explicitly disabled.
+#ifndef FMT_SAFE_DURATION_CAST
+# define FMT_SAFE_DURATION_CAST 1
+#endif
+#if FMT_SAFE_DURATION_CAST
+
+// For conversion between std::chrono::durations without undefined
+// behaviour or erroneous results.
+// This is a stripped down version of duration_cast, for inclusion in fmt.
+// See https://github.com/pauldreik/safe_duration_cast
+//
+// Copyright Paul Dreik 2019
+namespace safe_duration_cast {
+
+template <typename To, typename From,
+ FMT_ENABLE_IF(!std::is_same<From, To>::value &&
+ std::numeric_limits<From>::is_signed ==
+ std::numeric_limits<To>::is_signed)>
+FMT_CONSTEXPR To lossless_integral_conversion(const From from, int& ec) {
+ ec = 0;
+ using F = std::numeric_limits<From>;
+ using T = std::numeric_limits<To>;
+ static_assert(F::is_integer, "From must be integral");
+ static_assert(T::is_integer, "To must be integral");
+
+ // A and B are both signed, or both unsigned.
+ if (F::digits <= T::digits) {
+ // From fits in To without any problem.
+ } else {
+ // From does not always fit in To, resort to a dynamic check.
+ if (from < T::min() || from > T::max()) {
+ // outside range.
+ ec = 1;
+ return {};
+ }
+ }
+ return static_cast<To>(from);
+}
+
+/**
+ * converts From to To, without loss. If the dynamic value of from
+ * can't be converted to To without loss, ec is set.
+ */
+template <typename To, typename From,
+ FMT_ENABLE_IF(!std::is_same<From, To>::value &&
+ std::numeric_limits<From>::is_signed !=
+ std::numeric_limits<To>::is_signed)>
+FMT_CONSTEXPR To lossless_integral_conversion(const From from, int& ec) {
+ ec = 0;
+ using F = std::numeric_limits<From>;
+ using T = std::numeric_limits<To>;
+ static_assert(F::is_integer, "From must be integral");
+ static_assert(T::is_integer, "To must be integral");
+
+ if (F::is_signed && !T::is_signed) {
+ // From may be negative, not allowed!
+ if (fmt::internal::is_negative(from)) {
+ ec = 1;
+ return {};
+ }
+
+ // From is positive. Can it always fit in To?
+ if (F::digits <= T::digits) {
+ // yes, From always fits in To.
+ } else {
+ // from may not fit in To, we have to do a dynamic check
+ if (from > static_cast<From>(T::max())) {
+ ec = 1;
+ return {};
+ }
+ }
+ }
+
+ if (!F::is_signed && T::is_signed) {
+ // can from be held in To?
+ if (F::digits < T::digits) {
+ // yes, From always fits in To.
+ } else {
+ // from may not fit in To, we have to do a dynamic check
+ if (from > static_cast<From>(T::max())) {
+ // outside range.
+ ec = 1;
+ return {};
+ }
+ }
+ }
+
+ // reaching here means all is ok for lossless conversion.
+ return static_cast<To>(from);
+
+} // function
+
+template <typename To, typename From,
+ FMT_ENABLE_IF(std::is_same<From, To>::value)>
+FMT_CONSTEXPR To lossless_integral_conversion(const From from, int& ec) {
+ ec = 0;
+ return from;
+} // function
+
+// clang-format off
+/**
+ * converts From to To if possible, otherwise ec is set.
+ *
+ * input | output
+ * ---------------------------------|---------------
+ * NaN | NaN
+ * Inf | Inf
+ * normal, fits in output | converted (possibly lossy)
+ * normal, does not fit in output | ec is set
+ * subnormal | best effort
+ * -Inf | -Inf
+ */
+// clang-format on
+template <typename To, typename From,
+ FMT_ENABLE_IF(!std::is_same<From, To>::value)>
+FMT_CONSTEXPR To safe_float_conversion(const From from, int& ec) {
+ ec = 0;
+ using T = std::numeric_limits<To>;
+ static_assert(std::is_floating_point<From>::value, "From must be floating");
+ static_assert(std::is_floating_point<To>::value, "To must be floating");
+
+ // catch the only happy case
+ if (std::isfinite(from)) {
+ if (from >= T::lowest() && from <= T::max()) {
+ return static_cast<To>(from);
+ }
+ // not within range.
+ ec = 1;
+ return {};
+ }
+
+ // nan and inf will be preserved
+ return static_cast<To>(from);
+} // function
+
+template <typename To, typename From,
+ FMT_ENABLE_IF(std::is_same<From, To>::value)>
+FMT_CONSTEXPR To safe_float_conversion(const From from, int& ec) {
+ ec = 0;
+ static_assert(std::is_floating_point<From>::value, "From must be floating");
+ return from;
+}
+
+/**
+ * safe duration cast between integral durations
+ */
+template <typename To, typename FromRep, typename FromPeriod,
+ FMT_ENABLE_IF(std::is_integral<FromRep>::value),
+ FMT_ENABLE_IF(std::is_integral<typename To::rep>::value)>
+To safe_duration_cast(std::chrono::duration<FromRep, FromPeriod> from,
+ int& ec) {
+ using From = std::chrono::duration<FromRep, FromPeriod>;
+ ec = 0;
+ // the basic idea is that we need to convert from count() in the from type
+ // to count() in the To type, by multiplying it with this:
+ struct Factor
+ : std::ratio_divide<typename From::period, typename To::period> {};
+
+ static_assert(Factor::num > 0, "num must be positive");
+ static_assert(Factor::den > 0, "den must be positive");
+
+ // the conversion is like this: multiply from.count() with Factor::num
+ // /Factor::den and convert it to To::rep, all this without
+ // overflow/underflow. let's start by finding a suitable type that can hold
+ // both To, From and Factor::num
+ using IntermediateRep =
+ typename std::common_type<typename From::rep, typename To::rep,
+ decltype(Factor::num)>::type;
+
+ // safe conversion to IntermediateRep
+ IntermediateRep count =
+ lossless_integral_conversion<IntermediateRep>(from.count(), ec);
+ if (ec) {
+ return {};
+ }
+ // multiply with Factor::num without overflow or underflow
+ if (Factor::num != 1) {
+ const auto max1 = internal::max_value<IntermediateRep>() / Factor::num;
+ if (count > max1) {
+ ec = 1;
+ return {};
+ }
+ const auto min1 = std::numeric_limits<IntermediateRep>::min() / Factor::num;
+ if (count < min1) {
+ ec = 1;
+ return {};
+ }
+ count *= Factor::num;
+ }
+
+ // this can't go wrong, right? den>0 is checked earlier.
+ if (Factor::den != 1) {
+ count /= Factor::den;
+ }
+ // convert to the to type, safely
+ using ToRep = typename To::rep;
+ const ToRep tocount = lossless_integral_conversion<ToRep>(count, ec);
+ if (ec) {
+ return {};
+ }
+ return To{tocount};
+}
+
+/**
+ * safe duration_cast between floating point durations
+ */
+template <typename To, typename FromRep, typename FromPeriod,
+ FMT_ENABLE_IF(std::is_floating_point<FromRep>::value),
+ FMT_ENABLE_IF(std::is_floating_point<typename To::rep>::value)>
+To safe_duration_cast(std::chrono::duration<FromRep, FromPeriod> from,
+ int& ec) {
+ using From = std::chrono::duration<FromRep, FromPeriod>;
+ ec = 0;
+ if (std::isnan(from.count())) {
+ // nan in, gives nan out. easy.
+ return To{std::numeric_limits<typename To::rep>::quiet_NaN()};
+ }
+ // maybe we should also check if from is denormal, and decide what to do about
+ // it.
+
+ // +-inf should be preserved.
+ if (std::isinf(from.count())) {
+ return To{from.count()};
+ }
+
+ // the basic idea is that we need to convert from count() in the from type
+ // to count() in the To type, by multiplying it with this:
+ struct Factor
+ : std::ratio_divide<typename From::period, typename To::period> {};
+
+ static_assert(Factor::num > 0, "num must be positive");
+ static_assert(Factor::den > 0, "den must be positive");
+
+ // the conversion is like this: multiply from.count() with Factor::num
+ // /Factor::den and convert it to To::rep, all this without
+ // overflow/underflow. let's start by finding a suitable type that can hold
+ // both To, From and Factor::num
+ using IntermediateRep =
+ typename std::common_type<typename From::rep, typename To::rep,
+ decltype(Factor::num)>::type;
+
+ // force conversion of From::rep -> IntermediateRep to be safe,
+ // even if it will never happen be narrowing in this context.
+ IntermediateRep count =
+ safe_float_conversion<IntermediateRep>(from.count(), ec);
+ if (ec) {
+ return {};
+ }
+
+ // multiply with Factor::num without overflow or underflow
+ if (Factor::num != 1) {
+ constexpr auto max1 = internal::max_value<IntermediateRep>() /
+ static_cast<IntermediateRep>(Factor::num);
+ if (count > max1) {
+ ec = 1;
+ return {};
+ }
+ constexpr auto min1 = std::numeric_limits<IntermediateRep>::lowest() /
+ static_cast<IntermediateRep>(Factor::num);
+ if (count < min1) {
+ ec = 1;
+ return {};
+ }
+ count *= static_cast<IntermediateRep>(Factor::num);
+ }
+
+ // this can't go wrong, right? den>0 is checked earlier.
+ if (Factor::den != 1) {
+ using common_t = typename std::common_type<IntermediateRep, intmax_t>::type;
+ count /= static_cast<common_t>(Factor::den);
+ }
+
+ // convert to the to type, safely
+ using ToRep = typename To::rep;
+
+ const ToRep tocount = safe_float_conversion<ToRep>(count, ec);
+ if (ec) {
+ return {};
+ }
+ return To{tocount};
+}
+} // namespace safe_duration_cast
+#endif
+
+// Prevents expansion of a preceding token as a function-style macro.
+// Usage: f FMT_NOMACRO()
+#define FMT_NOMACRO
+
+namespace internal {
+inline null<> localtime_r FMT_NOMACRO(...) { return null<>(); }
+inline null<> localtime_s(...) { return null<>(); }
+inline null<> gmtime_r(...) { return null<>(); }
+inline null<> gmtime_s(...) { return null<>(); }
+} // namespace internal
+
+// Thread-safe replacement for std::localtime
+inline std::tm localtime(std::time_t time) {
+ struct dispatcher {
+ std::time_t time_;
+ std::tm tm_;
+
+ dispatcher(std::time_t t) : time_(t) {}
+
+ bool run() {
+ using namespace fmt::internal;
+ return handle(localtime_r(&time_, &tm_));
+ }
+
+ bool handle(std::tm* tm) { return tm != nullptr; }
+
+ bool handle(internal::null<>) {
+ using namespace fmt::internal;
+ return fallback(localtime_s(&tm_, &time_));
+ }
+
+ bool fallback(int res) { return res == 0; }
+
+#if !FMT_MSC_VER
+ bool fallback(internal::null<>) {
+ using namespace fmt::internal;
+ std::tm* tm = std::localtime(&time_);
+ if (tm) tm_ = *tm;
+ return tm != nullptr;
+ }
+#endif
+ };
+ dispatcher lt(time);
+ // Too big time values may be unsupported.
+ if (!lt.run()) FMT_THROW(format_error("time_t value out of range"));
+ return lt.tm_;
+}
+
+// Thread-safe replacement for std::gmtime
+inline std::tm gmtime(std::time_t time) {
+ struct dispatcher {
+ std::time_t time_;
+ std::tm tm_;
+
+ dispatcher(std::time_t t) : time_(t) {}
+
+ bool run() {
+ using namespace fmt::internal;
+ return handle(gmtime_r(&time_, &tm_));
+ }
+
+ bool handle(std::tm* tm) { return tm != nullptr; }
+
+ bool handle(internal::null<>) {
+ using namespace fmt::internal;
+ return fallback(gmtime_s(&tm_, &time_));
+ }
+
+ bool fallback(int res) { return res == 0; }
+
+#if !FMT_MSC_VER
+ bool fallback(internal::null<>) {
+ std::tm* tm = std::gmtime(&time_);
+ if (tm) tm_ = *tm;
+ return tm != nullptr;
+ }
+#endif
+ };
+ dispatcher gt(time);
+ // Too big time values may be unsupported.
+ if (!gt.run()) FMT_THROW(format_error("time_t value out of range"));
+ return gt.tm_;
+}
+
+namespace internal {
+inline std::size_t strftime(char* str, std::size_t count, const char* format,
+ const std::tm* time) {
+ return std::strftime(str, count, format, time);
+}
+
+inline std::size_t strftime(wchar_t* str, std::size_t count,
+ const wchar_t* format, const std::tm* time) {
+ return std::wcsftime(str, count, format, time);
+}
+} // namespace internal
+
+template <typename Char> struct formatter<std::tm, Char> {
+ template <typename ParseContext>
+ auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+ auto it = ctx.begin();
+ if (it != ctx.end() && *it == ':') ++it;
+ auto end = it;
+ while (end != ctx.end() && *end != '}') ++end;
+ tm_format.reserve(internal::to_unsigned(end - it + 1));
+ tm_format.append(it, end);
+ tm_format.push_back('\0');
+ return end;
+ }
+
+ template <typename FormatContext>
+ auto format(const std::tm& tm, FormatContext& ctx) -> decltype(ctx.out()) {
+ basic_memory_buffer<Char> buf;
+ std::size_t start = buf.size();
+ for (;;) {
+ std::size_t size = buf.capacity() - start;
+ std::size_t count =
+ internal::strftime(&buf[start], size, &tm_format[0], &tm);
+ if (count != 0) {
+ buf.resize(start + count);
+ break;
+ }
+ if (size >= tm_format.size() * 256) {
+ // If the buffer is 256 times larger than the format string, assume
+ // that `strftime` gives an empty result. There doesn't seem to be a
+ // better way to distinguish the two cases:
+ // https://github.com/fmtlib/fmt/issues/367
+ break;
+ }
+ const std::size_t MIN_GROWTH = 10;
+ buf.reserve(buf.capacity() + (size > MIN_GROWTH ? size : MIN_GROWTH));
+ }
+ return std::copy(buf.begin(), buf.end(), ctx.out());
+ }
+
+ basic_memory_buffer<Char> tm_format;
+};
+
+namespace internal {
+template <typename Period> FMT_CONSTEXPR const char* get_units() {
+ return nullptr;
+}
+template <> FMT_CONSTEXPR const char* get_units<std::atto>() { return "as"; }
+template <> FMT_CONSTEXPR const char* get_units<std::femto>() { return "fs"; }
+template <> FMT_CONSTEXPR const char* get_units<std::pico>() { return "ps"; }
+template <> FMT_CONSTEXPR const char* get_units<std::nano>() { return "ns"; }
+template <> FMT_CONSTEXPR const char* get_units<std::micro>() { return "µs"; }
+template <> FMT_CONSTEXPR const char* get_units<std::milli>() { return "ms"; }
+template <> FMT_CONSTEXPR const char* get_units<std::centi>() { return "cs"; }
+template <> FMT_CONSTEXPR const char* get_units<std::deci>() { return "ds"; }
+template <> FMT_CONSTEXPR const char* get_units<std::ratio<1>>() { return "s"; }
+template <> FMT_CONSTEXPR const char* get_units<std::deca>() { return "das"; }
+template <> FMT_CONSTEXPR const char* get_units<std::hecto>() { return "hs"; }
+template <> FMT_CONSTEXPR const char* get_units<std::kilo>() { return "ks"; }
+template <> FMT_CONSTEXPR const char* get_units<std::mega>() { return "Ms"; }
+template <> FMT_CONSTEXPR const char* get_units<std::giga>() { return "Gs"; }
+template <> FMT_CONSTEXPR const char* get_units<std::tera>() { return "Ts"; }
+template <> FMT_CONSTEXPR const char* get_units<std::peta>() { return "Ps"; }
+template <> FMT_CONSTEXPR const char* get_units<std::exa>() { return "Es"; }
+template <> FMT_CONSTEXPR const char* get_units<std::ratio<60>>() {
+ return "m";
+}
+template <> FMT_CONSTEXPR const char* get_units<std::ratio<3600>>() {
+ return "h";
+}
+
+enum class numeric_system {
+ standard,
+ // Alternative numeric system, e.g. 十二 instead of 12 in ja_JP locale.
+ alternative
+};
+
+// Parses a put_time-like format string and invokes handler actions.
+template <typename Char, typename Handler>
+FMT_CONSTEXPR const Char* parse_chrono_format(const Char* begin,
+ const Char* end,
+ Handler&& handler) {
+ auto ptr = begin;
+ while (ptr != end) {
+ auto c = *ptr;
+ if (c == '}') break;
+ if (c != '%') {
+ ++ptr;
+ continue;
+ }
+ if (begin != ptr) handler.on_text(begin, ptr);
+ ++ptr; // consume '%'
+ if (ptr == end) FMT_THROW(format_error("invalid format"));
+ c = *ptr++;
+ switch (c) {
+ case '%':
+ handler.on_text(ptr - 1, ptr);
+ break;
+ case 'n': {
+ const char newline[] = "\n";
+ handler.on_text(newline, newline + 1);
+ break;
+ }
+ case 't': {
+ const char tab[] = "\t";
+ handler.on_text(tab, tab + 1);
+ break;
+ }
+ // Day of the week:
+ case 'a':
+ handler.on_abbr_weekday();
+ break;
+ case 'A':
+ handler.on_full_weekday();
+ break;
+ case 'w':
+ handler.on_dec0_weekday(numeric_system::standard);
+ break;
+ case 'u':
+ handler.on_dec1_weekday(numeric_system::standard);
+ break;
+ // Month:
+ case 'b':
+ handler.on_abbr_month();
+ break;
+ case 'B':
+ handler.on_full_month();
+ break;
+ // Hour, minute, second:
+ case 'H':
+ handler.on_24_hour(numeric_system::standard);
+ break;
+ case 'I':
+ handler.on_12_hour(numeric_system::standard);
+ break;
+ case 'M':
+ handler.on_minute(numeric_system::standard);
+ break;
+ case 'S':
+ handler.on_second(numeric_system::standard);
+ break;
+ // Other:
+ case 'c':
+ handler.on_datetime(numeric_system::standard);
+ break;
+ case 'x':
+ handler.on_loc_date(numeric_system::standard);
+ break;
+ case 'X':
+ handler.on_loc_time(numeric_system::standard);
+ break;
+ case 'D':
+ handler.on_us_date();
+ break;
+ case 'F':
+ handler.on_iso_date();
+ break;
+ case 'r':
+ handler.on_12_hour_time();
+ break;
+ case 'R':
+ handler.on_24_hour_time();
+ break;
+ case 'T':
+ handler.on_iso_time();
+ break;
+ case 'p':
+ handler.on_am_pm();
+ break;
+ case 'Q':
+ handler.on_duration_value();
+ break;
+ case 'q':
+ handler.on_duration_unit();
+ break;
+ case 'z':
+ handler.on_utc_offset();
+ break;
+ case 'Z':
+ handler.on_tz_name();
+ break;
+ // Alternative representation:
+ case 'E': {
+ if (ptr == end) FMT_THROW(format_error("invalid format"));
+ c = *ptr++;
+ switch (c) {
+ case 'c':
+ handler.on_datetime(numeric_system::alternative);
+ break;
+ case 'x':
+ handler.on_loc_date(numeric_system::alternative);
+ break;
+ case 'X':
+ handler.on_loc_time(numeric_system::alternative);
+ break;
+ default:
+ FMT_THROW(format_error("invalid format"));
+ }
+ break;
+ }
+ case 'O':
+ if (ptr == end) FMT_THROW(format_error("invalid format"));
+ c = *ptr++;
+ switch (c) {
+ case 'w':
+ handler.on_dec0_weekday(numeric_system::alternative);
+ break;
+ case 'u':
+ handler.on_dec1_weekday(numeric_system::alternative);
+ break;
+ case 'H':
+ handler.on_24_hour(numeric_system::alternative);
+ break;
+ case 'I':
+ handler.on_12_hour(numeric_system::alternative);
+ break;
+ case 'M':
+ handler.on_minute(numeric_system::alternative);
+ break;
+ case 'S':
+ handler.on_second(numeric_system::alternative);
+ break;
+ default:
+ FMT_THROW(format_error("invalid format"));
+ }
+ break;
+ default:
+ FMT_THROW(format_error("invalid format"));
+ }
+ begin = ptr;
+ }
+ if (begin != ptr) handler.on_text(begin, ptr);
+ return ptr;
+}
+
+struct chrono_format_checker {
+ FMT_NORETURN void report_no_date() { FMT_THROW(format_error("no date")); }
+
+ template <typename Char> void on_text(const Char*, const Char*) {}
+ FMT_NORETURN void on_abbr_weekday() { report_no_date(); }
+ FMT_NORETURN void on_full_weekday() { report_no_date(); }
+ FMT_NORETURN void on_dec0_weekday(numeric_system) { report_no_date(); }
+ FMT_NORETURN void on_dec1_weekday(numeric_system) { report_no_date(); }
+ FMT_NORETURN void on_abbr_month() { report_no_date(); }
+ FMT_NORETURN void on_full_month() { report_no_date(); }
+ void on_24_hour(numeric_system) {}
+ void on_12_hour(numeric_system) {}
+ void on_minute(numeric_system) {}
+ void on_second(numeric_system) {}
+ FMT_NORETURN void on_datetime(numeric_system) { report_no_date(); }
+ FMT_NORETURN void on_loc_date(numeric_system) { report_no_date(); }
+ FMT_NORETURN void on_loc_time(numeric_system) { report_no_date(); }
+ FMT_NORETURN void on_us_date() { report_no_date(); }
+ FMT_NORETURN void on_iso_date() { report_no_date(); }
+ void on_12_hour_time() {}
+ void on_24_hour_time() {}
+ void on_iso_time() {}
+ void on_am_pm() {}
+ void on_duration_value() {}
+ void on_duration_unit() {}
+ FMT_NORETURN void on_utc_offset() { report_no_date(); }
+ FMT_NORETURN void on_tz_name() { report_no_date(); }
+};
+
+template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+inline bool isnan(T) {
+ return false;
+}
+template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
+inline bool isnan(T value) {
+ return std::isnan(value);
+}
+
+template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+inline bool isfinite(T) {
+ return true;
+}
+template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
+inline bool isfinite(T value) {
+ return std::isfinite(value);
+}
+
+// Converts value to int and checks that it's in the range [0, upper).
+template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+inline int to_nonnegative_int(T value, int upper) {
+ FMT_ASSERT(value >= 0 && value <= upper, "invalid value");
+ (void)upper;
+ return static_cast<int>(value);
+}
+template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+inline int to_nonnegative_int(T value, int upper) {
+ FMT_ASSERT(
+ std::isnan(value) || (value >= 0 && value <= static_cast<T>(upper)),
+ "invalid value");
+ (void)upper;
+ return static_cast<int>(value);
+}
+
+template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+inline T mod(T x, int y) {
+ return x % static_cast<T>(y);
+}
+template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
+inline T mod(T x, int y) {
+ return std::fmod(x, static_cast<T>(y));
+}
+
+// If T is an integral type, maps T to its unsigned counterpart, otherwise
+// leaves it unchanged (unlike std::make_unsigned).
+template <typename T, bool INTEGRAL = std::is_integral<T>::value>
+struct make_unsigned_or_unchanged {
+ using type = T;
+};
+
+template <typename T> struct make_unsigned_or_unchanged<T, true> {
+ using type = typename std::make_unsigned<T>::type;
+};
+
+#if FMT_SAFE_DURATION_CAST
+// throwing version of safe_duration_cast
+template <typename To, typename FromRep, typename FromPeriod>
+To fmt_safe_duration_cast(std::chrono::duration<FromRep, FromPeriod> from) {
+ int ec;
+ To to = safe_duration_cast::safe_duration_cast<To>(from, ec);
+ if (ec) FMT_THROW(format_error("cannot format duration"));
+ return to;
+}
+#endif
+
+template <typename Rep, typename Period,
+ FMT_ENABLE_IF(std::is_integral<Rep>::value)>
+inline std::chrono::duration<Rep, std::milli> get_milliseconds(
+ std::chrono::duration<Rep, Period> d) {
+ // this may overflow and/or the result may not fit in the
+ // target type.
+#if FMT_SAFE_DURATION_CAST
+ using CommonSecondsType =
+ typename std::common_type<decltype(d), std::chrono::seconds>::type;
+ const auto d_as_common = fmt_safe_duration_cast<CommonSecondsType>(d);
+ const auto d_as_whole_seconds =
+ fmt_safe_duration_cast<std::chrono::seconds>(d_as_common);
+ // this conversion should be nonproblematic
+ const auto diff = d_as_common - d_as_whole_seconds;
+ const auto ms =
+ fmt_safe_duration_cast<std::chrono::duration<Rep, std::milli>>(diff);
+ return ms;
+#else
+ auto s = std::chrono::duration_cast<std::chrono::seconds>(d);
+ return std::chrono::duration_cast<std::chrono::milliseconds>(d - s);
+#endif
+}
+
+template <typename Rep, typename Period,
+ FMT_ENABLE_IF(std::is_floating_point<Rep>::value)>
+inline std::chrono::duration<Rep, std::milli> get_milliseconds(
+ std::chrono::duration<Rep, Period> d) {
+ using common_type = typename std::common_type<Rep, std::intmax_t>::type;
+ auto ms = mod(d.count() * static_cast<common_type>(Period::num) /
+ static_cast<common_type>(Period::den) * 1000,
+ 1000);
+ return std::chrono::duration<Rep, std::milli>(static_cast<Rep>(ms));
+}
+
+template <typename Rep, typename OutputIt>
+OutputIt format_chrono_duration_value(OutputIt out, Rep val, int precision) {
+ if (precision >= 0) return format_to(out, "{:.{}f}", val, precision);
+ return format_to(out, std::is_floating_point<Rep>::value ? "{:g}" : "{}",
+ val);
+}
+
+template <typename Period, typename OutputIt>
+static OutputIt format_chrono_duration_unit(OutputIt out) {
+ if (const char* unit = get_units<Period>()) return format_to(out, "{}", unit);
+ if (Period::den == 1) return format_to(out, "[{}]s", Period::num);
+ return format_to(out, "[{}/{}]s", Period::num, Period::den);
+}
+
+template <typename FormatContext, typename OutputIt, typename Rep,
+ typename Period>
+struct chrono_formatter {
+ FormatContext& context;
+ OutputIt out;
+ int precision;
+ // rep is unsigned to avoid overflow.
+ using rep =
+ conditional_t<std::is_integral<Rep>::value && sizeof(Rep) < sizeof(int),
+ unsigned, typename make_unsigned_or_unchanged<Rep>::type>;
+ rep val;
+ using seconds = std::chrono::duration<rep>;
+ seconds s;
+ using milliseconds = std::chrono::duration<rep, std::milli>;
+ bool negative;
+
+ using char_type = typename FormatContext::char_type;
+
+ explicit chrono_formatter(FormatContext& ctx, OutputIt o,
+ std::chrono::duration<Rep, Period> d)
+ : context(ctx),
+ out(o),
+ val(static_cast<rep>(d.count())),
+ negative(false) {
+ if (d.count() < 0) {
+ val = 0 - val;
+ negative = true;
+ }
+
+ // this may overflow and/or the result may not fit in the
+ // target type.
+#if FMT_SAFE_DURATION_CAST
+ // might need checked conversion (rep!=Rep)
+ auto tmpval = std::chrono::duration<rep, Period>(val);
+ s = fmt_safe_duration_cast<seconds>(tmpval);
+#else
+ s = std::chrono::duration_cast<seconds>(
+ std::chrono::duration<rep, Period>(val));
+#endif
+ }
+
+ // returns true if nan or inf, writes to out.
+ bool handle_nan_inf() {
+ if (isfinite(val)) {
+ return false;
+ }
+ if (isnan(val)) {
+ write_nan();
+ return true;
+ }
+ // must be +-inf
+ if (val > 0) {
+ write_pinf();
+ } else {
+ write_ninf();
+ }
+ return true;
+ }
+
+ Rep hour() const { return static_cast<Rep>(mod((s.count() / 3600), 24)); }
+
+ Rep hour12() const {
+ Rep hour = static_cast<Rep>(mod((s.count() / 3600), 12));
+ return hour <= 0 ? 12 : hour;
+ }
+
+ Rep minute() const { return static_cast<Rep>(mod((s.count() / 60), 60)); }
+ Rep second() const { return static_cast<Rep>(mod(s.count(), 60)); }
+
+ std::tm time() const {
+ auto time = std::tm();
+ time.tm_hour = to_nonnegative_int(hour(), 24);
+ time.tm_min = to_nonnegative_int(minute(), 60);
+ time.tm_sec = to_nonnegative_int(second(), 60);
+ return time;
+ }
+
+ void write_sign() {
+ if (negative) {
+ *out++ = '-';
+ negative = false;
+ }
+ }
+
+ void write(Rep value, int width) {
+ write_sign();
+ if (isnan(value)) return write_nan();
+ uint32_or_64_or_128_t<int> n =
+ to_unsigned(to_nonnegative_int(value, max_value<int>()));
+ int num_digits = internal::count_digits(n);
+ if (width > num_digits) out = std::fill_n(out, width - num_digits, '0');
+ out = format_decimal<char_type>(out, n, num_digits);
+ }
+
+ void write_nan() { std::copy_n("nan", 3, out); }
+ void write_pinf() { std::copy_n("inf", 3, out); }
+ void write_ninf() { std::copy_n("-inf", 4, out); }
+
+ void format_localized(const tm& time, const char* format) {
+ if (isnan(val)) return write_nan();
+ auto locale = context.locale().template get<std::locale>();
+ auto& facet = std::use_facet<std::time_put<char_type>>(locale);
+ std::basic_ostringstream<char_type> os;
+ os.imbue(locale);
+ facet.put(os, os, ' ', &time, format, format + std::strlen(format));
+ auto str = os.str();
+ std::copy(str.begin(), str.end(), out);
+ }
+
+ void on_text(const char_type* begin, const char_type* end) {
+ std::copy(begin, end, out);
+ }
+
+ // These are not implemented because durations don't have date information.
+ void on_abbr_weekday() {}
+ void on_full_weekday() {}
+ void on_dec0_weekday(numeric_system) {}
+ void on_dec1_weekday(numeric_system) {}
+ void on_abbr_month() {}
+ void on_full_month() {}
+ void on_datetime(numeric_system) {}
+ void on_loc_date(numeric_system) {}
+ void on_loc_time(numeric_system) {}
+ void on_us_date() {}
+ void on_iso_date() {}
+ void on_utc_offset() {}
+ void on_tz_name() {}
+
+ void on_24_hour(numeric_system ns) {
+ if (handle_nan_inf()) return;
+
+ if (ns == numeric_system::standard) return write(hour(), 2);
+ auto time = tm();
+ time.tm_hour = to_nonnegative_int(hour(), 24);
+ format_localized(time, "%OH");
+ }
+
+ void on_12_hour(numeric_system ns) {
+ if (handle_nan_inf()) return;
+
+ if (ns == numeric_system::standard) return write(hour12(), 2);
+ auto time = tm();
+ time.tm_hour = to_nonnegative_int(hour12(), 12);
+ format_localized(time, "%OI");
+ }
+
+ void on_minute(numeric_system ns) {
+ if (handle_nan_inf()) return;
+
+ if (ns == numeric_system::standard) return write(minute(), 2);
+ auto time = tm();
+ time.tm_min = to_nonnegative_int(minute(), 60);
+ format_localized(time, "%OM");
+ }
+
+ void on_second(numeric_system ns) {
+ if (handle_nan_inf()) return;
+
+ if (ns == numeric_system::standard) {
+ write(second(), 2);
+#if FMT_SAFE_DURATION_CAST
+ // convert rep->Rep
+ using duration_rep = std::chrono::duration<rep, Period>;
+ using duration_Rep = std::chrono::duration<Rep, Period>;
+ auto tmpval = fmt_safe_duration_cast<duration_Rep>(duration_rep{val});
+#else
+ auto tmpval = std::chrono::duration<Rep, Period>(val);
+#endif
+ auto ms = get_milliseconds(tmpval);
+ if (ms != std::chrono::milliseconds(0)) {
+ *out++ = '.';
+ write(ms.count(), 3);
+ }
+ return;
+ }
+ auto time = tm();
+ time.tm_sec = to_nonnegative_int(second(), 60);
+ format_localized(time, "%OS");
+ }
+
+ void on_12_hour_time() {
+ if (handle_nan_inf()) return;
+
+ format_localized(time(), "%r");
+ }
+
+ void on_24_hour_time() {
+ if (handle_nan_inf()) {
+ *out++ = ':';
+ handle_nan_inf();
+ return;
+ }
+
+ write(hour(), 2);
+ *out++ = ':';
+ write(minute(), 2);
+ }
+
+ void on_iso_time() {
+ on_24_hour_time();
+ *out++ = ':';
+ if (handle_nan_inf()) return;
+ write(second(), 2);
+ }
+
+ void on_am_pm() {
+ if (handle_nan_inf()) return;
+ format_localized(time(), "%p");
+ }
+
+ void on_duration_value() {
+ if (handle_nan_inf()) return;
+ write_sign();
+ out = format_chrono_duration_value(out, val, precision);
+ }
+
+ void on_duration_unit() { out = format_chrono_duration_unit<Period>(out); }
+};
+} // namespace internal
+
+template <typename Rep, typename Period, typename Char>
+struct formatter<std::chrono::duration<Rep, Period>, Char> {
+ private:
+ basic_format_specs<Char> specs;
+ int precision;
+ using arg_ref_type = internal::arg_ref<Char>;
+ arg_ref_type width_ref;
+ arg_ref_type precision_ref;
+ mutable basic_string_view<Char> format_str;
+ using duration = std::chrono::duration<Rep, Period>;
+
+ struct spec_handler {
+ formatter& f;
+ basic_format_parse_context<Char>& context;
+ basic_string_view<Char> format_str;
+
+ template <typename Id> FMT_CONSTEXPR arg_ref_type make_arg_ref(Id arg_id) {
+ context.check_arg_id(arg_id);
+ return arg_ref_type(arg_id);
+ }
+
+ FMT_CONSTEXPR arg_ref_type make_arg_ref(basic_string_view<Char> arg_id) {
+ context.check_arg_id(arg_id);
+ return arg_ref_type(arg_id);
+ }
+
+ FMT_CONSTEXPR arg_ref_type make_arg_ref(internal::auto_id) {
+ return arg_ref_type(context.next_arg_id());
+ }
+
+ void on_error(const char* msg) { FMT_THROW(format_error(msg)); }
+ void on_fill(Char fill) { f.specs.fill[0] = fill; }
+ void on_align(align_t align) { f.specs.align = align; }
+ void on_width(int width) { f.specs.width = width; }
+ void on_precision(int _precision) { f.precision = _precision; }
+ void end_precision() {}
+
+ template <typename Id> void on_dynamic_width(Id arg_id) {
+ f.width_ref = make_arg_ref(arg_id);
+ }
+
+ template <typename Id> void on_dynamic_precision(Id arg_id) {
+ f.precision_ref = make_arg_ref(arg_id);
+ }
+ };
+
+ using iterator = typename basic_format_parse_context<Char>::iterator;
+ struct parse_range {
+ iterator begin;
+ iterator end;
+ };
+
+ FMT_CONSTEXPR parse_range do_parse(basic_format_parse_context<Char>& ctx) {
+ auto begin = ctx.begin(), end = ctx.end();
+ if (begin == end || *begin == '}') return {begin, begin};
+ spec_handler handler{*this, ctx, format_str};
+ begin = internal::parse_align(begin, end, handler);
+ if (begin == end) return {begin, begin};
+ begin = internal::parse_width(begin, end, handler);
+ if (begin == end) return {begin, begin};
+ if (*begin == '.') {
+ if (std::is_floating_point<Rep>::value)
+ begin = internal::parse_precision(begin, end, handler);
+ else
+ handler.on_error("precision not allowed for this argument type");
+ }
+ end = parse_chrono_format(begin, end, internal::chrono_format_checker());
+ return {begin, end};
+ }
+
+ public:
+ formatter() : precision(-1) {}
+
+ FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx)
+ -> decltype(ctx.begin()) {
+ auto range = do_parse(ctx);
+ format_str = basic_string_view<Char>(
+ &*range.begin, internal::to_unsigned(range.end - range.begin));
+ return range.end;
+ }
+
+ template <typename FormatContext>
+ auto format(const duration& d, FormatContext& ctx) -> decltype(ctx.out()) {
+ auto begin = format_str.begin(), end = format_str.end();
+ // As a possible future optimization, we could avoid extra copying if width
+ // is not specified.
+ basic_memory_buffer<Char> buf;
+ auto out = std::back_inserter(buf);
+ using range = internal::output_range<decltype(ctx.out()), Char>;
+ internal::basic_writer<range> w(range(ctx.out()));
+ internal::handle_dynamic_spec<internal::width_checker>(specs.width,
+ width_ref, ctx);
+ internal::handle_dynamic_spec<internal::precision_checker>(
+ precision, precision_ref, ctx);
+ if (begin == end || *begin == '}') {
+ out = internal::format_chrono_duration_value(out, d.count(), precision);
+ internal::format_chrono_duration_unit<Period>(out);
+ } else {
+ internal::chrono_formatter<FormatContext, decltype(out), Rep, Period> f(
+ ctx, out, d);
+ f.precision = precision;
+ parse_chrono_format(begin, end, f);
+ }
+ w.write(buf.data(), buf.size(), specs);
+ return w.out();
+ }
+};
+
+FMT_END_NAMESPACE
+
+#endif // FMT_CHRONO_H_
--- /dev/null
+// Formatting library for C++ - color support
+//
+// Copyright (c) 2018 - present, Victor Zverovich and fmt contributors
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_COLOR_H_
+#define FMT_COLOR_H_
+
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+
+enum class color : uint32_t {
+ alice_blue = 0xF0F8FF, // rgb(240,248,255)
+ antique_white = 0xFAEBD7, // rgb(250,235,215)
+ aqua = 0x00FFFF, // rgb(0,255,255)
+ aquamarine = 0x7FFFD4, // rgb(127,255,212)
+ azure = 0xF0FFFF, // rgb(240,255,255)
+ beige = 0xF5F5DC, // rgb(245,245,220)
+ bisque = 0xFFE4C4, // rgb(255,228,196)
+ black = 0x000000, // rgb(0,0,0)
+ blanched_almond = 0xFFEBCD, // rgb(255,235,205)
+ blue = 0x0000FF, // rgb(0,0,255)
+ blue_violet = 0x8A2BE2, // rgb(138,43,226)
+ brown = 0xA52A2A, // rgb(165,42,42)
+ burly_wood = 0xDEB887, // rgb(222,184,135)
+ cadet_blue = 0x5F9EA0, // rgb(95,158,160)
+ chartreuse = 0x7FFF00, // rgb(127,255,0)
+ chocolate = 0xD2691E, // rgb(210,105,30)
+ coral = 0xFF7F50, // rgb(255,127,80)
+ cornflower_blue = 0x6495ED, // rgb(100,149,237)
+ cornsilk = 0xFFF8DC, // rgb(255,248,220)
+ crimson = 0xDC143C, // rgb(220,20,60)
+ cyan = 0x00FFFF, // rgb(0,255,255)
+ dark_blue = 0x00008B, // rgb(0,0,139)
+ dark_cyan = 0x008B8B, // rgb(0,139,139)
+ dark_golden_rod = 0xB8860B, // rgb(184,134,11)
+ dark_gray = 0xA9A9A9, // rgb(169,169,169)
+ dark_green = 0x006400, // rgb(0,100,0)
+ dark_khaki = 0xBDB76B, // rgb(189,183,107)
+ dark_magenta = 0x8B008B, // rgb(139,0,139)
+ dark_olive_green = 0x556B2F, // rgb(85,107,47)
+ dark_orange = 0xFF8C00, // rgb(255,140,0)
+ dark_orchid = 0x9932CC, // rgb(153,50,204)
+ dark_red = 0x8B0000, // rgb(139,0,0)
+ dark_salmon = 0xE9967A, // rgb(233,150,122)
+ dark_sea_green = 0x8FBC8F, // rgb(143,188,143)
+ dark_slate_blue = 0x483D8B, // rgb(72,61,139)
+ dark_slate_gray = 0x2F4F4F, // rgb(47,79,79)
+ dark_turquoise = 0x00CED1, // rgb(0,206,209)
+ dark_violet = 0x9400D3, // rgb(148,0,211)
+ deep_pink = 0xFF1493, // rgb(255,20,147)
+ deep_sky_blue = 0x00BFFF, // rgb(0,191,255)
+ dim_gray = 0x696969, // rgb(105,105,105)
+ dodger_blue = 0x1E90FF, // rgb(30,144,255)
+ fire_brick = 0xB22222, // rgb(178,34,34)
+ floral_white = 0xFFFAF0, // rgb(255,250,240)
+ forest_green = 0x228B22, // rgb(34,139,34)
+ fuchsia = 0xFF00FF, // rgb(255,0,255)
+ gainsboro = 0xDCDCDC, // rgb(220,220,220)
+ ghost_white = 0xF8F8FF, // rgb(248,248,255)
+ gold = 0xFFD700, // rgb(255,215,0)
+ golden_rod = 0xDAA520, // rgb(218,165,32)
+ gray = 0x808080, // rgb(128,128,128)
+ green = 0x008000, // rgb(0,128,0)
+ green_yellow = 0xADFF2F, // rgb(173,255,47)
+ honey_dew = 0xF0FFF0, // rgb(240,255,240)
+ hot_pink = 0xFF69B4, // rgb(255,105,180)
+ indian_red = 0xCD5C5C, // rgb(205,92,92)
+ indigo = 0x4B0082, // rgb(75,0,130)
+ ivory = 0xFFFFF0, // rgb(255,255,240)
+ khaki = 0xF0E68C, // rgb(240,230,140)
+ lavender = 0xE6E6FA, // rgb(230,230,250)
+ lavender_blush = 0xFFF0F5, // rgb(255,240,245)
+ lawn_green = 0x7CFC00, // rgb(124,252,0)
+ lemon_chiffon = 0xFFFACD, // rgb(255,250,205)
+ light_blue = 0xADD8E6, // rgb(173,216,230)
+ light_coral = 0xF08080, // rgb(240,128,128)
+ light_cyan = 0xE0FFFF, // rgb(224,255,255)
+ light_golden_rod_yellow = 0xFAFAD2, // rgb(250,250,210)
+ light_gray = 0xD3D3D3, // rgb(211,211,211)
+ light_green = 0x90EE90, // rgb(144,238,144)
+ light_pink = 0xFFB6C1, // rgb(255,182,193)
+ light_salmon = 0xFFA07A, // rgb(255,160,122)
+ light_sea_green = 0x20B2AA, // rgb(32,178,170)
+ light_sky_blue = 0x87CEFA, // rgb(135,206,250)
+ light_slate_gray = 0x778899, // rgb(119,136,153)
+ light_steel_blue = 0xB0C4DE, // rgb(176,196,222)
+ light_yellow = 0xFFFFE0, // rgb(255,255,224)
+ lime = 0x00FF00, // rgb(0,255,0)
+ lime_green = 0x32CD32, // rgb(50,205,50)
+ linen = 0xFAF0E6, // rgb(250,240,230)
+ magenta = 0xFF00FF, // rgb(255,0,255)
+ maroon = 0x800000, // rgb(128,0,0)
+ medium_aquamarine = 0x66CDAA, // rgb(102,205,170)
+ medium_blue = 0x0000CD, // rgb(0,0,205)
+ medium_orchid = 0xBA55D3, // rgb(186,85,211)
+ medium_purple = 0x9370DB, // rgb(147,112,219)
+ medium_sea_green = 0x3CB371, // rgb(60,179,113)
+ medium_slate_blue = 0x7B68EE, // rgb(123,104,238)
+ medium_spring_green = 0x00FA9A, // rgb(0,250,154)
+ medium_turquoise = 0x48D1CC, // rgb(72,209,204)
+ medium_violet_red = 0xC71585, // rgb(199,21,133)
+ midnight_blue = 0x191970, // rgb(25,25,112)
+ mint_cream = 0xF5FFFA, // rgb(245,255,250)
+ misty_rose = 0xFFE4E1, // rgb(255,228,225)
+ moccasin = 0xFFE4B5, // rgb(255,228,181)
+ navajo_white = 0xFFDEAD, // rgb(255,222,173)
+ navy = 0x000080, // rgb(0,0,128)
+ old_lace = 0xFDF5E6, // rgb(253,245,230)
+ olive = 0x808000, // rgb(128,128,0)
+ olive_drab = 0x6B8E23, // rgb(107,142,35)
+ orange = 0xFFA500, // rgb(255,165,0)
+ orange_red = 0xFF4500, // rgb(255,69,0)
+ orchid = 0xDA70D6, // rgb(218,112,214)
+ pale_golden_rod = 0xEEE8AA, // rgb(238,232,170)
+ pale_green = 0x98FB98, // rgb(152,251,152)
+ pale_turquoise = 0xAFEEEE, // rgb(175,238,238)
+ pale_violet_red = 0xDB7093, // rgb(219,112,147)
+ papaya_whip = 0xFFEFD5, // rgb(255,239,213)
+ peach_puff = 0xFFDAB9, // rgb(255,218,185)
+ peru = 0xCD853F, // rgb(205,133,63)
+ pink = 0xFFC0CB, // rgb(255,192,203)
+ plum = 0xDDA0DD, // rgb(221,160,221)
+ powder_blue = 0xB0E0E6, // rgb(176,224,230)
+ purple = 0x800080, // rgb(128,0,128)
+ rebecca_purple = 0x663399, // rgb(102,51,153)
+ red = 0xFF0000, // rgb(255,0,0)
+ rosy_brown = 0xBC8F8F, // rgb(188,143,143)
+ royal_blue = 0x4169E1, // rgb(65,105,225)
+ saddle_brown = 0x8B4513, // rgb(139,69,19)
+ salmon = 0xFA8072, // rgb(250,128,114)
+ sandy_brown = 0xF4A460, // rgb(244,164,96)
+ sea_green = 0x2E8B57, // rgb(46,139,87)
+ sea_shell = 0xFFF5EE, // rgb(255,245,238)
+ sienna = 0xA0522D, // rgb(160,82,45)
+ silver = 0xC0C0C0, // rgb(192,192,192)
+ sky_blue = 0x87CEEB, // rgb(135,206,235)
+ slate_blue = 0x6A5ACD, // rgb(106,90,205)
+ slate_gray = 0x708090, // rgb(112,128,144)
+ snow = 0xFFFAFA, // rgb(255,250,250)
+ spring_green = 0x00FF7F, // rgb(0,255,127)
+ steel_blue = 0x4682B4, // rgb(70,130,180)
+ tan = 0xD2B48C, // rgb(210,180,140)
+ teal = 0x008080, // rgb(0,128,128)
+ thistle = 0xD8BFD8, // rgb(216,191,216)
+ tomato = 0xFF6347, // rgb(255,99,71)
+ turquoise = 0x40E0D0, // rgb(64,224,208)
+ violet = 0xEE82EE, // rgb(238,130,238)
+ wheat = 0xF5DEB3, // rgb(245,222,179)
+ white = 0xFFFFFF, // rgb(255,255,255)
+ white_smoke = 0xF5F5F5, // rgb(245,245,245)
+ yellow = 0xFFFF00, // rgb(255,255,0)
+ yellow_green = 0x9ACD32 // rgb(154,205,50)
+}; // enum class color
+
+enum class terminal_color : uint8_t {
+ black = 30,
+ red,
+ green,
+ yellow,
+ blue,
+ magenta,
+ cyan,
+ white,
+ bright_black = 90,
+ bright_red,
+ bright_green,
+ bright_yellow,
+ bright_blue,
+ bright_magenta,
+ bright_cyan,
+ bright_white
+};
+
+enum class emphasis : uint8_t {
+ bold = 1,
+ italic = 1 << 1,
+ underline = 1 << 2,
+ strikethrough = 1 << 3
+};
+
+// rgb is a struct for red, green and blue colors.
+// Using the name "rgb" makes some editors show the color in a tooltip.
+struct rgb {
+ FMT_CONSTEXPR rgb() : r(0), g(0), b(0) {}
+ FMT_CONSTEXPR rgb(uint8_t r_, uint8_t g_, uint8_t b_) : r(r_), g(g_), b(b_) {}
+ FMT_CONSTEXPR rgb(uint32_t hex)
+ : r((hex >> 16) & 0xFF), g((hex >> 8) & 0xFF), b(hex & 0xFF) {}
+ FMT_CONSTEXPR rgb(color hex)
+ : r((uint32_t(hex) >> 16) & 0xFF),
+ g((uint32_t(hex) >> 8) & 0xFF),
+ b(uint32_t(hex) & 0xFF) {}
+ uint8_t r;
+ uint8_t g;
+ uint8_t b;
+};
+
+namespace internal {
+
+// color is a struct of either a rgb color or a terminal color.
+struct color_type {
+ FMT_CONSTEXPR color_type() FMT_NOEXCEPT : is_rgb(), value{} {}
+ FMT_CONSTEXPR color_type(color rgb_color) FMT_NOEXCEPT : is_rgb(true),
+ value{} {
+ value.rgb_color = static_cast<uint32_t>(rgb_color);
+ }
+ FMT_CONSTEXPR color_type(rgb rgb_color) FMT_NOEXCEPT : is_rgb(true), value{} {
+ value.rgb_color = (static_cast<uint32_t>(rgb_color.r) << 16) |
+ (static_cast<uint32_t>(rgb_color.g) << 8) | rgb_color.b;
+ }
+ FMT_CONSTEXPR color_type(terminal_color term_color) FMT_NOEXCEPT : is_rgb(),
+ value{} {
+ value.term_color = static_cast<uint8_t>(term_color);
+ }
+ bool is_rgb;
+ union color_union {
+ uint8_t term_color;
+ uint32_t rgb_color;
+ } value;
+};
+} // namespace internal
+
+// Experimental text formatting support.
+class text_style {
+ public:
+ FMT_CONSTEXPR text_style(emphasis em = emphasis()) FMT_NOEXCEPT
+ : set_foreground_color(),
+ set_background_color(),
+ ems(em) {}
+
+ FMT_CONSTEXPR text_style& operator|=(const text_style& rhs) {
+ if (!set_foreground_color) {
+ set_foreground_color = rhs.set_foreground_color;
+ foreground_color = rhs.foreground_color;
+ } else if (rhs.set_foreground_color) {
+ if (!foreground_color.is_rgb || !rhs.foreground_color.is_rgb)
+ FMT_THROW(format_error("can't OR a terminal color"));
+ foreground_color.value.rgb_color |= rhs.foreground_color.value.rgb_color;
+ }
+
+ if (!set_background_color) {
+ set_background_color = rhs.set_background_color;
+ background_color = rhs.background_color;
+ } else if (rhs.set_background_color) {
+ if (!background_color.is_rgb || !rhs.background_color.is_rgb)
+ FMT_THROW(format_error("can't OR a terminal color"));
+ background_color.value.rgb_color |= rhs.background_color.value.rgb_color;
+ }
+
+ ems = static_cast<emphasis>(static_cast<uint8_t>(ems) |
+ static_cast<uint8_t>(rhs.ems));
+ return *this;
+ }
+
+ friend FMT_CONSTEXPR text_style operator|(text_style lhs,
+ const text_style& rhs) {
+ return lhs |= rhs;
+ }
+
+ FMT_CONSTEXPR text_style& operator&=(const text_style& rhs) {
+ if (!set_foreground_color) {
+ set_foreground_color = rhs.set_foreground_color;
+ foreground_color = rhs.foreground_color;
+ } else if (rhs.set_foreground_color) {
+ if (!foreground_color.is_rgb || !rhs.foreground_color.is_rgb)
+ FMT_THROW(format_error("can't AND a terminal color"));
+ foreground_color.value.rgb_color &= rhs.foreground_color.value.rgb_color;
+ }
+
+ if (!set_background_color) {
+ set_background_color = rhs.set_background_color;
+ background_color = rhs.background_color;
+ } else if (rhs.set_background_color) {
+ if (!background_color.is_rgb || !rhs.background_color.is_rgb)
+ FMT_THROW(format_error("can't AND a terminal color"));
+ background_color.value.rgb_color &= rhs.background_color.value.rgb_color;
+ }
+
+ ems = static_cast<emphasis>(static_cast<uint8_t>(ems) &
+ static_cast<uint8_t>(rhs.ems));
+ return *this;
+ }
+
+ friend FMT_CONSTEXPR text_style operator&(text_style lhs,
+ const text_style& rhs) {
+ return lhs &= rhs;
+ }
+
+ FMT_CONSTEXPR bool has_foreground() const FMT_NOEXCEPT {
+ return set_foreground_color;
+ }
+ FMT_CONSTEXPR bool has_background() const FMT_NOEXCEPT {
+ return set_background_color;
+ }
+ FMT_CONSTEXPR bool has_emphasis() const FMT_NOEXCEPT {
+ return static_cast<uint8_t>(ems) != 0;
+ }
+ FMT_CONSTEXPR internal::color_type get_foreground() const FMT_NOEXCEPT {
+ FMT_ASSERT(has_foreground(), "no foreground specified for this style");
+ return foreground_color;
+ }
+ FMT_CONSTEXPR internal::color_type get_background() const FMT_NOEXCEPT {
+ FMT_ASSERT(has_background(), "no background specified for this style");
+ return background_color;
+ }
+ FMT_CONSTEXPR emphasis get_emphasis() const FMT_NOEXCEPT {
+ FMT_ASSERT(has_emphasis(), "no emphasis specified for this style");
+ return ems;
+ }
+
+ private:
+ FMT_CONSTEXPR text_style(bool is_foreground,
+ internal::color_type text_color) FMT_NOEXCEPT
+ : set_foreground_color(),
+ set_background_color(),
+ ems() {
+ if (is_foreground) {
+ foreground_color = text_color;
+ set_foreground_color = true;
+ } else {
+ background_color = text_color;
+ set_background_color = true;
+ }
+ }
+
+ friend FMT_CONSTEXPR_DECL text_style fg(internal::color_type foreground)
+ FMT_NOEXCEPT;
+ friend FMT_CONSTEXPR_DECL text_style bg(internal::color_type background)
+ FMT_NOEXCEPT;
+
+ internal::color_type foreground_color;
+ internal::color_type background_color;
+ bool set_foreground_color;
+ bool set_background_color;
+ emphasis ems;
+};
+
+FMT_CONSTEXPR text_style fg(internal::color_type foreground) FMT_NOEXCEPT {
+ return text_style(/*is_foreground=*/true, foreground);
+}
+
+FMT_CONSTEXPR text_style bg(internal::color_type background) FMT_NOEXCEPT {
+ return text_style(/*is_foreground=*/false, background);
+}
+
+FMT_CONSTEXPR text_style operator|(emphasis lhs, emphasis rhs) FMT_NOEXCEPT {
+ return text_style(lhs) | rhs;
+}
+
+namespace internal {
+
+template <typename Char> struct ansi_color_escape {
+ FMT_CONSTEXPR ansi_color_escape(internal::color_type text_color,
+ const char* esc) FMT_NOEXCEPT {
+ // If we have a terminal color, we need to output another escape code
+ // sequence.
+ if (!text_color.is_rgb) {
+ bool is_background = esc == internal::data::background_color;
+ uint32_t value = text_color.value.term_color;
+ // Background ASCII codes are the same as the foreground ones but with
+ // 10 more.
+ if (is_background) value += 10u;
+
+ std::size_t index = 0;
+ buffer[index++] = static_cast<Char>('\x1b');
+ buffer[index++] = static_cast<Char>('[');
+
+ if (value >= 100u) {
+ buffer[index++] = static_cast<Char>('1');
+ value %= 100u;
+ }
+ buffer[index++] = static_cast<Char>('0' + value / 10u);
+ buffer[index++] = static_cast<Char>('0' + value % 10u);
+
+ buffer[index++] = static_cast<Char>('m');
+ buffer[index++] = static_cast<Char>('\0');
+ return;
+ }
+
+ for (int i = 0; i < 7; i++) {
+ buffer[i] = static_cast<Char>(esc[i]);
+ }
+ rgb color(text_color.value.rgb_color);
+ to_esc(color.r, buffer + 7, ';');
+ to_esc(color.g, buffer + 11, ';');
+ to_esc(color.b, buffer + 15, 'm');
+ buffer[19] = static_cast<Char>(0);
+ }
+ FMT_CONSTEXPR ansi_color_escape(emphasis em) FMT_NOEXCEPT {
+ uint8_t em_codes[4] = {};
+ uint8_t em_bits = static_cast<uint8_t>(em);
+ if (em_bits & static_cast<uint8_t>(emphasis::bold)) em_codes[0] = 1;
+ if (em_bits & static_cast<uint8_t>(emphasis::italic)) em_codes[1] = 3;
+ if (em_bits & static_cast<uint8_t>(emphasis::underline)) em_codes[2] = 4;
+ if (em_bits & static_cast<uint8_t>(emphasis::strikethrough))
+ em_codes[3] = 9;
+
+ std::size_t index = 0;
+ for (int i = 0; i < 4; ++i) {
+ if (!em_codes[i]) continue;
+ buffer[index++] = static_cast<Char>('\x1b');
+ buffer[index++] = static_cast<Char>('[');
+ buffer[index++] = static_cast<Char>('0' + em_codes[i]);
+ buffer[index++] = static_cast<Char>('m');
+ }
+ buffer[index++] = static_cast<Char>(0);
+ }
+ FMT_CONSTEXPR operator const Char*() const FMT_NOEXCEPT { return buffer; }
+
+ FMT_CONSTEXPR const Char* begin() const FMT_NOEXCEPT { return buffer; }
+ FMT_CONSTEXPR const Char* end() const FMT_NOEXCEPT {
+ return buffer + std::strlen(buffer);
+ }
+
+ private:
+ Char buffer[7u + 3u * 4u + 1u];
+
+ static FMT_CONSTEXPR void to_esc(uint8_t c, Char* out,
+ char delimiter) FMT_NOEXCEPT {
+ out[0] = static_cast<Char>('0' + c / 100);
+ out[1] = static_cast<Char>('0' + c / 10 % 10);
+ out[2] = static_cast<Char>('0' + c % 10);
+ out[3] = static_cast<Char>(delimiter);
+ }
+};
+
+template <typename Char>
+FMT_CONSTEXPR ansi_color_escape<Char> make_foreground_color(
+ internal::color_type foreground) FMT_NOEXCEPT {
+ return ansi_color_escape<Char>(foreground, internal::data::foreground_color);
+}
+
+template <typename Char>
+FMT_CONSTEXPR ansi_color_escape<Char> make_background_color(
+ internal::color_type background) FMT_NOEXCEPT {
+ return ansi_color_escape<Char>(background, internal::data::background_color);
+}
+
+template <typename Char>
+FMT_CONSTEXPR ansi_color_escape<Char> make_emphasis(emphasis em) FMT_NOEXCEPT {
+ return ansi_color_escape<Char>(em);
+}
+
+template <typename Char>
+inline void fputs(const Char* chars, FILE* stream) FMT_NOEXCEPT {
+ std::fputs(chars, stream);
+}
+
+template <>
+inline void fputs<wchar_t>(const wchar_t* chars, FILE* stream) FMT_NOEXCEPT {
+ std::fputws(chars, stream);
+}
+
+template <typename Char> inline void reset_color(FILE* stream) FMT_NOEXCEPT {
+ fputs(internal::data::reset_color, stream);
+}
+
+template <> inline void reset_color<wchar_t>(FILE* stream) FMT_NOEXCEPT {
+ fputs(internal::data::wreset_color, stream);
+}
+
+template <typename Char>
+inline void reset_color(basic_memory_buffer<Char>& buffer) FMT_NOEXCEPT {
+ const char* begin = data::reset_color;
+ const char* end = begin + sizeof(data::reset_color) - 1;
+ buffer.append(begin, end);
+}
+
+template <typename Char>
+void vformat_to(basic_memory_buffer<Char>& buf, const text_style& ts,
+ basic_string_view<Char> format_str,
+ basic_format_args<buffer_context<Char>> args) {
+ bool has_style = false;
+ if (ts.has_emphasis()) {
+ has_style = true;
+ auto emphasis = internal::make_emphasis<Char>(ts.get_emphasis());
+ buf.append(emphasis.begin(), emphasis.end());
+ }
+ if (ts.has_foreground()) {
+ has_style = true;
+ auto foreground =
+ internal::make_foreground_color<Char>(ts.get_foreground());
+ buf.append(foreground.begin(), foreground.end());
+ }
+ if (ts.has_background()) {
+ has_style = true;
+ auto background =
+ internal::make_background_color<Char>(ts.get_background());
+ buf.append(background.begin(), background.end());
+ }
+ vformat_to(buf, format_str, args);
+ if (has_style) {
+ internal::reset_color<Char>(buf);
+ }
+}
+} // namespace internal
+
+template <typename S, typename Char = char_t<S>>
+void vprint(std::FILE* f, const text_style& ts, const S& format,
+ basic_format_args<buffer_context<Char>> args) {
+ basic_memory_buffer<Char> buf;
+ internal::vformat_to(buf, ts, to_string_view(format), args);
+ buf.push_back(Char(0));
+ internal::fputs(buf.data(), f);
+}
+
+/**
+ Formats a string and prints it to the specified file stream using ANSI
+ escape sequences to specify text formatting.
+ Example:
+ fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
+ "Elapsed time: {0:.2f} seconds", 1.23);
+ */
+template <typename S, typename... Args,
+ FMT_ENABLE_IF(internal::is_string<S>::value)>
+void print(std::FILE* f, const text_style& ts, const S& format_str,
+ const Args&... args) {
+ internal::check_format_string<Args...>(format_str);
+ using context = buffer_context<char_t<S>>;
+ format_arg_store<context, Args...> as{args...};
+ vprint(f, ts, format_str, basic_format_args<context>(as));
+}
+
+/**
+ Formats a string and prints it to stdout using ANSI escape sequences to
+ specify text formatting.
+ Example:
+ fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
+ "Elapsed time: {0:.2f} seconds", 1.23);
+ */
+template <typename S, typename... Args,
+ FMT_ENABLE_IF(internal::is_string<S>::value)>
+void print(const text_style& ts, const S& format_str, const Args&... args) {
+ return print(stdout, ts, format_str, args...);
+}
+
+template <typename S, typename Char = char_t<S>>
+inline std::basic_string<Char> vformat(
+ const text_style& ts, const S& format_str,
+ basic_format_args<buffer_context<Char>> args) {
+ basic_memory_buffer<Char> buf;
+ internal::vformat_to(buf, ts, to_string_view(format_str), args);
+ return fmt::to_string(buf);
+}
+
+/**
+ \rst
+ Formats arguments and returns the result as a string using ANSI
+ escape sequences to specify text formatting.
+
+ **Example**::
+
+ #include <fmt/color.h>
+ std::string message = fmt::format(fmt::emphasis::bold | fg(fmt::color::red),
+ "The answer is {}", 42);
+ \endrst
+*/
+template <typename S, typename... Args, typename Char = char_t<S>>
+inline std::basic_string<Char> format(const text_style& ts, const S& format_str,
+ const Args&... args) {
+ return vformat(ts, to_string_view(format_str),
+ {internal::make_args_checked<Args...>(format_str, args...)});
+}
+
+FMT_END_NAMESPACE
+
+#endif // FMT_COLOR_H_
--- /dev/null
+// Formatting library for C++ - experimental format string compilation
+//
+// Copyright (c) 2012 - present, Victor Zverovich and fmt contributors
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_COMPILE_H_
+#define FMT_COMPILE_H_
+
+#include <vector>
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+// Part of a compiled format string. It can be either literal text or a
+// replacement field.
+template <typename Char> struct format_part {
+ enum class kind { arg_index, arg_name, text, replacement };
+
+ struct replacement {
+ arg_ref<Char> arg_id;
+ dynamic_format_specs<Char> specs;
+ };
+
+ kind part_kind;
+ union value {
+ int arg_index;
+ basic_string_view<Char> str;
+ replacement repl;
+
+ FMT_CONSTEXPR value(int index = 0) : arg_index(index) {}
+ FMT_CONSTEXPR value(basic_string_view<Char> s) : str(s) {}
+ FMT_CONSTEXPR value(replacement r) : repl(r) {}
+ } val;
+ // Position past the end of the argument id.
+ const Char* arg_id_end = nullptr;
+
+ FMT_CONSTEXPR format_part(kind k = kind::arg_index, value v = {})
+ : part_kind(k), val(v) {}
+
+ static FMT_CONSTEXPR format_part make_arg_index(int index) {
+ return format_part(kind::arg_index, index);
+ }
+ static FMT_CONSTEXPR format_part make_arg_name(basic_string_view<Char> name) {
+ return format_part(kind::arg_name, name);
+ }
+ static FMT_CONSTEXPR format_part make_text(basic_string_view<Char> text) {
+ return format_part(kind::text, text);
+ }
+ static FMT_CONSTEXPR format_part make_replacement(replacement repl) {
+ return format_part(kind::replacement, repl);
+ }
+};
+
+template <typename Char> struct part_counter {
+ unsigned num_parts = 0;
+
+ FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) {
+ if (begin != end) ++num_parts;
+ }
+
+ FMT_CONSTEXPR void on_arg_id() { ++num_parts; }
+ FMT_CONSTEXPR void on_arg_id(int) { ++num_parts; }
+ FMT_CONSTEXPR void on_arg_id(basic_string_view<Char>) { ++num_parts; }
+
+ FMT_CONSTEXPR void on_replacement_field(const Char*) {}
+
+ FMT_CONSTEXPR const Char* on_format_specs(const Char* begin,
+ const Char* end) {
+ // Find the matching brace.
+ unsigned brace_counter = 0;
+ for (; begin != end; ++begin) {
+ if (*begin == '{') {
+ ++brace_counter;
+ } else if (*begin == '}') {
+ if (brace_counter == 0u) break;
+ --brace_counter;
+ }
+ }
+ return begin;
+ }
+
+ FMT_CONSTEXPR void on_error(const char*) {}
+};
+
+// Counts the number of parts in a format string.
+template <typename Char>
+FMT_CONSTEXPR unsigned count_parts(basic_string_view<Char> format_str) {
+ part_counter<Char> counter;
+ parse_format_string<true>(format_str, counter);
+ return counter.num_parts;
+}
+
+template <typename Char, typename PartHandler>
+class format_string_compiler : public error_handler {
+ private:
+ using part = format_part<Char>;
+
+ PartHandler handler_;
+ part part_;
+ basic_string_view<Char> format_str_;
+ basic_format_parse_context<Char> parse_context_;
+
+ public:
+ FMT_CONSTEXPR format_string_compiler(basic_string_view<Char> format_str,
+ PartHandler handler)
+ : handler_(handler),
+ format_str_(format_str),
+ parse_context_(format_str) {}
+
+ FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) {
+ if (begin != end)
+ handler_(part::make_text({begin, to_unsigned(end - begin)}));
+ }
+
+ FMT_CONSTEXPR void on_arg_id() {
+ part_ = part::make_arg_index(parse_context_.next_arg_id());
+ }
+
+ FMT_CONSTEXPR void on_arg_id(int id) {
+ parse_context_.check_arg_id(id);
+ part_ = part::make_arg_index(id);
+ }
+
+ FMT_CONSTEXPR void on_arg_id(basic_string_view<Char> id) {
+ part_ = part::make_arg_name(id);
+ }
+
+ FMT_CONSTEXPR void on_replacement_field(const Char* ptr) {
+ part_.arg_id_end = ptr;
+ handler_(part_);
+ }
+
+ FMT_CONSTEXPR const Char* on_format_specs(const Char* begin,
+ const Char* end) {
+ auto repl = typename part::replacement();
+ dynamic_specs_handler<basic_format_parse_context<Char>> handler(
+ repl.specs, parse_context_);
+ auto it = parse_format_specs(begin, end, handler);
+ if (*it != '}') on_error("missing '}' in format string");
+ repl.arg_id = part_.part_kind == part::kind::arg_index
+ ? arg_ref<Char>(part_.val.arg_index)
+ : arg_ref<Char>(part_.val.str);
+ auto part = part::make_replacement(repl);
+ part.arg_id_end = begin;
+ handler_(part);
+ return it;
+ }
+};
+
+// Compiles a format string and invokes handler(part) for each parsed part.
+template <bool IS_CONSTEXPR, typename Char, typename PartHandler>
+FMT_CONSTEXPR void compile_format_string(basic_string_view<Char> format_str,
+ PartHandler handler) {
+ parse_format_string<IS_CONSTEXPR>(
+ format_str,
+ format_string_compiler<Char, PartHandler>(format_str, handler));
+}
+
+template <typename Range, typename Context, typename Id>
+void format_arg(
+ basic_format_parse_context<typename Range::value_type>& parse_ctx,
+ Context& ctx, Id arg_id) {
+ ctx.advance_to(
+ visit_format_arg(arg_formatter<Range>(ctx, &parse_ctx), ctx.arg(arg_id)));
+}
+
+// vformat_to is defined in a subnamespace to prevent ADL.
+namespace cf {
+template <typename Context, typename Range, typename CompiledFormat>
+auto vformat_to(Range out, CompiledFormat& cf, basic_format_args<Context> args)
+ -> typename Context::iterator {
+ using char_type = typename Context::char_type;
+ basic_format_parse_context<char_type> parse_ctx(
+ to_string_view(cf.format_str_));
+ Context ctx(out.begin(), args);
+
+ const auto& parts = cf.parts();
+ for (auto part_it = std::begin(parts); part_it != std::end(parts);
+ ++part_it) {
+ const auto& part = *part_it;
+ const auto& value = part.val;
+
+ using format_part_t = format_part<char_type>;
+ switch (part.part_kind) {
+ case format_part_t::kind::text: {
+ const auto text = value.str;
+ auto output = ctx.out();
+ auto&& it = reserve(output, text.size());
+ it = std::copy_n(text.begin(), text.size(), it);
+ ctx.advance_to(output);
+ break;
+ }
+
+ case format_part_t::kind::arg_index:
+ advance_to(parse_ctx, part.arg_id_end);
+ internal::format_arg<Range>(parse_ctx, ctx, value.arg_index);
+ break;
+
+ case format_part_t::kind::arg_name:
+ advance_to(parse_ctx, part.arg_id_end);
+ internal::format_arg<Range>(parse_ctx, ctx, value.str);
+ break;
+
+ case format_part_t::kind::replacement: {
+ const auto& arg_id_value = value.repl.arg_id.val;
+ const auto arg = value.repl.arg_id.kind == arg_id_kind::index
+ ? ctx.arg(arg_id_value.index)
+ : ctx.arg(arg_id_value.name);
+
+ auto specs = value.repl.specs;
+
+ handle_dynamic_spec<width_checker>(specs.width, specs.width_ref, ctx);
+ handle_dynamic_spec<precision_checker>(specs.precision,
+ specs.precision_ref, ctx);
+
+ error_handler h;
+ numeric_specs_checker<error_handler> checker(h, arg.type());
+ if (specs.align == align::numeric) checker.require_numeric_argument();
+ if (specs.sign != sign::none) checker.check_sign();
+ if (specs.alt) checker.require_numeric_argument();
+ if (specs.precision >= 0) checker.check_precision();
+
+ advance_to(parse_ctx, part.arg_id_end);
+ ctx.advance_to(
+ visit_format_arg(arg_formatter<Range>(ctx, nullptr, &specs), arg));
+ break;
+ }
+ }
+ }
+ return ctx.out();
+}
+} // namespace cf
+
+struct basic_compiled_format {};
+
+template <typename S, typename = void>
+struct compiled_format_base : basic_compiled_format {
+ using char_type = char_t<S>;
+ using parts_container = std::vector<internal::format_part<char_type>>;
+
+ parts_container compiled_parts;
+
+ explicit compiled_format_base(basic_string_view<char_type> format_str) {
+ compile_format_string<false>(format_str,
+ [this](const format_part<char_type>& part) {
+ compiled_parts.push_back(part);
+ });
+ }
+
+ const parts_container& parts() const { return compiled_parts; }
+};
+
+template <typename Char, unsigned N> struct format_part_array {
+ format_part<Char> data[N] = {};
+ FMT_CONSTEXPR format_part_array() = default;
+};
+
+template <typename Char, unsigned N>
+FMT_CONSTEXPR format_part_array<Char, N> compile_to_parts(
+ basic_string_view<Char> format_str) {
+ format_part_array<Char, N> parts;
+ unsigned counter = 0;
+ // This is not a lambda for compatibility with older compilers.
+ struct {
+ format_part<Char>* parts;
+ unsigned* counter;
+ FMT_CONSTEXPR void operator()(const format_part<Char>& part) {
+ parts[(*counter)++] = part;
+ }
+ } collector{parts.data, &counter};
+ compile_format_string<true>(format_str, collector);
+ if (counter < N) {
+ parts.data[counter] =
+ format_part<Char>::make_text(basic_string_view<Char>());
+ }
+ return parts;
+}
+
+template <typename T> constexpr const T& constexpr_max(const T& a, const T& b) {
+ return (a < b) ? b : a;
+}
+
+template <typename S>
+struct compiled_format_base<S, enable_if_t<is_compile_string<S>::value>>
+ : basic_compiled_format {
+ using char_type = char_t<S>;
+
+ FMT_CONSTEXPR explicit compiled_format_base(basic_string_view<char_type>) {}
+
+// Workaround for old compilers. Format string compilation will not be
+// performed there anyway.
+#if FMT_USE_CONSTEXPR
+ static FMT_CONSTEXPR_DECL const unsigned num_format_parts =
+ constexpr_max(count_parts(to_string_view(S())), 1u);
+#else
+ static const unsigned num_format_parts = 1;
+#endif
+
+ using parts_container = format_part<char_type>[num_format_parts];
+
+ const parts_container& parts() const {
+ static FMT_CONSTEXPR_DECL const auto compiled_parts =
+ compile_to_parts<char_type, num_format_parts>(
+ internal::to_string_view(S()));
+ return compiled_parts.data;
+ }
+};
+
+template <typename S, typename... Args>
+class compiled_format : private compiled_format_base<S> {
+ public:
+ using typename compiled_format_base<S>::char_type;
+
+ private:
+ basic_string_view<char_type> format_str_;
+
+ template <typename Context, typename Range, typename CompiledFormat>
+ friend auto cf::vformat_to(Range out, CompiledFormat& cf,
+ basic_format_args<Context> args) ->
+ typename Context::iterator;
+
+ public:
+ compiled_format() = delete;
+ explicit constexpr compiled_format(basic_string_view<char_type> format_str)
+ : compiled_format_base<S>(format_str), format_str_(format_str) {}
+};
+
+#ifdef __cpp_if_constexpr
+template <typename... Args> struct type_list {};
+
+// Returns a reference to the argument at index N from [first, rest...].
+template <int N, typename T, typename... Args>
+constexpr const auto& get(const T& first, const Args&... rest) {
+ static_assert(N < 1 + sizeof...(Args), "index is out of bounds");
+ if constexpr (N == 0)
+ return first;
+ else
+ return get<N - 1>(rest...);
+}
+
+template <int N, typename> struct get_type_impl;
+
+template <int N, typename... Args> struct get_type_impl<N, type_list<Args...>> {
+ using type = remove_cvref_t<decltype(get<N>(std::declval<Args>()...))>;
+};
+
+template <int N, typename T>
+using get_type = typename get_type_impl<N, T>::type;
+
+template <typename Char> struct text {
+ basic_string_view<Char> data;
+ using char_type = Char;
+
+ template <typename OutputIt, typename... Args>
+ OutputIt format(OutputIt out, const Args&...) const {
+ // TODO: reserve
+ return copy_str<Char>(data.begin(), data.end(), out);
+ }
+};
+
+template <typename Char>
+constexpr text<Char> make_text(basic_string_view<Char> s, size_t pos,
+ size_t size) {
+ return {{&s[pos], size}};
+}
+
+template <typename Char, typename OutputIt, typename T,
+ std::enable_if_t<std::is_integral_v<T>, int> = 0>
+OutputIt format_default(OutputIt out, T value) {
+ // TODO: reserve
+ format_int fi(value);
+ return std::copy(fi.data(), fi.data() + fi.size(), out);
+}
+
+template <typename Char, typename OutputIt>
+OutputIt format_default(OutputIt out, double value) {
+ writer w(out);
+ w.write(value);
+ return w.out();
+}
+
+template <typename Char, typename OutputIt>
+OutputIt format_default(OutputIt out, Char value) {
+ *out++ = value;
+ return out;
+}
+
+template <typename Char, typename OutputIt>
+OutputIt format_default(OutputIt out, const Char* value) {
+ auto length = std::char_traits<Char>::length(value);
+ return copy_str<Char>(value, value + length, out);
+}
+
+// A replacement field that refers to argument N.
+template <typename Char, typename T, int N> struct field {
+ using char_type = Char;
+
+ template <typename OutputIt, typename... Args>
+ OutputIt format(OutputIt out, const Args&... args) const {
+ // This ensures that the argument type is convertile to `const T&`.
+ const T& arg = get<N>(args...);
+ return format_default<Char>(out, arg);
+ }
+};
+
+template <typename L, typename R> struct concat {
+ L lhs;
+ R rhs;
+ using char_type = typename L::char_type;
+
+ template <typename OutputIt, typename... Args>
+ OutputIt format(OutputIt out, const Args&... args) const {
+ out = lhs.format(out, args...);
+ return rhs.format(out, args...);
+ }
+};
+
+template <typename L, typename R>
+constexpr concat<L, R> make_concat(L lhs, R rhs) {
+ return {lhs, rhs};
+}
+
+struct unknown_format {};
+
+template <typename Char>
+constexpr size_t parse_text(basic_string_view<Char> str, size_t pos) {
+ for (size_t size = str.size(); pos != size; ++pos) {
+ if (str[pos] == '{' || str[pos] == '}') break;
+ }
+ return pos;
+}
+
+template <typename Args, size_t POS, int ID, typename S>
+constexpr auto compile_format_string(S format_str);
+
+template <typename Args, size_t POS, int ID, typename T, typename S>
+constexpr auto parse_tail(T head, S format_str) {
+ if constexpr (POS != to_string_view(format_str).size()) {
+ constexpr auto tail = compile_format_string<Args, POS, ID>(format_str);
+ if constexpr (std::is_same<remove_cvref_t<decltype(tail)>,
+ unknown_format>())
+ return tail;
+ else
+ return make_concat(head, tail);
+ } else {
+ return head;
+ }
+}
+
+// Compiles a non-empty format string and returns the compiled representation
+// or unknown_format() on unrecognized input.
+template <typename Args, size_t POS, int ID, typename S>
+constexpr auto compile_format_string(S format_str) {
+ using char_type = typename S::char_type;
+ constexpr basic_string_view<char_type> str = format_str;
+ if constexpr (str[POS] == '{') {
+ if (POS + 1 == str.size())
+ throw format_error("unmatched '{' in format string");
+ if constexpr (str[POS + 1] == '{') {
+ return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str);
+ } else if constexpr (str[POS + 1] == '}') {
+ using type = get_type<ID, Args>;
+ if constexpr (std::is_same<type, int>::value) {
+ return parse_tail<Args, POS + 2, ID + 1>(field<char_type, type, ID>(),
+ format_str);
+ } else {
+ return unknown_format();
+ }
+ } else {
+ return unknown_format();
+ }
+ } else if constexpr (str[POS] == '}') {
+ if (POS + 1 == str.size())
+ throw format_error("unmatched '}' in format string");
+ return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), format_str);
+ } else {
+ constexpr auto end = parse_text(str, POS + 1);
+ return parse_tail<Args, end, ID>(make_text(str, POS, end - POS),
+ format_str);
+ }
+}
+#endif // __cpp_if_constexpr
+} // namespace internal
+
+#if FMT_USE_CONSTEXPR
+# ifdef __cpp_if_constexpr
+template <typename... Args, typename S,
+ FMT_ENABLE_IF(is_compile_string<S>::value)>
+constexpr auto compile(S format_str) {
+ constexpr basic_string_view<typename S::char_type> str = format_str;
+ if constexpr (str.size() == 0) {
+ return internal::make_text(str, 0, 0);
+ } else {
+ constexpr auto result =
+ internal::compile_format_string<internal::type_list<Args...>, 0, 0>(
+ format_str);
+ if constexpr (std::is_same<remove_cvref_t<decltype(result)>,
+ internal::unknown_format>()) {
+ return internal::compiled_format<S, Args...>(to_string_view(format_str));
+ } else {
+ return result;
+ }
+ }
+}
+
+template <typename CompiledFormat, typename... Args,
+ typename Char = typename CompiledFormat::char_type,
+ FMT_ENABLE_IF(!std::is_base_of<internal::basic_compiled_format,
+ CompiledFormat>::value)>
+std::basic_string<Char> format(const CompiledFormat& cf, const Args&... args) {
+ basic_memory_buffer<Char> buffer;
+ cf.format(std::back_inserter(buffer), args...);
+ return to_string(buffer);
+}
+
+template <typename OutputIt, typename CompiledFormat, typename... Args,
+ FMT_ENABLE_IF(!std::is_base_of<internal::basic_compiled_format,
+ CompiledFormat>::value)>
+OutputIt format_to(OutputIt out, const CompiledFormat& cf,
+ const Args&... args) {
+ return cf.format(out, args...);
+}
+# else
+template <typename... Args, typename S,
+ FMT_ENABLE_IF(is_compile_string<S>::value)>
+constexpr auto compile(S format_str) -> internal::compiled_format<S, Args...> {
+ return internal::compiled_format<S, Args...>(to_string_view(format_str));
+}
+# endif // __cpp_if_constexpr
+#endif // FMT_USE_CONSTEXPR
+
+// Compiles the format string which must be a string literal.
+template <typename... Args, typename Char, size_t N>
+auto compile(const Char (&format_str)[N])
+ -> internal::compiled_format<const Char*, Args...> {
+ return internal::compiled_format<const Char*, Args...>(
+ basic_string_view<Char>(format_str, N - 1));
+}
+
+template <typename CompiledFormat, typename... Args,
+ typename Char = typename CompiledFormat::char_type,
+ FMT_ENABLE_IF(std::is_base_of<internal::basic_compiled_format,
+ CompiledFormat>::value)>
+std::basic_string<Char> format(const CompiledFormat& cf, const Args&... args) {
+ basic_memory_buffer<Char> buffer;
+ using range = buffer_range<Char>;
+ using context = buffer_context<Char>;
+ internal::cf::vformat_to<context>(range(buffer), cf,
+ {make_format_args<context>(args...)});
+ return to_string(buffer);
+}
+
+template <typename OutputIt, typename CompiledFormat, typename... Args,
+ FMT_ENABLE_IF(std::is_base_of<internal::basic_compiled_format,
+ CompiledFormat>::value)>
+OutputIt format_to(OutputIt out, const CompiledFormat& cf,
+ const Args&... args) {
+ using char_type = typename CompiledFormat::char_type;
+ using range = internal::output_range<OutputIt, char_type>;
+ using context = format_context_t<OutputIt, char_type>;
+ return internal::cf::vformat_to<context>(
+ range(out), cf, {make_format_args<context>(args...)});
+}
+
+template <typename OutputIt, typename CompiledFormat, typename... Args,
+ FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value)>
+format_to_n_result<OutputIt> format_to_n(OutputIt out, size_t n,
+ const CompiledFormat& cf,
+ const Args&... args) {
+ auto it =
+ format_to(internal::truncating_iterator<OutputIt>(out, n), cf, args...);
+ return {it.base(), it.count()};
+}
+
+template <typename CompiledFormat, typename... Args>
+std::size_t formatted_size(const CompiledFormat& cf, const Args&... args) {
+ return format_to(internal::counting_iterator(), cf, args...).count();
+}
+
+FMT_END_NAMESPACE
+
+#endif // FMT_COMPILE_H_
--- /dev/null
+// Formatting library for C++ - the core API
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_CORE_H_
+#define FMT_CORE_H_
+
+#include <cstdio> // std::FILE
+#include <cstring>
+#include <iterator>
+#include <string>
+#include <type_traits>
+
+// The fmt library version in the form major * 10000 + minor * 100 + patch.
+#define FMT_VERSION 60102
+
+#ifdef __has_feature
+# define FMT_HAS_FEATURE(x) __has_feature(x)
+#else
+# define FMT_HAS_FEATURE(x) 0
+#endif
+
+#if defined(__has_include) && !defined(__INTELLISENSE__) && \
+ !(defined(__INTEL_COMPILER) && __INTEL_COMPILER < 1600)
+# define FMT_HAS_INCLUDE(x) __has_include(x)
+#else
+# define FMT_HAS_INCLUDE(x) 0
+#endif
+
+#ifdef __has_cpp_attribute
+# define FMT_HAS_CPP_ATTRIBUTE(x) __has_cpp_attribute(x)
+#else
+# define FMT_HAS_CPP_ATTRIBUTE(x) 0
+#endif
+
+#if defined(__GNUC__) && !defined(__clang__)
+# define FMT_GCC_VERSION (__GNUC__ * 100 + __GNUC_MINOR__)
+#else
+# define FMT_GCC_VERSION 0
+#endif
+
+#if __cplusplus >= 201103L || defined(__GXX_EXPERIMENTAL_CXX0X__)
+# define FMT_HAS_GXX_CXX11 FMT_GCC_VERSION
+#else
+# define FMT_HAS_GXX_CXX11 0
+#endif
+
+#ifdef __NVCC__
+# define FMT_NVCC __NVCC__
+#else
+# define FMT_NVCC 0
+#endif
+
+#ifdef _MSC_VER
+# define FMT_MSC_VER _MSC_VER
+#else
+# define FMT_MSC_VER 0
+#endif
+
+// Check if relaxed C++14 constexpr is supported.
+// GCC doesn't allow throw in constexpr until version 6 (bug 67371).
+#ifndef FMT_USE_CONSTEXPR
+# define FMT_USE_CONSTEXPR \
+ (FMT_HAS_FEATURE(cxx_relaxed_constexpr) || FMT_MSC_VER >= 1910 || \
+ (FMT_GCC_VERSION >= 600 && __cplusplus >= 201402L)) && \
+ !FMT_NVCC
+#endif
+#if FMT_USE_CONSTEXPR
+# define FMT_CONSTEXPR constexpr
+# define FMT_CONSTEXPR_DECL constexpr
+#else
+# define FMT_CONSTEXPR inline
+# define FMT_CONSTEXPR_DECL
+#endif
+
+#ifndef FMT_OVERRIDE
+# if FMT_HAS_FEATURE(cxx_override) || \
+ (FMT_GCC_VERSION >= 408 && FMT_HAS_GXX_CXX11) || FMT_MSC_VER >= 1900
+# define FMT_OVERRIDE override
+# else
+# define FMT_OVERRIDE
+# endif
+#endif
+
+// Check if exceptions are disabled.
+#ifndef FMT_EXCEPTIONS
+# if (defined(__GNUC__) && !defined(__EXCEPTIONS)) || \
+ FMT_MSC_VER && !_HAS_EXCEPTIONS
+# define FMT_EXCEPTIONS 0
+# else
+# define FMT_EXCEPTIONS 1
+# endif
+#endif
+
+// Define FMT_USE_NOEXCEPT to make fmt use noexcept (C++11 feature).
+#ifndef FMT_USE_NOEXCEPT
+# define FMT_USE_NOEXCEPT 0
+#endif
+
+#if FMT_USE_NOEXCEPT || FMT_HAS_FEATURE(cxx_noexcept) || \
+ (FMT_GCC_VERSION >= 408 && FMT_HAS_GXX_CXX11) || FMT_MSC_VER >= 1900
+# define FMT_DETECTED_NOEXCEPT noexcept
+# define FMT_HAS_CXX11_NOEXCEPT 1
+#else
+# define FMT_DETECTED_NOEXCEPT throw()
+# define FMT_HAS_CXX11_NOEXCEPT 0
+#endif
+
+#ifndef FMT_NOEXCEPT
+# if FMT_EXCEPTIONS || FMT_HAS_CXX11_NOEXCEPT
+# define FMT_NOEXCEPT FMT_DETECTED_NOEXCEPT
+# else
+# define FMT_NOEXCEPT
+# endif
+#endif
+
+// [[noreturn]] is disabled on MSVC because of bogus unreachable code warnings.
+#if FMT_EXCEPTIONS && FMT_HAS_CPP_ATTRIBUTE(noreturn) && !FMT_MSC_VER
+# define FMT_NORETURN [[noreturn]]
+#else
+# define FMT_NORETURN
+#endif
+
+#ifndef FMT_DEPRECATED
+# if (FMT_HAS_CPP_ATTRIBUTE(deprecated) && __cplusplus >= 201402L) || \
+ FMT_MSC_VER >= 1900
+# define FMT_DEPRECATED [[deprecated]]
+# else
+# if defined(__GNUC__) || defined(__clang__)
+# define FMT_DEPRECATED __attribute__((deprecated))
+# elif FMT_MSC_VER
+# define FMT_DEPRECATED __declspec(deprecated)
+# else
+# define FMT_DEPRECATED /* deprecated */
+# endif
+# endif
+#endif
+
+// Workaround broken [[deprecated]] in the Intel compiler and NVCC.
+#if defined(__INTEL_COMPILER) || FMT_NVCC
+# define FMT_DEPRECATED_ALIAS
+#else
+# define FMT_DEPRECATED_ALIAS FMT_DEPRECATED
+#endif
+
+#ifndef FMT_BEGIN_NAMESPACE
+# if FMT_HAS_FEATURE(cxx_inline_namespaces) || FMT_GCC_VERSION >= 404 || \
+ FMT_MSC_VER >= 1900
+# define FMT_INLINE_NAMESPACE inline namespace
+# define FMT_END_NAMESPACE \
+ } \
+ }
+# else
+# define FMT_INLINE_NAMESPACE namespace
+# define FMT_END_NAMESPACE \
+ } \
+ using namespace v6; \
+ }
+# endif
+# define FMT_BEGIN_NAMESPACE \
+ namespace fmt { \
+ FMT_INLINE_NAMESPACE v6 {
+#endif
+
+#if !defined(FMT_HEADER_ONLY) && defined(_WIN32)
+# ifdef FMT_EXPORT
+# define FMT_API __declspec(dllexport)
+# elif defined(FMT_SHARED)
+# define FMT_API __declspec(dllimport)
+# define FMT_EXTERN_TEMPLATE_API FMT_API
+# endif
+#endif
+#ifndef FMT_API
+# define FMT_API
+#endif
+#ifndef FMT_EXTERN_TEMPLATE_API
+# define FMT_EXTERN_TEMPLATE_API
+#endif
+
+#ifndef FMT_HEADER_ONLY
+# define FMT_EXTERN extern
+#else
+# define FMT_EXTERN
+#endif
+
+// libc++ supports string_view in pre-c++17.
+#if (FMT_HAS_INCLUDE(<string_view>) && \
+ (__cplusplus > 201402L || defined(_LIBCPP_VERSION))) || \
+ (defined(_MSVC_LANG) && _MSVC_LANG > 201402L && _MSC_VER >= 1910)
+# include <string_view>
+# define FMT_USE_STRING_VIEW
+#elif FMT_HAS_INCLUDE("experimental/string_view") && __cplusplus >= 201402L
+# include <experimental/string_view>
+# define FMT_USE_EXPERIMENTAL_STRING_VIEW
+#endif
+
+FMT_BEGIN_NAMESPACE
+
+// Implementations of enable_if_t and other types for pre-C++14 systems.
+template <bool B, class T = void>
+using enable_if_t = typename std::enable_if<B, T>::type;
+template <bool B, class T, class F>
+using conditional_t = typename std::conditional<B, T, F>::type;
+template <bool B> using bool_constant = std::integral_constant<bool, B>;
+template <typename T>
+using remove_reference_t = typename std::remove_reference<T>::type;
+template <typename T>
+using remove_const_t = typename std::remove_const<T>::type;
+template <typename T>
+using remove_cvref_t = typename std::remove_cv<remove_reference_t<T>>::type;
+
+struct monostate {};
+
+// An enable_if helper to be used in template parameters which results in much
+// shorter symbols: https://godbolt.org/z/sWw4vP. Extra parentheses are needed
+// to workaround a bug in MSVC 2019 (see #1140 and #1186).
+#define FMT_ENABLE_IF(...) enable_if_t<(__VA_ARGS__), int> = 0
+
+namespace internal {
+
+// A workaround for gcc 4.8 to make void_t work in a SFINAE context.
+template <typename... Ts> struct void_t_impl { using type = void; };
+
+FMT_API void assert_fail(const char* file, int line, const char* message);
+
+#ifndef FMT_ASSERT
+# ifdef NDEBUG
+# define FMT_ASSERT(condition, message)
+# else
+# define FMT_ASSERT(condition, message) \
+ ((condition) \
+ ? void() \
+ : fmt::internal::assert_fail(__FILE__, __LINE__, (message)))
+# endif
+#endif
+
+#if defined(FMT_USE_STRING_VIEW)
+template <typename Char> using std_string_view = std::basic_string_view<Char>;
+#elif defined(FMT_USE_EXPERIMENTAL_STRING_VIEW)
+template <typename Char>
+using std_string_view = std::experimental::basic_string_view<Char>;
+#else
+template <typename T> struct std_string_view {};
+#endif
+
+#ifdef FMT_USE_INT128
+// Do nothing.
+#elif defined(__SIZEOF_INT128__)
+# define FMT_USE_INT128 1
+using int128_t = __int128_t;
+using uint128_t = __uint128_t;
+#else
+# define FMT_USE_INT128 0
+#endif
+#if !FMT_USE_INT128
+struct int128_t {};
+struct uint128_t {};
+#endif
+
+// Casts a nonnegative integer to unsigned.
+template <typename Int>
+FMT_CONSTEXPR typename std::make_unsigned<Int>::type to_unsigned(Int value) {
+ FMT_ASSERT(value >= 0, "negative value");
+ return static_cast<typename std::make_unsigned<Int>::type>(value);
+}
+} // namespace internal
+
+template <typename... Ts>
+using void_t = typename internal::void_t_impl<Ts...>::type;
+
+/**
+ An implementation of ``std::basic_string_view`` for pre-C++17. It provides a
+ subset of the API. ``fmt::basic_string_view`` is used for format strings even
+ if ``std::string_view`` is available to prevent issues when a library is
+ compiled with a different ``-std`` option than the client code (which is not
+ recommended).
+ */
+template <typename Char> class basic_string_view {
+ private:
+ const Char* data_;
+ size_t size_;
+
+ public:
+ using char_type = Char;
+ using iterator = const Char*;
+
+ FMT_CONSTEXPR basic_string_view() FMT_NOEXCEPT : data_(nullptr), size_(0) {}
+
+ /** Constructs a string reference object from a C string and a size. */
+ FMT_CONSTEXPR basic_string_view(const Char* s, size_t count) FMT_NOEXCEPT
+ : data_(s),
+ size_(count) {}
+
+ /**
+ \rst
+ Constructs a string reference object from a C string computing
+ the size with ``std::char_traits<Char>::length``.
+ \endrst
+ */
+ basic_string_view(const Char* s)
+ : data_(s), size_(std::char_traits<Char>::length(s)) {}
+
+ /** Constructs a string reference from a ``std::basic_string`` object. */
+ template <typename Traits, typename Alloc>
+ FMT_CONSTEXPR basic_string_view(
+ const std::basic_string<Char, Traits, Alloc>& s) FMT_NOEXCEPT
+ : data_(s.data()),
+ size_(s.size()) {}
+
+ template <
+ typename S,
+ FMT_ENABLE_IF(std::is_same<S, internal::std_string_view<Char>>::value)>
+ FMT_CONSTEXPR basic_string_view(S s) FMT_NOEXCEPT : data_(s.data()),
+ size_(s.size()) {}
+
+ /** Returns a pointer to the string data. */
+ FMT_CONSTEXPR const Char* data() const { return data_; }
+
+ /** Returns the string size. */
+ FMT_CONSTEXPR size_t size() const { return size_; }
+
+ FMT_CONSTEXPR iterator begin() const { return data_; }
+ FMT_CONSTEXPR iterator end() const { return data_ + size_; }
+
+ FMT_CONSTEXPR const Char& operator[](size_t pos) const { return data_[pos]; }
+
+ FMT_CONSTEXPR void remove_prefix(size_t n) {
+ data_ += n;
+ size_ -= n;
+ }
+
+ // Lexicographically compare this string reference to other.
+ int compare(basic_string_view other) const {
+ size_t str_size = size_ < other.size_ ? size_ : other.size_;
+ int result = std::char_traits<Char>::compare(data_, other.data_, str_size);
+ if (result == 0)
+ result = size_ == other.size_ ? 0 : (size_ < other.size_ ? -1 : 1);
+ return result;
+ }
+
+ friend bool operator==(basic_string_view lhs, basic_string_view rhs) {
+ return lhs.compare(rhs) == 0;
+ }
+ friend bool operator!=(basic_string_view lhs, basic_string_view rhs) {
+ return lhs.compare(rhs) != 0;
+ }
+ friend bool operator<(basic_string_view lhs, basic_string_view rhs) {
+ return lhs.compare(rhs) < 0;
+ }
+ friend bool operator<=(basic_string_view lhs, basic_string_view rhs) {
+ return lhs.compare(rhs) <= 0;
+ }
+ friend bool operator>(basic_string_view lhs, basic_string_view rhs) {
+ return lhs.compare(rhs) > 0;
+ }
+ friend bool operator>=(basic_string_view lhs, basic_string_view rhs) {
+ return lhs.compare(rhs) >= 0;
+ }
+};
+
+using string_view = basic_string_view<char>;
+using wstring_view = basic_string_view<wchar_t>;
+
+#ifndef __cpp_char8_t
+// A UTF-8 code unit type.
+enum char8_t : unsigned char {};
+#endif
+
+/** Specifies if ``T`` is a character type. Can be specialized by users. */
+template <typename T> struct is_char : std::false_type {};
+template <> struct is_char<char> : std::true_type {};
+template <> struct is_char<wchar_t> : std::true_type {};
+template <> struct is_char<char8_t> : std::true_type {};
+template <> struct is_char<char16_t> : std::true_type {};
+template <> struct is_char<char32_t> : std::true_type {};
+
+/**
+ \rst
+ Returns a string view of `s`. In order to add custom string type support to
+ {fmt} provide an overload of `to_string_view` for it in the same namespace as
+ the type for the argument-dependent lookup to work.
+
+ **Example**::
+
+ namespace my_ns {
+ inline string_view to_string_view(const my_string& s) {
+ return {s.data(), s.length()};
+ }
+ }
+ std::string message = fmt::format(my_string("The answer is {}"), 42);
+ \endrst
+ */
+template <typename Char, FMT_ENABLE_IF(is_char<Char>::value)>
+inline basic_string_view<Char> to_string_view(const Char* s) {
+ return s;
+}
+
+template <typename Char, typename Traits, typename Alloc>
+inline basic_string_view<Char> to_string_view(
+ const std::basic_string<Char, Traits, Alloc>& s) {
+ return s;
+}
+
+template <typename Char>
+inline basic_string_view<Char> to_string_view(basic_string_view<Char> s) {
+ return s;
+}
+
+template <typename Char,
+ FMT_ENABLE_IF(!std::is_empty<internal::std_string_view<Char>>::value)>
+inline basic_string_view<Char> to_string_view(
+ internal::std_string_view<Char> s) {
+ return s;
+}
+
+// A base class for compile-time strings. It is defined in the fmt namespace to
+// make formatting functions visible via ADL, e.g. format(fmt("{}"), 42).
+struct compile_string {};
+
+template <typename S>
+struct is_compile_string : std::is_base_of<compile_string, S> {};
+
+template <typename S, FMT_ENABLE_IF(is_compile_string<S>::value)>
+constexpr basic_string_view<typename S::char_type> to_string_view(const S& s) {
+ return s;
+}
+
+namespace internal {
+void to_string_view(...);
+using fmt::v6::to_string_view;
+
+// Specifies whether S is a string type convertible to fmt::basic_string_view.
+// It should be a constexpr function but MSVC 2017 fails to compile it in
+// enable_if and MSVC 2015 fails to compile it as an alias template.
+template <typename S>
+struct is_string : std::is_class<decltype(to_string_view(std::declval<S>()))> {
+};
+
+template <typename S, typename = void> struct char_t_impl {};
+template <typename S> struct char_t_impl<S, enable_if_t<is_string<S>::value>> {
+ using result = decltype(to_string_view(std::declval<S>()));
+ using type = typename result::char_type;
+};
+
+struct error_handler {
+ FMT_CONSTEXPR error_handler() = default;
+ FMT_CONSTEXPR error_handler(const error_handler&) = default;
+
+ // This function is intentionally not constexpr to give a compile-time error.
+ FMT_NORETURN FMT_API void on_error(const char* message);
+};
+} // namespace internal
+
+/** String's character type. */
+template <typename S> using char_t = typename internal::char_t_impl<S>::type;
+
+/**
+ \rst
+ Parsing context consisting of a format string range being parsed and an
+ argument counter for automatic indexing.
+
+ You can use one of the following type aliases for common character types:
+
+ +-----------------------+-------------------------------------+
+ | Type | Definition |
+ +=======================+=====================================+
+ | format_parse_context | basic_format_parse_context<char> |
+ +-----------------------+-------------------------------------+
+ | wformat_parse_context | basic_format_parse_context<wchar_t> |
+ +-----------------------+-------------------------------------+
+ \endrst
+ */
+template <typename Char, typename ErrorHandler = internal::error_handler>
+class basic_format_parse_context : private ErrorHandler {
+ private:
+ basic_string_view<Char> format_str_;
+ int next_arg_id_;
+
+ public:
+ using char_type = Char;
+ using iterator = typename basic_string_view<Char>::iterator;
+
+ explicit FMT_CONSTEXPR basic_format_parse_context(
+ basic_string_view<Char> format_str, ErrorHandler eh = ErrorHandler())
+ : ErrorHandler(eh), format_str_(format_str), next_arg_id_(0) {}
+
+ /**
+ Returns an iterator to the beginning of the format string range being
+ parsed.
+ */
+ FMT_CONSTEXPR iterator begin() const FMT_NOEXCEPT {
+ return format_str_.begin();
+ }
+
+ /**
+ Returns an iterator past the end of the format string range being parsed.
+ */
+ FMT_CONSTEXPR iterator end() const FMT_NOEXCEPT { return format_str_.end(); }
+
+ /** Advances the begin iterator to ``it``. */
+ FMT_CONSTEXPR void advance_to(iterator it) {
+ format_str_.remove_prefix(internal::to_unsigned(it - begin()));
+ }
+
+ /**
+ Reports an error if using the manual argument indexing; otherwise returns
+ the next argument index and switches to the automatic indexing.
+ */
+ FMT_CONSTEXPR int next_arg_id() {
+ if (next_arg_id_ >= 0) return next_arg_id_++;
+ on_error("cannot switch from manual to automatic argument indexing");
+ return 0;
+ }
+
+ /**
+ Reports an error if using the automatic argument indexing; otherwise
+ switches to the manual indexing.
+ */
+ FMT_CONSTEXPR void check_arg_id(int) {
+ if (next_arg_id_ > 0)
+ on_error("cannot switch from automatic to manual argument indexing");
+ else
+ next_arg_id_ = -1;
+ }
+
+ FMT_CONSTEXPR void check_arg_id(basic_string_view<Char>) {}
+
+ FMT_CONSTEXPR void on_error(const char* message) {
+ ErrorHandler::on_error(message);
+ }
+
+ FMT_CONSTEXPR ErrorHandler error_handler() const { return *this; }
+};
+
+using format_parse_context = basic_format_parse_context<char>;
+using wformat_parse_context = basic_format_parse_context<wchar_t>;
+
+template <typename Char, typename ErrorHandler = internal::error_handler>
+using basic_parse_context FMT_DEPRECATED_ALIAS =
+ basic_format_parse_context<Char, ErrorHandler>;
+using parse_context FMT_DEPRECATED_ALIAS = basic_format_parse_context<char>;
+using wparse_context FMT_DEPRECATED_ALIAS = basic_format_parse_context<wchar_t>;
+
+template <typename Context> class basic_format_arg;
+template <typename Context> class basic_format_args;
+
+// A formatter for objects of type T.
+template <typename T, typename Char = char, typename Enable = void>
+struct formatter {
+ // A deleted default constructor indicates a disabled formatter.
+ formatter() = delete;
+};
+
+template <typename T, typename Char, typename Enable = void>
+struct FMT_DEPRECATED convert_to_int
+ : bool_constant<!std::is_arithmetic<T>::value &&
+ std::is_convertible<T, int>::value> {};
+
+// Specifies if T has an enabled formatter specialization. A type can be
+// formattable even if it doesn't have a formatter e.g. via a conversion.
+template <typename T, typename Context>
+using has_formatter =
+ std::is_constructible<typename Context::template formatter_type<T>>;
+
+namespace internal {
+
+/** A contiguous memory buffer with an optional growing ability. */
+template <typename T> class buffer {
+ private:
+ T* ptr_;
+ std::size_t size_;
+ std::size_t capacity_;
+
+ protected:
+ // Don't initialize ptr_ since it is not accessed to save a few cycles.
+ buffer(std::size_t sz) FMT_NOEXCEPT : size_(sz), capacity_(sz) {}
+
+ buffer(T* p = nullptr, std::size_t sz = 0, std::size_t cap = 0) FMT_NOEXCEPT
+ : ptr_(p),
+ size_(sz),
+ capacity_(cap) {}
+
+ /** Sets the buffer data and capacity. */
+ void set(T* buf_data, std::size_t buf_capacity) FMT_NOEXCEPT {
+ ptr_ = buf_data;
+ capacity_ = buf_capacity;
+ }
+
+ /** Increases the buffer capacity to hold at least *capacity* elements. */
+ virtual void grow(std::size_t capacity) = 0;
+
+ public:
+ using value_type = T;
+ using const_reference = const T&;
+
+ buffer(const buffer&) = delete;
+ void operator=(const buffer&) = delete;
+ virtual ~buffer() = default;
+
+ T* begin() FMT_NOEXCEPT { return ptr_; }
+ T* end() FMT_NOEXCEPT { return ptr_ + size_; }
+
+ /** Returns the size of this buffer. */
+ std::size_t size() const FMT_NOEXCEPT { return size_; }
+
+ /** Returns the capacity of this buffer. */
+ std::size_t capacity() const FMT_NOEXCEPT { return capacity_; }
+
+ /** Returns a pointer to the buffer data. */
+ T* data() FMT_NOEXCEPT { return ptr_; }
+
+ /** Returns a pointer to the buffer data. */
+ const T* data() const FMT_NOEXCEPT { return ptr_; }
+
+ /**
+ Resizes the buffer. If T is a POD type new elements may not be initialized.
+ */
+ void resize(std::size_t new_size) {
+ reserve(new_size);
+ size_ = new_size;
+ }
+
+ /** Clears this buffer. */
+ void clear() { size_ = 0; }
+
+ /** Reserves space to store at least *capacity* elements. */
+ void reserve(std::size_t new_capacity) {
+ if (new_capacity > capacity_) grow(new_capacity);
+ }
+
+ void push_back(const T& value) {
+ reserve(size_ + 1);
+ ptr_[size_++] = value;
+ }
+
+ /** Appends data to the end of the buffer. */
+ template <typename U> void append(const U* begin, const U* end);
+
+ T& operator[](std::size_t index) { return ptr_[index]; }
+ const T& operator[](std::size_t index) const { return ptr_[index]; }
+};
+
+// A container-backed buffer.
+template <typename Container>
+class container_buffer : public buffer<typename Container::value_type> {
+ private:
+ Container& container_;
+
+ protected:
+ void grow(std::size_t capacity) FMT_OVERRIDE {
+ container_.resize(capacity);
+ this->set(&container_[0], capacity);
+ }
+
+ public:
+ explicit container_buffer(Container& c)
+ : buffer<typename Container::value_type>(c.size()), container_(c) {}
+};
+
+// Extracts a reference to the container from back_insert_iterator.
+template <typename Container>
+inline Container& get_container(std::back_insert_iterator<Container> it) {
+ using bi_iterator = std::back_insert_iterator<Container>;
+ struct accessor : bi_iterator {
+ accessor(bi_iterator iter) : bi_iterator(iter) {}
+ using bi_iterator::container;
+ };
+ return *accessor(it).container;
+}
+
+template <typename T, typename Char = char, typename Enable = void>
+struct fallback_formatter {
+ fallback_formatter() = delete;
+};
+
+// Specifies if T has an enabled fallback_formatter specialization.
+template <typename T, typename Context>
+using has_fallback_formatter =
+ std::is_constructible<fallback_formatter<T, typename Context::char_type>>;
+
+template <typename Char> struct named_arg_base;
+template <typename T, typename Char> struct named_arg;
+
+enum type {
+ none_type,
+ named_arg_type,
+ // Integer types should go first,
+ int_type,
+ uint_type,
+ long_long_type,
+ ulong_long_type,
+ int128_type,
+ uint128_type,
+ bool_type,
+ char_type,
+ last_integer_type = char_type,
+ // followed by floating-point types.
+ float_type,
+ double_type,
+ long_double_type,
+ last_numeric_type = long_double_type,
+ cstring_type,
+ string_type,
+ pointer_type,
+ custom_type
+};
+
+// Maps core type T to the corresponding type enum constant.
+template <typename T, typename Char>
+struct type_constant : std::integral_constant<type, custom_type> {};
+
+#define FMT_TYPE_CONSTANT(Type, constant) \
+ template <typename Char> \
+ struct type_constant<Type, Char> : std::integral_constant<type, constant> {}
+
+FMT_TYPE_CONSTANT(const named_arg_base<Char>&, named_arg_type);
+FMT_TYPE_CONSTANT(int, int_type);
+FMT_TYPE_CONSTANT(unsigned, uint_type);
+FMT_TYPE_CONSTANT(long long, long_long_type);
+FMT_TYPE_CONSTANT(unsigned long long, ulong_long_type);
+FMT_TYPE_CONSTANT(int128_t, int128_type);
+FMT_TYPE_CONSTANT(uint128_t, uint128_type);
+FMT_TYPE_CONSTANT(bool, bool_type);
+FMT_TYPE_CONSTANT(Char, char_type);
+FMT_TYPE_CONSTANT(float, float_type);
+FMT_TYPE_CONSTANT(double, double_type);
+FMT_TYPE_CONSTANT(long double, long_double_type);
+FMT_TYPE_CONSTANT(const Char*, cstring_type);
+FMT_TYPE_CONSTANT(basic_string_view<Char>, string_type);
+FMT_TYPE_CONSTANT(const void*, pointer_type);
+
+FMT_CONSTEXPR bool is_integral_type(type t) {
+ FMT_ASSERT(t != named_arg_type, "invalid argument type");
+ return t > none_type && t <= last_integer_type;
+}
+
+FMT_CONSTEXPR bool is_arithmetic_type(type t) {
+ FMT_ASSERT(t != named_arg_type, "invalid argument type");
+ return t > none_type && t <= last_numeric_type;
+}
+
+template <typename Char> struct string_value {
+ const Char* data;
+ std::size_t size;
+};
+
+template <typename Context> struct custom_value {
+ using parse_context = basic_format_parse_context<typename Context::char_type>;
+ const void* value;
+ void (*format)(const void* arg, parse_context& parse_ctx, Context& ctx);
+};
+
+// A formatting argument value.
+template <typename Context> class value {
+ public:
+ using char_type = typename Context::char_type;
+
+ union {
+ int int_value;
+ unsigned uint_value;
+ long long long_long_value;
+ unsigned long long ulong_long_value;
+ int128_t int128_value;
+ uint128_t uint128_value;
+ bool bool_value;
+ char_type char_value;
+ float float_value;
+ double double_value;
+ long double long_double_value;
+ const void* pointer;
+ string_value<char_type> string;
+ custom_value<Context> custom;
+ const named_arg_base<char_type>* named_arg;
+ };
+
+ FMT_CONSTEXPR value(int val = 0) : int_value(val) {}
+ FMT_CONSTEXPR value(unsigned val) : uint_value(val) {}
+ value(long long val) : long_long_value(val) {}
+ value(unsigned long long val) : ulong_long_value(val) {}
+ value(int128_t val) : int128_value(val) {}
+ value(uint128_t val) : uint128_value(val) {}
+ value(float val) : float_value(val) {}
+ value(double val) : double_value(val) {}
+ value(long double val) : long_double_value(val) {}
+ value(bool val) : bool_value(val) {}
+ value(char_type val) : char_value(val) {}
+ value(const char_type* val) { string.data = val; }
+ value(basic_string_view<char_type> val) {
+ string.data = val.data();
+ string.size = val.size();
+ }
+ value(const void* val) : pointer(val) {}
+
+ template <typename T> value(const T& val) {
+ custom.value = &val;
+ // Get the formatter type through the context to allow different contexts
+ // have different extension points, e.g. `formatter<T>` for `format` and
+ // `printf_formatter<T>` for `printf`.
+ custom.format = format_custom_arg<
+ T, conditional_t<has_formatter<T, Context>::value,
+ typename Context::template formatter_type<T>,
+ fallback_formatter<T, char_type>>>;
+ }
+
+ value(const named_arg_base<char_type>& val) { named_arg = &val; }
+
+ private:
+ // Formats an argument of a custom type, such as a user-defined class.
+ template <typename T, typename Formatter>
+ static void format_custom_arg(
+ const void* arg, basic_format_parse_context<char_type>& parse_ctx,
+ Context& ctx) {
+ Formatter f;
+ parse_ctx.advance_to(f.parse(parse_ctx));
+ ctx.advance_to(f.format(*static_cast<const T*>(arg), ctx));
+ }
+};
+
+template <typename Context, typename T>
+FMT_CONSTEXPR basic_format_arg<Context> make_arg(const T& value);
+
+// To minimize the number of types we need to deal with, long is translated
+// either to int or to long long depending on its size.
+enum { long_short = sizeof(long) == sizeof(int) };
+using long_type = conditional_t<long_short, int, long long>;
+using ulong_type = conditional_t<long_short, unsigned, unsigned long long>;
+
+// Maps formatting arguments to core types.
+template <typename Context> struct arg_mapper {
+ using char_type = typename Context::char_type;
+
+ FMT_CONSTEXPR int map(signed char val) { return val; }
+ FMT_CONSTEXPR unsigned map(unsigned char val) { return val; }
+ FMT_CONSTEXPR int map(short val) { return val; }
+ FMT_CONSTEXPR unsigned map(unsigned short val) { return val; }
+ FMT_CONSTEXPR int map(int val) { return val; }
+ FMT_CONSTEXPR unsigned map(unsigned val) { return val; }
+ FMT_CONSTEXPR long_type map(long val) { return val; }
+ FMT_CONSTEXPR ulong_type map(unsigned long val) { return val; }
+ FMT_CONSTEXPR long long map(long long val) { return val; }
+ FMT_CONSTEXPR unsigned long long map(unsigned long long val) { return val; }
+ FMT_CONSTEXPR int128_t map(int128_t val) { return val; }
+ FMT_CONSTEXPR uint128_t map(uint128_t val) { return val; }
+ FMT_CONSTEXPR bool map(bool val) { return val; }
+
+ template <typename T, FMT_ENABLE_IF(is_char<T>::value)>
+ FMT_CONSTEXPR char_type map(T val) {
+ static_assert(
+ std::is_same<T, char>::value || std::is_same<T, char_type>::value,
+ "mixing character types is disallowed");
+ return val;
+ }
+
+ FMT_CONSTEXPR float map(float val) { return val; }
+ FMT_CONSTEXPR double map(double val) { return val; }
+ FMT_CONSTEXPR long double map(long double val) { return val; }
+
+ FMT_CONSTEXPR const char_type* map(char_type* val) { return val; }
+ FMT_CONSTEXPR const char_type* map(const char_type* val) { return val; }
+ template <typename T, FMT_ENABLE_IF(is_string<T>::value)>
+ FMT_CONSTEXPR basic_string_view<char_type> map(const T& val) {
+ static_assert(std::is_same<char_type, char_t<T>>::value,
+ "mixing character types is disallowed");
+ return to_string_view(val);
+ }
+ template <typename T,
+ FMT_ENABLE_IF(
+ std::is_constructible<basic_string_view<char_type>, T>::value &&
+ !is_string<T>::value)>
+ FMT_CONSTEXPR basic_string_view<char_type> map(const T& val) {
+ return basic_string_view<char_type>(val);
+ }
+ template <
+ typename T,
+ FMT_ENABLE_IF(
+ std::is_constructible<std_string_view<char_type>, T>::value &&
+ !std::is_constructible<basic_string_view<char_type>, T>::value &&
+ !is_string<T>::value && !has_formatter<T, Context>::value)>
+ FMT_CONSTEXPR basic_string_view<char_type> map(const T& val) {
+ return std_string_view<char_type>(val);
+ }
+ FMT_CONSTEXPR const char* map(const signed char* val) {
+ static_assert(std::is_same<char_type, char>::value, "invalid string type");
+ return reinterpret_cast<const char*>(val);
+ }
+ FMT_CONSTEXPR const char* map(const unsigned char* val) {
+ static_assert(std::is_same<char_type, char>::value, "invalid string type");
+ return reinterpret_cast<const char*>(val);
+ }
+
+ FMT_CONSTEXPR const void* map(void* val) { return val; }
+ FMT_CONSTEXPR const void* map(const void* val) { return val; }
+ FMT_CONSTEXPR const void* map(std::nullptr_t val) { return val; }
+ template <typename T> FMT_CONSTEXPR int map(const T*) {
+ // Formatting of arbitrary pointers is disallowed. If you want to output
+ // a pointer cast it to "void *" or "const void *". In particular, this
+ // forbids formatting of "[const] volatile char *" which is printed as bool
+ // by iostreams.
+ static_assert(!sizeof(T), "formatting of non-void pointers is disallowed");
+ return 0;
+ }
+
+ template <typename T,
+ FMT_ENABLE_IF(std::is_enum<T>::value &&
+ !has_formatter<T, Context>::value &&
+ !has_fallback_formatter<T, Context>::value)>
+ FMT_CONSTEXPR auto map(const T& val) -> decltype(
+ map(static_cast<typename std::underlying_type<T>::type>(val))) {
+ return map(static_cast<typename std::underlying_type<T>::type>(val));
+ }
+ template <
+ typename T,
+ FMT_ENABLE_IF(
+ !is_string<T>::value && !is_char<T>::value &&
+ !std::is_constructible<basic_string_view<char_type>, T>::value &&
+ (has_formatter<T, Context>::value ||
+ (has_fallback_formatter<T, Context>::value &&
+ !std::is_constructible<std_string_view<char_type>, T>::value)))>
+ FMT_CONSTEXPR const T& map(const T& val) {
+ return val;
+ }
+
+ template <typename T>
+ FMT_CONSTEXPR const named_arg_base<char_type>& map(
+ const named_arg<T, char_type>& val) {
+ auto arg = make_arg<Context>(val.value);
+ std::memcpy(val.data, &arg, sizeof(arg));
+ return val;
+ }
+};
+
+// A type constant after applying arg_mapper<Context>.
+template <typename T, typename Context>
+using mapped_type_constant =
+ type_constant<decltype(arg_mapper<Context>().map(std::declval<const T&>())),
+ typename Context::char_type>;
+
+enum { packed_arg_bits = 5 };
+// Maximum number of arguments with packed types.
+enum { max_packed_args = 63 / packed_arg_bits };
+enum : unsigned long long { is_unpacked_bit = 1ULL << 63 };
+
+template <typename Context> class arg_map;
+} // namespace internal
+
+// A formatting argument. It is a trivially copyable/constructible type to
+// allow storage in basic_memory_buffer.
+template <typename Context> class basic_format_arg {
+ private:
+ internal::value<Context> value_;
+ internal::type type_;
+
+ template <typename ContextType, typename T>
+ friend FMT_CONSTEXPR basic_format_arg<ContextType> internal::make_arg(
+ const T& value);
+
+ template <typename Visitor, typename Ctx>
+ friend FMT_CONSTEXPR auto visit_format_arg(Visitor&& vis,
+ const basic_format_arg<Ctx>& arg)
+ -> decltype(vis(0));
+
+ friend class basic_format_args<Context>;
+ friend class internal::arg_map<Context>;
+
+ using char_type = typename Context::char_type;
+
+ public:
+ class handle {
+ public:
+ explicit handle(internal::custom_value<Context> custom) : custom_(custom) {}
+
+ void format(basic_format_parse_context<char_type>& parse_ctx,
+ Context& ctx) const {
+ custom_.format(custom_.value, parse_ctx, ctx);
+ }
+
+ private:
+ internal::custom_value<Context> custom_;
+ };
+
+ FMT_CONSTEXPR basic_format_arg() : type_(internal::none_type) {}
+
+ FMT_CONSTEXPR explicit operator bool() const FMT_NOEXCEPT {
+ return type_ != internal::none_type;
+ }
+
+ internal::type type() const { return type_; }
+
+ bool is_integral() const { return internal::is_integral_type(type_); }
+ bool is_arithmetic() const { return internal::is_arithmetic_type(type_); }
+};
+
+/**
+ \rst
+ Visits an argument dispatching to the appropriate visit method based on
+ the argument type. For example, if the argument type is ``double`` then
+ ``vis(value)`` will be called with the value of type ``double``.
+ \endrst
+ */
+template <typename Visitor, typename Context>
+FMT_CONSTEXPR auto visit_format_arg(Visitor&& vis,
+ const basic_format_arg<Context>& arg)
+ -> decltype(vis(0)) {
+ using char_type = typename Context::char_type;
+ switch (arg.type_) {
+ case internal::none_type:
+ break;
+ case internal::named_arg_type:
+ FMT_ASSERT(false, "invalid argument type");
+ break;
+ case internal::int_type:
+ return vis(arg.value_.int_value);
+ case internal::uint_type:
+ return vis(arg.value_.uint_value);
+ case internal::long_long_type:
+ return vis(arg.value_.long_long_value);
+ case internal::ulong_long_type:
+ return vis(arg.value_.ulong_long_value);
+#if FMT_USE_INT128
+ case internal::int128_type:
+ return vis(arg.value_.int128_value);
+ case internal::uint128_type:
+ return vis(arg.value_.uint128_value);
+#else
+ case internal::int128_type:
+ case internal::uint128_type:
+ break;
+#endif
+ case internal::bool_type:
+ return vis(arg.value_.bool_value);
+ case internal::char_type:
+ return vis(arg.value_.char_value);
+ case internal::float_type:
+ return vis(arg.value_.float_value);
+ case internal::double_type:
+ return vis(arg.value_.double_value);
+ case internal::long_double_type:
+ return vis(arg.value_.long_double_value);
+ case internal::cstring_type:
+ return vis(arg.value_.string.data);
+ case internal::string_type:
+ return vis(basic_string_view<char_type>(arg.value_.string.data,
+ arg.value_.string.size));
+ case internal::pointer_type:
+ return vis(arg.value_.pointer);
+ case internal::custom_type:
+ return vis(typename basic_format_arg<Context>::handle(arg.value_.custom));
+ }
+ return vis(monostate());
+}
+
+namespace internal {
+// A map from argument names to their values for named arguments.
+template <typename Context> class arg_map {
+ private:
+ using char_type = typename Context::char_type;
+
+ struct entry {
+ basic_string_view<char_type> name;
+ basic_format_arg<Context> arg;
+ };
+
+ entry* map_;
+ unsigned size_;
+
+ void push_back(value<Context> val) {
+ const auto& named = *val.named_arg;
+ map_[size_] = {named.name, named.template deserialize<Context>()};
+ ++size_;
+ }
+
+ public:
+ arg_map(const arg_map&) = delete;
+ void operator=(const arg_map&) = delete;
+ arg_map() : map_(nullptr), size_(0) {}
+ void init(const basic_format_args<Context>& args);
+ ~arg_map() { delete[] map_; }
+
+ basic_format_arg<Context> find(basic_string_view<char_type> name) const {
+ // The list is unsorted, so just return the first matching name.
+ for (entry *it = map_, *end = map_ + size_; it != end; ++it) {
+ if (it->name == name) return it->arg;
+ }
+ return {};
+ }
+};
+
+// A type-erased reference to an std::locale to avoid heavy <locale> include.
+class locale_ref {
+ private:
+ const void* locale_; // A type-erased pointer to std::locale.
+
+ public:
+ locale_ref() : locale_(nullptr) {}
+ template <typename Locale> explicit locale_ref(const Locale& loc);
+
+ explicit operator bool() const FMT_NOEXCEPT { return locale_ != nullptr; }
+
+ template <typename Locale> Locale get() const;
+};
+
+template <typename> constexpr unsigned long long encode_types() { return 0; }
+
+template <typename Context, typename Arg, typename... Args>
+constexpr unsigned long long encode_types() {
+ return mapped_type_constant<Arg, Context>::value |
+ (encode_types<Context, Args...>() << packed_arg_bits);
+}
+
+template <typename Context, typename T>
+FMT_CONSTEXPR basic_format_arg<Context> make_arg(const T& value) {
+ basic_format_arg<Context> arg;
+ arg.type_ = mapped_type_constant<T, Context>::value;
+ arg.value_ = arg_mapper<Context>().map(value);
+ return arg;
+}
+
+template <bool IS_PACKED, typename Context, typename T,
+ FMT_ENABLE_IF(IS_PACKED)>
+inline value<Context> make_arg(const T& val) {
+ return arg_mapper<Context>().map(val);
+}
+
+template <bool IS_PACKED, typename Context, typename T,
+ FMT_ENABLE_IF(!IS_PACKED)>
+inline basic_format_arg<Context> make_arg(const T& value) {
+ return make_arg<Context>(value);
+}
+} // namespace internal
+
+// Formatting context.
+template <typename OutputIt, typename Char> class basic_format_context {
+ public:
+ /** The character type for the output. */
+ using char_type = Char;
+
+ private:
+ OutputIt out_;
+ basic_format_args<basic_format_context> args_;
+ internal::arg_map<basic_format_context> map_;
+ internal::locale_ref loc_;
+
+ public:
+ using iterator = OutputIt;
+ using format_arg = basic_format_arg<basic_format_context>;
+ template <typename T> using formatter_type = formatter<T, char_type>;
+
+ basic_format_context(const basic_format_context&) = delete;
+ void operator=(const basic_format_context&) = delete;
+ /**
+ Constructs a ``basic_format_context`` object. References to the arguments are
+ stored in the object so make sure they have appropriate lifetimes.
+ */
+ basic_format_context(OutputIt out,
+ basic_format_args<basic_format_context> ctx_args,
+ internal::locale_ref loc = internal::locale_ref())
+ : out_(out), args_(ctx_args), loc_(loc) {}
+
+ format_arg arg(int id) const { return args_.get(id); }
+
+ // Checks if manual indexing is used and returns the argument with the
+ // specified name.
+ format_arg arg(basic_string_view<char_type> name);
+
+ internal::error_handler error_handler() { return {}; }
+ void on_error(const char* message) { error_handler().on_error(message); }
+
+ // Returns an iterator to the beginning of the output range.
+ iterator out() { return out_; }
+
+ // Advances the begin iterator to ``it``.
+ void advance_to(iterator it) { out_ = it; }
+
+ internal::locale_ref locale() { return loc_; }
+};
+
+template <typename Char>
+using buffer_context =
+ basic_format_context<std::back_insert_iterator<internal::buffer<Char>>,
+ Char>;
+using format_context = buffer_context<char>;
+using wformat_context = buffer_context<wchar_t>;
+
+/**
+ \rst
+ An array of references to arguments. It can be implicitly converted into
+ `~fmt::basic_format_args` for passing into type-erased formatting functions
+ such as `~fmt::vformat`.
+ \endrst
+ */
+template <typename Context, typename... Args> class format_arg_store {
+ private:
+ static const size_t num_args = sizeof...(Args);
+ static const bool is_packed = num_args < internal::max_packed_args;
+
+ using value_type = conditional_t<is_packed, internal::value<Context>,
+ basic_format_arg<Context>>;
+
+ // If the arguments are not packed, add one more element to mark the end.
+ value_type data_[num_args + (num_args == 0 ? 1 : 0)];
+
+ friend class basic_format_args<Context>;
+
+ public:
+ static constexpr unsigned long long types =
+ is_packed ? internal::encode_types<Context, Args...>()
+ : internal::is_unpacked_bit | num_args;
+
+ format_arg_store(const Args&... args)
+ : data_{internal::make_arg<is_packed, Context>(args)...} {}
+};
+
+/**
+ \rst
+ Constructs an `~fmt::format_arg_store` object that contains references to
+ arguments and can be implicitly converted to `~fmt::format_args`. `Context`
+ can be omitted in which case it defaults to `~fmt::context`.
+ See `~fmt::arg` for lifetime considerations.
+ \endrst
+ */
+template <typename Context = format_context, typename... Args>
+inline format_arg_store<Context, Args...> make_format_args(
+ const Args&... args) {
+ return {args...};
+}
+
+/** Formatting arguments. */
+template <typename Context> class basic_format_args {
+ public:
+ using size_type = int;
+ using format_arg = basic_format_arg<Context>;
+
+ private:
+ // To reduce compiled code size per formatting function call, types of first
+ // max_packed_args arguments are passed in the types_ field.
+ unsigned long long types_;
+ union {
+ // If the number of arguments is less than max_packed_args, the argument
+ // values are stored in values_, otherwise they are stored in args_.
+ // This is done to reduce compiled code size as storing larger objects
+ // may require more code (at least on x86-64) even if the same amount of
+ // data is actually copied to stack. It saves ~10% on the bloat test.
+ const internal::value<Context>* values_;
+ const format_arg* args_;
+ };
+
+ bool is_packed() const { return (types_ & internal::is_unpacked_bit) == 0; }
+
+ internal::type type(int index) const {
+ int shift = index * internal::packed_arg_bits;
+ unsigned int mask = (1 << internal::packed_arg_bits) - 1;
+ return static_cast<internal::type>((types_ >> shift) & mask);
+ }
+
+ friend class internal::arg_map<Context>;
+
+ void set_data(const internal::value<Context>* values) { values_ = values; }
+ void set_data(const format_arg* args) { args_ = args; }
+
+ format_arg do_get(int index) const {
+ format_arg arg;
+ if (!is_packed()) {
+ auto num_args = max_size();
+ if (index < num_args) arg = args_[index];
+ return arg;
+ }
+ if (index > internal::max_packed_args) return arg;
+ arg.type_ = type(index);
+ if (arg.type_ == internal::none_type) return arg;
+ internal::value<Context>& val = arg.value_;
+ val = values_[index];
+ return arg;
+ }
+
+ public:
+ basic_format_args() : types_(0) {}
+
+ /**
+ \rst
+ Constructs a `basic_format_args` object from `~fmt::format_arg_store`.
+ \endrst
+ */
+ template <typename... Args>
+ basic_format_args(const format_arg_store<Context, Args...>& store)
+ : types_(store.types) {
+ set_data(store.data_);
+ }
+
+ /**
+ \rst
+ Constructs a `basic_format_args` object from a dynamic set of arguments.
+ \endrst
+ */
+ basic_format_args(const format_arg* args, int count)
+ : types_(internal::is_unpacked_bit | internal::to_unsigned(count)) {
+ set_data(args);
+ }
+
+ /** Returns the argument at specified index. */
+ format_arg get(int index) const {
+ format_arg arg = do_get(index);
+ if (arg.type_ == internal::named_arg_type)
+ arg = arg.value_.named_arg->template deserialize<Context>();
+ return arg;
+ }
+
+ int max_size() const {
+ unsigned long long max_packed = internal::max_packed_args;
+ return static_cast<int>(is_packed() ? max_packed
+ : types_ & ~internal::is_unpacked_bit);
+ }
+};
+
+/** An alias to ``basic_format_args<context>``. */
+// It is a separate type rather than an alias to make symbols readable.
+struct format_args : basic_format_args<format_context> {
+ template <typename... Args>
+ format_args(Args&&... args)
+ : basic_format_args<format_context>(std::forward<Args>(args)...) {}
+};
+struct wformat_args : basic_format_args<wformat_context> {
+ template <typename... Args>
+ wformat_args(Args&&... args)
+ : basic_format_args<wformat_context>(std::forward<Args>(args)...) {}
+};
+
+template <typename Container> struct is_contiguous : std::false_type {};
+
+template <typename Char>
+struct is_contiguous<std::basic_string<Char>> : std::true_type {};
+
+template <typename Char>
+struct is_contiguous<internal::buffer<Char>> : std::true_type {};
+
+namespace internal {
+
+template <typename OutputIt>
+struct is_contiguous_back_insert_iterator : std::false_type {};
+template <typename Container>
+struct is_contiguous_back_insert_iterator<std::back_insert_iterator<Container>>
+ : is_contiguous<Container> {};
+
+template <typename Char> struct named_arg_base {
+ basic_string_view<Char> name;
+
+ // Serialized value<context>.
+ mutable char data[sizeof(basic_format_arg<buffer_context<Char>>)];
+
+ named_arg_base(basic_string_view<Char> nm) : name(nm) {}
+
+ template <typename Context> basic_format_arg<Context> deserialize() const {
+ basic_format_arg<Context> arg;
+ std::memcpy(&arg, data, sizeof(basic_format_arg<Context>));
+ return arg;
+ }
+};
+
+template <typename T, typename Char> struct named_arg : named_arg_base<Char> {
+ const T& value;
+
+ named_arg(basic_string_view<Char> name, const T& val)
+ : named_arg_base<Char>(name), value(val) {}
+};
+
+template <typename..., typename S, FMT_ENABLE_IF(!is_compile_string<S>::value)>
+inline void check_format_string(const S&) {
+#if defined(FMT_ENFORCE_COMPILE_STRING)
+ static_assert(is_compile_string<S>::value,
+ "FMT_ENFORCE_COMPILE_STRING requires all format strings to "
+ "utilize FMT_STRING() or fmt().");
+#endif
+}
+template <typename..., typename S, FMT_ENABLE_IF(is_compile_string<S>::value)>
+void check_format_string(S);
+
+struct view {};
+template <bool...> struct bool_pack;
+template <bool... Args>
+using all_true =
+ std::is_same<bool_pack<Args..., true>, bool_pack<true, Args...>>;
+
+template <typename... Args, typename S, typename Char = char_t<S>>
+inline format_arg_store<buffer_context<Char>, remove_reference_t<Args>...>
+make_args_checked(const S& format_str,
+ const remove_reference_t<Args>&... args) {
+ static_assert(all_true<(!std::is_base_of<view, remove_reference_t<Args>>() ||
+ !std::is_reference<Args>())...>::value,
+ "passing views as lvalues is disallowed");
+ check_format_string<remove_const_t<remove_reference_t<Args>>...>(format_str);
+ return {args...};
+}
+
+template <typename Char>
+std::basic_string<Char> vformat(basic_string_view<Char> format_str,
+ basic_format_args<buffer_context<Char>> args);
+
+template <typename Char>
+typename buffer_context<Char>::iterator vformat_to(
+ buffer<Char>& buf, basic_string_view<Char> format_str,
+ basic_format_args<buffer_context<Char>> args);
+} // namespace internal
+
+/**
+ \rst
+ Returns a named argument to be used in a formatting function.
+
+ The named argument holds a reference and does not extend the lifetime
+ of its arguments.
+ Consequently, a dangling reference can accidentally be created.
+ The user should take care to only pass this function temporaries when
+ the named argument is itself a temporary, as per the following example.
+
+ **Example**::
+
+ fmt::print("Elapsed time: {s:.2f} seconds", fmt::arg("s", 1.23));
+ \endrst
+ */
+template <typename S, typename T, typename Char = char_t<S>>
+inline internal::named_arg<T, Char> arg(const S& name, const T& arg) {
+ static_assert(internal::is_string<S>::value, "");
+ return {name, arg};
+}
+
+// Disable nested named arguments, e.g. ``arg("a", arg("b", 42))``.
+template <typename S, typename T, typename Char>
+void arg(S, internal::named_arg<T, Char>) = delete;
+
+/** Formats a string and writes the output to ``out``. */
+// GCC 8 and earlier cannot handle std::back_insert_iterator<Container> with
+// vformat_to<ArgFormatter>(...) overload, so SFINAE on iterator type instead.
+template <typename OutputIt, typename S, typename Char = char_t<S>,
+ FMT_ENABLE_IF(
+ internal::is_contiguous_back_insert_iterator<OutputIt>::value)>
+OutputIt vformat_to(OutputIt out, const S& format_str,
+ basic_format_args<buffer_context<Char>> args) {
+ using container = remove_reference_t<decltype(internal::get_container(out))>;
+ internal::container_buffer<container> buf((internal::get_container(out)));
+ internal::vformat_to(buf, to_string_view(format_str), args);
+ return out;
+}
+
+template <typename Container, typename S, typename... Args,
+ FMT_ENABLE_IF(
+ is_contiguous<Container>::value&& internal::is_string<S>::value)>
+inline std::back_insert_iterator<Container> format_to(
+ std::back_insert_iterator<Container> out, const S& format_str,
+ Args&&... args) {
+ return vformat_to(
+ out, to_string_view(format_str),
+ {internal::make_args_checked<Args...>(format_str, args...)});
+}
+
+template <typename S, typename Char = char_t<S>>
+inline std::basic_string<Char> vformat(
+ const S& format_str, basic_format_args<buffer_context<Char>> args) {
+ return internal::vformat(to_string_view(format_str), args);
+}
+
+/**
+ \rst
+ Formats arguments and returns the result as a string.
+
+ **Example**::
+
+ #include <fmt/core.h>
+ std::string message = fmt::format("The answer is {}", 42);
+ \endrst
+*/
+// Pass char_t as a default template parameter instead of using
+// std::basic_string<char_t<S>> to reduce the symbol size.
+template <typename S, typename... Args, typename Char = char_t<S>>
+inline std::basic_string<Char> format(const S& format_str, Args&&... args) {
+ return internal::vformat(
+ to_string_view(format_str),
+ {internal::make_args_checked<Args...>(format_str, args...)});
+}
+
+FMT_API void vprint(std::FILE* f, string_view format_str, format_args args);
+FMT_API void vprint(string_view format_str, format_args args);
+
+/**
+ \rst
+ Prints formatted data to the file *f*. For wide format strings,
+ *f* should be in wide-oriented mode set via ``fwide(f, 1)`` or
+ ``_setmode(_fileno(f), _O_U8TEXT)`` on Windows.
+
+ **Example**::
+
+ fmt::print(stderr, "Don't {}!", "panic");
+ \endrst
+ */
+template <typename S, typename... Args,
+ FMT_ENABLE_IF(internal::is_string<S>::value)>
+inline void print(std::FILE* f, const S& format_str, Args&&... args) {
+ vprint(f, to_string_view(format_str),
+ internal::make_args_checked<Args...>(format_str, args...));
+}
+
+/**
+ \rst
+ Prints formatted data to ``stdout``.
+
+ **Example**::
+
+ fmt::print("Elapsed time: {0:.2f} seconds", 1.23);
+ \endrst
+ */
+template <typename S, typename... Args,
+ FMT_ENABLE_IF(internal::is_string<S>::value)>
+inline void print(const S& format_str, Args&&... args) {
+ vprint(to_string_view(format_str),
+ internal::make_args_checked<Args...>(format_str, args...));
+}
+FMT_END_NAMESPACE
+
+#endif // FMT_CORE_H_
--- /dev/null
+// Formatting library for C++ - implementation
+//
+// Copyright (c) 2012 - 2016, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_FORMAT_INL_H_
+#define FMT_FORMAT_INL_H_
+
+#include "format.h"
+
+#include <cassert>
+#include <cctype>
+#include <climits>
+#include <cmath>
+#include <cstdarg>
+#include <cstring> // for std::memmove
+#include <cwchar>
+#if !defined(FMT_STATIC_THOUSANDS_SEPARATOR)
+# include <locale>
+#endif
+
+#if FMT_USE_WINDOWS_H
+# if !defined(FMT_HEADER_ONLY) && !defined(WIN32_LEAN_AND_MEAN)
+# define WIN32_LEAN_AND_MEAN
+# endif
+# if defined(NOMINMAX) || defined(FMT_WIN_MINMAX)
+# include <windows.h>
+# else
+# define NOMINMAX
+# include <windows.h>
+# undef NOMINMAX
+# endif
+#endif
+
+#if FMT_EXCEPTIONS
+# define FMT_TRY try
+# define FMT_CATCH(x) catch (x)
+#else
+# define FMT_TRY if (true)
+# define FMT_CATCH(x) if (false)
+#endif
+
+#ifdef _MSC_VER
+# pragma warning(push)
+# pragma warning(disable : 4702) // unreachable code
+#endif
+
+// Dummy implementations of strerror_r and strerror_s called if corresponding
+// system functions are not available.
+inline fmt::internal::null<> strerror_r(int, char*, ...) { return {}; }
+inline fmt::internal::null<> strerror_s(char*, std::size_t, ...) { return {}; }
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+FMT_FUNC void assert_fail(const char* file, int line, const char* message) {
+ print(stderr, "{}:{}: assertion failed: {}", file, line, message);
+ std::abort();
+}
+
+#ifndef _MSC_VER
+# define FMT_SNPRINTF snprintf
+#else // _MSC_VER
+inline int fmt_snprintf(char* buffer, size_t size, const char* format, ...) {
+ va_list args;
+ va_start(args, format);
+ int result = vsnprintf_s(buffer, size, _TRUNCATE, format, args);
+ va_end(args);
+ return result;
+}
+# define FMT_SNPRINTF fmt_snprintf
+#endif // _MSC_VER
+
+using format_func = void (*)(internal::buffer<char>&, int, string_view);
+
+// A portable thread-safe version of strerror.
+// Sets buffer to point to a string describing the error code.
+// This can be either a pointer to a string stored in buffer,
+// or a pointer to some static immutable string.
+// Returns one of the following values:
+// 0 - success
+// ERANGE - buffer is not large enough to store the error message
+// other - failure
+// Buffer should be at least of size 1.
+FMT_FUNC int safe_strerror(int error_code, char*& buffer,
+ std::size_t buffer_size) FMT_NOEXCEPT {
+ FMT_ASSERT(buffer != nullptr && buffer_size != 0, "invalid buffer");
+
+ class dispatcher {
+ private:
+ int error_code_;
+ char*& buffer_;
+ std::size_t buffer_size_;
+
+ // A noop assignment operator to avoid bogus warnings.
+ void operator=(const dispatcher&) {}
+
+ // Handle the result of XSI-compliant version of strerror_r.
+ int handle(int result) {
+ // glibc versions before 2.13 return result in errno.
+ return result == -1 ? errno : result;
+ }
+
+ // Handle the result of GNU-specific version of strerror_r.
+ int handle(char* message) {
+ // If the buffer is full then the message is probably truncated.
+ if (message == buffer_ && strlen(buffer_) == buffer_size_ - 1)
+ return ERANGE;
+ buffer_ = message;
+ return 0;
+ }
+
+ // Handle the case when strerror_r is not available.
+ int handle(internal::null<>) {
+ return fallback(strerror_s(buffer_, buffer_size_, error_code_));
+ }
+
+ // Fallback to strerror_s when strerror_r is not available.
+ int fallback(int result) {
+ // If the buffer is full then the message is probably truncated.
+ return result == 0 && strlen(buffer_) == buffer_size_ - 1 ? ERANGE
+ : result;
+ }
+
+#if !FMT_MSC_VER
+ // Fallback to strerror if strerror_r and strerror_s are not available.
+ int fallback(internal::null<>) {
+ errno = 0;
+ buffer_ = strerror(error_code_);
+ return errno;
+ }
+#endif
+
+ public:
+ dispatcher(int err_code, char*& buf, std::size_t buf_size)
+ : error_code_(err_code), buffer_(buf), buffer_size_(buf_size) {}
+
+ int run() { return handle(strerror_r(error_code_, buffer_, buffer_size_)); }
+ };
+ return dispatcher(error_code, buffer, buffer_size).run();
+}
+
+FMT_FUNC void format_error_code(internal::buffer<char>& out, int error_code,
+ string_view message) FMT_NOEXCEPT {
+ // Report error code making sure that the output fits into
+ // inline_buffer_size to avoid dynamic memory allocation and potential
+ // bad_alloc.
+ out.resize(0);
+ static const char SEP[] = ": ";
+ static const char ERROR_STR[] = "error ";
+ // Subtract 2 to account for terminating null characters in SEP and ERROR_STR.
+ std::size_t error_code_size = sizeof(SEP) + sizeof(ERROR_STR) - 2;
+ auto abs_value = static_cast<uint32_or_64_or_128_t<int>>(error_code);
+ if (internal::is_negative(error_code)) {
+ abs_value = 0 - abs_value;
+ ++error_code_size;
+ }
+ error_code_size += internal::to_unsigned(internal::count_digits(abs_value));
+ internal::writer w(out);
+ if (message.size() <= inline_buffer_size - error_code_size) {
+ w.write(message);
+ w.write(SEP);
+ }
+ w.write(ERROR_STR);
+ w.write(error_code);
+ assert(out.size() <= inline_buffer_size);
+}
+
+// A wrapper around fwrite that throws on error.
+FMT_FUNC void fwrite_fully(const void* ptr, size_t size, size_t count,
+ FILE* stream) {
+ size_t written = std::fwrite(ptr, size, count, stream);
+ if (written < count) {
+ FMT_THROW(system_error(errno, "cannot write to file"));
+ }
+}
+
+FMT_FUNC void report_error(format_func func, int error_code,
+ string_view message) FMT_NOEXCEPT {
+ memory_buffer full_message;
+ func(full_message, error_code, message);
+ // Don't use fwrite_fully because the latter may throw.
+ (void)std::fwrite(full_message.data(), full_message.size(), 1, stderr);
+ std::fputc('\n', stderr);
+}
+} // namespace internal
+
+#if !defined(FMT_STATIC_THOUSANDS_SEPARATOR)
+namespace internal {
+
+template <typename Locale>
+locale_ref::locale_ref(const Locale& loc) : locale_(&loc) {
+ static_assert(std::is_same<Locale, std::locale>::value, "");
+}
+
+template <typename Locale> Locale locale_ref::get() const {
+ static_assert(std::is_same<Locale, std::locale>::value, "");
+ return locale_ ? *static_cast<const std::locale*>(locale_) : std::locale();
+}
+
+template <typename Char> FMT_FUNC std::string grouping_impl(locale_ref loc) {
+ return std::use_facet<std::numpunct<Char>>(loc.get<std::locale>()).grouping();
+}
+template <typename Char> FMT_FUNC Char thousands_sep_impl(locale_ref loc) {
+ return std::use_facet<std::numpunct<Char>>(loc.get<std::locale>())
+ .thousands_sep();
+}
+template <typename Char> FMT_FUNC Char decimal_point_impl(locale_ref loc) {
+ return std::use_facet<std::numpunct<Char>>(loc.get<std::locale>())
+ .decimal_point();
+}
+} // namespace internal
+#else
+template <typename Char>
+FMT_FUNC std::string internal::grouping_impl(locale_ref) {
+ return "\03";
+}
+template <typename Char>
+FMT_FUNC Char internal::thousands_sep_impl(locale_ref) {
+ return FMT_STATIC_THOUSANDS_SEPARATOR;
+}
+template <typename Char>
+FMT_FUNC Char internal::decimal_point_impl(locale_ref) {
+ return '.';
+}
+#endif
+
+FMT_API FMT_FUNC format_error::~format_error() FMT_NOEXCEPT = default;
+FMT_API FMT_FUNC system_error::~system_error() FMT_NOEXCEPT = default;
+
+FMT_FUNC void system_error::init(int err_code, string_view format_str,
+ format_args args) {
+ error_code_ = err_code;
+ memory_buffer buffer;
+ format_system_error(buffer, err_code, vformat(format_str, args));
+ std::runtime_error& base = *this;
+ base = std::runtime_error(to_string(buffer));
+}
+
+namespace internal {
+
+template <> FMT_FUNC int count_digits<4>(internal::fallback_uintptr n) {
+ // fallback_uintptr is always stored in little endian.
+ int i = static_cast<int>(sizeof(void*)) - 1;
+ while (i > 0 && n.value[i] == 0) --i;
+ auto char_digits = std::numeric_limits<unsigned char>::digits / 4;
+ return i >= 0 ? i * char_digits + count_digits<4, unsigned>(n.value[i]) : 1;
+}
+
+template <typename T>
+const char basic_data<T>::digits[] =
+ "0001020304050607080910111213141516171819"
+ "2021222324252627282930313233343536373839"
+ "4041424344454647484950515253545556575859"
+ "6061626364656667686970717273747576777879"
+ "8081828384858687888990919293949596979899";
+
+template <typename T>
+const char basic_data<T>::hex_digits[] = "0123456789abcdef";
+
+#define FMT_POWERS_OF_10(factor) \
+ factor * 10, (factor)*100, (factor)*1000, (factor)*10000, (factor)*100000, \
+ (factor)*1000000, (factor)*10000000, (factor)*100000000, \
+ (factor)*1000000000
+
+template <typename T>
+const uint64_t basic_data<T>::powers_of_10_64[] = {
+ 1, FMT_POWERS_OF_10(1), FMT_POWERS_OF_10(1000000000ULL),
+ 10000000000000000000ULL};
+
+template <typename T>
+const uint32_t basic_data<T>::zero_or_powers_of_10_32[] = {0,
+ FMT_POWERS_OF_10(1)};
+
+template <typename T>
+const uint64_t basic_data<T>::zero_or_powers_of_10_64[] = {
+ 0, FMT_POWERS_OF_10(1), FMT_POWERS_OF_10(1000000000ULL),
+ 10000000000000000000ULL};
+
+// Normalized 64-bit significands of pow(10, k), for k = -348, -340, ..., 340.
+// These are generated by support/compute-powers.py.
+template <typename T>
+const uint64_t basic_data<T>::pow10_significands[] = {
+ 0xfa8fd5a0081c0288, 0xbaaee17fa23ebf76, 0x8b16fb203055ac76,
+ 0xcf42894a5dce35ea, 0x9a6bb0aa55653b2d, 0xe61acf033d1a45df,
+ 0xab70fe17c79ac6ca, 0xff77b1fcbebcdc4f, 0xbe5691ef416bd60c,
+ 0x8dd01fad907ffc3c, 0xd3515c2831559a83, 0x9d71ac8fada6c9b5,
+ 0xea9c227723ee8bcb, 0xaecc49914078536d, 0x823c12795db6ce57,
+ 0xc21094364dfb5637, 0x9096ea6f3848984f, 0xd77485cb25823ac7,
+ 0xa086cfcd97bf97f4, 0xef340a98172aace5, 0xb23867fb2a35b28e,
+ 0x84c8d4dfd2c63f3b, 0xc5dd44271ad3cdba, 0x936b9fcebb25c996,
+ 0xdbac6c247d62a584, 0xa3ab66580d5fdaf6, 0xf3e2f893dec3f126,
+ 0xb5b5ada8aaff80b8, 0x87625f056c7c4a8b, 0xc9bcff6034c13053,
+ 0x964e858c91ba2655, 0xdff9772470297ebd, 0xa6dfbd9fb8e5b88f,
+ 0xf8a95fcf88747d94, 0xb94470938fa89bcf, 0x8a08f0f8bf0f156b,
+ 0xcdb02555653131b6, 0x993fe2c6d07b7fac, 0xe45c10c42a2b3b06,
+ 0xaa242499697392d3, 0xfd87b5f28300ca0e, 0xbce5086492111aeb,
+ 0x8cbccc096f5088cc, 0xd1b71758e219652c, 0x9c40000000000000,
+ 0xe8d4a51000000000, 0xad78ebc5ac620000, 0x813f3978f8940984,
+ 0xc097ce7bc90715b3, 0x8f7e32ce7bea5c70, 0xd5d238a4abe98068,
+ 0x9f4f2726179a2245, 0xed63a231d4c4fb27, 0xb0de65388cc8ada8,
+ 0x83c7088e1aab65db, 0xc45d1df942711d9a, 0x924d692ca61be758,
+ 0xda01ee641a708dea, 0xa26da3999aef774a, 0xf209787bb47d6b85,
+ 0xb454e4a179dd1877, 0x865b86925b9bc5c2, 0xc83553c5c8965d3d,
+ 0x952ab45cfa97a0b3, 0xde469fbd99a05fe3, 0xa59bc234db398c25,
+ 0xf6c69a72a3989f5c, 0xb7dcbf5354e9bece, 0x88fcf317f22241e2,
+ 0xcc20ce9bd35c78a5, 0x98165af37b2153df, 0xe2a0b5dc971f303a,
+ 0xa8d9d1535ce3b396, 0xfb9b7cd9a4a7443c, 0xbb764c4ca7a44410,
+ 0x8bab8eefb6409c1a, 0xd01fef10a657842c, 0x9b10a4e5e9913129,
+ 0xe7109bfba19c0c9d, 0xac2820d9623bf429, 0x80444b5e7aa7cf85,
+ 0xbf21e44003acdd2d, 0x8e679c2f5e44ff8f, 0xd433179d9c8cb841,
+ 0x9e19db92b4e31ba9, 0xeb96bf6ebadf77d9, 0xaf87023b9bf0ee6b,
+};
+
+// Binary exponents of pow(10, k), for k = -348, -340, ..., 340, corresponding
+// to significands above.
+template <typename T>
+const int16_t basic_data<T>::pow10_exponents[] = {
+ -1220, -1193, -1166, -1140, -1113, -1087, -1060, -1034, -1007, -980, -954,
+ -927, -901, -874, -847, -821, -794, -768, -741, -715, -688, -661,
+ -635, -608, -582, -555, -529, -502, -475, -449, -422, -396, -369,
+ -343, -316, -289, -263, -236, -210, -183, -157, -130, -103, -77,
+ -50, -24, 3, 30, 56, 83, 109, 136, 162, 189, 216,
+ 242, 269, 295, 322, 348, 375, 402, 428, 455, 481, 508,
+ 534, 561, 588, 614, 641, 667, 694, 720, 747, 774, 800,
+ 827, 853, 880, 907, 933, 960, 986, 1013, 1039, 1066};
+
+template <typename T>
+const char basic_data<T>::foreground_color[] = "\x1b[38;2;";
+template <typename T>
+const char basic_data<T>::background_color[] = "\x1b[48;2;";
+template <typename T> const char basic_data<T>::reset_color[] = "\x1b[0m";
+template <typename T> const wchar_t basic_data<T>::wreset_color[] = L"\x1b[0m";
+template <typename T> const char basic_data<T>::signs[] = {0, '-', '+', ' '};
+
+template <typename T> struct bits {
+ static FMT_CONSTEXPR_DECL const int value =
+ static_cast<int>(sizeof(T) * std::numeric_limits<unsigned char>::digits);
+};
+
+class fp;
+template <int SHIFT = 0> fp normalize(fp value);
+
+// Lower (upper) boundary is a value half way between a floating-point value
+// and its predecessor (successor). Boundaries have the same exponent as the
+// value so only significands are stored.
+struct boundaries {
+ uint64_t lower;
+ uint64_t upper;
+};
+
+// A handmade floating-point number f * pow(2, e).
+class fp {
+ private:
+ using significand_type = uint64_t;
+
+ // All sizes are in bits.
+ // Subtract 1 to account for an implicit most significant bit in the
+ // normalized form.
+ static FMT_CONSTEXPR_DECL const int double_significand_size =
+ std::numeric_limits<double>::digits - 1;
+ static FMT_CONSTEXPR_DECL const uint64_t implicit_bit =
+ 1ULL << double_significand_size;
+
+ public:
+ significand_type f;
+ int e;
+
+ static FMT_CONSTEXPR_DECL const int significand_size =
+ bits<significand_type>::value;
+
+ fp() : f(0), e(0) {}
+ fp(uint64_t f_val, int e_val) : f(f_val), e(e_val) {}
+
+ // Constructs fp from an IEEE754 double. It is a template to prevent compile
+ // errors on platforms where double is not IEEE754.
+ template <typename Double> explicit fp(Double d) { assign(d); }
+
+ // Normalizes the value converted from double and multiplied by (1 << SHIFT).
+ template <int SHIFT> friend fp normalize(fp value) {
+ // Handle subnormals.
+ const auto shifted_implicit_bit = fp::implicit_bit << SHIFT;
+ while ((value.f & shifted_implicit_bit) == 0) {
+ value.f <<= 1;
+ --value.e;
+ }
+ // Subtract 1 to account for hidden bit.
+ const auto offset =
+ fp::significand_size - fp::double_significand_size - SHIFT - 1;
+ value.f <<= offset;
+ value.e -= offset;
+ return value;
+ }
+
+ // Assigns d to this and return true iff predecessor is closer than successor.
+ template <typename Double, FMT_ENABLE_IF(sizeof(Double) == sizeof(uint64_t))>
+ bool assign(Double d) {
+ // Assume double is in the format [sign][exponent][significand].
+ using limits = std::numeric_limits<Double>;
+ const int exponent_size =
+ bits<Double>::value - double_significand_size - 1; // -1 for sign
+ const uint64_t significand_mask = implicit_bit - 1;
+ const uint64_t exponent_mask = (~0ULL >> 1) & ~significand_mask;
+ const int exponent_bias = (1 << exponent_size) - limits::max_exponent - 1;
+ auto u = bit_cast<uint64_t>(d);
+ f = u & significand_mask;
+ auto biased_e = (u & exponent_mask) >> double_significand_size;
+ // Predecessor is closer if d is a normalized power of 2 (f == 0) other than
+ // the smallest normalized number (biased_e > 1).
+ bool is_predecessor_closer = f == 0 && biased_e > 1;
+ if (biased_e != 0)
+ f += implicit_bit;
+ else
+ biased_e = 1; // Subnormals use biased exponent 1 (min exponent).
+ e = static_cast<int>(biased_e - exponent_bias - double_significand_size);
+ return is_predecessor_closer;
+ }
+
+ template <typename Double, FMT_ENABLE_IF(sizeof(Double) != sizeof(uint64_t))>
+ bool assign(Double) {
+ *this = fp();
+ return false;
+ }
+
+ // Assigns d to this together with computing lower and upper boundaries,
+ // where a boundary is a value half way between the number and its predecessor
+ // (lower) or successor (upper). The upper boundary is normalized and lower
+ // has the same exponent but may be not normalized.
+ template <typename Double> boundaries assign_with_boundaries(Double d) {
+ bool is_lower_closer = assign(d);
+ fp lower =
+ is_lower_closer ? fp((f << 2) - 1, e - 2) : fp((f << 1) - 1, e - 1);
+ // 1 in normalize accounts for the exponent shift above.
+ fp upper = normalize<1>(fp((f << 1) + 1, e - 1));
+ lower.f <<= lower.e - upper.e;
+ return boundaries{lower.f, upper.f};
+ }
+
+ template <typename Double> boundaries assign_float_with_boundaries(Double d) {
+ assign(d);
+ constexpr int min_normal_e = std::numeric_limits<float>::min_exponent -
+ std::numeric_limits<double>::digits;
+ significand_type half_ulp = 1 << (std::numeric_limits<double>::digits -
+ std::numeric_limits<float>::digits - 1);
+ if (min_normal_e > e) half_ulp <<= min_normal_e - e;
+ fp upper = normalize<0>(fp(f + half_ulp, e));
+ fp lower = fp(
+ f - (half_ulp >> ((f == implicit_bit && e > min_normal_e) ? 1 : 0)), e);
+ lower.f <<= lower.e - upper.e;
+ return boundaries{lower.f, upper.f};
+ }
+};
+
+inline bool operator==(fp x, fp y) { return x.f == y.f && x.e == y.e; }
+
+// Computes lhs * rhs / pow(2, 64) rounded to nearest with half-up tie breaking.
+inline uint64_t multiply(uint64_t lhs, uint64_t rhs) {
+#if FMT_USE_INT128
+ auto product = static_cast<__uint128_t>(lhs) * rhs;
+ auto f = static_cast<uint64_t>(product >> 64);
+ return (static_cast<uint64_t>(product) & (1ULL << 63)) != 0 ? f + 1 : f;
+#else
+ // Multiply 32-bit parts of significands.
+ uint64_t mask = (1ULL << 32) - 1;
+ uint64_t a = lhs >> 32, b = lhs & mask;
+ uint64_t c = rhs >> 32, d = rhs & mask;
+ uint64_t ac = a * c, bc = b * c, ad = a * d, bd = b * d;
+ // Compute mid 64-bit of result and round.
+ uint64_t mid = (bd >> 32) + (ad & mask) + (bc & mask) + (1U << 31);
+ return ac + (ad >> 32) + (bc >> 32) + (mid >> 32);
+#endif
+}
+
+inline fp operator*(fp x, fp y) { return {multiply(x.f, y.f), x.e + y.e + 64}; }
+
+// Returns a cached power of 10 `c_k = c_k.f * pow(2, c_k.e)` such that its
+// (binary) exponent satisfies `min_exponent <= c_k.e <= min_exponent + 28`.
+FMT_FUNC fp get_cached_power(int min_exponent, int& pow10_exponent) {
+ const uint64_t one_over_log2_10 = 0x4d104d42; // round(pow(2, 32) / log2(10))
+ int index = static_cast<int>(
+ static_cast<int64_t>(
+ (min_exponent + fp::significand_size - 1) * one_over_log2_10 +
+ ((uint64_t(1) << 32) - 1) // ceil
+ ) >>
+ 32 // arithmetic shift
+ );
+ // Decimal exponent of the first (smallest) cached power of 10.
+ const int first_dec_exp = -348;
+ // Difference between 2 consecutive decimal exponents in cached powers of 10.
+ const int dec_exp_step = 8;
+ index = (index - first_dec_exp - 1) / dec_exp_step + 1;
+ pow10_exponent = first_dec_exp + index * dec_exp_step;
+ return {data::pow10_significands[index], data::pow10_exponents[index]};
+}
+
+// A simple accumulator to hold the sums of terms in bigint::square if uint128_t
+// is not available.
+struct accumulator {
+ uint64_t lower;
+ uint64_t upper;
+
+ accumulator() : lower(0), upper(0) {}
+ explicit operator uint32_t() const { return static_cast<uint32_t>(lower); }
+
+ void operator+=(uint64_t n) {
+ lower += n;
+ if (lower < n) ++upper;
+ }
+ void operator>>=(int shift) {
+ assert(shift == 32);
+ (void)shift;
+ lower = (upper << 32) | (lower >> 32);
+ upper >>= 32;
+ }
+};
+
+class bigint {
+ private:
+ // A bigint is stored as an array of bigits (big digits), with bigit at index
+ // 0 being the least significant one.
+ using bigit = uint32_t;
+ using double_bigit = uint64_t;
+ enum { bigits_capacity = 32 };
+ basic_memory_buffer<bigit, bigits_capacity> bigits_;
+ int exp_;
+
+ static FMT_CONSTEXPR_DECL const int bigit_bits = bits<bigit>::value;
+
+ friend struct formatter<bigint>;
+
+ void subtract_bigits(int index, bigit other, bigit& borrow) {
+ auto result = static_cast<double_bigit>(bigits_[index]) - other - borrow;
+ bigits_[index] = static_cast<bigit>(result);
+ borrow = static_cast<bigit>(result >> (bigit_bits * 2 - 1));
+ }
+
+ void remove_leading_zeros() {
+ int num_bigits = static_cast<int>(bigits_.size()) - 1;
+ while (num_bigits > 0 && bigits_[num_bigits] == 0) --num_bigits;
+ bigits_.resize(num_bigits + 1);
+ }
+
+ // Computes *this -= other assuming aligned bigints and *this >= other.
+ void subtract_aligned(const bigint& other) {
+ FMT_ASSERT(other.exp_ >= exp_, "unaligned bigints");
+ FMT_ASSERT(compare(*this, other) >= 0, "");
+ bigit borrow = 0;
+ int i = other.exp_ - exp_;
+ for (int j = 0, n = static_cast<int>(other.bigits_.size()); j != n;
+ ++i, ++j) {
+ subtract_bigits(i, other.bigits_[j], borrow);
+ }
+ while (borrow > 0) subtract_bigits(i, 0, borrow);
+ remove_leading_zeros();
+ }
+
+ void multiply(uint32_t value) {
+ const double_bigit wide_value = value;
+ bigit carry = 0;
+ for (size_t i = 0, n = bigits_.size(); i < n; ++i) {
+ double_bigit result = bigits_[i] * wide_value + carry;
+ bigits_[i] = static_cast<bigit>(result);
+ carry = static_cast<bigit>(result >> bigit_bits);
+ }
+ if (carry != 0) bigits_.push_back(carry);
+ }
+
+ void multiply(uint64_t value) {
+ const bigit mask = ~bigit(0);
+ const double_bigit lower = value & mask;
+ const double_bigit upper = value >> bigit_bits;
+ double_bigit carry = 0;
+ for (size_t i = 0, n = bigits_.size(); i < n; ++i) {
+ double_bigit result = bigits_[i] * lower + (carry & mask);
+ carry =
+ bigits_[i] * upper + (result >> bigit_bits) + (carry >> bigit_bits);
+ bigits_[i] = static_cast<bigit>(result);
+ }
+ while (carry != 0) {
+ bigits_.push_back(carry & mask);
+ carry >>= bigit_bits;
+ }
+ }
+
+ public:
+ bigint() : exp_(0) {}
+ explicit bigint(uint64_t n) { assign(n); }
+ ~bigint() { assert(bigits_.capacity() <= bigits_capacity); }
+
+ bigint(const bigint&) = delete;
+ void operator=(const bigint&) = delete;
+
+ void assign(const bigint& other) {
+ bigits_.resize(other.bigits_.size());
+ auto data = other.bigits_.data();
+ std::copy(data, data + other.bigits_.size(), bigits_.data());
+ exp_ = other.exp_;
+ }
+
+ void assign(uint64_t n) {
+ int num_bigits = 0;
+ do {
+ bigits_[num_bigits++] = n & ~bigit(0);
+ n >>= bigit_bits;
+ } while (n != 0);
+ bigits_.resize(num_bigits);
+ exp_ = 0;
+ }
+
+ int num_bigits() const { return static_cast<int>(bigits_.size()) + exp_; }
+
+ bigint& operator<<=(int shift) {
+ assert(shift >= 0);
+ exp_ += shift / bigit_bits;
+ shift %= bigit_bits;
+ if (shift == 0) return *this;
+ bigit carry = 0;
+ for (size_t i = 0, n = bigits_.size(); i < n; ++i) {
+ bigit c = bigits_[i] >> (bigit_bits - shift);
+ bigits_[i] = (bigits_[i] << shift) + carry;
+ carry = c;
+ }
+ if (carry != 0) bigits_.push_back(carry);
+ return *this;
+ }
+
+ template <typename Int> bigint& operator*=(Int value) {
+ FMT_ASSERT(value > 0, "");
+ multiply(uint32_or_64_or_128_t<Int>(value));
+ return *this;
+ }
+
+ friend int compare(const bigint& lhs, const bigint& rhs) {
+ int num_lhs_bigits = lhs.num_bigits(), num_rhs_bigits = rhs.num_bigits();
+ if (num_lhs_bigits != num_rhs_bigits)
+ return num_lhs_bigits > num_rhs_bigits ? 1 : -1;
+ int i = static_cast<int>(lhs.bigits_.size()) - 1;
+ int j = static_cast<int>(rhs.bigits_.size()) - 1;
+ int end = i - j;
+ if (end < 0) end = 0;
+ for (; i >= end; --i, --j) {
+ bigit lhs_bigit = lhs.bigits_[i], rhs_bigit = rhs.bigits_[j];
+ if (lhs_bigit != rhs_bigit) return lhs_bigit > rhs_bigit ? 1 : -1;
+ }
+ if (i != j) return i > j ? 1 : -1;
+ return 0;
+ }
+
+ // Returns compare(lhs1 + lhs2, rhs).
+ friend int add_compare(const bigint& lhs1, const bigint& lhs2,
+ const bigint& rhs) {
+ int max_lhs_bigits = (std::max)(lhs1.num_bigits(), lhs2.num_bigits());
+ int num_rhs_bigits = rhs.num_bigits();
+ if (max_lhs_bigits + 1 < num_rhs_bigits) return -1;
+ if (max_lhs_bigits > num_rhs_bigits) return 1;
+ auto get_bigit = [](const bigint& n, int i) -> bigit {
+ return i >= n.exp_ && i < n.num_bigits() ? n.bigits_[i - n.exp_] : 0;
+ };
+ double_bigit borrow = 0;
+ int min_exp = (std::min)((std::min)(lhs1.exp_, lhs2.exp_), rhs.exp_);
+ for (int i = num_rhs_bigits - 1; i >= min_exp; --i) {
+ double_bigit sum =
+ static_cast<double_bigit>(get_bigit(lhs1, i)) + get_bigit(lhs2, i);
+ bigit rhs_bigit = get_bigit(rhs, i);
+ if (sum > rhs_bigit + borrow) return 1;
+ borrow = rhs_bigit + borrow - sum;
+ if (borrow > 1) return -1;
+ borrow <<= bigit_bits;
+ }
+ return borrow != 0 ? -1 : 0;
+ }
+
+ // Assigns pow(10, exp) to this bigint.
+ void assign_pow10(int exp) {
+ assert(exp >= 0);
+ if (exp == 0) return assign(1);
+ // Find the top bit.
+ int bitmask = 1;
+ while (exp >= bitmask) bitmask <<= 1;
+ bitmask >>= 1;
+ // pow(10, exp) = pow(5, exp) * pow(2, exp). First compute pow(5, exp) by
+ // repeated squaring and multiplication.
+ assign(5);
+ bitmask >>= 1;
+ while (bitmask != 0) {
+ square();
+ if ((exp & bitmask) != 0) *this *= 5;
+ bitmask >>= 1;
+ }
+ *this <<= exp; // Multiply by pow(2, exp) by shifting.
+ }
+
+ void square() {
+ basic_memory_buffer<bigit, bigits_capacity> n(std::move(bigits_));
+ int num_bigits = static_cast<int>(bigits_.size());
+ int num_result_bigits = 2 * num_bigits;
+ bigits_.resize(num_result_bigits);
+ using accumulator_t = conditional_t<FMT_USE_INT128, uint128_t, accumulator>;
+ auto sum = accumulator_t();
+ for (int bigit_index = 0; bigit_index < num_bigits; ++bigit_index) {
+ // Compute bigit at position bigit_index of the result by adding
+ // cross-product terms n[i] * n[j] such that i + j == bigit_index.
+ for (int i = 0, j = bigit_index; j >= 0; ++i, --j) {
+ // Most terms are multiplied twice which can be optimized in the future.
+ sum += static_cast<double_bigit>(n[i]) * n[j];
+ }
+ bigits_[bigit_index] = static_cast<bigit>(sum);
+ sum >>= bits<bigit>::value; // Compute the carry.
+ }
+ // Do the same for the top half.
+ for (int bigit_index = num_bigits; bigit_index < num_result_bigits;
+ ++bigit_index) {
+ for (int j = num_bigits - 1, i = bigit_index - j; i < num_bigits;)
+ sum += static_cast<double_bigit>(n[i++]) * n[j--];
+ bigits_[bigit_index] = static_cast<bigit>(sum);
+ sum >>= bits<bigit>::value;
+ }
+ --num_result_bigits;
+ remove_leading_zeros();
+ exp_ *= 2;
+ }
+
+ // Divides this bignum by divisor, assigning the remainder to this and
+ // returning the quotient.
+ int divmod_assign(const bigint& divisor) {
+ FMT_ASSERT(this != &divisor, "");
+ if (compare(*this, divisor) < 0) return 0;
+ int num_bigits = static_cast<int>(bigits_.size());
+ FMT_ASSERT(divisor.bigits_[divisor.bigits_.size() - 1] != 0, "");
+ int exp_difference = exp_ - divisor.exp_;
+ if (exp_difference > 0) {
+ // Align bigints by adding trailing zeros to simplify subtraction.
+ bigits_.resize(num_bigits + exp_difference);
+ for (int i = num_bigits - 1, j = i + exp_difference; i >= 0; --i, --j)
+ bigits_[j] = bigits_[i];
+ std::uninitialized_fill_n(bigits_.data(), exp_difference, 0);
+ exp_ -= exp_difference;
+ }
+ int quotient = 0;
+ do {
+ subtract_aligned(divisor);
+ ++quotient;
+ } while (compare(*this, divisor) >= 0);
+ return quotient;
+ }
+};
+
+enum round_direction { unknown, up, down };
+
+// Given the divisor (normally a power of 10), the remainder = v % divisor for
+// some number v and the error, returns whether v should be rounded up, down, or
+// whether the rounding direction can't be determined due to error.
+// error should be less than divisor / 2.
+inline round_direction get_round_direction(uint64_t divisor, uint64_t remainder,
+ uint64_t error) {
+ FMT_ASSERT(remainder < divisor, ""); // divisor - remainder won't overflow.
+ FMT_ASSERT(error < divisor, ""); // divisor - error won't overflow.
+ FMT_ASSERT(error < divisor - error, ""); // error * 2 won't overflow.
+ // Round down if (remainder + error) * 2 <= divisor.
+ if (remainder <= divisor - remainder && error * 2 <= divisor - remainder * 2)
+ return down;
+ // Round up if (remainder - error) * 2 >= divisor.
+ if (remainder >= error &&
+ remainder - error >= divisor - (remainder - error)) {
+ return up;
+ }
+ return unknown;
+}
+
+namespace digits {
+enum result {
+ more, // Generate more digits.
+ done, // Done generating digits.
+ error // Digit generation cancelled due to an error.
+};
+}
+
+// Generates output using the Grisu digit-gen algorithm.
+// error: the size of the region (lower, upper) outside of which numbers
+// definitely do not round to value (Delta in Grisu3).
+template <typename Handler>
+FMT_ALWAYS_INLINE digits::result grisu_gen_digits(fp value, uint64_t error,
+ int& exp, Handler& handler) {
+ const fp one(1ULL << -value.e, value.e);
+ // The integral part of scaled value (p1 in Grisu) = value / one. It cannot be
+ // zero because it contains a product of two 64-bit numbers with MSB set (due
+ // to normalization) - 1, shifted right by at most 60 bits.
+ auto integral = static_cast<uint32_t>(value.f >> -one.e);
+ FMT_ASSERT(integral != 0, "");
+ FMT_ASSERT(integral == value.f >> -one.e, "");
+ // The fractional part of scaled value (p2 in Grisu) c = value % one.
+ uint64_t fractional = value.f & (one.f - 1);
+ exp = count_digits(integral); // kappa in Grisu.
+ // Divide by 10 to prevent overflow.
+ auto result = handler.on_start(data::powers_of_10_64[exp - 1] << -one.e,
+ value.f / 10, error * 10, exp);
+ if (result != digits::more) return result;
+ // Generate digits for the integral part. This can produce up to 10 digits.
+ do {
+ uint32_t digit = 0;
+ auto divmod_integral = [&](uint32_t divisor) {
+ digit = integral / divisor;
+ integral %= divisor;
+ };
+ // This optimization by Milo Yip reduces the number of integer divisions by
+ // one per iteration.
+ switch (exp) {
+ case 10:
+ divmod_integral(1000000000);
+ break;
+ case 9:
+ divmod_integral(100000000);
+ break;
+ case 8:
+ divmod_integral(10000000);
+ break;
+ case 7:
+ divmod_integral(1000000);
+ break;
+ case 6:
+ divmod_integral(100000);
+ break;
+ case 5:
+ divmod_integral(10000);
+ break;
+ case 4:
+ divmod_integral(1000);
+ break;
+ case 3:
+ divmod_integral(100);
+ break;
+ case 2:
+ divmod_integral(10);
+ break;
+ case 1:
+ digit = integral;
+ integral = 0;
+ break;
+ default:
+ FMT_ASSERT(false, "invalid number of digits");
+ }
+ --exp;
+ uint64_t remainder =
+ (static_cast<uint64_t>(integral) << -one.e) + fractional;
+ result = handler.on_digit(static_cast<char>('0' + digit),
+ data::powers_of_10_64[exp] << -one.e, remainder,
+ error, exp, true);
+ if (result != digits::more) return result;
+ } while (exp > 0);
+ // Generate digits for the fractional part.
+ for (;;) {
+ fractional *= 10;
+ error *= 10;
+ char digit =
+ static_cast<char>('0' + static_cast<char>(fractional >> -one.e));
+ fractional &= one.f - 1;
+ --exp;
+ result = handler.on_digit(digit, one.f, fractional, error, exp, false);
+ if (result != digits::more) return result;
+ }
+}
+
+// The fixed precision digit handler.
+struct fixed_handler {
+ char* buf;
+ int size;
+ int precision;
+ int exp10;
+ bool fixed;
+
+ digits::result on_start(uint64_t divisor, uint64_t remainder, uint64_t error,
+ int& exp) {
+ // Non-fixed formats require at least one digit and no precision adjustment.
+ if (!fixed) return digits::more;
+ // Adjust fixed precision by exponent because it is relative to decimal
+ // point.
+ precision += exp + exp10;
+ // Check if precision is satisfied just by leading zeros, e.g.
+ // format("{:.2f}", 0.001) gives "0.00" without generating any digits.
+ if (precision > 0) return digits::more;
+ if (precision < 0) return digits::done;
+ auto dir = get_round_direction(divisor, remainder, error);
+ if (dir == unknown) return digits::error;
+ buf[size++] = dir == up ? '1' : '0';
+ return digits::done;
+ }
+
+ digits::result on_digit(char digit, uint64_t divisor, uint64_t remainder,
+ uint64_t error, int, bool integral) {
+ FMT_ASSERT(remainder < divisor, "");
+ buf[size++] = digit;
+ if (size < precision) return digits::more;
+ if (!integral) {
+ // Check if error * 2 < divisor with overflow prevention.
+ // The check is not needed for the integral part because error = 1
+ // and divisor > (1 << 32) there.
+ if (error >= divisor || error >= divisor - error) return digits::error;
+ } else {
+ FMT_ASSERT(error == 1 && divisor > 2, "");
+ }
+ auto dir = get_round_direction(divisor, remainder, error);
+ if (dir != up) return dir == down ? digits::done : digits::error;
+ ++buf[size - 1];
+ for (int i = size - 1; i > 0 && buf[i] > '9'; --i) {
+ buf[i] = '0';
+ ++buf[i - 1];
+ }
+ if (buf[0] > '9') {
+ buf[0] = '1';
+ buf[size++] = '0';
+ }
+ return digits::done;
+ }
+};
+
+// The shortest representation digit handler.
+struct grisu_shortest_handler {
+ char* buf;
+ int size;
+ // Distance between scaled value and upper bound (wp_W in Grisu3).
+ uint64_t diff;
+
+ digits::result on_start(uint64_t, uint64_t, uint64_t, int&) {
+ return digits::more;
+ }
+
+ // Decrement the generated number approaching value from above.
+ void round(uint64_t d, uint64_t divisor, uint64_t& remainder,
+ uint64_t error) {
+ while (
+ remainder < d && error - remainder >= divisor &&
+ (remainder + divisor < d || d - remainder >= remainder + divisor - d)) {
+ --buf[size - 1];
+ remainder += divisor;
+ }
+ }
+
+ // Implements Grisu's round_weed.
+ digits::result on_digit(char digit, uint64_t divisor, uint64_t remainder,
+ uint64_t error, int exp, bool integral) {
+ buf[size++] = digit;
+ if (remainder >= error) return digits::more;
+ uint64_t unit = integral ? 1 : data::powers_of_10_64[-exp];
+ uint64_t up = (diff - 1) * unit; // wp_Wup
+ round(up, divisor, remainder, error);
+ uint64_t down = (diff + 1) * unit; // wp_Wdown
+ if (remainder < down && error - remainder >= divisor &&
+ (remainder + divisor < down ||
+ down - remainder > remainder + divisor - down)) {
+ return digits::error;
+ }
+ return 2 * unit <= remainder && remainder <= error - 4 * unit
+ ? digits::done
+ : digits::error;
+ }
+};
+
+// Formats value using a variation of the Fixed-Precision Positive
+// Floating-Point Printout ((FPP)^2) algorithm by Steele & White:
+// https://fmt.dev/p372-steele.pdf.
+template <typename Double>
+void fallback_format(Double d, buffer<char>& buf, int& exp10) {
+ bigint numerator; // 2 * R in (FPP)^2.
+ bigint denominator; // 2 * S in (FPP)^2.
+ // lower and upper are differences between value and corresponding boundaries.
+ bigint lower; // (M^- in (FPP)^2).
+ bigint upper_store; // upper's value if different from lower.
+ bigint* upper = nullptr; // (M^+ in (FPP)^2).
+ fp value;
+ // Shift numerator and denominator by an extra bit or two (if lower boundary
+ // is closer) to make lower and upper integers. This eliminates multiplication
+ // by 2 during later computations.
+ // TODO: handle float
+ int shift = value.assign(d) ? 2 : 1;
+ uint64_t significand = value.f << shift;
+ if (value.e >= 0) {
+ numerator.assign(significand);
+ numerator <<= value.e;
+ lower.assign(1);
+ lower <<= value.e;
+ if (shift != 1) {
+ upper_store.assign(1);
+ upper_store <<= value.e + 1;
+ upper = &upper_store;
+ }
+ denominator.assign_pow10(exp10);
+ denominator <<= 1;
+ } else if (exp10 < 0) {
+ numerator.assign_pow10(-exp10);
+ lower.assign(numerator);
+ if (shift != 1) {
+ upper_store.assign(numerator);
+ upper_store <<= 1;
+ upper = &upper_store;
+ }
+ numerator *= significand;
+ denominator.assign(1);
+ denominator <<= shift - value.e;
+ } else {
+ numerator.assign(significand);
+ denominator.assign_pow10(exp10);
+ denominator <<= shift - value.e;
+ lower.assign(1);
+ if (shift != 1) {
+ upper_store.assign(1ULL << 1);
+ upper = &upper_store;
+ }
+ }
+ if (!upper) upper = &lower;
+ // Invariant: value == (numerator / denominator) * pow(10, exp10).
+ bool even = (value.f & 1) == 0;
+ int num_digits = 0;
+ char* data = buf.data();
+ for (;;) {
+ int digit = numerator.divmod_assign(denominator);
+ bool low = compare(numerator, lower) - even < 0; // numerator <[=] lower.
+ // numerator + upper >[=] pow10:
+ bool high = add_compare(numerator, *upper, denominator) + even > 0;
+ data[num_digits++] = static_cast<char>('0' + digit);
+ if (low || high) {
+ if (!low) {
+ ++data[num_digits - 1];
+ } else if (high) {
+ int result = add_compare(numerator, numerator, denominator);
+ // Round half to even.
+ if (result > 0 || (result == 0 && (digit % 2) != 0))
+ ++data[num_digits - 1];
+ }
+ buf.resize(num_digits);
+ exp10 -= num_digits - 1;
+ return;
+ }
+ numerator *= 10;
+ lower *= 10;
+ if (upper != &lower) *upper *= 10;
+ }
+}
+
+// Formats value using the Grisu algorithm
+// (https://www.cs.tufts.edu/~nr/cs257/archive/florian-loitsch/printf.pdf)
+// if T is a IEEE754 binary32 or binary64 and snprintf otherwise.
+template <typename T>
+int format_float(T value, int precision, float_specs specs, buffer<char>& buf) {
+ static_assert(!std::is_same<T, float>(), "");
+ FMT_ASSERT(value >= 0, "value is negative");
+
+ const bool fixed = specs.format == float_format::fixed;
+ if (value <= 0) { // <= instead of == to silence a warning.
+ if (precision <= 0 || !fixed) {
+ buf.push_back('0');
+ return 0;
+ }
+ buf.resize(to_unsigned(precision));
+ std::uninitialized_fill_n(buf.data(), precision, '0');
+ return -precision;
+ }
+
+ if (!specs.use_grisu) return snprintf_float(value, precision, specs, buf);
+
+ int exp = 0;
+ const int min_exp = -60; // alpha in Grisu.
+ int cached_exp10 = 0; // K in Grisu.
+ if (precision != -1) {
+ if (precision > 17) return snprintf_float(value, precision, specs, buf);
+ fp normalized = normalize(fp(value));
+ const auto cached_pow = get_cached_power(
+ min_exp - (normalized.e + fp::significand_size), cached_exp10);
+ normalized = normalized * cached_pow;
+ fixed_handler handler{buf.data(), 0, precision, -cached_exp10, fixed};
+ if (grisu_gen_digits(normalized, 1, exp, handler) == digits::error)
+ return snprintf_float(value, precision, specs, buf);
+ int num_digits = handler.size;
+ if (!fixed) {
+ // Remove trailing zeros.
+ while (num_digits > 0 && buf[num_digits - 1] == '0') {
+ --num_digits;
+ ++exp;
+ }
+ }
+ buf.resize(to_unsigned(num_digits));
+ } else {
+ fp fp_value;
+ auto boundaries = specs.binary32
+ ? fp_value.assign_float_with_boundaries(value)
+ : fp_value.assign_with_boundaries(value);
+ fp_value = normalize(fp_value);
+ // Find a cached power of 10 such that multiplying value by it will bring
+ // the exponent in the range [min_exp, -32].
+ const fp cached_pow = get_cached_power(
+ min_exp - (fp_value.e + fp::significand_size), cached_exp10);
+ // Multiply value and boundaries by the cached power of 10.
+ fp_value = fp_value * cached_pow;
+ boundaries.lower = multiply(boundaries.lower, cached_pow.f);
+ boundaries.upper = multiply(boundaries.upper, cached_pow.f);
+ assert(min_exp <= fp_value.e && fp_value.e <= -32);
+ --boundaries.lower; // \tilde{M}^- - 1 ulp -> M^-_{\downarrow}.
+ ++boundaries.upper; // \tilde{M}^+ + 1 ulp -> M^+_{\uparrow}.
+ // Numbers outside of (lower, upper) definitely do not round to value.
+ grisu_shortest_handler handler{buf.data(), 0,
+ boundaries.upper - fp_value.f};
+ auto result =
+ grisu_gen_digits(fp(boundaries.upper, fp_value.e),
+ boundaries.upper - boundaries.lower, exp, handler);
+ if (result == digits::error) {
+ exp += handler.size - cached_exp10 - 1;
+ fallback_format(value, buf, exp);
+ return exp;
+ }
+ buf.resize(to_unsigned(handler.size));
+ }
+ return exp - cached_exp10;
+}
+
+template <typename T>
+int snprintf_float(T value, int precision, float_specs specs,
+ buffer<char>& buf) {
+ // Buffer capacity must be non-zero, otherwise MSVC's vsnprintf_s will fail.
+ FMT_ASSERT(buf.capacity() > buf.size(), "empty buffer");
+ static_assert(!std::is_same<T, float>(), "");
+
+ // Subtract 1 to account for the difference in precision since we use %e for
+ // both general and exponent format.
+ if (specs.format == float_format::general ||
+ specs.format == float_format::exp)
+ precision = (precision >= 0 ? precision : 6) - 1;
+
+ // Build the format string.
+ enum { max_format_size = 7 }; // Ths longest format is "%#.*Le".
+ char format[max_format_size];
+ char* format_ptr = format;
+ *format_ptr++ = '%';
+ if (specs.trailing_zeros) *format_ptr++ = '#';
+ if (precision >= 0) {
+ *format_ptr++ = '.';
+ *format_ptr++ = '*';
+ }
+ if (std::is_same<T, long double>()) *format_ptr++ = 'L';
+ *format_ptr++ = specs.format != float_format::hex
+ ? (specs.format == float_format::fixed ? 'f' : 'e')
+ : (specs.upper ? 'A' : 'a');
+ *format_ptr = '\0';
+
+ // Format using snprintf.
+ auto offset = buf.size();
+ for (;;) {
+ auto begin = buf.data() + offset;
+ auto capacity = buf.capacity() - offset;
+#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION
+ if (precision > 100000)
+ throw std::runtime_error(
+ "fuzz mode - avoid large allocation inside snprintf");
+#endif
+ // Suppress the warning about a nonliteral format string.
+ auto snprintf_ptr = FMT_SNPRINTF;
+ int result = precision >= 0
+ ? snprintf_ptr(begin, capacity, format, precision, value)
+ : snprintf_ptr(begin, capacity, format, value);
+ if (result < 0) {
+ buf.reserve(buf.capacity() + 1); // The buffer will grow exponentially.
+ continue;
+ }
+ unsigned size = to_unsigned(result);
+ // Size equal to capacity means that the last character was truncated.
+ if (size >= capacity) {
+ buf.reserve(size + offset + 1); // Add 1 for the terminating '\0'.
+ continue;
+ }
+ auto is_digit = [](char c) { return c >= '0' && c <= '9'; };
+ if (specs.format == float_format::fixed) {
+ if (precision == 0) {
+ buf.resize(size);
+ return 0;
+ }
+ // Find and remove the decimal point.
+ auto end = begin + size, p = end;
+ do {
+ --p;
+ } while (is_digit(*p));
+ int fraction_size = static_cast<int>(end - p - 1);
+ std::memmove(p, p + 1, fraction_size);
+ buf.resize(size - 1);
+ return -fraction_size;
+ }
+ if (specs.format == float_format::hex) {
+ buf.resize(size + offset);
+ return 0;
+ }
+ // Find and parse the exponent.
+ auto end = begin + size, exp_pos = end;
+ do {
+ --exp_pos;
+ } while (*exp_pos != 'e');
+ char sign = exp_pos[1];
+ assert(sign == '+' || sign == '-');
+ int exp = 0;
+ auto p = exp_pos + 2; // Skip 'e' and sign.
+ do {
+ assert(is_digit(*p));
+ exp = exp * 10 + (*p++ - '0');
+ } while (p != end);
+ if (sign == '-') exp = -exp;
+ int fraction_size = 0;
+ if (exp_pos != begin + 1) {
+ // Remove trailing zeros.
+ auto fraction_end = exp_pos - 1;
+ while (*fraction_end == '0') --fraction_end;
+ // Move the fractional part left to get rid of the decimal point.
+ fraction_size = static_cast<int>(fraction_end - begin - 1);
+ std::memmove(begin + 1, begin + 2, fraction_size);
+ }
+ buf.resize(fraction_size + offset + 1);
+ return exp - fraction_size;
+ }
+}
+} // namespace internal
+
+template <> struct formatter<internal::bigint> {
+ format_parse_context::iterator parse(format_parse_context& ctx) {
+ return ctx.begin();
+ }
+
+ format_context::iterator format(const internal::bigint& n,
+ format_context& ctx) {
+ auto out = ctx.out();
+ bool first = true;
+ for (auto i = n.bigits_.size(); i > 0; --i) {
+ auto value = n.bigits_[i - 1];
+ if (first) {
+ out = format_to(out, "{:x}", value);
+ first = false;
+ continue;
+ }
+ out = format_to(out, "{:08x}", value);
+ }
+ if (n.exp_ > 0)
+ out = format_to(out, "p{}", n.exp_ * internal::bigint::bigit_bits);
+ return out;
+ }
+};
+
+#if FMT_USE_WINDOWS_H
+
+FMT_FUNC internal::utf8_to_utf16::utf8_to_utf16(string_view s) {
+ static const char ERROR_MSG[] = "cannot convert string from UTF-8 to UTF-16";
+ if (s.size() > INT_MAX)
+ FMT_THROW(windows_error(ERROR_INVALID_PARAMETER, ERROR_MSG));
+ int s_size = static_cast<int>(s.size());
+ if (s_size == 0) {
+ // MultiByteToWideChar does not support zero length, handle separately.
+ buffer_.resize(1);
+ buffer_[0] = 0;
+ return;
+ }
+
+ int length = MultiByteToWideChar(CP_UTF8, MB_ERR_INVALID_CHARS, s.data(),
+ s_size, nullptr, 0);
+ if (length == 0) FMT_THROW(windows_error(GetLastError(), ERROR_MSG));
+ buffer_.resize(length + 1);
+ length = MultiByteToWideChar(CP_UTF8, MB_ERR_INVALID_CHARS, s.data(), s_size,
+ &buffer_[0], length);
+ if (length == 0) FMT_THROW(windows_error(GetLastError(), ERROR_MSG));
+ buffer_[length] = 0;
+}
+
+FMT_FUNC internal::utf16_to_utf8::utf16_to_utf8(wstring_view s) {
+ if (int error_code = convert(s)) {
+ FMT_THROW(windows_error(error_code,
+ "cannot convert string from UTF-16 to UTF-8"));
+ }
+}
+
+FMT_FUNC int internal::utf16_to_utf8::convert(wstring_view s) {
+ if (s.size() > INT_MAX) return ERROR_INVALID_PARAMETER;
+ int s_size = static_cast<int>(s.size());
+ if (s_size == 0) {
+ // WideCharToMultiByte does not support zero length, handle separately.
+ buffer_.resize(1);
+ buffer_[0] = 0;
+ return 0;
+ }
+
+ int length = WideCharToMultiByte(CP_UTF8, 0, s.data(), s_size, nullptr, 0,
+ nullptr, nullptr);
+ if (length == 0) return GetLastError();
+ buffer_.resize(length + 1);
+ length = WideCharToMultiByte(CP_UTF8, 0, s.data(), s_size, &buffer_[0],
+ length, nullptr, nullptr);
+ if (length == 0) return GetLastError();
+ buffer_[length] = 0;
+ return 0;
+}
+
+FMT_FUNC void windows_error::init(int err_code, string_view format_str,
+ format_args args) {
+ error_code_ = err_code;
+ memory_buffer buffer;
+ internal::format_windows_error(buffer, err_code, vformat(format_str, args));
+ std::runtime_error& base = *this;
+ base = std::runtime_error(to_string(buffer));
+}
+
+FMT_FUNC void internal::format_windows_error(internal::buffer<char>& out,
+ int error_code,
+ string_view message) FMT_NOEXCEPT {
+ FMT_TRY {
+ wmemory_buffer buf;
+ buf.resize(inline_buffer_size);
+ for (;;) {
+ wchar_t* system_message = &buf[0];
+ int result = FormatMessageW(
+ FORMAT_MESSAGE_FROM_SYSTEM | FORMAT_MESSAGE_IGNORE_INSERTS, nullptr,
+ error_code, MAKELANGID(LANG_NEUTRAL, SUBLANG_DEFAULT), system_message,
+ static_cast<uint32_t>(buf.size()), nullptr);
+ if (result != 0) {
+ utf16_to_utf8 utf8_message;
+ if (utf8_message.convert(system_message) == ERROR_SUCCESS) {
+ internal::writer w(out);
+ w.write(message);
+ w.write(": ");
+ w.write(utf8_message);
+ return;
+ }
+ break;
+ }
+ if (GetLastError() != ERROR_INSUFFICIENT_BUFFER)
+ break; // Can't get error message, report error code instead.
+ buf.resize(buf.size() * 2);
+ }
+ }
+ FMT_CATCH(...) {}
+ format_error_code(out, error_code, message);
+}
+
+#endif // FMT_USE_WINDOWS_H
+
+FMT_FUNC void format_system_error(internal::buffer<char>& out, int error_code,
+ string_view message) FMT_NOEXCEPT {
+ FMT_TRY {
+ memory_buffer buf;
+ buf.resize(inline_buffer_size);
+ for (;;) {
+ char* system_message = &buf[0];
+ int result =
+ internal::safe_strerror(error_code, system_message, buf.size());
+ if (result == 0) {
+ internal::writer w(out);
+ w.write(message);
+ w.write(": ");
+ w.write(system_message);
+ return;
+ }
+ if (result != ERANGE)
+ break; // Can't get error message, report error code instead.
+ buf.resize(buf.size() * 2);
+ }
+ }
+ FMT_CATCH(...) {}
+ format_error_code(out, error_code, message);
+}
+
+FMT_FUNC void internal::error_handler::on_error(const char* message) {
+ FMT_THROW(format_error(message));
+}
+
+FMT_FUNC void report_system_error(int error_code,
+ fmt::string_view message) FMT_NOEXCEPT {
+ report_error(format_system_error, error_code, message);
+}
+
+#if FMT_USE_WINDOWS_H
+FMT_FUNC void report_windows_error(int error_code,
+ fmt::string_view message) FMT_NOEXCEPT {
+ report_error(internal::format_windows_error, error_code, message);
+}
+#endif
+
+FMT_FUNC void vprint(std::FILE* f, string_view format_str, format_args args) {
+ memory_buffer buffer;
+ internal::vformat_to(buffer, format_str,
+ basic_format_args<buffer_context<char>>(args));
+ internal::fwrite_fully(buffer.data(), 1, buffer.size(), f);
+}
+
+FMT_FUNC void vprint(string_view format_str, format_args args) {
+ vprint(stdout, format_str, args);
+}
+
+FMT_END_NAMESPACE
+
+#ifdef _MSC_VER
+# pragma warning(pop)
+#endif
+
+#endif // FMT_FORMAT_INL_H_
--- /dev/null
+/*
+ Formatting library for C++
+
+ Copyright (c) 2012 - present, Victor Zverovich
+
+ Permission is hereby granted, free of charge, to any person obtaining
+ a copy of this software and associated documentation files (the
+ "Software"), to deal in the Software without restriction, including
+ without limitation the rights to use, copy, modify, merge, publish,
+ distribute, sublicense, and/or sell copies of the Software, and to
+ permit persons to whom the Software is furnished to do so, subject to
+ the following conditions:
+
+ The above copyright notice and this permission notice shall be
+ included in all copies or substantial portions of the Software.
+
+ THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+ EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+ MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+ NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+ LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+ OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+ WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+ --- Optional exception to the license ---
+
+ As an exception, if, as a result of your compiling your source code, portions
+ of this Software are embedded into a machine-executable object form of such
+ source code, you may redistribute such embedded portions in such object form
+ without including the above copyright and permission notices.
+ */
+
+#ifndef FMT_FORMAT_H_
+#define FMT_FORMAT_H_
+
+#include "core.h"
+
+#include <algorithm>
+#include <cerrno>
+#include <cmath>
+#include <cstdint>
+#include <limits>
+#include <memory>
+#include <stdexcept>
+
+#ifdef __clang__
+# define FMT_CLANG_VERSION (__clang_major__ * 100 + __clang_minor__)
+#else
+# define FMT_CLANG_VERSION 0
+#endif
+
+#ifdef __INTEL_COMPILER
+# define FMT_ICC_VERSION __INTEL_COMPILER
+#elif defined(__ICL)
+# define FMT_ICC_VERSION __ICL
+#else
+# define FMT_ICC_VERSION 0
+#endif
+
+#ifdef __NVCC__
+# define FMT_CUDA_VERSION (__CUDACC_VER_MAJOR__ * 100 + __CUDACC_VER_MINOR__)
+#else
+# define FMT_CUDA_VERSION 0
+#endif
+
+#ifdef __has_builtin
+# define FMT_HAS_BUILTIN(x) __has_builtin(x)
+#else
+# define FMT_HAS_BUILTIN(x) 0
+#endif
+
+#if FMT_HAS_CPP_ATTRIBUTE(fallthrough) && \
+ (__cplusplus >= 201703 || FMT_GCC_VERSION != 0)
+# define FMT_FALLTHROUGH [[fallthrough]]
+#else
+# define FMT_FALLTHROUGH
+#endif
+
+#ifndef FMT_THROW
+# if FMT_EXCEPTIONS
+# if FMT_MSC_VER
+FMT_BEGIN_NAMESPACE
+namespace internal {
+template <typename Exception> inline void do_throw(const Exception& x) {
+ // Silence unreachable code warnings in MSVC because these are nearly
+ // impossible to fix in a generic code.
+ volatile bool b = true;
+ if (b) throw x;
+}
+} // namespace internal
+FMT_END_NAMESPACE
+# define FMT_THROW(x) internal::do_throw(x)
+# else
+# define FMT_THROW(x) throw x
+# endif
+# else
+# define FMT_THROW(x) \
+ do { \
+ static_cast<void>(sizeof(x)); \
+ FMT_ASSERT(false, ""); \
+ } while (false)
+# endif
+#endif
+
+#ifndef FMT_USE_USER_DEFINED_LITERALS
+// For Intel and NVIDIA compilers both they and the system gcc/msc support UDLs.
+# if (FMT_HAS_FEATURE(cxx_user_literals) || FMT_GCC_VERSION >= 407 || \
+ FMT_MSC_VER >= 1900) && \
+ (!(FMT_ICC_VERSION || FMT_CUDA_VERSION) || FMT_ICC_VERSION >= 1500 || \
+ FMT_CUDA_VERSION >= 700)
+# define FMT_USE_USER_DEFINED_LITERALS 1
+# else
+# define FMT_USE_USER_DEFINED_LITERALS 0
+# endif
+#endif
+
+#ifndef FMT_USE_UDL_TEMPLATE
+// EDG front end based compilers (icc, nvcc) do not support UDL templates yet
+// and GCC 9 warns about them.
+# if FMT_USE_USER_DEFINED_LITERALS && FMT_ICC_VERSION == 0 && \
+ FMT_CUDA_VERSION == 0 && \
+ ((FMT_GCC_VERSION >= 600 && FMT_GCC_VERSION <= 900 && \
+ __cplusplus >= 201402L) || \
+ FMT_CLANG_VERSION >= 304)
+# define FMT_USE_UDL_TEMPLATE 1
+# else
+# define FMT_USE_UDL_TEMPLATE 0
+# endif
+#endif
+
+// __builtin_clz is broken in clang with Microsoft CodeGen:
+// https://github.com/fmtlib/fmt/issues/519
+#if (FMT_GCC_VERSION || FMT_HAS_BUILTIN(__builtin_clz)) && !FMT_MSC_VER
+# define FMT_BUILTIN_CLZ(n) __builtin_clz(n)
+#endif
+#if (FMT_GCC_VERSION || FMT_HAS_BUILTIN(__builtin_clzll)) && !FMT_MSC_VER
+# define FMT_BUILTIN_CLZLL(n) __builtin_clzll(n)
+#endif
+
+// Some compilers masquerade as both MSVC and GCC-likes or otherwise support
+// __builtin_clz and __builtin_clzll, so only define FMT_BUILTIN_CLZ using the
+// MSVC intrinsics if the clz and clzll builtins are not available.
+#if FMT_MSC_VER && !defined(FMT_BUILTIN_CLZLL) && !defined(_MANAGED)
+# include <intrin.h> // _BitScanReverse, _BitScanReverse64
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+// Avoid Clang with Microsoft CodeGen's -Wunknown-pragmas warning.
+# ifndef __clang__
+# pragma intrinsic(_BitScanReverse)
+# endif
+inline uint32_t clz(uint32_t x) {
+ unsigned long r = 0;
+ _BitScanReverse(&r, x);
+
+ FMT_ASSERT(x != 0, "");
+ // Static analysis complains about using uninitialized data
+ // "r", but the only way that can happen is if "x" is 0,
+ // which the callers guarantee to not happen.
+# pragma warning(suppress : 6102)
+ return 31 - r;
+}
+# define FMT_BUILTIN_CLZ(n) internal::clz(n)
+
+# if defined(_WIN64) && !defined(__clang__)
+# pragma intrinsic(_BitScanReverse64)
+# endif
+
+inline uint32_t clzll(uint64_t x) {
+ unsigned long r = 0;
+# ifdef _WIN64
+ _BitScanReverse64(&r, x);
+# else
+ // Scan the high 32 bits.
+ if (_BitScanReverse(&r, static_cast<uint32_t>(x >> 32))) return 63 - (r + 32);
+
+ // Scan the low 32 bits.
+ _BitScanReverse(&r, static_cast<uint32_t>(x));
+# endif
+
+ FMT_ASSERT(x != 0, "");
+ // Static analysis complains about using uninitialized data
+ // "r", but the only way that can happen is if "x" is 0,
+ // which the callers guarantee to not happen.
+# pragma warning(suppress : 6102)
+ return 63 - r;
+}
+# define FMT_BUILTIN_CLZLL(n) internal::clzll(n)
+} // namespace internal
+FMT_END_NAMESPACE
+#endif
+
+// Enable the deprecated numeric alignment.
+#ifndef FMT_NUMERIC_ALIGN
+# define FMT_NUMERIC_ALIGN 1
+#endif
+
+// Enable the deprecated percent specifier.
+#ifndef FMT_DEPRECATED_PERCENT
+# define FMT_DEPRECATED_PERCENT 0
+#endif
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+// A helper function to suppress bogus "conditional expression is constant"
+// warnings.
+template <typename T> inline T const_check(T value) { return value; }
+
+// An equivalent of `*reinterpret_cast<Dest*>(&source)` that doesn't have
+// undefined behavior (e.g. due to type aliasing).
+// Example: uint64_t d = bit_cast<uint64_t>(2.718);
+template <typename Dest, typename Source>
+inline Dest bit_cast(const Source& source) {
+ static_assert(sizeof(Dest) == sizeof(Source), "size mismatch");
+ Dest dest;
+ std::memcpy(&dest, &source, sizeof(dest));
+ return dest;
+}
+
+inline bool is_big_endian() {
+ auto u = 1u;
+ struct bytes {
+ char data[sizeof(u)];
+ };
+ return bit_cast<bytes>(u).data[0] == 0;
+}
+
+// A fallback implementation of uintptr_t for systems that lack it.
+struct fallback_uintptr {
+ unsigned char value[sizeof(void*)];
+
+ fallback_uintptr() = default;
+ explicit fallback_uintptr(const void* p) {
+ *this = bit_cast<fallback_uintptr>(p);
+ if (is_big_endian()) {
+ for (size_t i = 0, j = sizeof(void*) - 1; i < j; ++i, --j)
+ std::swap(value[i], value[j]);
+ }
+ }
+};
+#ifdef UINTPTR_MAX
+using uintptr_t = ::uintptr_t;
+inline uintptr_t to_uintptr(const void* p) { return bit_cast<uintptr_t>(p); }
+#else
+using uintptr_t = fallback_uintptr;
+inline fallback_uintptr to_uintptr(const void* p) {
+ return fallback_uintptr(p);
+}
+#endif
+
+// Returns the largest possible value for type T. Same as
+// std::numeric_limits<T>::max() but shorter and not affected by the max macro.
+template <typename T> constexpr T max_value() {
+ return (std::numeric_limits<T>::max)();
+}
+template <typename T> constexpr int num_bits() {
+ return std::numeric_limits<T>::digits;
+}
+template <> constexpr int num_bits<fallback_uintptr>() {
+ return static_cast<int>(sizeof(void*) *
+ std::numeric_limits<unsigned char>::digits);
+}
+
+// An approximation of iterator_t for pre-C++20 systems.
+template <typename T>
+using iterator_t = decltype(std::begin(std::declval<T&>()));
+
+// Detect the iterator category of *any* given type in a SFINAE-friendly way.
+// Unfortunately, older implementations of std::iterator_traits are not safe
+// for use in a SFINAE-context.
+template <typename It, typename Enable = void>
+struct iterator_category : std::false_type {};
+
+template <typename T> struct iterator_category<T*> {
+ using type = std::random_access_iterator_tag;
+};
+
+template <typename It>
+struct iterator_category<It, void_t<typename It::iterator_category>> {
+ using type = typename It::iterator_category;
+};
+
+// Detect if *any* given type models the OutputIterator concept.
+template <typename It> class is_output_iterator {
+ // Check for mutability because all iterator categories derived from
+ // std::input_iterator_tag *may* also meet the requirements of an
+ // OutputIterator, thereby falling into the category of 'mutable iterators'
+ // [iterator.requirements.general] clause 4. The compiler reveals this
+ // property only at the point of *actually dereferencing* the iterator!
+ template <typename U>
+ static decltype(*(std::declval<U>())) test(std::input_iterator_tag);
+ template <typename U> static char& test(std::output_iterator_tag);
+ template <typename U> static const char& test(...);
+
+ using type = decltype(test<It>(typename iterator_category<It>::type{}));
+
+ public:
+ static const bool value = !std::is_const<remove_reference_t<type>>::value;
+};
+
+// A workaround for std::string not having mutable data() until C++17.
+template <typename Char> inline Char* get_data(std::basic_string<Char>& s) {
+ return &s[0];
+}
+template <typename Container>
+inline typename Container::value_type* get_data(Container& c) {
+ return c.data();
+}
+
+#ifdef _SECURE_SCL
+// Make a checked iterator to avoid MSVC warnings.
+template <typename T> using checked_ptr = stdext::checked_array_iterator<T*>;
+template <typename T> checked_ptr<T> make_checked(T* p, std::size_t size) {
+ return {p, size};
+}
+#else
+template <typename T> using checked_ptr = T*;
+template <typename T> inline T* make_checked(T* p, std::size_t) { return p; }
+#endif
+
+template <typename Container, FMT_ENABLE_IF(is_contiguous<Container>::value)>
+inline checked_ptr<typename Container::value_type> reserve(
+ std::back_insert_iterator<Container>& it, std::size_t n) {
+ Container& c = get_container(it);
+ std::size_t size = c.size();
+ c.resize(size + n);
+ return make_checked(get_data(c) + size, n);
+}
+
+template <typename Iterator>
+inline Iterator& reserve(Iterator& it, std::size_t) {
+ return it;
+}
+
+// An output iterator that counts the number of objects written to it and
+// discards them.
+class counting_iterator {
+ private:
+ std::size_t count_;
+
+ public:
+ using iterator_category = std::output_iterator_tag;
+ using difference_type = std::ptrdiff_t;
+ using pointer = void;
+ using reference = void;
+ using _Unchecked_type = counting_iterator; // Mark iterator as checked.
+
+ struct value_type {
+ template <typename T> void operator=(const T&) {}
+ };
+
+ counting_iterator() : count_(0) {}
+
+ std::size_t count() const { return count_; }
+
+ counting_iterator& operator++() {
+ ++count_;
+ return *this;
+ }
+
+ counting_iterator operator++(int) {
+ auto it = *this;
+ ++*this;
+ return it;
+ }
+
+ value_type operator*() const { return {}; }
+};
+
+template <typename OutputIt> class truncating_iterator_base {
+ protected:
+ OutputIt out_;
+ std::size_t limit_;
+ std::size_t count_;
+
+ truncating_iterator_base(OutputIt out, std::size_t limit)
+ : out_(out), limit_(limit), count_(0) {}
+
+ public:
+ using iterator_category = std::output_iterator_tag;
+ using difference_type = void;
+ using pointer = void;
+ using reference = void;
+ using _Unchecked_type =
+ truncating_iterator_base; // Mark iterator as checked.
+
+ OutputIt base() const { return out_; }
+ std::size_t count() const { return count_; }
+};
+
+// An output iterator that truncates the output and counts the number of objects
+// written to it.
+template <typename OutputIt,
+ typename Enable = typename std::is_void<
+ typename std::iterator_traits<OutputIt>::value_type>::type>
+class truncating_iterator;
+
+template <typename OutputIt>
+class truncating_iterator<OutputIt, std::false_type>
+ : public truncating_iterator_base<OutputIt> {
+ using traits = std::iterator_traits<OutputIt>;
+
+ mutable typename traits::value_type blackhole_;
+
+ public:
+ using value_type = typename traits::value_type;
+
+ truncating_iterator(OutputIt out, std::size_t limit)
+ : truncating_iterator_base<OutputIt>(out, limit) {}
+
+ truncating_iterator& operator++() {
+ if (this->count_++ < this->limit_) ++this->out_;
+ return *this;
+ }
+
+ truncating_iterator operator++(int) {
+ auto it = *this;
+ ++*this;
+ return it;
+ }
+
+ value_type& operator*() const {
+ return this->count_ < this->limit_ ? *this->out_ : blackhole_;
+ }
+};
+
+template <typename OutputIt>
+class truncating_iterator<OutputIt, std::true_type>
+ : public truncating_iterator_base<OutputIt> {
+ public:
+ using value_type = typename OutputIt::container_type::value_type;
+
+ truncating_iterator(OutputIt out, std::size_t limit)
+ : truncating_iterator_base<OutputIt>(out, limit) {}
+
+ truncating_iterator& operator=(value_type val) {
+ if (this->count_++ < this->limit_) this->out_ = val;
+ return *this;
+ }
+
+ truncating_iterator& operator++() { return *this; }
+ truncating_iterator& operator++(int) { return *this; }
+ truncating_iterator& operator*() { return *this; }
+};
+
+// A range with the specified output iterator and value type.
+template <typename OutputIt, typename T = typename OutputIt::value_type>
+class output_range {
+ private:
+ OutputIt it_;
+
+ public:
+ using value_type = T;
+ using iterator = OutputIt;
+ struct sentinel {};
+
+ explicit output_range(OutputIt it) : it_(it) {}
+ OutputIt begin() const { return it_; }
+ sentinel end() const { return {}; } // Sentinel is not used yet.
+};
+
+template <typename Char>
+inline size_t count_code_points(basic_string_view<Char> s) {
+ return s.size();
+}
+
+// Counts the number of code points in a UTF-8 string.
+inline size_t count_code_points(basic_string_view<char8_t> s) {
+ const char8_t* data = s.data();
+ size_t num_code_points = 0;
+ for (size_t i = 0, size = s.size(); i != size; ++i) {
+ if ((data[i] & 0xc0) != 0x80) ++num_code_points;
+ }
+ return num_code_points;
+}
+
+template <typename Char>
+inline size_t code_point_index(basic_string_view<Char> s, size_t n) {
+ size_t size = s.size();
+ return n < size ? n : size;
+}
+
+// Calculates the index of the nth code point in a UTF-8 string.
+inline size_t code_point_index(basic_string_view<char8_t> s, size_t n) {
+ const char8_t* data = s.data();
+ size_t num_code_points = 0;
+ for (size_t i = 0, size = s.size(); i != size; ++i) {
+ if ((data[i] & 0xc0) != 0x80 && ++num_code_points > n) {
+ return i;
+ }
+ }
+ return s.size();
+}
+
+inline char8_t to_char8_t(char c) { return static_cast<char8_t>(c); }
+
+template <typename InputIt, typename OutChar>
+using needs_conversion = bool_constant<
+ std::is_same<typename std::iterator_traits<InputIt>::value_type,
+ char>::value &&
+ std::is_same<OutChar, char8_t>::value>;
+
+template <typename OutChar, typename InputIt, typename OutputIt,
+ FMT_ENABLE_IF(!needs_conversion<InputIt, OutChar>::value)>
+OutputIt copy_str(InputIt begin, InputIt end, OutputIt it) {
+ return std::copy(begin, end, it);
+}
+
+template <typename OutChar, typename InputIt, typename OutputIt,
+ FMT_ENABLE_IF(needs_conversion<InputIt, OutChar>::value)>
+OutputIt copy_str(InputIt begin, InputIt end, OutputIt it) {
+ return std::transform(begin, end, it, to_char8_t);
+}
+
+#ifndef FMT_USE_GRISU
+# define FMT_USE_GRISU 1
+#endif
+
+template <typename T> constexpr bool use_grisu() {
+ return FMT_USE_GRISU && std::numeric_limits<double>::is_iec559 &&
+ sizeof(T) <= sizeof(double);
+}
+
+template <typename T>
+template <typename U>
+void buffer<T>::append(const U* begin, const U* end) {
+ std::size_t new_size = size_ + to_unsigned(end - begin);
+ reserve(new_size);
+ std::uninitialized_copy(begin, end, make_checked(ptr_, capacity_) + size_);
+ size_ = new_size;
+}
+} // namespace internal
+
+// A range with an iterator appending to a buffer.
+template <typename T>
+class buffer_range : public internal::output_range<
+ std::back_insert_iterator<internal::buffer<T>>, T> {
+ public:
+ using iterator = std::back_insert_iterator<internal::buffer<T>>;
+ using internal::output_range<iterator, T>::output_range;
+ buffer_range(internal::buffer<T>& buf)
+ : internal::output_range<iterator, T>(std::back_inserter(buf)) {}
+};
+
+// A UTF-8 string view.
+class u8string_view : public basic_string_view<char8_t> {
+ public:
+ u8string_view(const char* s)
+ : basic_string_view<char8_t>(reinterpret_cast<const char8_t*>(s)) {}
+ u8string_view(const char* s, size_t count) FMT_NOEXCEPT
+ : basic_string_view<char8_t>(reinterpret_cast<const char8_t*>(s), count) {
+ }
+};
+
+#if FMT_USE_USER_DEFINED_LITERALS
+inline namespace literals {
+inline u8string_view operator"" _u(const char* s, std::size_t n) {
+ return {s, n};
+}
+} // namespace literals
+#endif
+
+// The number of characters to store in the basic_memory_buffer object itself
+// to avoid dynamic memory allocation.
+enum { inline_buffer_size = 500 };
+
+/**
+ \rst
+ A dynamically growing memory buffer for trivially copyable/constructible types
+ with the first ``SIZE`` elements stored in the object itself.
+
+ You can use one of the following type aliases for common character types:
+
+ +----------------+------------------------------+
+ | Type | Definition |
+ +================+==============================+
+ | memory_buffer | basic_memory_buffer<char> |
+ +----------------+------------------------------+
+ | wmemory_buffer | basic_memory_buffer<wchar_t> |
+ +----------------+------------------------------+
+
+ **Example**::
+
+ fmt::memory_buffer out;
+ format_to(out, "The answer is {}.", 42);
+
+ This will append the following output to the ``out`` object:
+
+ .. code-block:: none
+
+ The answer is 42.
+
+ The output can be converted to an ``std::string`` with ``to_string(out)``.
+ \endrst
+ */
+template <typename T, std::size_t SIZE = inline_buffer_size,
+ typename Allocator = std::allocator<T>>
+class basic_memory_buffer : private Allocator, public internal::buffer<T> {
+ private:
+ T store_[SIZE];
+
+ // Deallocate memory allocated by the buffer.
+ void deallocate() {
+ T* data = this->data();
+ if (data != store_) Allocator::deallocate(data, this->capacity());
+ }
+
+ protected:
+ void grow(std::size_t size) FMT_OVERRIDE;
+
+ public:
+ using value_type = T;
+ using const_reference = const T&;
+
+ explicit basic_memory_buffer(const Allocator& alloc = Allocator())
+ : Allocator(alloc) {
+ this->set(store_, SIZE);
+ }
+ ~basic_memory_buffer() FMT_OVERRIDE { deallocate(); }
+
+ private:
+ // Move data from other to this buffer.
+ void move(basic_memory_buffer& other) {
+ Allocator &this_alloc = *this, &other_alloc = other;
+ this_alloc = std::move(other_alloc);
+ T* data = other.data();
+ std::size_t size = other.size(), capacity = other.capacity();
+ if (data == other.store_) {
+ this->set(store_, capacity);
+ std::uninitialized_copy(other.store_, other.store_ + size,
+ internal::make_checked(store_, capacity));
+ } else {
+ this->set(data, capacity);
+ // Set pointer to the inline array so that delete is not called
+ // when deallocating.
+ other.set(other.store_, 0);
+ }
+ this->resize(size);
+ }
+
+ public:
+ /**
+ \rst
+ Constructs a :class:`fmt::basic_memory_buffer` object moving the content
+ of the other object to it.
+ \endrst
+ */
+ basic_memory_buffer(basic_memory_buffer&& other) FMT_NOEXCEPT { move(other); }
+
+ /**
+ \rst
+ Moves the content of the other ``basic_memory_buffer`` object to this one.
+ \endrst
+ */
+ basic_memory_buffer& operator=(basic_memory_buffer&& other) FMT_NOEXCEPT {
+ FMT_ASSERT(this != &other, "");
+ deallocate();
+ move(other);
+ return *this;
+ }
+
+ // Returns a copy of the allocator associated with this buffer.
+ Allocator get_allocator() const { return *this; }
+};
+
+template <typename T, std::size_t SIZE, typename Allocator>
+void basic_memory_buffer<T, SIZE, Allocator>::grow(std::size_t size) {
+#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION
+ if (size > 1000) throw std::runtime_error("fuzz mode - won't grow that much");
+#endif
+ std::size_t old_capacity = this->capacity();
+ std::size_t new_capacity = old_capacity + old_capacity / 2;
+ if (size > new_capacity) new_capacity = size;
+ T* old_data = this->data();
+ T* new_data = std::allocator_traits<Allocator>::allocate(*this, new_capacity);
+ // The following code doesn't throw, so the raw pointer above doesn't leak.
+ std::uninitialized_copy(old_data, old_data + this->size(),
+ internal::make_checked(new_data, new_capacity));
+ this->set(new_data, new_capacity);
+ // deallocate must not throw according to the standard, but even if it does,
+ // the buffer already uses the new storage and will deallocate it in
+ // destructor.
+ if (old_data != store_) Allocator::deallocate(old_data, old_capacity);
+}
+
+using memory_buffer = basic_memory_buffer<char>;
+using wmemory_buffer = basic_memory_buffer<wchar_t>;
+
+/** A formatting error such as invalid format string. */
+class FMT_API format_error : public std::runtime_error {
+ public:
+ explicit format_error(const char* message) : std::runtime_error(message) {}
+ explicit format_error(const std::string& message)
+ : std::runtime_error(message) {}
+ format_error(const format_error&) = default;
+ format_error& operator=(const format_error&) = default;
+ format_error(format_error&&) = default;
+ format_error& operator=(format_error&&) = default;
+ ~format_error() FMT_NOEXCEPT FMT_OVERRIDE;
+};
+
+namespace internal {
+
+// Returns true if value is negative, false otherwise.
+// Same as `value < 0` but doesn't produce warnings if T is an unsigned type.
+template <typename T, FMT_ENABLE_IF(std::numeric_limits<T>::is_signed)>
+FMT_CONSTEXPR bool is_negative(T value) {
+ return value < 0;
+}
+template <typename T, FMT_ENABLE_IF(!std::numeric_limits<T>::is_signed)>
+FMT_CONSTEXPR bool is_negative(T) {
+ return false;
+}
+
+// Smallest of uint32_t, uint64_t, uint128_t that is large enough to
+// represent all values of T.
+template <typename T>
+using uint32_or_64_or_128_t = conditional_t<
+ std::numeric_limits<T>::digits <= 32, uint32_t,
+ conditional_t<std::numeric_limits<T>::digits <= 64, uint64_t, uint128_t>>;
+
+// Static data is placed in this class template for the header-only config.
+template <typename T = void> struct FMT_EXTERN_TEMPLATE_API basic_data {
+ static const uint64_t powers_of_10_64[];
+ static const uint32_t zero_or_powers_of_10_32[];
+ static const uint64_t zero_or_powers_of_10_64[];
+ static const uint64_t pow10_significands[];
+ static const int16_t pow10_exponents[];
+ static const char digits[];
+ static const char hex_digits[];
+ static const char foreground_color[];
+ static const char background_color[];
+ static const char reset_color[5];
+ static const wchar_t wreset_color[5];
+ static const char signs[];
+};
+
+FMT_EXTERN template struct basic_data<void>;
+
+// This is a struct rather than an alias to avoid shadowing warnings in gcc.
+struct data : basic_data<> {};
+
+#ifdef FMT_BUILTIN_CLZLL
+// Returns the number of decimal digits in n. Leading zeros are not counted
+// except for n == 0 in which case count_digits returns 1.
+inline int count_digits(uint64_t n) {
+ // Based on http://graphics.stanford.edu/~seander/bithacks.html#IntegerLog10
+ // and the benchmark https://github.com/localvoid/cxx-benchmark-count-digits.
+ int t = (64 - FMT_BUILTIN_CLZLL(n | 1)) * 1233 >> 12;
+ return t - (n < data::zero_or_powers_of_10_64[t]) + 1;
+}
+#else
+// Fallback version of count_digits used when __builtin_clz is not available.
+inline int count_digits(uint64_t n) {
+ int count = 1;
+ for (;;) {
+ // Integer division is slow so do it for a group of four digits instead
+ // of for every digit. The idea comes from the talk by Alexandrescu
+ // "Three Optimization Tips for C++". See speed-test for a comparison.
+ if (n < 10) return count;
+ if (n < 100) return count + 1;
+ if (n < 1000) return count + 2;
+ if (n < 10000) return count + 3;
+ n /= 10000u;
+ count += 4;
+ }
+}
+#endif
+
+#if FMT_USE_INT128
+inline int count_digits(uint128_t n) {
+ int count = 1;
+ for (;;) {
+ // Integer division is slow so do it for a group of four digits instead
+ // of for every digit. The idea comes from the talk by Alexandrescu
+ // "Three Optimization Tips for C++". See speed-test for a comparison.
+ if (n < 10) return count;
+ if (n < 100) return count + 1;
+ if (n < 1000) return count + 2;
+ if (n < 10000) return count + 3;
+ n /= 10000U;
+ count += 4;
+ }
+}
+#endif
+
+// Counts the number of digits in n. BITS = log2(radix).
+template <unsigned BITS, typename UInt> inline int count_digits(UInt n) {
+ int num_digits = 0;
+ do {
+ ++num_digits;
+ } while ((n >>= BITS) != 0);
+ return num_digits;
+}
+
+template <> int count_digits<4>(internal::fallback_uintptr n);
+
+#if FMT_GCC_VERSION || FMT_CLANG_VERSION
+# define FMT_ALWAYS_INLINE inline __attribute__((always_inline))
+#else
+# define FMT_ALWAYS_INLINE
+#endif
+
+#ifdef FMT_BUILTIN_CLZ
+// Optional version of count_digits for better performance on 32-bit platforms.
+inline int count_digits(uint32_t n) {
+ int t = (32 - FMT_BUILTIN_CLZ(n | 1)) * 1233 >> 12;
+ return t - (n < data::zero_or_powers_of_10_32[t]) + 1;
+}
+#endif
+
+template <typename Char> FMT_API std::string grouping_impl(locale_ref loc);
+template <typename Char> inline std::string grouping(locale_ref loc) {
+ return grouping_impl<char>(loc);
+}
+template <> inline std::string grouping<wchar_t>(locale_ref loc) {
+ return grouping_impl<wchar_t>(loc);
+}
+
+template <typename Char> FMT_API Char thousands_sep_impl(locale_ref loc);
+template <typename Char> inline Char thousands_sep(locale_ref loc) {
+ return Char(thousands_sep_impl<char>(loc));
+}
+template <> inline wchar_t thousands_sep(locale_ref loc) {
+ return thousands_sep_impl<wchar_t>(loc);
+}
+
+template <typename Char> FMT_API Char decimal_point_impl(locale_ref loc);
+template <typename Char> inline Char decimal_point(locale_ref loc) {
+ return Char(decimal_point_impl<char>(loc));
+}
+template <> inline wchar_t decimal_point(locale_ref loc) {
+ return decimal_point_impl<wchar_t>(loc);
+}
+
+// Formats a decimal unsigned integer value writing into buffer.
+// add_thousands_sep is called after writing each char to add a thousands
+// separator if necessary.
+template <typename UInt, typename Char, typename F>
+inline Char* format_decimal(Char* buffer, UInt value, int num_digits,
+ F add_thousands_sep) {
+ FMT_ASSERT(num_digits >= 0, "invalid digit count");
+ buffer += num_digits;
+ Char* end = buffer;
+ while (value >= 100) {
+ // Integer division is slow so do it for a group of two digits instead
+ // of for every digit. The idea comes from the talk by Alexandrescu
+ // "Three Optimization Tips for C++". See speed-test for a comparison.
+ auto index = static_cast<unsigned>((value % 100) * 2);
+ value /= 100;
+ *--buffer = static_cast<Char>(data::digits[index + 1]);
+ add_thousands_sep(buffer);
+ *--buffer = static_cast<Char>(data::digits[index]);
+ add_thousands_sep(buffer);
+ }
+ if (value < 10) {
+ *--buffer = static_cast<Char>('0' + value);
+ return end;
+ }
+ auto index = static_cast<unsigned>(value * 2);
+ *--buffer = static_cast<Char>(data::digits[index + 1]);
+ add_thousands_sep(buffer);
+ *--buffer = static_cast<Char>(data::digits[index]);
+ return end;
+}
+
+template <typename Int> constexpr int digits10() noexcept {
+ return std::numeric_limits<Int>::digits10;
+}
+template <> constexpr int digits10<int128_t>() noexcept { return 38; }
+template <> constexpr int digits10<uint128_t>() noexcept { return 38; }
+
+template <typename Char, typename UInt, typename Iterator, typename F>
+inline Iterator format_decimal(Iterator out, UInt value, int num_digits,
+ F add_thousands_sep) {
+ FMT_ASSERT(num_digits >= 0, "invalid digit count");
+ // Buffer should be large enough to hold all digits (<= digits10 + 1).
+ enum { max_size = digits10<UInt>() + 1 };
+ Char buffer[2 * max_size];
+ auto end = format_decimal(buffer, value, num_digits, add_thousands_sep);
+ return internal::copy_str<Char>(buffer, end, out);
+}
+
+template <typename Char, typename It, typename UInt>
+inline It format_decimal(It out, UInt value, int num_digits) {
+ return format_decimal<Char>(out, value, num_digits, [](Char*) {});
+}
+
+template <unsigned BASE_BITS, typename Char, typename UInt>
+inline Char* format_uint(Char* buffer, UInt value, int num_digits,
+ bool upper = false) {
+ buffer += num_digits;
+ Char* end = buffer;
+ do {
+ const char* digits = upper ? "0123456789ABCDEF" : data::hex_digits;
+ unsigned digit = (value & ((1 << BASE_BITS) - 1));
+ *--buffer = static_cast<Char>(BASE_BITS < 4 ? static_cast<char>('0' + digit)
+ : digits[digit]);
+ } while ((value >>= BASE_BITS) != 0);
+ return end;
+}
+
+template <unsigned BASE_BITS, typename Char>
+Char* format_uint(Char* buffer, internal::fallback_uintptr n, int num_digits,
+ bool = false) {
+ auto char_digits = std::numeric_limits<unsigned char>::digits / 4;
+ int start = (num_digits + char_digits - 1) / char_digits - 1;
+ if (int start_digits = num_digits % char_digits) {
+ unsigned value = n.value[start--];
+ buffer = format_uint<BASE_BITS>(buffer, value, start_digits);
+ }
+ for (; start >= 0; --start) {
+ unsigned value = n.value[start];
+ buffer += char_digits;
+ auto p = buffer;
+ for (int i = 0; i < char_digits; ++i) {
+ unsigned digit = (value & ((1 << BASE_BITS) - 1));
+ *--p = static_cast<Char>(data::hex_digits[digit]);
+ value >>= BASE_BITS;
+ }
+ }
+ return buffer;
+}
+
+template <unsigned BASE_BITS, typename Char, typename It, typename UInt>
+inline It format_uint(It out, UInt value, int num_digits, bool upper = false) {
+ // Buffer should be large enough to hold all digits (digits / BASE_BITS + 1).
+ char buffer[num_bits<UInt>() / BASE_BITS + 1];
+ format_uint<BASE_BITS>(buffer, value, num_digits, upper);
+ return internal::copy_str<Char>(buffer, buffer + num_digits, out);
+}
+
+#ifndef _WIN32
+# define FMT_USE_WINDOWS_H 0
+#elif !defined(FMT_USE_WINDOWS_H)
+# define FMT_USE_WINDOWS_H 1
+#endif
+
+// Define FMT_USE_WINDOWS_H to 0 to disable use of windows.h.
+// All the functionality that relies on it will be disabled too.
+#if FMT_USE_WINDOWS_H
+// A converter from UTF-8 to UTF-16.
+// It is only provided for Windows since other systems support UTF-8 natively.
+class utf8_to_utf16 {
+ private:
+ wmemory_buffer buffer_;
+
+ public:
+ FMT_API explicit utf8_to_utf16(string_view s);
+ operator wstring_view() const { return wstring_view(&buffer_[0], size()); }
+ size_t size() const { return buffer_.size() - 1; }
+ const wchar_t* c_str() const { return &buffer_[0]; }
+ std::wstring str() const { return std::wstring(&buffer_[0], size()); }
+};
+
+// A converter from UTF-16 to UTF-8.
+// It is only provided for Windows since other systems support UTF-8 natively.
+class utf16_to_utf8 {
+ private:
+ memory_buffer buffer_;
+
+ public:
+ utf16_to_utf8() {}
+ FMT_API explicit utf16_to_utf8(wstring_view s);
+ operator string_view() const { return string_view(&buffer_[0], size()); }
+ size_t size() const { return buffer_.size() - 1; }
+ const char* c_str() const { return &buffer_[0]; }
+ std::string str() const { return std::string(&buffer_[0], size()); }
+
+ // Performs conversion returning a system error code instead of
+ // throwing exception on conversion error. This method may still throw
+ // in case of memory allocation error.
+ FMT_API int convert(wstring_view s);
+};
+
+FMT_API void format_windows_error(internal::buffer<char>& out, int error_code,
+ string_view message) FMT_NOEXCEPT;
+#endif
+
+template <typename T = void> struct null {};
+
+// Workaround an array initialization issue in gcc 4.8.
+template <typename Char> struct fill_t {
+ private:
+ Char data_[6];
+
+ public:
+ FMT_CONSTEXPR Char& operator[](size_t index) { return data_[index]; }
+ FMT_CONSTEXPR const Char& operator[](size_t index) const {
+ return data_[index];
+ }
+
+ static FMT_CONSTEXPR fill_t<Char> make() {
+ auto fill = fill_t<Char>();
+ fill[0] = Char(' ');
+ return fill;
+ }
+};
+} // namespace internal
+
+// We cannot use enum classes as bit fields because of a gcc bug
+// https://gcc.gnu.org/bugzilla/show_bug.cgi?id=61414.
+namespace align {
+enum type { none, left, right, center, numeric };
+}
+using align_t = align::type;
+
+namespace sign {
+enum type { none, minus, plus, space };
+}
+using sign_t = sign::type;
+
+// Format specifiers for built-in and string types.
+template <typename Char> struct basic_format_specs {
+ int width;
+ int precision;
+ char type;
+ align_t align : 4;
+ sign_t sign : 3;
+ bool alt : 1; // Alternate form ('#').
+ internal::fill_t<Char> fill;
+
+ constexpr basic_format_specs()
+ : width(0),
+ precision(-1),
+ type(0),
+ align(align::none),
+ sign(sign::none),
+ alt(false),
+ fill(internal::fill_t<Char>::make()) {}
+};
+
+using format_specs = basic_format_specs<char>;
+
+namespace internal {
+
+// A floating-point presentation format.
+enum class float_format : unsigned char {
+ general, // General: exponent notation or fixed point based on magnitude.
+ exp, // Exponent notation with the default precision of 6, e.g. 1.2e-3.
+ fixed, // Fixed point with the default precision of 6, e.g. 0.0012.
+ hex
+};
+
+struct float_specs {
+ int precision;
+ float_format format : 8;
+ sign_t sign : 8;
+ bool upper : 1;
+ bool locale : 1;
+ bool percent : 1;
+ bool binary32 : 1;
+ bool use_grisu : 1;
+ bool trailing_zeros : 1;
+};
+
+// Writes the exponent exp in the form "[+-]d{2,3}" to buffer.
+template <typename Char, typename It> It write_exponent(int exp, It it) {
+ FMT_ASSERT(-10000 < exp && exp < 10000, "exponent out of range");
+ if (exp < 0) {
+ *it++ = static_cast<Char>('-');
+ exp = -exp;
+ } else {
+ *it++ = static_cast<Char>('+');
+ }
+ if (exp >= 100) {
+ const char* top = data::digits + (exp / 100) * 2;
+ if (exp >= 1000) *it++ = static_cast<Char>(top[0]);
+ *it++ = static_cast<Char>(top[1]);
+ exp %= 100;
+ }
+ const char* d = data::digits + exp * 2;
+ *it++ = static_cast<Char>(d[0]);
+ *it++ = static_cast<Char>(d[1]);
+ return it;
+}
+
+template <typename Char> class float_writer {
+ private:
+ // The number is given as v = digits_ * pow(10, exp_).
+ const char* digits_;
+ int num_digits_;
+ int exp_;
+ size_t size_;
+ float_specs specs_;
+ Char decimal_point_;
+
+ template <typename It> It prettify(It it) const {
+ // pow(10, full_exp - 1) <= v <= pow(10, full_exp).
+ int full_exp = num_digits_ + exp_;
+ if (specs_.format == float_format::exp) {
+ // Insert a decimal point after the first digit and add an exponent.
+ *it++ = static_cast<Char>(*digits_);
+ int num_zeros = specs_.precision - num_digits_;
+ bool trailing_zeros = num_zeros > 0 && specs_.trailing_zeros;
+ if (num_digits_ > 1 || trailing_zeros) *it++ = decimal_point_;
+ it = copy_str<Char>(digits_ + 1, digits_ + num_digits_, it);
+ if (trailing_zeros)
+ it = std::fill_n(it, num_zeros, static_cast<Char>('0'));
+ *it++ = static_cast<Char>(specs_.upper ? 'E' : 'e');
+ return write_exponent<Char>(full_exp - 1, it);
+ }
+ if (num_digits_ <= full_exp) {
+ // 1234e7 -> 12340000000[.0+]
+ it = copy_str<Char>(digits_, digits_ + num_digits_, it);
+ it = std::fill_n(it, full_exp - num_digits_, static_cast<Char>('0'));
+ if (specs_.trailing_zeros) {
+ *it++ = decimal_point_;
+ int num_zeros = specs_.precision - full_exp;
+ if (num_zeros <= 0) {
+ if (specs_.format != float_format::fixed)
+ *it++ = static_cast<Char>('0');
+ return it;
+ }
+#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION
+ if (num_zeros > 1000)
+ throw std::runtime_error("fuzz mode - avoiding excessive cpu use");
+#endif
+ it = std::fill_n(it, num_zeros, static_cast<Char>('0'));
+ }
+ } else if (full_exp > 0) {
+ // 1234e-2 -> 12.34[0+]
+ it = copy_str<Char>(digits_, digits_ + full_exp, it);
+ if (!specs_.trailing_zeros) {
+ // Remove trailing zeros.
+ int num_digits = num_digits_;
+ while (num_digits > full_exp && digits_[num_digits - 1] == '0')
+ --num_digits;
+ if (num_digits != full_exp) *it++ = decimal_point_;
+ return copy_str<Char>(digits_ + full_exp, digits_ + num_digits, it);
+ }
+ *it++ = decimal_point_;
+ it = copy_str<Char>(digits_ + full_exp, digits_ + num_digits_, it);
+ if (specs_.precision > num_digits_) {
+ // Add trailing zeros.
+ int num_zeros = specs_.precision - num_digits_;
+ it = std::fill_n(it, num_zeros, static_cast<Char>('0'));
+ }
+ } else {
+ // 1234e-6 -> 0.001234
+ *it++ = static_cast<Char>('0');
+ int num_zeros = -full_exp;
+ if (specs_.precision >= 0 && specs_.precision < num_zeros)
+ num_zeros = specs_.precision;
+ int num_digits = num_digits_;
+ if (!specs_.trailing_zeros)
+ while (num_digits > 0 && digits_[num_digits - 1] == '0') --num_digits;
+ if (num_zeros != 0 || num_digits != 0) {
+ *it++ = decimal_point_;
+ it = std::fill_n(it, num_zeros, static_cast<Char>('0'));
+ it = copy_str<Char>(digits_, digits_ + num_digits, it);
+ }
+ }
+ return it;
+ }
+
+ public:
+ float_writer(const char* digits, int num_digits, int exp, float_specs specs,
+ Char decimal_point)
+ : digits_(digits),
+ num_digits_(num_digits),
+ exp_(exp),
+ specs_(specs),
+ decimal_point_(decimal_point) {
+ int full_exp = num_digits + exp - 1;
+ int precision = specs.precision > 0 ? specs.precision : 16;
+ if (specs_.format == float_format::general &&
+ !(full_exp >= -4 && full_exp < precision)) {
+ specs_.format = float_format::exp;
+ }
+ size_ = prettify(counting_iterator()).count();
+ size_ += specs.sign ? 1 : 0;
+ }
+
+ size_t size() const { return size_; }
+ size_t width() const { return size(); }
+
+ template <typename It> void operator()(It&& it) {
+ if (specs_.sign) *it++ = static_cast<Char>(data::signs[specs_.sign]);
+ it = prettify(it);
+ }
+};
+
+template <typename T>
+int format_float(T value, int precision, float_specs specs, buffer<char>& buf);
+
+// Formats a floating-point number with snprintf.
+template <typename T>
+int snprintf_float(T value, int precision, float_specs specs,
+ buffer<char>& buf);
+
+template <typename T> T promote_float(T value) { return value; }
+inline double promote_float(float value) { return value; }
+
+template <typename Handler>
+FMT_CONSTEXPR void handle_int_type_spec(char spec, Handler&& handler) {
+ switch (spec) {
+ case 0:
+ case 'd':
+ handler.on_dec();
+ break;
+ case 'x':
+ case 'X':
+ handler.on_hex();
+ break;
+ case 'b':
+ case 'B':
+ handler.on_bin();
+ break;
+ case 'o':
+ handler.on_oct();
+ break;
+ case 'n':
+ handler.on_num();
+ break;
+ default:
+ handler.on_error();
+ }
+}
+
+template <typename ErrorHandler = error_handler, typename Char>
+FMT_CONSTEXPR float_specs parse_float_type_spec(
+ const basic_format_specs<Char>& specs, ErrorHandler&& eh = {}) {
+ auto result = float_specs();
+ result.trailing_zeros = specs.alt;
+ switch (specs.type) {
+ case 0:
+ result.format = float_format::general;
+ result.trailing_zeros |= specs.precision != 0;
+ break;
+ case 'G':
+ result.upper = true;
+ FMT_FALLTHROUGH;
+ case 'g':
+ result.format = float_format::general;
+ break;
+ case 'E':
+ result.upper = true;
+ FMT_FALLTHROUGH;
+ case 'e':
+ result.format = float_format::exp;
+ result.trailing_zeros |= specs.precision != 0;
+ break;
+ case 'F':
+ result.upper = true;
+ FMT_FALLTHROUGH;
+ case 'f':
+ result.format = float_format::fixed;
+ result.trailing_zeros |= specs.precision != 0;
+ break;
+#if FMT_DEPRECATED_PERCENT
+ case '%':
+ result.format = float_format::fixed;
+ result.percent = true;
+ break;
+#endif
+ case 'A':
+ result.upper = true;
+ FMT_FALLTHROUGH;
+ case 'a':
+ result.format = float_format::hex;
+ break;
+ case 'n':
+ result.locale = true;
+ break;
+ default:
+ eh.on_error("invalid type specifier");
+ break;
+ }
+ return result;
+}
+
+template <typename Char, typename Handler>
+FMT_CONSTEXPR void handle_char_specs(const basic_format_specs<Char>* specs,
+ Handler&& handler) {
+ if (!specs) return handler.on_char();
+ if (specs->type && specs->type != 'c') return handler.on_int();
+ if (specs->align == align::numeric || specs->sign != sign::none || specs->alt)
+ handler.on_error("invalid format specifier for char");
+ handler.on_char();
+}
+
+template <typename Char, typename Handler>
+FMT_CONSTEXPR void handle_cstring_type_spec(Char spec, Handler&& handler) {
+ if (spec == 0 || spec == 's')
+ handler.on_string();
+ else if (spec == 'p')
+ handler.on_pointer();
+ else
+ handler.on_error("invalid type specifier");
+}
+
+template <typename Char, typename ErrorHandler>
+FMT_CONSTEXPR void check_string_type_spec(Char spec, ErrorHandler&& eh) {
+ if (spec != 0 && spec != 's') eh.on_error("invalid type specifier");
+}
+
+template <typename Char, typename ErrorHandler>
+FMT_CONSTEXPR void check_pointer_type_spec(Char spec, ErrorHandler&& eh) {
+ if (spec != 0 && spec != 'p') eh.on_error("invalid type specifier");
+}
+
+template <typename ErrorHandler> class int_type_checker : private ErrorHandler {
+ public:
+ FMT_CONSTEXPR explicit int_type_checker(ErrorHandler eh) : ErrorHandler(eh) {}
+
+ FMT_CONSTEXPR void on_dec() {}
+ FMT_CONSTEXPR void on_hex() {}
+ FMT_CONSTEXPR void on_bin() {}
+ FMT_CONSTEXPR void on_oct() {}
+ FMT_CONSTEXPR void on_num() {}
+
+ FMT_CONSTEXPR void on_error() {
+ ErrorHandler::on_error("invalid type specifier");
+ }
+};
+
+template <typename ErrorHandler>
+class char_specs_checker : public ErrorHandler {
+ private:
+ char type_;
+
+ public:
+ FMT_CONSTEXPR char_specs_checker(char type, ErrorHandler eh)
+ : ErrorHandler(eh), type_(type) {}
+
+ FMT_CONSTEXPR void on_int() {
+ handle_int_type_spec(type_, int_type_checker<ErrorHandler>(*this));
+ }
+ FMT_CONSTEXPR void on_char() {}
+};
+
+template <typename ErrorHandler>
+class cstring_type_checker : public ErrorHandler {
+ public:
+ FMT_CONSTEXPR explicit cstring_type_checker(ErrorHandler eh)
+ : ErrorHandler(eh) {}
+
+ FMT_CONSTEXPR void on_string() {}
+ FMT_CONSTEXPR void on_pointer() {}
+};
+
+template <typename Context>
+void arg_map<Context>::init(const basic_format_args<Context>& args) {
+ if (map_) return;
+ map_ = new entry[internal::to_unsigned(args.max_size())];
+ if (args.is_packed()) {
+ for (int i = 0;; ++i) {
+ internal::type arg_type = args.type(i);
+ if (arg_type == internal::none_type) return;
+ if (arg_type == internal::named_arg_type) push_back(args.values_[i]);
+ }
+ }
+ for (int i = 0, n = args.max_size(); i < n; ++i) {
+ auto type = args.args_[i].type_;
+ if (type == internal::named_arg_type) push_back(args.args_[i].value_);
+ }
+}
+
+template <typename Char> struct nonfinite_writer {
+ sign_t sign;
+ const char* str;
+ static constexpr size_t str_size = 3;
+
+ size_t size() const { return str_size + (sign ? 1 : 0); }
+ size_t width() const { return size(); }
+
+ template <typename It> void operator()(It&& it) const {
+ if (sign) *it++ = static_cast<Char>(data::signs[sign]);
+ it = copy_str<Char>(str, str + str_size, it);
+ }
+};
+
+// This template provides operations for formatting and writing data into a
+// character range.
+template <typename Range> class basic_writer {
+ public:
+ using char_type = typename Range::value_type;
+ using iterator = typename Range::iterator;
+ using format_specs = basic_format_specs<char_type>;
+
+ private:
+ iterator out_; // Output iterator.
+ locale_ref locale_;
+
+ // Attempts to reserve space for n extra characters in the output range.
+ // Returns a pointer to the reserved range or a reference to out_.
+ auto reserve(std::size_t n) -> decltype(internal::reserve(out_, n)) {
+ return internal::reserve(out_, n);
+ }
+
+ template <typename F> struct padded_int_writer {
+ size_t size_;
+ string_view prefix;
+ char_type fill;
+ std::size_t padding;
+ F f;
+
+ size_t size() const { return size_; }
+ size_t width() const { return size_; }
+
+ template <typename It> void operator()(It&& it) const {
+ if (prefix.size() != 0)
+ it = copy_str<char_type>(prefix.begin(), prefix.end(), it);
+ it = std::fill_n(it, padding, fill);
+ f(it);
+ }
+ };
+
+ // Writes an integer in the format
+ // <left-padding><prefix><numeric-padding><digits><right-padding>
+ // where <digits> are written by f(it).
+ template <typename F>
+ void write_int(int num_digits, string_view prefix, format_specs specs, F f) {
+ std::size_t size = prefix.size() + to_unsigned(num_digits);
+ char_type fill = specs.fill[0];
+ std::size_t padding = 0;
+ if (specs.align == align::numeric) {
+ auto unsiged_width = to_unsigned(specs.width);
+ if (unsiged_width > size) {
+ padding = unsiged_width - size;
+ size = unsiged_width;
+ }
+ } else if (specs.precision > num_digits) {
+ size = prefix.size() + to_unsigned(specs.precision);
+ padding = to_unsigned(specs.precision - num_digits);
+ fill = static_cast<char_type>('0');
+ }
+ if (specs.align == align::none) specs.align = align::right;
+ write_padded(specs, padded_int_writer<F>{size, prefix, fill, padding, f});
+ }
+
+ // Writes a decimal integer.
+ template <typename Int> void write_decimal(Int value) {
+ auto abs_value = static_cast<uint32_or_64_or_128_t<Int>>(value);
+ bool negative = is_negative(value);
+ // Don't do -abs_value since it trips unsigned-integer-overflow sanitizer.
+ if (negative) abs_value = ~abs_value + 1;
+ int num_digits = count_digits(abs_value);
+ auto&& it = reserve((negative ? 1 : 0) + static_cast<size_t>(num_digits));
+ if (negative) *it++ = static_cast<char_type>('-');
+ it = format_decimal<char_type>(it, abs_value, num_digits);
+ }
+
+ // The handle_int_type_spec handler that writes an integer.
+ template <typename Int, typename Specs> struct int_writer {
+ using unsigned_type = uint32_or_64_or_128_t<Int>;
+
+ basic_writer<Range>& writer;
+ const Specs& specs;
+ unsigned_type abs_value;
+ char prefix[4];
+ unsigned prefix_size;
+
+ string_view get_prefix() const { return string_view(prefix, prefix_size); }
+
+ int_writer(basic_writer<Range>& w, Int value, const Specs& s)
+ : writer(w),
+ specs(s),
+ abs_value(static_cast<unsigned_type>(value)),
+ prefix_size(0) {
+ if (is_negative(value)) {
+ prefix[0] = '-';
+ ++prefix_size;
+ abs_value = 0 - abs_value;
+ } else if (specs.sign != sign::none && specs.sign != sign::minus) {
+ prefix[0] = specs.sign == sign::plus ? '+' : ' ';
+ ++prefix_size;
+ }
+ }
+
+ struct dec_writer {
+ unsigned_type abs_value;
+ int num_digits;
+
+ template <typename It> void operator()(It&& it) const {
+ it = internal::format_decimal<char_type>(it, abs_value, num_digits);
+ }
+ };
+
+ void on_dec() {
+ int num_digits = count_digits(abs_value);
+ writer.write_int(num_digits, get_prefix(), specs,
+ dec_writer{abs_value, num_digits});
+ }
+
+ struct hex_writer {
+ int_writer& self;
+ int num_digits;
+
+ template <typename It> void operator()(It&& it) const {
+ it = format_uint<4, char_type>(it, self.abs_value, num_digits,
+ self.specs.type != 'x');
+ }
+ };
+
+ void on_hex() {
+ if (specs.alt) {
+ prefix[prefix_size++] = '0';
+ prefix[prefix_size++] = specs.type;
+ }
+ int num_digits = count_digits<4>(abs_value);
+ writer.write_int(num_digits, get_prefix(), specs,
+ hex_writer{*this, num_digits});
+ }
+
+ template <int BITS> struct bin_writer {
+ unsigned_type abs_value;
+ int num_digits;
+
+ template <typename It> void operator()(It&& it) const {
+ it = format_uint<BITS, char_type>(it, abs_value, num_digits);
+ }
+ };
+
+ void on_bin() {
+ if (specs.alt) {
+ prefix[prefix_size++] = '0';
+ prefix[prefix_size++] = static_cast<char>(specs.type);
+ }
+ int num_digits = count_digits<1>(abs_value);
+ writer.write_int(num_digits, get_prefix(), specs,
+ bin_writer<1>{abs_value, num_digits});
+ }
+
+ void on_oct() {
+ int num_digits = count_digits<3>(abs_value);
+ if (specs.alt && specs.precision <= num_digits && abs_value != 0) {
+ // Octal prefix '0' is counted as a digit, so only add it if precision
+ // is not greater than the number of digits.
+ prefix[prefix_size++] = '0';
+ }
+ writer.write_int(num_digits, get_prefix(), specs,
+ bin_writer<3>{abs_value, num_digits});
+ }
+
+ enum { sep_size = 1 };
+
+ struct num_writer {
+ unsigned_type abs_value;
+ int size;
+ const std::string& groups;
+ char_type sep;
+
+ template <typename It> void operator()(It&& it) const {
+ basic_string_view<char_type> s(&sep, sep_size);
+ // Index of a decimal digit with the least significant digit having
+ // index 0.
+ int digit_index = 0;
+ std::string::const_iterator group = groups.cbegin();
+ it = format_decimal<char_type>(
+ it, abs_value, size,
+ [this, s, &group, &digit_index](char_type*& buffer) {
+ if (*group <= 0 || ++digit_index % *group != 0 ||
+ *group == max_value<char>())
+ return;
+ if (group + 1 != groups.cend()) {
+ digit_index = 0;
+ ++group;
+ }
+ buffer -= s.size();
+ std::uninitialized_copy(s.data(), s.data() + s.size(),
+ make_checked(buffer, s.size()));
+ });
+ }
+ };
+
+ void on_num() {
+ std::string groups = grouping<char_type>(writer.locale_);
+ if (groups.empty()) return on_dec();
+ auto sep = thousands_sep<char_type>(writer.locale_);
+ if (!sep) return on_dec();
+ int num_digits = count_digits(abs_value);
+ int size = num_digits;
+ std::string::const_iterator group = groups.cbegin();
+ while (group != groups.cend() && num_digits > *group && *group > 0 &&
+ *group != max_value<char>()) {
+ size += sep_size;
+ num_digits -= *group;
+ ++group;
+ }
+ if (group == groups.cend())
+ size += sep_size * ((num_digits - 1) / groups.back());
+ writer.write_int(size, get_prefix(), specs,
+ num_writer{abs_value, size, groups, sep});
+ }
+
+ FMT_NORETURN void on_error() {
+ FMT_THROW(format_error("invalid type specifier"));
+ }
+ };
+
+ template <typename Char> struct str_writer {
+ const Char* s;
+ size_t size_;
+
+ size_t size() const { return size_; }
+ size_t width() const {
+ return count_code_points(basic_string_view<Char>(s, size_));
+ }
+
+ template <typename It> void operator()(It&& it) const {
+ it = copy_str<char_type>(s, s + size_, it);
+ }
+ };
+
+ template <typename UIntPtr> struct pointer_writer {
+ UIntPtr value;
+ int num_digits;
+
+ size_t size() const { return to_unsigned(num_digits) + 2; }
+ size_t width() const { return size(); }
+
+ template <typename It> void operator()(It&& it) const {
+ *it++ = static_cast<char_type>('0');
+ *it++ = static_cast<char_type>('x');
+ it = format_uint<4, char_type>(it, value, num_digits);
+ }
+ };
+
+ public:
+ explicit basic_writer(Range out, locale_ref loc = locale_ref())
+ : out_(out.begin()), locale_(loc) {}
+
+ iterator out() const { return out_; }
+
+ // Writes a value in the format
+ // <left-padding><value><right-padding>
+ // where <value> is written by f(it).
+ template <typename F> void write_padded(const format_specs& specs, F&& f) {
+ // User-perceived width (in code points).
+ unsigned width = to_unsigned(specs.width);
+ size_t size = f.size(); // The number of code units.
+ size_t num_code_points = width != 0 ? f.width() : size;
+ if (width <= num_code_points) return f(reserve(size));
+ auto&& it = reserve(width + (size - num_code_points));
+ char_type fill = specs.fill[0];
+ std::size_t padding = width - num_code_points;
+ if (specs.align == align::right) {
+ it = std::fill_n(it, padding, fill);
+ f(it);
+ } else if (specs.align == align::center) {
+ std::size_t left_padding = padding / 2;
+ it = std::fill_n(it, left_padding, fill);
+ f(it);
+ it = std::fill_n(it, padding - left_padding, fill);
+ } else {
+ f(it);
+ it = std::fill_n(it, padding, fill);
+ }
+ }
+
+ void write(int value) { write_decimal(value); }
+ void write(long value) { write_decimal(value); }
+ void write(long long value) { write_decimal(value); }
+
+ void write(unsigned value) { write_decimal(value); }
+ void write(unsigned long value) { write_decimal(value); }
+ void write(unsigned long long value) { write_decimal(value); }
+
+#if FMT_USE_INT128
+ void write(int128_t value) { write_decimal(value); }
+ void write(uint128_t value) { write_decimal(value); }
+#endif
+
+ template <typename T, typename Spec>
+ void write_int(T value, const Spec& spec) {
+ handle_int_type_spec(spec.type, int_writer<T, Spec>(*this, value, spec));
+ }
+
+ template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
+ void write(T value, format_specs specs = {}) {
+ float_specs fspecs = parse_float_type_spec(specs);
+ fspecs.sign = specs.sign;
+ if (std::signbit(value)) { // value < 0 is false for NaN so use signbit.
+ fspecs.sign = sign::minus;
+ value = -value;
+ } else if (fspecs.sign == sign::minus) {
+ fspecs.sign = sign::none;
+ }
+
+ if (!std::isfinite(value)) {
+ auto str = std::isinf(value) ? (fspecs.upper ? "INF" : "inf")
+ : (fspecs.upper ? "NAN" : "nan");
+ return write_padded(specs, nonfinite_writer<char_type>{fspecs.sign, str});
+ }
+
+ if (specs.align == align::none) {
+ specs.align = align::right;
+ } else if (specs.align == align::numeric) {
+ if (fspecs.sign) {
+ auto&& it = reserve(1);
+ *it++ = static_cast<char_type>(data::signs[fspecs.sign]);
+ fspecs.sign = sign::none;
+ if (specs.width != 0) --specs.width;
+ }
+ specs.align = align::right;
+ }
+
+ memory_buffer buffer;
+ if (fspecs.format == float_format::hex) {
+ if (fspecs.sign) buffer.push_back(data::signs[fspecs.sign]);
+ snprintf_float(promote_float(value), specs.precision, fspecs, buffer);
+ write_padded(specs, str_writer<char>{buffer.data(), buffer.size()});
+ return;
+ }
+ int precision = specs.precision >= 0 || !specs.type ? specs.precision : 6;
+ if (fspecs.format == float_format::exp) ++precision;
+ if (const_check(std::is_same<T, float>())) fspecs.binary32 = true;
+ fspecs.use_grisu = use_grisu<T>();
+ if (const_check(FMT_DEPRECATED_PERCENT) && fspecs.percent) value *= 100;
+ int exp = format_float(promote_float(value), precision, fspecs, buffer);
+ if (const_check(FMT_DEPRECATED_PERCENT) && fspecs.percent) {
+ buffer.push_back('%');
+ --exp; // Adjust decimal place position.
+ }
+ fspecs.precision = precision;
+ char_type point = fspecs.locale ? decimal_point<char_type>(locale_)
+ : static_cast<char_type>('.');
+ write_padded(specs, float_writer<char_type>(buffer.data(),
+ static_cast<int>(buffer.size()),
+ exp, fspecs, point));
+ }
+
+ void write(char value) {
+ auto&& it = reserve(1);
+ *it++ = value;
+ }
+
+ template <typename Char, FMT_ENABLE_IF(std::is_same<Char, char_type>::value)>
+ void write(Char value) {
+ auto&& it = reserve(1);
+ *it++ = value;
+ }
+
+ void write(string_view value) {
+ auto&& it = reserve(value.size());
+ it = copy_str<char_type>(value.begin(), value.end(), it);
+ }
+ void write(wstring_view value) {
+ static_assert(std::is_same<char_type, wchar_t>::value, "");
+ auto&& it = reserve(value.size());
+ it = std::copy(value.begin(), value.end(), it);
+ }
+
+ template <typename Char>
+ void write(const Char* s, std::size_t size, const format_specs& specs) {
+ write_padded(specs, str_writer<Char>{s, size});
+ }
+
+ template <typename Char>
+ void write(basic_string_view<Char> s, const format_specs& specs = {}) {
+ const Char* data = s.data();
+ std::size_t size = s.size();
+ if (specs.precision >= 0 && to_unsigned(specs.precision) < size)
+ size = code_point_index(s, to_unsigned(specs.precision));
+ write(data, size, specs);
+ }
+
+ template <typename UIntPtr>
+ void write_pointer(UIntPtr value, const format_specs* specs) {
+ int num_digits = count_digits<4>(value);
+ auto pw = pointer_writer<UIntPtr>{value, num_digits};
+ if (!specs) return pw(reserve(to_unsigned(num_digits) + 2));
+ format_specs specs_copy = *specs;
+ if (specs_copy.align == align::none) specs_copy.align = align::right;
+ write_padded(specs_copy, pw);
+ }
+};
+
+using writer = basic_writer<buffer_range<char>>;
+
+template <typename T> struct is_integral : std::is_integral<T> {};
+template <> struct is_integral<int128_t> : std::true_type {};
+template <> struct is_integral<uint128_t> : std::true_type {};
+
+template <typename Range, typename ErrorHandler = internal::error_handler>
+class arg_formatter_base {
+ public:
+ using char_type = typename Range::value_type;
+ using iterator = typename Range::iterator;
+ using format_specs = basic_format_specs<char_type>;
+
+ private:
+ using writer_type = basic_writer<Range>;
+ writer_type writer_;
+ format_specs* specs_;
+
+ struct char_writer {
+ char_type value;
+
+ size_t size() const { return 1; }
+ size_t width() const { return 1; }
+
+ template <typename It> void operator()(It&& it) const { *it++ = value; }
+ };
+
+ void write_char(char_type value) {
+ if (specs_)
+ writer_.write_padded(*specs_, char_writer{value});
+ else
+ writer_.write(value);
+ }
+
+ void write_pointer(const void* p) {
+ writer_.write_pointer(internal::to_uintptr(p), specs_);
+ }
+
+ protected:
+ writer_type& writer() { return writer_; }
+ FMT_DEPRECATED format_specs* spec() { return specs_; }
+ format_specs* specs() { return specs_; }
+ iterator out() { return writer_.out(); }
+
+ void write(bool value) {
+ string_view sv(value ? "true" : "false");
+ specs_ ? writer_.write(sv, *specs_) : writer_.write(sv);
+ }
+
+ void write(const char_type* value) {
+ if (!value) {
+ FMT_THROW(format_error("string pointer is null"));
+ } else {
+ auto length = std::char_traits<char_type>::length(value);
+ basic_string_view<char_type> sv(value, length);
+ specs_ ? writer_.write(sv, *specs_) : writer_.write(sv);
+ }
+ }
+
+ public:
+ arg_formatter_base(Range r, format_specs* s, locale_ref loc)
+ : writer_(r, loc), specs_(s) {}
+
+ iterator operator()(monostate) {
+ FMT_ASSERT(false, "invalid argument type");
+ return out();
+ }
+
+ template <typename T, FMT_ENABLE_IF(is_integral<T>::value)>
+ iterator operator()(T value) {
+ if (specs_)
+ writer_.write_int(value, *specs_);
+ else
+ writer_.write(value);
+ return out();
+ }
+
+ iterator operator()(char_type value) {
+ internal::handle_char_specs(
+ specs_, char_spec_handler(*this, static_cast<char_type>(value)));
+ return out();
+ }
+
+ iterator operator()(bool value) {
+ if (specs_ && specs_->type) return (*this)(value ? 1 : 0);
+ write(value != 0);
+ return out();
+ }
+
+ template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
+ iterator operator()(T value) {
+ writer_.write(value, specs_ ? *specs_ : format_specs());
+ return out();
+ }
+
+ struct char_spec_handler : ErrorHandler {
+ arg_formatter_base& formatter;
+ char_type value;
+
+ char_spec_handler(arg_formatter_base& f, char_type val)
+ : formatter(f), value(val) {}
+
+ void on_int() {
+ if (formatter.specs_)
+ formatter.writer_.write_int(value, *formatter.specs_);
+ else
+ formatter.writer_.write(value);
+ }
+ void on_char() { formatter.write_char(value); }
+ };
+
+ struct cstring_spec_handler : internal::error_handler {
+ arg_formatter_base& formatter;
+ const char_type* value;
+
+ cstring_spec_handler(arg_formatter_base& f, const char_type* val)
+ : formatter(f), value(val) {}
+
+ void on_string() { formatter.write(value); }
+ void on_pointer() { formatter.write_pointer(value); }
+ };
+
+ iterator operator()(const char_type* value) {
+ if (!specs_) return write(value), out();
+ internal::handle_cstring_type_spec(specs_->type,
+ cstring_spec_handler(*this, value));
+ return out();
+ }
+
+ iterator operator()(basic_string_view<char_type> value) {
+ if (specs_) {
+ internal::check_string_type_spec(specs_->type, internal::error_handler());
+ writer_.write(value, *specs_);
+ } else {
+ writer_.write(value);
+ }
+ return out();
+ }
+
+ iterator operator()(const void* value) {
+ if (specs_)
+ check_pointer_type_spec(specs_->type, internal::error_handler());
+ write_pointer(value);
+ return out();
+ }
+};
+
+template <typename Char> FMT_CONSTEXPR bool is_name_start(Char c) {
+ return ('a' <= c && c <= 'z') || ('A' <= c && c <= 'Z') || '_' == c;
+}
+
+// Parses the range [begin, end) as an unsigned integer. This function assumes
+// that the range is non-empty and the first character is a digit.
+template <typename Char, typename ErrorHandler>
+FMT_CONSTEXPR int parse_nonnegative_int(const Char*& begin, const Char* end,
+ ErrorHandler&& eh) {
+ FMT_ASSERT(begin != end && '0' <= *begin && *begin <= '9', "");
+ if (*begin == '0') {
+ ++begin;
+ return 0;
+ }
+ unsigned value = 0;
+ // Convert to unsigned to prevent a warning.
+ constexpr unsigned max_int = max_value<int>();
+ unsigned big = max_int / 10;
+ do {
+ // Check for overflow.
+ if (value > big) {
+ value = max_int + 1;
+ break;
+ }
+ value = value * 10 + unsigned(*begin - '0');
+ ++begin;
+ } while (begin != end && '0' <= *begin && *begin <= '9');
+ if (value > max_int) eh.on_error("number is too big");
+ return static_cast<int>(value);
+}
+
+template <typename Context> class custom_formatter {
+ private:
+ using char_type = typename Context::char_type;
+
+ basic_format_parse_context<char_type>& parse_ctx_;
+ Context& ctx_;
+
+ public:
+ explicit custom_formatter(basic_format_parse_context<char_type>& parse_ctx,
+ Context& ctx)
+ : parse_ctx_(parse_ctx), ctx_(ctx) {}
+
+ bool operator()(typename basic_format_arg<Context>::handle h) const {
+ h.format(parse_ctx_, ctx_);
+ return true;
+ }
+
+ template <typename T> bool operator()(T) const { return false; }
+};
+
+template <typename T>
+using is_integer =
+ bool_constant<is_integral<T>::value && !std::is_same<T, bool>::value &&
+ !std::is_same<T, char>::value &&
+ !std::is_same<T, wchar_t>::value>;
+
+template <typename ErrorHandler> class width_checker {
+ public:
+ explicit FMT_CONSTEXPR width_checker(ErrorHandler& eh) : handler_(eh) {}
+
+ template <typename T, FMT_ENABLE_IF(is_integer<T>::value)>
+ FMT_CONSTEXPR unsigned long long operator()(T value) {
+ if (is_negative(value)) handler_.on_error("negative width");
+ return static_cast<unsigned long long>(value);
+ }
+
+ template <typename T, FMT_ENABLE_IF(!is_integer<T>::value)>
+ FMT_CONSTEXPR unsigned long long operator()(T) {
+ handler_.on_error("width is not integer");
+ return 0;
+ }
+
+ private:
+ ErrorHandler& handler_;
+};
+
+template <typename ErrorHandler> class precision_checker {
+ public:
+ explicit FMT_CONSTEXPR precision_checker(ErrorHandler& eh) : handler_(eh) {}
+
+ template <typename T, FMT_ENABLE_IF(is_integer<T>::value)>
+ FMT_CONSTEXPR unsigned long long operator()(T value) {
+ if (is_negative(value)) handler_.on_error("negative precision");
+ return static_cast<unsigned long long>(value);
+ }
+
+ template <typename T, FMT_ENABLE_IF(!is_integer<T>::value)>
+ FMT_CONSTEXPR unsigned long long operator()(T) {
+ handler_.on_error("precision is not integer");
+ return 0;
+ }
+
+ private:
+ ErrorHandler& handler_;
+};
+
+// A format specifier handler that sets fields in basic_format_specs.
+template <typename Char> class specs_setter {
+ public:
+ explicit FMT_CONSTEXPR specs_setter(basic_format_specs<Char>& specs)
+ : specs_(specs) {}
+
+ FMT_CONSTEXPR specs_setter(const specs_setter& other)
+ : specs_(other.specs_) {}
+
+ FMT_CONSTEXPR void on_align(align_t align) { specs_.align = align; }
+ FMT_CONSTEXPR void on_fill(Char fill) { specs_.fill[0] = fill; }
+ FMT_CONSTEXPR void on_plus() { specs_.sign = sign::plus; }
+ FMT_CONSTEXPR void on_minus() { specs_.sign = sign::minus; }
+ FMT_CONSTEXPR void on_space() { specs_.sign = sign::space; }
+ FMT_CONSTEXPR void on_hash() { specs_.alt = true; }
+
+ FMT_CONSTEXPR void on_zero() {
+ specs_.align = align::numeric;
+ specs_.fill[0] = Char('0');
+ }
+
+ FMT_CONSTEXPR void on_width(int width) { specs_.width = width; }
+ FMT_CONSTEXPR void on_precision(int precision) {
+ specs_.precision = precision;
+ }
+ FMT_CONSTEXPR void end_precision() {}
+
+ FMT_CONSTEXPR void on_type(Char type) {
+ specs_.type = static_cast<char>(type);
+ }
+
+ protected:
+ basic_format_specs<Char>& specs_;
+};
+
+template <typename ErrorHandler> class numeric_specs_checker {
+ public:
+ FMT_CONSTEXPR numeric_specs_checker(ErrorHandler& eh, internal::type arg_type)
+ : error_handler_(eh), arg_type_(arg_type) {}
+
+ FMT_CONSTEXPR void require_numeric_argument() {
+ if (!is_arithmetic_type(arg_type_))
+ error_handler_.on_error("format specifier requires numeric argument");
+ }
+
+ FMT_CONSTEXPR void check_sign() {
+ require_numeric_argument();
+ if (is_integral_type(arg_type_) && arg_type_ != int_type &&
+ arg_type_ != long_long_type && arg_type_ != internal::char_type) {
+ error_handler_.on_error("format specifier requires signed argument");
+ }
+ }
+
+ FMT_CONSTEXPR void check_precision() {
+ if (is_integral_type(arg_type_) || arg_type_ == internal::pointer_type)
+ error_handler_.on_error("precision not allowed for this argument type");
+ }
+
+ private:
+ ErrorHandler& error_handler_;
+ internal::type arg_type_;
+};
+
+// A format specifier handler that checks if specifiers are consistent with the
+// argument type.
+template <typename Handler> class specs_checker : public Handler {
+ public:
+ FMT_CONSTEXPR specs_checker(const Handler& handler, internal::type arg_type)
+ : Handler(handler), checker_(*this, arg_type) {}
+
+ FMT_CONSTEXPR specs_checker(const specs_checker& other)
+ : Handler(other), checker_(*this, other.arg_type_) {}
+
+ FMT_CONSTEXPR void on_align(align_t align) {
+ if (align == align::numeric) checker_.require_numeric_argument();
+ Handler::on_align(align);
+ }
+
+ FMT_CONSTEXPR void on_plus() {
+ checker_.check_sign();
+ Handler::on_plus();
+ }
+
+ FMT_CONSTEXPR void on_minus() {
+ checker_.check_sign();
+ Handler::on_minus();
+ }
+
+ FMT_CONSTEXPR void on_space() {
+ checker_.check_sign();
+ Handler::on_space();
+ }
+
+ FMT_CONSTEXPR void on_hash() {
+ checker_.require_numeric_argument();
+ Handler::on_hash();
+ }
+
+ FMT_CONSTEXPR void on_zero() {
+ checker_.require_numeric_argument();
+ Handler::on_zero();
+ }
+
+ FMT_CONSTEXPR void end_precision() { checker_.check_precision(); }
+
+ private:
+ numeric_specs_checker<Handler> checker_;
+};
+
+template <template <typename> class Handler, typename FormatArg,
+ typename ErrorHandler>
+FMT_CONSTEXPR int get_dynamic_spec(FormatArg arg, ErrorHandler eh) {
+ unsigned long long value = visit_format_arg(Handler<ErrorHandler>(eh), arg);
+ if (value > to_unsigned(max_value<int>())) eh.on_error("number is too big");
+ return static_cast<int>(value);
+}
+
+struct auto_id {};
+
+template <typename Context>
+FMT_CONSTEXPR typename Context::format_arg get_arg(Context& ctx, int id) {
+ auto arg = ctx.arg(id);
+ if (!arg) ctx.on_error("argument index out of range");
+ return arg;
+}
+
+// The standard format specifier handler with checking.
+template <typename ParseContext, typename Context>
+class specs_handler : public specs_setter<typename Context::char_type> {
+ public:
+ using char_type = typename Context::char_type;
+
+ FMT_CONSTEXPR specs_handler(basic_format_specs<char_type>& specs,
+ ParseContext& parse_ctx, Context& ctx)
+ : specs_setter<char_type>(specs),
+ parse_context_(parse_ctx),
+ context_(ctx) {}
+
+ template <typename Id> FMT_CONSTEXPR void on_dynamic_width(Id arg_id) {
+ this->specs_.width = get_dynamic_spec<width_checker>(
+ get_arg(arg_id), context_.error_handler());
+ }
+
+ template <typename Id> FMT_CONSTEXPR void on_dynamic_precision(Id arg_id) {
+ this->specs_.precision = get_dynamic_spec<precision_checker>(
+ get_arg(arg_id), context_.error_handler());
+ }
+
+ void on_error(const char* message) { context_.on_error(message); }
+
+ private:
+ // This is only needed for compatibility with gcc 4.4.
+ using format_arg = typename Context::format_arg;
+
+ FMT_CONSTEXPR format_arg get_arg(auto_id) {
+ return internal::get_arg(context_, parse_context_.next_arg_id());
+ }
+
+ FMT_CONSTEXPR format_arg get_arg(int arg_id) {
+ parse_context_.check_arg_id(arg_id);
+ return internal::get_arg(context_, arg_id);
+ }
+
+ FMT_CONSTEXPR format_arg get_arg(basic_string_view<char_type> arg_id) {
+ parse_context_.check_arg_id(arg_id);
+ return context_.arg(arg_id);
+ }
+
+ ParseContext& parse_context_;
+ Context& context_;
+};
+
+enum class arg_id_kind { none, index, name };
+
+// An argument reference.
+template <typename Char> struct arg_ref {
+ FMT_CONSTEXPR arg_ref() : kind(arg_id_kind::none), val() {}
+ FMT_CONSTEXPR explicit arg_ref(int index)
+ : kind(arg_id_kind::index), val(index) {}
+ FMT_CONSTEXPR explicit arg_ref(basic_string_view<Char> name)
+ : kind(arg_id_kind::name), val(name) {}
+
+ FMT_CONSTEXPR arg_ref& operator=(int idx) {
+ kind = arg_id_kind::index;
+ val.index = idx;
+ return *this;
+ }
+
+ arg_id_kind kind;
+ union value {
+ FMT_CONSTEXPR value(int id = 0) : index{id} {}
+ FMT_CONSTEXPR value(basic_string_view<Char> n) : name(n) {}
+
+ int index;
+ basic_string_view<Char> name;
+ } val;
+};
+
+// Format specifiers with width and precision resolved at formatting rather
+// than parsing time to allow re-using the same parsed specifiers with
+// different sets of arguments (precompilation of format strings).
+template <typename Char>
+struct dynamic_format_specs : basic_format_specs<Char> {
+ arg_ref<Char> width_ref;
+ arg_ref<Char> precision_ref;
+};
+
+// Format spec handler that saves references to arguments representing dynamic
+// width and precision to be resolved at formatting time.
+template <typename ParseContext>
+class dynamic_specs_handler
+ : public specs_setter<typename ParseContext::char_type> {
+ public:
+ using char_type = typename ParseContext::char_type;
+
+ FMT_CONSTEXPR dynamic_specs_handler(dynamic_format_specs<char_type>& specs,
+ ParseContext& ctx)
+ : specs_setter<char_type>(specs), specs_(specs), context_(ctx) {}
+
+ FMT_CONSTEXPR dynamic_specs_handler(const dynamic_specs_handler& other)
+ : specs_setter<char_type>(other),
+ specs_(other.specs_),
+ context_(other.context_) {}
+
+ template <typename Id> FMT_CONSTEXPR void on_dynamic_width(Id arg_id) {
+ specs_.width_ref = make_arg_ref(arg_id);
+ }
+
+ template <typename Id> FMT_CONSTEXPR void on_dynamic_precision(Id arg_id) {
+ specs_.precision_ref = make_arg_ref(arg_id);
+ }
+
+ FMT_CONSTEXPR void on_error(const char* message) {
+ context_.on_error(message);
+ }
+
+ private:
+ using arg_ref_type = arg_ref<char_type>;
+
+ FMT_CONSTEXPR arg_ref_type make_arg_ref(int arg_id) {
+ context_.check_arg_id(arg_id);
+ return arg_ref_type(arg_id);
+ }
+
+ FMT_CONSTEXPR arg_ref_type make_arg_ref(auto_id) {
+ return arg_ref_type(context_.next_arg_id());
+ }
+
+ FMT_CONSTEXPR arg_ref_type make_arg_ref(basic_string_view<char_type> arg_id) {
+ context_.check_arg_id(arg_id);
+ basic_string_view<char_type> format_str(
+ context_.begin(), to_unsigned(context_.end() - context_.begin()));
+ return arg_ref_type(arg_id);
+ }
+
+ dynamic_format_specs<char_type>& specs_;
+ ParseContext& context_;
+};
+
+template <typename Char, typename IDHandler>
+FMT_CONSTEXPR const Char* parse_arg_id(const Char* begin, const Char* end,
+ IDHandler&& handler) {
+ FMT_ASSERT(begin != end, "");
+ Char c = *begin;
+ if (c == '}' || c == ':') {
+ handler();
+ return begin;
+ }
+ if (c >= '0' && c <= '9') {
+ int index = parse_nonnegative_int(begin, end, handler);
+ if (begin == end || (*begin != '}' && *begin != ':'))
+ handler.on_error("invalid format string");
+ else
+ handler(index);
+ return begin;
+ }
+ if (!is_name_start(c)) {
+ handler.on_error("invalid format string");
+ return begin;
+ }
+ auto it = begin;
+ do {
+ ++it;
+ } while (it != end && (is_name_start(c = *it) || ('0' <= c && c <= '9')));
+ handler(basic_string_view<Char>(begin, to_unsigned(it - begin)));
+ return it;
+}
+
+// Adapts SpecHandler to IDHandler API for dynamic width.
+template <typename SpecHandler, typename Char> struct width_adapter {
+ explicit FMT_CONSTEXPR width_adapter(SpecHandler& h) : handler(h) {}
+
+ FMT_CONSTEXPR void operator()() { handler.on_dynamic_width(auto_id()); }
+ FMT_CONSTEXPR void operator()(int id) { handler.on_dynamic_width(id); }
+ FMT_CONSTEXPR void operator()(basic_string_view<Char> id) {
+ handler.on_dynamic_width(id);
+ }
+
+ FMT_CONSTEXPR void on_error(const char* message) {
+ handler.on_error(message);
+ }
+
+ SpecHandler& handler;
+};
+
+// Adapts SpecHandler to IDHandler API for dynamic precision.
+template <typename SpecHandler, typename Char> struct precision_adapter {
+ explicit FMT_CONSTEXPR precision_adapter(SpecHandler& h) : handler(h) {}
+
+ FMT_CONSTEXPR void operator()() { handler.on_dynamic_precision(auto_id()); }
+ FMT_CONSTEXPR void operator()(int id) { handler.on_dynamic_precision(id); }
+ FMT_CONSTEXPR void operator()(basic_string_view<Char> id) {
+ handler.on_dynamic_precision(id);
+ }
+
+ FMT_CONSTEXPR void on_error(const char* message) {
+ handler.on_error(message);
+ }
+
+ SpecHandler& handler;
+};
+
+// Parses fill and alignment.
+template <typename Char, typename Handler>
+FMT_CONSTEXPR const Char* parse_align(const Char* begin, const Char* end,
+ Handler&& handler) {
+ FMT_ASSERT(begin != end, "");
+ auto align = align::none;
+ int i = 0;
+ if (begin + 1 != end) ++i;
+ do {
+ switch (static_cast<char>(begin[i])) {
+ case '<':
+ align = align::left;
+ break;
+ case '>':
+ align = align::right;
+ break;
+#if FMT_NUMERIC_ALIGN
+ case '=':
+ align = align::numeric;
+ break;
+#endif
+ case '^':
+ align = align::center;
+ break;
+ }
+ if (align != align::none) {
+ if (i > 0) {
+ auto c = *begin;
+ if (c == '{')
+ return handler.on_error("invalid fill character '{'"), begin;
+ begin += 2;
+ handler.on_fill(c);
+ } else
+ ++begin;
+ handler.on_align(align);
+ break;
+ }
+ } while (i-- > 0);
+ return begin;
+}
+
+template <typename Char, typename Handler>
+FMT_CONSTEXPR const Char* parse_width(const Char* begin, const Char* end,
+ Handler&& handler) {
+ FMT_ASSERT(begin != end, "");
+ if ('0' <= *begin && *begin <= '9') {
+ handler.on_width(parse_nonnegative_int(begin, end, handler));
+ } else if (*begin == '{') {
+ ++begin;
+ if (begin != end)
+ begin = parse_arg_id(begin, end, width_adapter<Handler, Char>(handler));
+ if (begin == end || *begin != '}')
+ return handler.on_error("invalid format string"), begin;
+ ++begin;
+ }
+ return begin;
+}
+
+template <typename Char, typename Handler>
+FMT_CONSTEXPR const Char* parse_precision(const Char* begin, const Char* end,
+ Handler&& handler) {
+ ++begin;
+ auto c = begin != end ? *begin : Char();
+ if ('0' <= c && c <= '9') {
+ handler.on_precision(parse_nonnegative_int(begin, end, handler));
+ } else if (c == '{') {
+ ++begin;
+ if (begin != end) {
+ begin =
+ parse_arg_id(begin, end, precision_adapter<Handler, Char>(handler));
+ }
+ if (begin == end || *begin++ != '}')
+ return handler.on_error("invalid format string"), begin;
+ } else {
+ return handler.on_error("missing precision specifier"), begin;
+ }
+ handler.end_precision();
+ return begin;
+}
+
+// Parses standard format specifiers and sends notifications about parsed
+// components to handler.
+template <typename Char, typename SpecHandler>
+FMT_CONSTEXPR const Char* parse_format_specs(const Char* begin, const Char* end,
+ SpecHandler&& handler) {
+ if (begin == end || *begin == '}') return begin;
+
+ begin = parse_align(begin, end, handler);
+ if (begin == end) return begin;
+
+ // Parse sign.
+ switch (static_cast<char>(*begin)) {
+ case '+':
+ handler.on_plus();
+ ++begin;
+ break;
+ case '-':
+ handler.on_minus();
+ ++begin;
+ break;
+ case ' ':
+ handler.on_space();
+ ++begin;
+ break;
+ }
+ if (begin == end) return begin;
+
+ if (*begin == '#') {
+ handler.on_hash();
+ if (++begin == end) return begin;
+ }
+
+ // Parse zero flag.
+ if (*begin == '0') {
+ handler.on_zero();
+ if (++begin == end) return begin;
+ }
+
+ begin = parse_width(begin, end, handler);
+ if (begin == end) return begin;
+
+ // Parse precision.
+ if (*begin == '.') {
+ begin = parse_precision(begin, end, handler);
+ }
+
+ // Parse type.
+ if (begin != end && *begin != '}') handler.on_type(*begin++);
+ return begin;
+}
+
+// Return the result via the out param to workaround gcc bug 77539.
+template <bool IS_CONSTEXPR, typename T, typename Ptr = const T*>
+FMT_CONSTEXPR bool find(Ptr first, Ptr last, T value, Ptr& out) {
+ for (out = first; out != last; ++out) {
+ if (*out == value) return true;
+ }
+ return false;
+}
+
+template <>
+inline bool find<false, char>(const char* first, const char* last, char value,
+ const char*& out) {
+ out = static_cast<const char*>(
+ std::memchr(first, value, internal::to_unsigned(last - first)));
+ return out != nullptr;
+}
+
+template <typename Handler, typename Char> struct id_adapter {
+ FMT_CONSTEXPR void operator()() { handler.on_arg_id(); }
+ FMT_CONSTEXPR void operator()(int id) { handler.on_arg_id(id); }
+ FMT_CONSTEXPR void operator()(basic_string_view<Char> id) {
+ handler.on_arg_id(id);
+ }
+ FMT_CONSTEXPR void on_error(const char* message) {
+ handler.on_error(message);
+ }
+ Handler& handler;
+};
+
+template <bool IS_CONSTEXPR, typename Char, typename Handler>
+FMT_CONSTEXPR void parse_format_string(basic_string_view<Char> format_str,
+ Handler&& handler) {
+ struct pfs_writer {
+ FMT_CONSTEXPR void operator()(const Char* begin, const Char* end) {
+ if (begin == end) return;
+ for (;;) {
+ const Char* p = nullptr;
+ if (!find<IS_CONSTEXPR>(begin, end, '}', p))
+ return handler_.on_text(begin, end);
+ ++p;
+ if (p == end || *p != '}')
+ return handler_.on_error("unmatched '}' in format string");
+ handler_.on_text(begin, p);
+ begin = p + 1;
+ }
+ }
+ Handler& handler_;
+ } write{handler};
+ auto begin = format_str.data();
+ auto end = begin + format_str.size();
+ while (begin != end) {
+ // Doing two passes with memchr (one for '{' and another for '}') is up to
+ // 2.5x faster than the naive one-pass implementation on big format strings.
+ const Char* p = begin;
+ if (*begin != '{' && !find<IS_CONSTEXPR>(begin, end, '{', p))
+ return write(begin, end);
+ write(begin, p);
+ ++p;
+ if (p == end) return handler.on_error("invalid format string");
+ if (static_cast<char>(*p) == '}') {
+ handler.on_arg_id();
+ handler.on_replacement_field(p);
+ } else if (*p == '{') {
+ handler.on_text(p, p + 1);
+ } else {
+ p = parse_arg_id(p, end, id_adapter<Handler, Char>{handler});
+ Char c = p != end ? *p : Char();
+ if (c == '}') {
+ handler.on_replacement_field(p);
+ } else if (c == ':') {
+ p = handler.on_format_specs(p + 1, end);
+ if (p == end || *p != '}')
+ return handler.on_error("unknown format specifier");
+ } else {
+ return handler.on_error("missing '}' in format string");
+ }
+ }
+ begin = p + 1;
+ }
+}
+
+template <typename T, typename ParseContext>
+FMT_CONSTEXPR const typename ParseContext::char_type* parse_format_specs(
+ ParseContext& ctx) {
+ using char_type = typename ParseContext::char_type;
+ using context = buffer_context<char_type>;
+ using mapped_type =
+ conditional_t<internal::mapped_type_constant<T, context>::value !=
+ internal::custom_type,
+ decltype(arg_mapper<context>().map(std::declval<T>())), T>;
+ auto f = conditional_t<has_formatter<mapped_type, context>::value,
+ formatter<mapped_type, char_type>,
+ internal::fallback_formatter<T, char_type>>();
+ return f.parse(ctx);
+}
+
+template <typename Char, typename ErrorHandler, typename... Args>
+class format_string_checker {
+ public:
+ explicit FMT_CONSTEXPR format_string_checker(
+ basic_string_view<Char> format_str, ErrorHandler eh)
+ : arg_id_(-1),
+ context_(format_str, eh),
+ parse_funcs_{&parse_format_specs<Args, parse_context_type>...} {}
+
+ FMT_CONSTEXPR void on_text(const Char*, const Char*) {}
+
+ FMT_CONSTEXPR void on_arg_id() {
+ arg_id_ = context_.next_arg_id();
+ check_arg_id();
+ }
+ FMT_CONSTEXPR void on_arg_id(int id) {
+ arg_id_ = id;
+ context_.check_arg_id(id);
+ check_arg_id();
+ }
+ FMT_CONSTEXPR void on_arg_id(basic_string_view<Char>) {
+ on_error("compile-time checks don't support named arguments");
+ }
+
+ FMT_CONSTEXPR void on_replacement_field(const Char*) {}
+
+ FMT_CONSTEXPR const Char* on_format_specs(const Char* begin, const Char*) {
+ advance_to(context_, begin);
+ return arg_id_ < num_args ? parse_funcs_[arg_id_](context_) : begin;
+ }
+
+ FMT_CONSTEXPR void on_error(const char* message) {
+ context_.on_error(message);
+ }
+
+ private:
+ using parse_context_type = basic_format_parse_context<Char, ErrorHandler>;
+ enum { num_args = sizeof...(Args) };
+
+ FMT_CONSTEXPR void check_arg_id() {
+ if (arg_id_ >= num_args) context_.on_error("argument index out of range");
+ }
+
+ // Format specifier parsing function.
+ using parse_func = const Char* (*)(parse_context_type&);
+
+ int arg_id_;
+ parse_context_type context_;
+ parse_func parse_funcs_[num_args > 0 ? num_args : 1];
+};
+
+template <typename Char, typename ErrorHandler, typename... Args>
+FMT_CONSTEXPR bool do_check_format_string(basic_string_view<Char> s,
+ ErrorHandler eh = ErrorHandler()) {
+ format_string_checker<Char, ErrorHandler, Args...> checker(s, eh);
+ parse_format_string<true>(s, checker);
+ return true;
+}
+
+template <typename... Args, typename S,
+ enable_if_t<(is_compile_string<S>::value), int>>
+void check_format_string(S format_str) {
+ FMT_CONSTEXPR_DECL bool invalid_format =
+ internal::do_check_format_string<typename S::char_type,
+ internal::error_handler, Args...>(
+ to_string_view(format_str));
+ (void)invalid_format;
+}
+
+template <template <typename> class Handler, typename Context>
+void handle_dynamic_spec(int& value, arg_ref<typename Context::char_type> ref,
+ Context& ctx) {
+ switch (ref.kind) {
+ case arg_id_kind::none:
+ break;
+ case arg_id_kind::index:
+ value = internal::get_dynamic_spec<Handler>(ctx.arg(ref.val.index),
+ ctx.error_handler());
+ break;
+ case arg_id_kind::name:
+ value = internal::get_dynamic_spec<Handler>(ctx.arg(ref.val.name),
+ ctx.error_handler());
+ break;
+ }
+}
+} // namespace internal
+
+template <typename Range>
+using basic_writer FMT_DEPRECATED_ALIAS = internal::basic_writer<Range>;
+using writer FMT_DEPRECATED_ALIAS = internal::writer;
+using wwriter FMT_DEPRECATED_ALIAS =
+ internal::basic_writer<buffer_range<wchar_t>>;
+
+/** The default argument formatter. */
+template <typename Range>
+class arg_formatter : public internal::arg_formatter_base<Range> {
+ private:
+ using char_type = typename Range::value_type;
+ using base = internal::arg_formatter_base<Range>;
+ using context_type = basic_format_context<typename base::iterator, char_type>;
+
+ context_type& ctx_;
+ basic_format_parse_context<char_type>* parse_ctx_;
+
+ public:
+ using range = Range;
+ using iterator = typename base::iterator;
+ using format_specs = typename base::format_specs;
+
+ /**
+ \rst
+ Constructs an argument formatter object.
+ *ctx* is a reference to the formatting context,
+ *specs* contains format specifier information for standard argument types.
+ \endrst
+ */
+ explicit arg_formatter(
+ context_type& ctx,
+ basic_format_parse_context<char_type>* parse_ctx = nullptr,
+ format_specs* specs = nullptr)
+ : base(Range(ctx.out()), specs, ctx.locale()),
+ ctx_(ctx),
+ parse_ctx_(parse_ctx) {}
+
+ using base::operator();
+
+ /** Formats an argument of a user-defined type. */
+ iterator operator()(typename basic_format_arg<context_type>::handle handle) {
+ handle.format(*parse_ctx_, ctx_);
+ return ctx_.out();
+ }
+};
+
+/**
+ An error returned by an operating system or a language runtime,
+ for example a file opening error.
+*/
+class FMT_API system_error : public std::runtime_error {
+ private:
+ void init(int err_code, string_view format_str, format_args args);
+
+ protected:
+ int error_code_;
+
+ system_error() : std::runtime_error(""), error_code_(0) {}
+
+ public:
+ /**
+ \rst
+ Constructs a :class:`fmt::system_error` object with a description
+ formatted with `fmt::format_system_error`. *message* and additional
+ arguments passed into the constructor are formatted similarly to
+ `fmt::format`.
+
+ **Example**::
+
+ // This throws a system_error with the description
+ // cannot open file 'madeup': No such file or directory
+ // or similar (system message may vary).
+ const char *filename = "madeup";
+ std::FILE *file = std::fopen(filename, "r");
+ if (!file)
+ throw fmt::system_error(errno, "cannot open file '{}'", filename);
+ \endrst
+ */
+ template <typename... Args>
+ system_error(int error_code, string_view message, const Args&... args)
+ : std::runtime_error("") {
+ init(error_code, message, make_format_args(args...));
+ }
+ system_error(const system_error&) = default;
+ system_error& operator=(const system_error&) = default;
+ system_error(system_error&&) = default;
+ system_error& operator=(system_error&&) = default;
+ ~system_error() FMT_NOEXCEPT FMT_OVERRIDE;
+
+ int error_code() const { return error_code_; }
+};
+
+/**
+ \rst
+ Formats an error returned by an operating system or a language runtime,
+ for example a file opening error, and writes it to *out* in the following
+ form:
+
+ .. parsed-literal::
+ *<message>*: *<system-message>*
+
+ where *<message>* is the passed message and *<system-message>* is
+ the system message corresponding to the error code.
+ *error_code* is a system error code as given by ``errno``.
+ If *error_code* is not a valid error code such as -1, the system message
+ may look like "Unknown error -1" and is platform-dependent.
+ \endrst
+ */
+FMT_API void format_system_error(internal::buffer<char>& out, int error_code,
+ string_view message) FMT_NOEXCEPT;
+
+// Reports a system error without throwing an exception.
+// Can be used to report errors from destructors.
+FMT_API void report_system_error(int error_code,
+ string_view message) FMT_NOEXCEPT;
+
+#if FMT_USE_WINDOWS_H
+
+/** A Windows error. */
+class windows_error : public system_error {
+ private:
+ FMT_API void init(int error_code, string_view format_str, format_args args);
+
+ public:
+ /**
+ \rst
+ Constructs a :class:`fmt::windows_error` object with the description
+ of the form
+
+ .. parsed-literal::
+ *<message>*: *<system-message>*
+
+ where *<message>* is the formatted message and *<system-message>* is the
+ system message corresponding to the error code.
+ *error_code* is a Windows error code as given by ``GetLastError``.
+ If *error_code* is not a valid error code such as -1, the system message
+ will look like "error -1".
+
+ **Example**::
+
+ // This throws a windows_error with the description
+ // cannot open file 'madeup': The system cannot find the file specified.
+ // or similar (system message may vary).
+ const char *filename = "madeup";
+ LPOFSTRUCT of = LPOFSTRUCT();
+ HFILE file = OpenFile(filename, &of, OF_READ);
+ if (file == HFILE_ERROR) {
+ throw fmt::windows_error(GetLastError(),
+ "cannot open file '{}'", filename);
+ }
+ \endrst
+ */
+ template <typename... Args>
+ windows_error(int error_code, string_view message, const Args&... args) {
+ init(error_code, message, make_format_args(args...));
+ }
+};
+
+// Reports a Windows error without throwing an exception.
+// Can be used to report errors from destructors.
+FMT_API void report_windows_error(int error_code,
+ string_view message) FMT_NOEXCEPT;
+
+#endif
+
+/** Fast integer formatter. */
+class format_int {
+ private:
+ // Buffer should be large enough to hold all digits (digits10 + 1),
+ // a sign and a null character.
+ enum { buffer_size = std::numeric_limits<unsigned long long>::digits10 + 3 };
+ mutable char buffer_[buffer_size];
+ char* str_;
+
+ // Formats value in reverse and returns a pointer to the beginning.
+ char* format_decimal(unsigned long long value) {
+ char* ptr = buffer_ + (buffer_size - 1); // Parens to workaround MSVC bug.
+ while (value >= 100) {
+ // Integer division is slow so do it for a group of two digits instead
+ // of for every digit. The idea comes from the talk by Alexandrescu
+ // "Three Optimization Tips for C++". See speed-test for a comparison.
+ auto index = static_cast<unsigned>((value % 100) * 2);
+ value /= 100;
+ *--ptr = internal::data::digits[index + 1];
+ *--ptr = internal::data::digits[index];
+ }
+ if (value < 10) {
+ *--ptr = static_cast<char>('0' + value);
+ return ptr;
+ }
+ auto index = static_cast<unsigned>(value * 2);
+ *--ptr = internal::data::digits[index + 1];
+ *--ptr = internal::data::digits[index];
+ return ptr;
+ }
+
+ void format_signed(long long value) {
+ auto abs_value = static_cast<unsigned long long>(value);
+ bool negative = value < 0;
+ if (negative) abs_value = 0 - abs_value;
+ str_ = format_decimal(abs_value);
+ if (negative) *--str_ = '-';
+ }
+
+ public:
+ explicit format_int(int value) { format_signed(value); }
+ explicit format_int(long value) { format_signed(value); }
+ explicit format_int(long long value) { format_signed(value); }
+ explicit format_int(unsigned value) : str_(format_decimal(value)) {}
+ explicit format_int(unsigned long value) : str_(format_decimal(value)) {}
+ explicit format_int(unsigned long long value) : str_(format_decimal(value)) {}
+
+ /** Returns the number of characters written to the output buffer. */
+ std::size_t size() const {
+ return internal::to_unsigned(buffer_ - str_ + buffer_size - 1);
+ }
+
+ /**
+ Returns a pointer to the output buffer content. No terminating null
+ character is appended.
+ */
+ const char* data() const { return str_; }
+
+ /**
+ Returns a pointer to the output buffer content with terminating null
+ character appended.
+ */
+ const char* c_str() const {
+ buffer_[buffer_size - 1] = '\0';
+ return str_;
+ }
+
+ /**
+ \rst
+ Returns the content of the output buffer as an ``std::string``.
+ \endrst
+ */
+ std::string str() const { return std::string(str_, size()); }
+};
+
+// A formatter specialization for the core types corresponding to internal::type
+// constants.
+template <typename T, typename Char>
+struct formatter<T, Char,
+ enable_if_t<internal::type_constant<T, Char>::value !=
+ internal::custom_type>> {
+ FMT_CONSTEXPR formatter() = default;
+
+ // Parses format specifiers stopping either at the end of the range or at the
+ // terminating '}'.
+ template <typename ParseContext>
+ FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+ using handler_type = internal::dynamic_specs_handler<ParseContext>;
+ auto type = internal::type_constant<T, Char>::value;
+ internal::specs_checker<handler_type> handler(handler_type(specs_, ctx),
+ type);
+ auto it = parse_format_specs(ctx.begin(), ctx.end(), handler);
+ auto eh = ctx.error_handler();
+ switch (type) {
+ case internal::none_type:
+ case internal::named_arg_type:
+ FMT_ASSERT(false, "invalid argument type");
+ break;
+ case internal::int_type:
+ case internal::uint_type:
+ case internal::long_long_type:
+ case internal::ulong_long_type:
+ case internal::int128_type:
+ case internal::uint128_type:
+ case internal::bool_type:
+ handle_int_type_spec(specs_.type,
+ internal::int_type_checker<decltype(eh)>(eh));
+ break;
+ case internal::char_type:
+ handle_char_specs(
+ &specs_, internal::char_specs_checker<decltype(eh)>(specs_.type, eh));
+ break;
+ case internal::float_type:
+ case internal::double_type:
+ case internal::long_double_type:
+ internal::parse_float_type_spec(specs_, eh);
+ break;
+ case internal::cstring_type:
+ internal::handle_cstring_type_spec(
+ specs_.type, internal::cstring_type_checker<decltype(eh)>(eh));
+ break;
+ case internal::string_type:
+ internal::check_string_type_spec(specs_.type, eh);
+ break;
+ case internal::pointer_type:
+ internal::check_pointer_type_spec(specs_.type, eh);
+ break;
+ case internal::custom_type:
+ // Custom format specifiers should be checked in parse functions of
+ // formatter specializations.
+ break;
+ }
+ return it;
+ }
+
+ template <typename FormatContext>
+ auto format(const T& val, FormatContext& ctx) -> decltype(ctx.out()) {
+ internal::handle_dynamic_spec<internal::width_checker>(
+ specs_.width, specs_.width_ref, ctx);
+ internal::handle_dynamic_spec<internal::precision_checker>(
+ specs_.precision, specs_.precision_ref, ctx);
+ using range_type =
+ internal::output_range<typename FormatContext::iterator,
+ typename FormatContext::char_type>;
+ return visit_format_arg(arg_formatter<range_type>(ctx, nullptr, &specs_),
+ internal::make_arg<FormatContext>(val));
+ }
+
+ private:
+ internal::dynamic_format_specs<Char> specs_;
+};
+
+#define FMT_FORMAT_AS(Type, Base) \
+ template <typename Char> \
+ struct formatter<Type, Char> : formatter<Base, Char> { \
+ template <typename FormatContext> \
+ auto format(const Type& val, FormatContext& ctx) -> decltype(ctx.out()) { \
+ return formatter<Base, Char>::format(val, ctx); \
+ } \
+ }
+
+FMT_FORMAT_AS(signed char, int);
+FMT_FORMAT_AS(unsigned char, unsigned);
+FMT_FORMAT_AS(short, int);
+FMT_FORMAT_AS(unsigned short, unsigned);
+FMT_FORMAT_AS(long, long long);
+FMT_FORMAT_AS(unsigned long, unsigned long long);
+FMT_FORMAT_AS(Char*, const Char*);
+FMT_FORMAT_AS(std::basic_string<Char>, basic_string_view<Char>);
+FMT_FORMAT_AS(std::nullptr_t, const void*);
+FMT_FORMAT_AS(internal::std_string_view<Char>, basic_string_view<Char>);
+
+template <typename Char>
+struct formatter<void*, Char> : formatter<const void*, Char> {
+ template <typename FormatContext>
+ auto format(void* val, FormatContext& ctx) -> decltype(ctx.out()) {
+ return formatter<const void*, Char>::format(val, ctx);
+ }
+};
+
+template <typename Char, size_t N>
+struct formatter<Char[N], Char> : formatter<basic_string_view<Char>, Char> {
+ template <typename FormatContext>
+ auto format(const Char* val, FormatContext& ctx) -> decltype(ctx.out()) {
+ return formatter<basic_string_view<Char>, Char>::format(val, ctx);
+ }
+};
+
+// A formatter for types known only at run time such as variant alternatives.
+//
+// Usage:
+// using variant = std::variant<int, std::string>;
+// template <>
+// struct formatter<variant>: dynamic_formatter<> {
+// void format(buffer &buf, const variant &v, context &ctx) {
+// visit([&](const auto &val) { format(buf, val, ctx); }, v);
+// }
+// };
+template <typename Char = char> class dynamic_formatter {
+ private:
+ struct null_handler : internal::error_handler {
+ void on_align(align_t) {}
+ void on_plus() {}
+ void on_minus() {}
+ void on_space() {}
+ void on_hash() {}
+ };
+
+ public:
+ template <typename ParseContext>
+ auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+ format_str_ = ctx.begin();
+ // Checks are deferred to formatting time when the argument type is known.
+ internal::dynamic_specs_handler<ParseContext> handler(specs_, ctx);
+ return parse_format_specs(ctx.begin(), ctx.end(), handler);
+ }
+
+ template <typename T, typename FormatContext>
+ auto format(const T& val, FormatContext& ctx) -> decltype(ctx.out()) {
+ handle_specs(ctx);
+ internal::specs_checker<null_handler> checker(
+ null_handler(),
+ internal::mapped_type_constant<T, FormatContext>::value);
+ checker.on_align(specs_.align);
+ switch (specs_.sign) {
+ case sign::none:
+ break;
+ case sign::plus:
+ checker.on_plus();
+ break;
+ case sign::minus:
+ checker.on_minus();
+ break;
+ case sign::space:
+ checker.on_space();
+ break;
+ }
+ if (specs_.alt) checker.on_hash();
+ if (specs_.precision >= 0) checker.end_precision();
+ using range = internal::output_range<typename FormatContext::iterator,
+ typename FormatContext::char_type>;
+ visit_format_arg(arg_formatter<range>(ctx, nullptr, &specs_),
+ internal::make_arg<FormatContext>(val));
+ return ctx.out();
+ }
+
+ private:
+ template <typename Context> void handle_specs(Context& ctx) {
+ internal::handle_dynamic_spec<internal::width_checker>(
+ specs_.width, specs_.width_ref, ctx);
+ internal::handle_dynamic_spec<internal::precision_checker>(
+ specs_.precision, specs_.precision_ref, ctx);
+ }
+
+ internal::dynamic_format_specs<Char> specs_;
+ const Char* format_str_;
+};
+
+template <typename Range, typename Char>
+typename basic_format_context<Range, Char>::format_arg
+basic_format_context<Range, Char>::arg(basic_string_view<char_type> name) {
+ map_.init(args_);
+ format_arg arg = map_.find(name);
+ if (arg.type() == internal::none_type) this->on_error("argument not found");
+ return arg;
+}
+
+template <typename Char, typename ErrorHandler>
+FMT_CONSTEXPR void advance_to(
+ basic_format_parse_context<Char, ErrorHandler>& ctx, const Char* p) {
+ ctx.advance_to(ctx.begin() + (p - &*ctx.begin()));
+}
+
+template <typename ArgFormatter, typename Char, typename Context>
+struct format_handler : internal::error_handler {
+ using range = typename ArgFormatter::range;
+
+ format_handler(range r, basic_string_view<Char> str,
+ basic_format_args<Context> format_args,
+ internal::locale_ref loc)
+ : parse_context(str), context(r.begin(), format_args, loc) {}
+
+ void on_text(const Char* begin, const Char* end) {
+ auto size = internal::to_unsigned(end - begin);
+ auto out = context.out();
+ auto&& it = internal::reserve(out, size);
+ it = std::copy_n(begin, size, it);
+ context.advance_to(out);
+ }
+
+ void get_arg(int id) { arg = internal::get_arg(context, id); }
+
+ void on_arg_id() { get_arg(parse_context.next_arg_id()); }
+ void on_arg_id(int id) {
+ parse_context.check_arg_id(id);
+ get_arg(id);
+ }
+ void on_arg_id(basic_string_view<Char> id) { arg = context.arg(id); }
+
+ void on_replacement_field(const Char* p) {
+ advance_to(parse_context, p);
+ context.advance_to(
+ visit_format_arg(ArgFormatter(context, &parse_context), arg));
+ }
+
+ const Char* on_format_specs(const Char* begin, const Char* end) {
+ advance_to(parse_context, begin);
+ internal::custom_formatter<Context> f(parse_context, context);
+ if (visit_format_arg(f, arg)) return parse_context.begin();
+ basic_format_specs<Char> specs;
+ using internal::specs_handler;
+ using parse_context_t = basic_format_parse_context<Char>;
+ internal::specs_checker<specs_handler<parse_context_t, Context>> handler(
+ specs_handler<parse_context_t, Context>(specs, parse_context, context),
+ arg.type());
+ begin = parse_format_specs(begin, end, handler);
+ if (begin == end || *begin != '}') on_error("missing '}' in format string");
+ advance_to(parse_context, begin);
+ context.advance_to(
+ visit_format_arg(ArgFormatter(context, &parse_context, &specs), arg));
+ return begin;
+ }
+
+ basic_format_parse_context<Char> parse_context;
+ Context context;
+ basic_format_arg<Context> arg;
+};
+
+/** Formats arguments and writes the output to the range. */
+template <typename ArgFormatter, typename Char, typename Context>
+typename Context::iterator vformat_to(
+ typename ArgFormatter::range out, basic_string_view<Char> format_str,
+ basic_format_args<Context> args,
+ internal::locale_ref loc = internal::locale_ref()) {
+ format_handler<ArgFormatter, Char, Context> h(out, format_str, args, loc);
+ internal::parse_format_string<false>(format_str, h);
+ return h.context.out();
+}
+
+// Casts ``p`` to ``const void*`` for pointer formatting.
+// Example:
+// auto s = format("{}", ptr(p));
+template <typename T> inline const void* ptr(const T* p) { return p; }
+template <typename T> inline const void* ptr(const std::unique_ptr<T>& p) {
+ return p.get();
+}
+template <typename T> inline const void* ptr(const std::shared_ptr<T>& p) {
+ return p.get();
+}
+
+template <typename It, typename Char> struct arg_join : internal::view {
+ It begin;
+ It end;
+ basic_string_view<Char> sep;
+
+ arg_join(It b, It e, basic_string_view<Char> s) : begin(b), end(e), sep(s) {}
+};
+
+template <typename It, typename Char>
+struct formatter<arg_join<It, Char>, Char>
+ : formatter<typename std::iterator_traits<It>::value_type, Char> {
+ template <typename FormatContext>
+ auto format(const arg_join<It, Char>& value, FormatContext& ctx)
+ -> decltype(ctx.out()) {
+ using base = formatter<typename std::iterator_traits<It>::value_type, Char>;
+ auto it = value.begin;
+ auto out = ctx.out();
+ if (it != value.end) {
+ out = base::format(*it++, ctx);
+ while (it != value.end) {
+ out = std::copy(value.sep.begin(), value.sep.end(), out);
+ ctx.advance_to(out);
+ out = base::format(*it++, ctx);
+ }
+ }
+ return out;
+ }
+};
+
+/**
+ Returns an object that formats the iterator range `[begin, end)` with elements
+ separated by `sep`.
+ */
+template <typename It>
+arg_join<It, char> join(It begin, It end, string_view sep) {
+ return {begin, end, sep};
+}
+
+template <typename It>
+arg_join<It, wchar_t> join(It begin, It end, wstring_view sep) {
+ return {begin, end, sep};
+}
+
+/**
+ \rst
+ Returns an object that formats `range` with elements separated by `sep`.
+
+ **Example**::
+
+ std::vector<int> v = {1, 2, 3};
+ fmt::print("{}", fmt::join(v, ", "));
+ // Output: "1, 2, 3"
+ \endrst
+ */
+template <typename Range>
+arg_join<internal::iterator_t<const Range>, char> join(const Range& range,
+ string_view sep) {
+ return join(std::begin(range), std::end(range), sep);
+}
+
+template <typename Range>
+arg_join<internal::iterator_t<const Range>, wchar_t> join(const Range& range,
+ wstring_view sep) {
+ return join(std::begin(range), std::end(range), sep);
+}
+
+/**
+ \rst
+ Converts *value* to ``std::string`` using the default format for type *T*.
+ It doesn't support user-defined types with custom formatters.
+
+ **Example**::
+
+ #include <fmt/format.h>
+
+ std::string answer = fmt::to_string(42);
+ \endrst
+ */
+template <typename T> inline std::string to_string(const T& value) {
+ return format("{}", value);
+}
+
+/**
+ Converts *value* to ``std::wstring`` using the default format for type *T*.
+ */
+template <typename T> inline std::wstring to_wstring(const T& value) {
+ return format(L"{}", value);
+}
+
+template <typename Char, std::size_t SIZE>
+std::basic_string<Char> to_string(const basic_memory_buffer<Char, SIZE>& buf) {
+ return std::basic_string<Char>(buf.data(), buf.size());
+}
+
+template <typename Char>
+typename buffer_context<Char>::iterator internal::vformat_to(
+ internal::buffer<Char>& buf, basic_string_view<Char> format_str,
+ basic_format_args<buffer_context<Char>> args) {
+ using range = buffer_range<Char>;
+ return vformat_to<arg_formatter<range>>(buf, to_string_view(format_str),
+ args);
+}
+
+template <typename S, typename Char = char_t<S>,
+ FMT_ENABLE_IF(internal::is_string<S>::value)>
+inline typename buffer_context<Char>::iterator vformat_to(
+ internal::buffer<Char>& buf, const S& format_str,
+ basic_format_args<buffer_context<Char>> args) {
+ return internal::vformat_to(buf, to_string_view(format_str), args);
+}
+
+template <typename S, typename... Args, std::size_t SIZE = inline_buffer_size,
+ typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
+inline typename buffer_context<Char>::iterator format_to(
+ basic_memory_buffer<Char, SIZE>& buf, const S& format_str, Args&&... args) {
+ internal::check_format_string<Args...>(format_str);
+ using context = buffer_context<Char>;
+ return internal::vformat_to(buf, to_string_view(format_str),
+ {make_format_args<context>(args...)});
+}
+
+template <typename OutputIt, typename Char = char>
+using format_context_t = basic_format_context<OutputIt, Char>;
+
+template <typename OutputIt, typename Char = char>
+using format_args_t = basic_format_args<format_context_t<OutputIt, Char>>;
+
+template <typename S, typename OutputIt, typename... Args,
+ FMT_ENABLE_IF(
+ internal::is_output_iterator<OutputIt>::value &&
+ !internal::is_contiguous_back_insert_iterator<OutputIt>::value)>
+inline OutputIt vformat_to(OutputIt out, const S& format_str,
+ format_args_t<OutputIt, char_t<S>> args) {
+ using range = internal::output_range<OutputIt, char_t<S>>;
+ return vformat_to<arg_formatter<range>>(range(out),
+ to_string_view(format_str), args);
+}
+
+/**
+ \rst
+ Formats arguments, writes the result to the output iterator ``out`` and returns
+ the iterator past the end of the output range.
+
+ **Example**::
+
+ std::vector<char> out;
+ fmt::format_to(std::back_inserter(out), "{}", 42);
+ \endrst
+ */
+template <typename OutputIt, typename S, typename... Args,
+ FMT_ENABLE_IF(
+ internal::is_output_iterator<OutputIt>::value &&
+ !internal::is_contiguous_back_insert_iterator<OutputIt>::value &&
+ internal::is_string<S>::value)>
+inline OutputIt format_to(OutputIt out, const S& format_str, Args&&... args) {
+ internal::check_format_string<Args...>(format_str);
+ using context = format_context_t<OutputIt, char_t<S>>;
+ return vformat_to(out, to_string_view(format_str),
+ {make_format_args<context>(args...)});
+}
+
+template <typename OutputIt> struct format_to_n_result {
+ /** Iterator past the end of the output range. */
+ OutputIt out;
+ /** Total (not truncated) output size. */
+ std::size_t size;
+};
+
+template <typename OutputIt, typename Char = typename OutputIt::value_type>
+using format_to_n_context =
+ format_context_t<internal::truncating_iterator<OutputIt>, Char>;
+
+template <typename OutputIt, typename Char = typename OutputIt::value_type>
+using format_to_n_args = basic_format_args<format_to_n_context<OutputIt, Char>>;
+
+template <typename OutputIt, typename Char, typename... Args>
+inline format_arg_store<format_to_n_context<OutputIt, Char>, Args...>
+make_format_to_n_args(const Args&... args) {
+ return format_arg_store<format_to_n_context<OutputIt, Char>, Args...>(
+ args...);
+}
+
+template <typename OutputIt, typename Char, typename... Args,
+ FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value)>
+inline format_to_n_result<OutputIt> vformat_to_n(
+ OutputIt out, std::size_t n, basic_string_view<Char> format_str,
+ format_to_n_args<OutputIt, Char> args) {
+ auto it = vformat_to(internal::truncating_iterator<OutputIt>(out, n),
+ format_str, args);
+ return {it.base(), it.count()};
+}
+
+/**
+ \rst
+ Formats arguments, writes up to ``n`` characters of the result to the output
+ iterator ``out`` and returns the total output size and the iterator past the
+ end of the output range.
+ \endrst
+ */
+template <typename OutputIt, typename S, typename... Args,
+ FMT_ENABLE_IF(internal::is_string<S>::value&&
+ internal::is_output_iterator<OutputIt>::value)>
+inline format_to_n_result<OutputIt> format_to_n(OutputIt out, std::size_t n,
+ const S& format_str,
+ const Args&... args) {
+ internal::check_format_string<Args...>(format_str);
+ using context = format_to_n_context<OutputIt, char_t<S>>;
+ return vformat_to_n(out, n, to_string_view(format_str),
+ {make_format_args<context>(args...)});
+}
+
+template <typename Char>
+inline std::basic_string<Char> internal::vformat(
+ basic_string_view<Char> format_str,
+ basic_format_args<buffer_context<Char>> args) {
+ basic_memory_buffer<Char> buffer;
+ internal::vformat_to(buffer, format_str, args);
+ return to_string(buffer);
+}
+
+/**
+ Returns the number of characters in the output of
+ ``format(format_str, args...)``.
+ */
+template <typename... Args>
+inline std::size_t formatted_size(string_view format_str, const Args&... args) {
+ return format_to(internal::counting_iterator(), format_str, args...).count();
+}
+
+template <typename Char, FMT_ENABLE_IF(std::is_same<Char, wchar_t>::value)>
+void vprint(std::FILE* f, basic_string_view<Char> format_str,
+ wformat_args args) {
+ wmemory_buffer buffer;
+ internal::vformat_to(buffer, format_str, args);
+ buffer.push_back(L'\0');
+ if (std::fputws(buffer.data(), f) == -1)
+ FMT_THROW(system_error(errno, "cannot write to file"));
+}
+
+template <typename Char, FMT_ENABLE_IF(std::is_same<Char, wchar_t>::value)>
+void vprint(basic_string_view<Char> format_str, wformat_args args) {
+ vprint(stdout, format_str, args);
+}
+
+#if FMT_USE_USER_DEFINED_LITERALS
+namespace internal {
+
+# if FMT_USE_UDL_TEMPLATE
+template <typename Char, Char... CHARS> class udl_formatter {
+ public:
+ template <typename... Args>
+ std::basic_string<Char> operator()(Args&&... args) const {
+ FMT_CONSTEXPR_DECL Char s[] = {CHARS..., '\0'};
+ FMT_CONSTEXPR_DECL bool invalid_format =
+ do_check_format_string<Char, error_handler, remove_cvref_t<Args>...>(
+ basic_string_view<Char>(s, sizeof...(CHARS)));
+ (void)invalid_format;
+ return format(s, std::forward<Args>(args)...);
+ }
+};
+# else
+template <typename Char> struct udl_formatter {
+ basic_string_view<Char> str;
+
+ template <typename... Args>
+ std::basic_string<Char> operator()(Args&&... args) const {
+ return format(str, std::forward<Args>(args)...);
+ }
+};
+# endif // FMT_USE_UDL_TEMPLATE
+
+template <typename Char> struct udl_arg {
+ basic_string_view<Char> str;
+
+ template <typename T> named_arg<T, Char> operator=(T&& value) const {
+ return {str, std::forward<T>(value)};
+ }
+};
+
+} // namespace internal
+
+inline namespace literals {
+# if FMT_USE_UDL_TEMPLATE
+# pragma GCC diagnostic push
+# if FMT_CLANG_VERSION
+# pragma GCC diagnostic ignored "-Wgnu-string-literal-operator-template"
+# endif
+template <typename Char, Char... CHARS>
+FMT_CONSTEXPR internal::udl_formatter<Char, CHARS...> operator""_format() {
+ return {};
+}
+# pragma GCC diagnostic pop
+# else
+/**
+ \rst
+ User-defined literal equivalent of :func:`fmt::format`.
+
+ **Example**::
+
+ using namespace fmt::literals;
+ std::string message = "The answer is {}"_format(42);
+ \endrst
+ */
+FMT_CONSTEXPR internal::udl_formatter<char> operator"" _format(const char* s,
+ std::size_t n) {
+ return {{s, n}};
+}
+FMT_CONSTEXPR internal::udl_formatter<wchar_t> operator"" _format(
+ const wchar_t* s, std::size_t n) {
+ return {{s, n}};
+}
+# endif // FMT_USE_UDL_TEMPLATE
+
+/**
+ \rst
+ User-defined literal equivalent of :func:`fmt::arg`.
+
+ **Example**::
+
+ using namespace fmt::literals;
+ fmt::print("Elapsed time: {s:.2f} seconds", "s"_a=1.23);
+ \endrst
+ */
+FMT_CONSTEXPR internal::udl_arg<char> operator"" _a(const char* s,
+ std::size_t n) {
+ return {{s, n}};
+}
+FMT_CONSTEXPR internal::udl_arg<wchar_t> operator"" _a(const wchar_t* s,
+ std::size_t n) {
+ return {{s, n}};
+}
+} // namespace literals
+#endif // FMT_USE_USER_DEFINED_LITERALS
+FMT_END_NAMESPACE
+
+#define FMT_STRING_IMPL(s, ...) \
+ [] { \
+ struct str : fmt::compile_string { \
+ using char_type = typename std::remove_cv<std::remove_pointer< \
+ typename std::decay<decltype(s)>::type>::type>::type; \
+ __VA_ARGS__ FMT_CONSTEXPR \
+ operator fmt::basic_string_view<char_type>() const { \
+ return {s, sizeof(s) / sizeof(char_type) - 1}; \
+ } \
+ } result; \
+ /* Suppress Qt Creator warning about unused operator. */ \
+ (void)static_cast<fmt::basic_string_view<typename str::char_type>>( \
+ result); \
+ return result; \
+ }()
+
+/**
+ \rst
+ Constructs a compile-time format string.
+
+ **Example**::
+
+ // A compile-time error because 'd' is an invalid specifier for strings.
+ std::string s = format(FMT_STRING("{:d}"), "foo");
+ \endrst
+ */
+#define FMT_STRING(s) FMT_STRING_IMPL(s, )
+
+#if defined(FMT_STRING_ALIAS) && FMT_STRING_ALIAS
+# define fmt(s) FMT_STRING_IMPL(s, [[deprecated]])
+#endif
+
+#ifdef FMT_HEADER_ONLY
+# define FMT_FUNC inline
+# include "format-inl.h"
+#else
+# define FMT_FUNC
+#endif
+
+#endif // FMT_FORMAT_H_
--- /dev/null
+// Formatting library for C++ - std::locale support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_LOCALE_H_
+#define FMT_LOCALE_H_
+
+#include <locale>
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+
+namespace internal {
+template <typename Char>
+typename buffer_context<Char>::iterator vformat_to(
+ const std::locale& loc, buffer<Char>& buf,
+ basic_string_view<Char> format_str,
+ basic_format_args<buffer_context<Char>> args) {
+ using range = buffer_range<Char>;
+ return vformat_to<arg_formatter<range>>(buf, to_string_view(format_str), args,
+ internal::locale_ref(loc));
+}
+
+template <typename Char>
+std::basic_string<Char> vformat(const std::locale& loc,
+ basic_string_view<Char> format_str,
+ basic_format_args<buffer_context<Char>> args) {
+ basic_memory_buffer<Char> buffer;
+ internal::vformat_to(loc, buffer, format_str, args);
+ return fmt::to_string(buffer);
+}
+} // namespace internal
+
+template <typename S, typename Char = char_t<S>>
+inline std::basic_string<Char> vformat(
+ const std::locale& loc, const S& format_str,
+ basic_format_args<buffer_context<Char>> args) {
+ return internal::vformat(loc, to_string_view(format_str), args);
+}
+
+template <typename S, typename... Args, typename Char = char_t<S>>
+inline std::basic_string<Char> format(const std::locale& loc,
+ const S& format_str, Args&&... args) {
+ return internal::vformat(
+ loc, to_string_view(format_str),
+ {internal::make_args_checked<Args...>(format_str, args...)});
+}
+
+template <typename S, typename OutputIt, typename... Args,
+ typename Char = enable_if_t<
+ internal::is_output_iterator<OutputIt>::value, char_t<S>>>
+inline OutputIt vformat_to(OutputIt out, const std::locale& loc,
+ const S& format_str,
+ format_args_t<OutputIt, Char> args) {
+ using range = internal::output_range<OutputIt, Char>;
+ return vformat_to<arg_formatter<range>>(
+ range(out), to_string_view(format_str), args, internal::locale_ref(loc));
+}
+
+template <typename OutputIt, typename S, typename... Args,
+ FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value&&
+ internal::is_string<S>::value)>
+inline OutputIt format_to(OutputIt out, const std::locale& loc,
+ const S& format_str, Args&&... args) {
+ internal::check_format_string<Args...>(format_str);
+ using context = format_context_t<OutputIt, char_t<S>>;
+ format_arg_store<context, Args...> as{args...};
+ return vformat_to(out, loc, to_string_view(format_str),
+ basic_format_args<context>(as));
+}
+
+FMT_END_NAMESPACE
+
+#endif // FMT_LOCALE_H_
--- /dev/null
+// Formatting library for C++ - std::ostream support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_OSTREAM_H_
+#define FMT_OSTREAM_H_
+
+#include <ostream>
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+template <class Char> class formatbuf : public std::basic_streambuf<Char> {
+ private:
+ using int_type = typename std::basic_streambuf<Char>::int_type;
+ using traits_type = typename std::basic_streambuf<Char>::traits_type;
+
+ buffer<Char>& buffer_;
+
+ public:
+ formatbuf(buffer<Char>& buf) : buffer_(buf) {}
+
+ protected:
+ // The put-area is actually always empty. This makes the implementation
+ // simpler and has the advantage that the streambuf and the buffer are always
+ // in sync and sputc never writes into uninitialized memory. The obvious
+ // disadvantage is that each call to sputc always results in a (virtual) call
+ // to overflow. There is no disadvantage here for sputn since this always
+ // results in a call to xsputn.
+
+ int_type overflow(int_type ch = traits_type::eof()) FMT_OVERRIDE {
+ if (!traits_type::eq_int_type(ch, traits_type::eof()))
+ buffer_.push_back(static_cast<Char>(ch));
+ return ch;
+ }
+
+ std::streamsize xsputn(const Char* s, std::streamsize count) FMT_OVERRIDE {
+ buffer_.append(s, s + count);
+ return count;
+ }
+};
+
+template <typename Char> struct test_stream : std::basic_ostream<Char> {
+ private:
+ // Hide all operator<< from std::basic_ostream<Char>.
+ void_t<> operator<<(null<>);
+ void_t<> operator<<(const Char*);
+
+ template <typename T, FMT_ENABLE_IF(std::is_convertible<T, int>::value &&
+ !std::is_enum<T>::value)>
+ void_t<> operator<<(T);
+};
+
+// Checks if T has a user-defined operator<< (e.g. not a member of
+// std::ostream).
+template <typename T, typename Char> class is_streamable {
+ private:
+ template <typename U>
+ static bool_constant<!std::is_same<decltype(std::declval<test_stream<Char>&>()
+ << std::declval<U>()),
+ void_t<>>::value>
+ test(int);
+
+ template <typename> static std::false_type test(...);
+
+ using result = decltype(test<T>(0));
+
+ public:
+ static const bool value = result::value;
+};
+
+// Write the content of buf to os.
+template <typename Char>
+void write(std::basic_ostream<Char>& os, buffer<Char>& buf) {
+ const Char* buf_data = buf.data();
+ using unsigned_streamsize = std::make_unsigned<std::streamsize>::type;
+ unsigned_streamsize size = buf.size();
+ unsigned_streamsize max_size = to_unsigned(max_value<std::streamsize>());
+ do {
+ unsigned_streamsize n = size <= max_size ? size : max_size;
+ os.write(buf_data, static_cast<std::streamsize>(n));
+ buf_data += n;
+ size -= n;
+ } while (size != 0);
+}
+
+template <typename Char, typename T>
+void format_value(buffer<Char>& buf, const T& value,
+ locale_ref loc = locale_ref()) {
+ formatbuf<Char> format_buf(buf);
+ std::basic_ostream<Char> output(&format_buf);
+ if (loc) output.imbue(loc.get<std::locale>());
+ output.exceptions(std::ios_base::failbit | std::ios_base::badbit);
+ output << value;
+ buf.resize(buf.size());
+}
+
+// Formats an object of type T that has an overloaded ostream operator<<.
+template <typename T, typename Char>
+struct fallback_formatter<T, Char, enable_if_t<is_streamable<T, Char>::value>>
+ : formatter<basic_string_view<Char>, Char> {
+ template <typename Context>
+ auto format(const T& value, Context& ctx) -> decltype(ctx.out()) {
+ basic_memory_buffer<Char> buffer;
+ format_value(buffer, value, ctx.locale());
+ basic_string_view<Char> str(buffer.data(), buffer.size());
+ return formatter<basic_string_view<Char>, Char>::format(str, ctx);
+ }
+};
+} // namespace internal
+
+template <typename Char>
+void vprint(std::basic_ostream<Char>& os, basic_string_view<Char> format_str,
+ basic_format_args<buffer_context<Char>> args) {
+ basic_memory_buffer<Char> buffer;
+ internal::vformat_to(buffer, format_str, args);
+ internal::write(os, buffer);
+}
+
+/**
+ \rst
+ Prints formatted data to the stream *os*.
+
+ **Example**::
+
+ fmt::print(cerr, "Don't {}!", "panic");
+ \endrst
+ */
+template <typename S, typename... Args,
+ typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
+void print(std::basic_ostream<Char>& os, const S& format_str, Args&&... args) {
+ vprint(os, to_string_view(format_str),
+ {internal::make_args_checked<Args...>(format_str, args...)});
+}
+FMT_END_NAMESPACE
+
+#endif // FMT_OSTREAM_H_
--- /dev/null
+// A C++ interface to POSIX functions.
+//
+// Copyright (c) 2012 - 2016, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_POSIX_H_
+#define FMT_POSIX_H_
+
+#if defined(__MINGW32__) || defined(__CYGWIN__)
+// Workaround MinGW bug https://sourceforge.net/p/mingw/bugs/2024/.
+# undef __STRICT_ANSI__
+#endif
+
+#include <cerrno>
+#include <clocale> // for locale_t
+#include <cstdio>
+#include <cstdlib> // for strtod_l
+
+#include <cstddef>
+
+#if defined __APPLE__ || defined(__FreeBSD__)
+# include <xlocale.h> // for LC_NUMERIC_MASK on OS X
+#endif
+
+#include "format.h"
+
+// UWP doesn't provide _pipe.
+#if FMT_HAS_INCLUDE("winapifamily.h")
+# include <winapifamily.h>
+#endif
+#if FMT_HAS_INCLUDE("fcntl.h") && \
+ (!defined(WINAPI_FAMILY) || (WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP))
+# include <fcntl.h> // for O_RDONLY
+# define FMT_USE_FCNTL 1
+#else
+# define FMT_USE_FCNTL 0
+#endif
+
+#ifndef FMT_POSIX
+# if defined(_WIN32) && !defined(__MINGW32__)
+// Fix warnings about deprecated symbols.
+# define FMT_POSIX(call) _##call
+# else
+# define FMT_POSIX(call) call
+# endif
+#endif
+
+// Calls to system functions are wrapped in FMT_SYSTEM for testability.
+#ifdef FMT_SYSTEM
+# define FMT_POSIX_CALL(call) FMT_SYSTEM(call)
+#else
+# define FMT_SYSTEM(call) call
+# ifdef _WIN32
+// Fix warnings about deprecated symbols.
+# define FMT_POSIX_CALL(call) ::_##call
+# else
+# define FMT_POSIX_CALL(call) ::call
+# endif
+#endif
+
+// Retries the expression while it evaluates to error_result and errno
+// equals to EINTR.
+#ifndef _WIN32
+# define FMT_RETRY_VAL(result, expression, error_result) \
+ do { \
+ (result) = (expression); \
+ } while ((result) == (error_result) && errno == EINTR)
+#else
+# define FMT_RETRY_VAL(result, expression, error_result) result = (expression)
+#endif
+
+#define FMT_RETRY(result, expression) FMT_RETRY_VAL(result, expression, -1)
+
+FMT_BEGIN_NAMESPACE
+
+/**
+ \rst
+ A reference to a null-terminated string. It can be constructed from a C
+ string or ``std::string``.
+
+ You can use one of the following type aliases for common character types:
+
+ +---------------+-----------------------------+
+ | Type | Definition |
+ +===============+=============================+
+ | cstring_view | basic_cstring_view<char> |
+ +---------------+-----------------------------+
+ | wcstring_view | basic_cstring_view<wchar_t> |
+ +---------------+-----------------------------+
+
+ This class is most useful as a parameter type to allow passing
+ different types of strings to a function, for example::
+
+ template <typename... Args>
+ std::string format(cstring_view format_str, const Args & ... args);
+
+ format("{}", 42);
+ format(std::string("{}"), 42);
+ \endrst
+ */
+template <typename Char> class basic_cstring_view {
+ private:
+ const Char* data_;
+
+ public:
+ /** Constructs a string reference object from a C string. */
+ basic_cstring_view(const Char* s) : data_(s) {}
+
+ /**
+ \rst
+ Constructs a string reference from an ``std::string`` object.
+ \endrst
+ */
+ basic_cstring_view(const std::basic_string<Char>& s) : data_(s.c_str()) {}
+
+ /** Returns the pointer to a C string. */
+ const Char* c_str() const { return data_; }
+};
+
+using cstring_view = basic_cstring_view<char>;
+using wcstring_view = basic_cstring_view<wchar_t>;
+
+// An error code.
+class error_code {
+ private:
+ int value_;
+
+ public:
+ explicit error_code(int value = 0) FMT_NOEXCEPT : value_(value) {}
+
+ int get() const FMT_NOEXCEPT { return value_; }
+};
+
+// A buffered file.
+class buffered_file {
+ private:
+ FILE* file_;
+
+ friend class file;
+
+ explicit buffered_file(FILE* f) : file_(f) {}
+
+ public:
+ buffered_file(const buffered_file&) = delete;
+ void operator=(const buffered_file&) = delete;
+
+ // Constructs a buffered_file object which doesn't represent any file.
+ buffered_file() FMT_NOEXCEPT : file_(nullptr) {}
+
+ // Destroys the object closing the file it represents if any.
+ FMT_API ~buffered_file() FMT_NOEXCEPT;
+
+ public:
+ buffered_file(buffered_file&& other) FMT_NOEXCEPT : file_(other.file_) {
+ other.file_ = nullptr;
+ }
+
+ buffered_file& operator=(buffered_file&& other) {
+ close();
+ file_ = other.file_;
+ other.file_ = nullptr;
+ return *this;
+ }
+
+ // Opens a file.
+ FMT_API buffered_file(cstring_view filename, cstring_view mode);
+
+ // Closes the file.
+ FMT_API void close();
+
+ // Returns the pointer to a FILE object representing this file.
+ FILE* get() const FMT_NOEXCEPT { return file_; }
+
+ // We place parentheses around fileno to workaround a bug in some versions
+ // of MinGW that define fileno as a macro.
+ FMT_API int(fileno)() const;
+
+ void vprint(string_view format_str, format_args args) {
+ fmt::vprint(file_, format_str, args);
+ }
+
+ template <typename... Args>
+ inline void print(string_view format_str, const Args&... args) {
+ vprint(format_str, make_format_args(args...));
+ }
+};
+
+#if FMT_USE_FCNTL
+// A file. Closed file is represented by a file object with descriptor -1.
+// Methods that are not declared with FMT_NOEXCEPT may throw
+// fmt::system_error in case of failure. Note that some errors such as
+// closing the file multiple times will cause a crash on Windows rather
+// than an exception. You can get standard behavior by overriding the
+// invalid parameter handler with _set_invalid_parameter_handler.
+class file {
+ private:
+ int fd_; // File descriptor.
+
+ // Constructs a file object with a given descriptor.
+ explicit file(int fd) : fd_(fd) {}
+
+ public:
+ // Possible values for the oflag argument to the constructor.
+ enum {
+ RDONLY = FMT_POSIX(O_RDONLY), // Open for reading only.
+ WRONLY = FMT_POSIX(O_WRONLY), // Open for writing only.
+ RDWR = FMT_POSIX(O_RDWR) // Open for reading and writing.
+ };
+
+ // Constructs a file object which doesn't represent any file.
+ file() FMT_NOEXCEPT : fd_(-1) {}
+
+ // Opens a file and constructs a file object representing this file.
+ FMT_API file(cstring_view path, int oflag);
+
+ public:
+ file(const file&) = delete;
+ void operator=(const file&) = delete;
+
+ file(file&& other) FMT_NOEXCEPT : fd_(other.fd_) { other.fd_ = -1; }
+
+ file& operator=(file&& other) FMT_NOEXCEPT {
+ close();
+ fd_ = other.fd_;
+ other.fd_ = -1;
+ return *this;
+ }
+
+ // Destroys the object closing the file it represents if any.
+ FMT_API ~file() FMT_NOEXCEPT;
+
+ // Returns the file descriptor.
+ int descriptor() const FMT_NOEXCEPT { return fd_; }
+
+ // Closes the file.
+ FMT_API void close();
+
+ // Returns the file size. The size has signed type for consistency with
+ // stat::st_size.
+ FMT_API long long size() const;
+
+ // Attempts to read count bytes from the file into the specified buffer.
+ FMT_API std::size_t read(void* buffer, std::size_t count);
+
+ // Attempts to write count bytes from the specified buffer to the file.
+ FMT_API std::size_t write(const void* buffer, std::size_t count);
+
+ // Duplicates a file descriptor with the dup function and returns
+ // the duplicate as a file object.
+ FMT_API static file dup(int fd);
+
+ // Makes fd be the copy of this file descriptor, closing fd first if
+ // necessary.
+ FMT_API void dup2(int fd);
+
+ // Makes fd be the copy of this file descriptor, closing fd first if
+ // necessary.
+ FMT_API void dup2(int fd, error_code& ec) FMT_NOEXCEPT;
+
+ // Creates a pipe setting up read_end and write_end file objects for reading
+ // and writing respectively.
+ FMT_API static void pipe(file& read_end, file& write_end);
+
+ // Creates a buffered_file object associated with this file and detaches
+ // this file object from the file.
+ FMT_API buffered_file fdopen(const char* mode);
+};
+
+// Returns the memory page size.
+long getpagesize();
+#endif // FMT_USE_FCNTL
+
+#ifdef FMT_LOCALE
+// A "C" numeric locale.
+class Locale {
+ private:
+# ifdef _WIN32
+ using locale_t = _locale_t;
+
+ enum { LC_NUMERIC_MASK = LC_NUMERIC };
+
+ static locale_t newlocale(int category_mask, const char* locale, locale_t) {
+ return _create_locale(category_mask, locale);
+ }
+
+ static void freelocale(locale_t locale) { _free_locale(locale); }
+
+ static double strtod_l(const char* nptr, char** endptr, _locale_t locale) {
+ return _strtod_l(nptr, endptr, locale);
+ }
+# endif
+
+ locale_t locale_;
+
+ public:
+ using type = locale_t;
+ Locale(const Locale&) = delete;
+ void operator=(const Locale&) = delete;
+
+ Locale() : locale_(newlocale(LC_NUMERIC_MASK, "C", nullptr)) {
+ if (!locale_) FMT_THROW(system_error(errno, "cannot create locale"));
+ }
+ ~Locale() { freelocale(locale_); }
+
+ type get() const { return locale_; }
+
+ // Converts string to floating-point number and advances str past the end
+ // of the parsed input.
+ double strtod(const char*& str) const {
+ char* end = nullptr;
+ double result = strtod_l(str, &end, locale_);
+ str = end;
+ return result;
+ }
+};
+#endif // FMT_LOCALE
+FMT_END_NAMESPACE
+
+#endif // FMT_POSIX_H_
--- /dev/null
+// Formatting library for C++ - legacy printf implementation
+//
+// Copyright (c) 2012 - 2016, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_PRINTF_H_
+#define FMT_PRINTF_H_
+
+#include <algorithm> // std::max
+#include <limits> // std::numeric_limits
+
+#include "ostream.h"
+
+FMT_BEGIN_NAMESPACE
+namespace internal {
+
+// Checks if a value fits in int - used to avoid warnings about comparing
+// signed and unsigned integers.
+template <bool IsSigned> struct int_checker {
+ template <typename T> static bool fits_in_int(T value) {
+ unsigned max = max_value<int>();
+ return value <= max;
+ }
+ static bool fits_in_int(bool) { return true; }
+};
+
+template <> struct int_checker<true> {
+ template <typename T> static bool fits_in_int(T value) {
+ return value >= std::numeric_limits<int>::min() &&
+ value <= max_value<int>();
+ }
+ static bool fits_in_int(int) { return true; }
+};
+
+class printf_precision_handler {
+ public:
+ template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+ int operator()(T value) {
+ if (!int_checker<std::numeric_limits<T>::is_signed>::fits_in_int(value))
+ FMT_THROW(format_error("number is too big"));
+ return (std::max)(static_cast<int>(value), 0);
+ }
+
+ template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+ int operator()(T) {
+ FMT_THROW(format_error("precision is not integer"));
+ return 0;
+ }
+};
+
+// An argument visitor that returns true iff arg is a zero integer.
+class is_zero_int {
+ public:
+ template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+ bool operator()(T value) {
+ return value == 0;
+ }
+
+ template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+ bool operator()(T) {
+ return false;
+ }
+};
+
+template <typename T> struct make_unsigned_or_bool : std::make_unsigned<T> {};
+
+template <> struct make_unsigned_or_bool<bool> { using type = bool; };
+
+template <typename T, typename Context> class arg_converter {
+ private:
+ using char_type = typename Context::char_type;
+
+ basic_format_arg<Context>& arg_;
+ char_type type_;
+
+ public:
+ arg_converter(basic_format_arg<Context>& arg, char_type type)
+ : arg_(arg), type_(type) {}
+
+ void operator()(bool value) {
+ if (type_ != 's') operator()<bool>(value);
+ }
+
+ template <typename U, FMT_ENABLE_IF(std::is_integral<U>::value)>
+ void operator()(U value) {
+ bool is_signed = type_ == 'd' || type_ == 'i';
+ using target_type = conditional_t<std::is_same<T, void>::value, U, T>;
+ if (const_check(sizeof(target_type) <= sizeof(int))) {
+ // Extra casts are used to silence warnings.
+ if (is_signed) {
+ arg_ = internal::make_arg<Context>(
+ static_cast<int>(static_cast<target_type>(value)));
+ } else {
+ using unsigned_type = typename make_unsigned_or_bool<target_type>::type;
+ arg_ = internal::make_arg<Context>(
+ static_cast<unsigned>(static_cast<unsigned_type>(value)));
+ }
+ } else {
+ if (is_signed) {
+ // glibc's printf doesn't sign extend arguments of smaller types:
+ // std::printf("%lld", -42); // prints "4294967254"
+ // but we don't have to do the same because it's a UB.
+ arg_ = internal::make_arg<Context>(static_cast<long long>(value));
+ } else {
+ arg_ = internal::make_arg<Context>(
+ static_cast<typename make_unsigned_or_bool<U>::type>(value));
+ }
+ }
+ }
+
+ template <typename U, FMT_ENABLE_IF(!std::is_integral<U>::value)>
+ void operator()(U) {} // No conversion needed for non-integral types.
+};
+
+// Converts an integer argument to T for printf, if T is an integral type.
+// If T is void, the argument is converted to corresponding signed or unsigned
+// type depending on the type specifier: 'd' and 'i' - signed, other -
+// unsigned).
+template <typename T, typename Context, typename Char>
+void convert_arg(basic_format_arg<Context>& arg, Char type) {
+ visit_format_arg(arg_converter<T, Context>(arg, type), arg);
+}
+
+// Converts an integer argument to char for printf.
+template <typename Context> class char_converter {
+ private:
+ basic_format_arg<Context>& arg_;
+
+ public:
+ explicit char_converter(basic_format_arg<Context>& arg) : arg_(arg) {}
+
+ template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+ void operator()(T value) {
+ arg_ = internal::make_arg<Context>(
+ static_cast<typename Context::char_type>(value));
+ }
+
+ template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+ void operator()(T) {} // No conversion needed for non-integral types.
+};
+
+// Checks if an argument is a valid printf width specifier and sets
+// left alignment if it is negative.
+template <typename Char> class printf_width_handler {
+ private:
+ using format_specs = basic_format_specs<Char>;
+
+ format_specs& specs_;
+
+ public:
+ explicit printf_width_handler(format_specs& specs) : specs_(specs) {}
+
+ template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+ unsigned operator()(T value) {
+ auto width = static_cast<uint32_or_64_or_128_t<T>>(value);
+ if (internal::is_negative(value)) {
+ specs_.align = align::left;
+ width = 0 - width;
+ }
+ unsigned int_max = max_value<int>();
+ if (width > int_max) FMT_THROW(format_error("number is too big"));
+ return static_cast<unsigned>(width);
+ }
+
+ template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+ unsigned operator()(T) {
+ FMT_THROW(format_error("width is not integer"));
+ return 0;
+ }
+};
+
+template <typename Char, typename Context>
+void printf(buffer<Char>& buf, basic_string_view<Char> format,
+ basic_format_args<Context> args) {
+ Context(std::back_inserter(buf), format, args).format();
+}
+
+template <typename OutputIt, typename Char, typename Context>
+internal::truncating_iterator<OutputIt> printf(
+ internal::truncating_iterator<OutputIt> it, basic_string_view<Char> format,
+ basic_format_args<Context> args) {
+ return Context(it, format, args).format();
+}
+} // namespace internal
+
+using internal::printf; // For printing into memory_buffer.
+
+template <typename Range> class printf_arg_formatter;
+
+template <typename OutputIt, typename Char> class basic_printf_context;
+
+/**
+ \rst
+ The ``printf`` argument formatter.
+ \endrst
+ */
+template <typename Range>
+class printf_arg_formatter : public internal::arg_formatter_base<Range> {
+ public:
+ using iterator = typename Range::iterator;
+
+ private:
+ using char_type = typename Range::value_type;
+ using base = internal::arg_formatter_base<Range>;
+ using context_type = basic_printf_context<iterator, char_type>;
+
+ context_type& context_;
+
+ void write_null_pointer(char) {
+ this->specs()->type = 0;
+ this->write("(nil)");
+ }
+
+ void write_null_pointer(wchar_t) {
+ this->specs()->type = 0;
+ this->write(L"(nil)");
+ }
+
+ public:
+ using format_specs = typename base::format_specs;
+
+ /**
+ \rst
+ Constructs an argument formatter object.
+ *buffer* is a reference to the output buffer and *specs* contains format
+ specifier information for standard argument types.
+ \endrst
+ */
+ printf_arg_formatter(iterator iter, format_specs& specs, context_type& ctx)
+ : base(Range(iter), &specs, internal::locale_ref()), context_(ctx) {}
+
+ template <typename T, FMT_ENABLE_IF(fmt::internal::is_integral<T>::value)>
+ iterator operator()(T value) {
+ // MSVC2013 fails to compile separate overloads for bool and char_type so
+ // use std::is_same instead.
+ if (std::is_same<T, bool>::value) {
+ format_specs& fmt_specs = *this->specs();
+ if (fmt_specs.type != 's') return base::operator()(value ? 1 : 0);
+ fmt_specs.type = 0;
+ this->write(value != 0);
+ } else if (std::is_same<T, char_type>::value) {
+ format_specs& fmt_specs = *this->specs();
+ if (fmt_specs.type && fmt_specs.type != 'c')
+ return (*this)(static_cast<int>(value));
+ fmt_specs.sign = sign::none;
+ fmt_specs.alt = false;
+ fmt_specs.align = align::right;
+ return base::operator()(value);
+ } else {
+ return base::operator()(value);
+ }
+ return this->out();
+ }
+
+ template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
+ iterator operator()(T value) {
+ return base::operator()(value);
+ }
+
+ /** Formats a null-terminated C string. */
+ iterator operator()(const char* value) {
+ if (value)
+ base::operator()(value);
+ else if (this->specs()->type == 'p')
+ write_null_pointer(char_type());
+ else
+ this->write("(null)");
+ return this->out();
+ }
+
+ /** Formats a null-terminated wide C string. */
+ iterator operator()(const wchar_t* value) {
+ if (value)
+ base::operator()(value);
+ else if (this->specs()->type == 'p')
+ write_null_pointer(char_type());
+ else
+ this->write(L"(null)");
+ return this->out();
+ }
+
+ iterator operator()(basic_string_view<char_type> value) {
+ return base::operator()(value);
+ }
+
+ iterator operator()(monostate value) { return base::operator()(value); }
+
+ /** Formats a pointer. */
+ iterator operator()(const void* value) {
+ if (value) return base::operator()(value);
+ this->specs()->type = 0;
+ write_null_pointer(char_type());
+ return this->out();
+ }
+
+ /** Formats an argument of a custom (user-defined) type. */
+ iterator operator()(typename basic_format_arg<context_type>::handle handle) {
+ handle.format(context_.parse_context(), context_);
+ return this->out();
+ }
+};
+
+template <typename T> struct printf_formatter {
+ template <typename ParseContext>
+ auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+ return ctx.begin();
+ }
+
+ template <typename FormatContext>
+ auto format(const T& value, FormatContext& ctx) -> decltype(ctx.out()) {
+ internal::format_value(internal::get_container(ctx.out()), value);
+ return ctx.out();
+ }
+};
+
+/** This template formats data and writes the output to a writer. */
+template <typename OutputIt, typename Char> class basic_printf_context {
+ public:
+ /** The character type for the output. */
+ using char_type = Char;
+ using format_arg = basic_format_arg<basic_printf_context>;
+ template <typename T> using formatter_type = printf_formatter<T>;
+
+ private:
+ using format_specs = basic_format_specs<char_type>;
+
+ OutputIt out_;
+ basic_format_args<basic_printf_context> args_;
+ basic_format_parse_context<Char> parse_ctx_;
+
+ static void parse_flags(format_specs& specs, const Char*& it,
+ const Char* end);
+
+ // Returns the argument with specified index or, if arg_index is -1, the next
+ // argument.
+ format_arg get_arg(int arg_index = -1);
+
+ // Parses argument index, flags and width and returns the argument index.
+ int parse_header(const Char*& it, const Char* end, format_specs& specs);
+
+ public:
+ /**
+ \rst
+ Constructs a ``printf_context`` object. References to the arguments and
+ the writer are stored in the context object so make sure they have
+ appropriate lifetimes.
+ \endrst
+ */
+ basic_printf_context(OutputIt out, basic_string_view<char_type> format_str,
+ basic_format_args<basic_printf_context> args)
+ : out_(out), args_(args), parse_ctx_(format_str) {}
+
+ OutputIt out() { return out_; }
+ void advance_to(OutputIt it) { out_ = it; }
+
+ format_arg arg(int id) const { return args_.get(id); }
+
+ basic_format_parse_context<Char>& parse_context() { return parse_ctx_; }
+
+ FMT_CONSTEXPR void on_error(const char* message) {
+ parse_ctx_.on_error(message);
+ }
+
+ /** Formats stored arguments and writes the output to the range. */
+ template <typename ArgFormatter = printf_arg_formatter<buffer_range<Char>>>
+ OutputIt format();
+};
+
+template <typename OutputIt, typename Char>
+void basic_printf_context<OutputIt, Char>::parse_flags(format_specs& specs,
+ const Char*& it,
+ const Char* end) {
+ for (; it != end; ++it) {
+ switch (*it) {
+ case '-':
+ specs.align = align::left;
+ break;
+ case '+':
+ specs.sign = sign::plus;
+ break;
+ case '0':
+ specs.fill[0] = '0';
+ break;
+ case ' ':
+ specs.sign = sign::space;
+ break;
+ case '#':
+ specs.alt = true;
+ break;
+ default:
+ return;
+ }
+ }
+}
+
+template <typename OutputIt, typename Char>
+typename basic_printf_context<OutputIt, Char>::format_arg
+basic_printf_context<OutputIt, Char>::get_arg(int arg_index) {
+ if (arg_index < 0)
+ arg_index = parse_ctx_.next_arg_id();
+ else
+ parse_ctx_.check_arg_id(--arg_index);
+ return internal::get_arg(*this, arg_index);
+}
+
+template <typename OutputIt, typename Char>
+int basic_printf_context<OutputIt, Char>::parse_header(
+ const Char*& it, const Char* end, format_specs& specs) {
+ int arg_index = -1;
+ char_type c = *it;
+ if (c >= '0' && c <= '9') {
+ // Parse an argument index (if followed by '$') or a width possibly
+ // preceded with '0' flag(s).
+ internal::error_handler eh;
+ int value = parse_nonnegative_int(it, end, eh);
+ if (it != end && *it == '$') { // value is an argument index
+ ++it;
+ arg_index = value;
+ } else {
+ if (c == '0') specs.fill[0] = '0';
+ if (value != 0) {
+ // Nonzero value means that we parsed width and don't need to
+ // parse it or flags again, so return now.
+ specs.width = value;
+ return arg_index;
+ }
+ }
+ }
+ parse_flags(specs, it, end);
+ // Parse width.
+ if (it != end) {
+ if (*it >= '0' && *it <= '9') {
+ internal::error_handler eh;
+ specs.width = parse_nonnegative_int(it, end, eh);
+ } else if (*it == '*') {
+ ++it;
+ specs.width = static_cast<int>(visit_format_arg(
+ internal::printf_width_handler<char_type>(specs), get_arg()));
+ }
+ }
+ return arg_index;
+}
+
+template <typename OutputIt, typename Char>
+template <typename ArgFormatter>
+OutputIt basic_printf_context<OutputIt, Char>::format() {
+ auto out = this->out();
+ const Char* start = parse_ctx_.begin();
+ const Char* end = parse_ctx_.end();
+ auto it = start;
+ while (it != end) {
+ char_type c = *it++;
+ if (c != '%') continue;
+ if (it != end && *it == c) {
+ out = std::copy(start, it, out);
+ start = ++it;
+ continue;
+ }
+ out = std::copy(start, it - 1, out);
+
+ format_specs specs;
+ specs.align = align::right;
+
+ // Parse argument index, flags and width.
+ int arg_index = parse_header(it, end, specs);
+ if (arg_index == 0) on_error("argument index out of range");
+
+ // Parse precision.
+ if (it != end && *it == '.') {
+ ++it;
+ c = it != end ? *it : 0;
+ if ('0' <= c && c <= '9') {
+ internal::error_handler eh;
+ specs.precision = parse_nonnegative_int(it, end, eh);
+ } else if (c == '*') {
+ ++it;
+ specs.precision =
+ static_cast<int>(visit_format_arg(internal::printf_precision_handler(), get_arg()));
+ } else {
+ specs.precision = 0;
+ }
+ }
+
+ format_arg arg = get_arg(arg_index);
+ if (specs.alt && visit_format_arg(internal::is_zero_int(), arg))
+ specs.alt = false;
+ if (specs.fill[0] == '0') {
+ if (arg.is_arithmetic())
+ specs.align = align::numeric;
+ else
+ specs.fill[0] = ' '; // Ignore '0' flag for non-numeric types.
+ }
+
+ // Parse length and convert the argument to the required type.
+ c = it != end ? *it++ : 0;
+ char_type t = it != end ? *it : 0;
+ using internal::convert_arg;
+ switch (c) {
+ case 'h':
+ if (t == 'h') {
+ ++it;
+ t = it != end ? *it : 0;
+ convert_arg<signed char>(arg, t);
+ } else {
+ convert_arg<short>(arg, t);
+ }
+ break;
+ case 'l':
+ if (t == 'l') {
+ ++it;
+ t = it != end ? *it : 0;
+ convert_arg<long long>(arg, t);
+ } else {
+ convert_arg<long>(arg, t);
+ }
+ break;
+ case 'j':
+ convert_arg<intmax_t>(arg, t);
+ break;
+ case 'z':
+ convert_arg<std::size_t>(arg, t);
+ break;
+ case 't':
+ convert_arg<std::ptrdiff_t>(arg, t);
+ break;
+ case 'L':
+ // printf produces garbage when 'L' is omitted for long double, no
+ // need to do the same.
+ break;
+ default:
+ --it;
+ convert_arg<void>(arg, c);
+ }
+
+ // Parse type.
+ if (it == end) FMT_THROW(format_error("invalid format string"));
+ specs.type = static_cast<char>(*it++);
+ if (arg.is_integral()) {
+ // Normalize type.
+ switch (specs.type) {
+ case 'i':
+ case 'u':
+ specs.type = 'd';
+ break;
+ case 'c':
+ visit_format_arg(internal::char_converter<basic_printf_context>(arg),
+ arg);
+ break;
+ }
+ }
+
+ start = it;
+
+ // Format argument.
+ visit_format_arg(ArgFormatter(out, specs, *this), arg);
+ }
+ return std::copy(start, it, out);
+}
+
+template <typename Char>
+using basic_printf_context_t =
+ basic_printf_context<std::back_insert_iterator<internal::buffer<Char>>,
+ Char>;
+
+using printf_context = basic_printf_context_t<char>;
+using wprintf_context = basic_printf_context_t<wchar_t>;
+
+using printf_args = basic_format_args<printf_context>;
+using wprintf_args = basic_format_args<wprintf_context>;
+
+/**
+ \rst
+ Constructs an `~fmt::format_arg_store` object that contains references to
+ arguments and can be implicitly converted to `~fmt::printf_args`.
+ \endrst
+ */
+template <typename... Args>
+inline format_arg_store<printf_context, Args...> make_printf_args(
+ const Args&... args) {
+ return {args...};
+}
+
+/**
+ \rst
+ Constructs an `~fmt::format_arg_store` object that contains references to
+ arguments and can be implicitly converted to `~fmt::wprintf_args`.
+ \endrst
+ */
+template <typename... Args>
+inline format_arg_store<wprintf_context, Args...> make_wprintf_args(
+ const Args&... args) {
+ return {args...};
+}
+
+template <typename S, typename Char = char_t<S>>
+inline std::basic_string<Char> vsprintf(
+ const S& format, basic_format_args<basic_printf_context_t<Char>> args) {
+ basic_memory_buffer<Char> buffer;
+ printf(buffer, to_string_view(format), args);
+ return to_string(buffer);
+}
+
+/**
+ \rst
+ Formats arguments and returns the result as a string.
+
+ **Example**::
+
+ std::string message = fmt::sprintf("The answer is %d", 42);
+ \endrst
+*/
+template <typename S, typename... Args,
+ typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
+inline std::basic_string<Char> sprintf(const S& format, const Args&... args) {
+ using context = basic_printf_context_t<Char>;
+ return vsprintf(to_string_view(format), {make_format_args<context>(args...)});
+}
+
+template <typename S, typename Char = char_t<S>>
+inline int vfprintf(std::FILE* f, const S& format,
+ basic_format_args<basic_printf_context_t<Char>> args) {
+ basic_memory_buffer<Char> buffer;
+ printf(buffer, to_string_view(format), args);
+ std::size_t size = buffer.size();
+ return std::fwrite(buffer.data(), sizeof(Char), size, f) < size
+ ? -1
+ : static_cast<int>(size);
+}
+
+/**
+ \rst
+ Prints formatted data to the file *f*.
+
+ **Example**::
+
+ fmt::fprintf(stderr, "Don't %s!", "panic");
+ \endrst
+ */
+template <typename S, typename... Args,
+ typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
+inline int fprintf(std::FILE* f, const S& format, const Args&... args) {
+ using context = basic_printf_context_t<Char>;
+ return vfprintf(f, to_string_view(format),
+ {make_format_args<context>(args...)});
+}
+
+template <typename S, typename Char = char_t<S>>
+inline int vprintf(const S& format,
+ basic_format_args<basic_printf_context_t<Char>> args) {
+ return vfprintf(stdout, to_string_view(format), args);
+}
+
+/**
+ \rst
+ Prints formatted data to ``stdout``.
+
+ **Example**::
+
+ fmt::printf("Elapsed time: %.2f seconds", 1.23);
+ \endrst
+ */
+template <typename S, typename... Args,
+ FMT_ENABLE_IF(internal::is_string<S>::value)>
+inline int printf(const S& format_str, const Args&... args) {
+ using context = basic_printf_context_t<char_t<S>>;
+ return vprintf(to_string_view(format_str),
+ {make_format_args<context>(args...)});
+}
+
+template <typename S, typename Char = char_t<S>>
+inline int vfprintf(std::basic_ostream<Char>& os, const S& format,
+ basic_format_args<basic_printf_context_t<Char>> args) {
+ basic_memory_buffer<Char> buffer;
+ printf(buffer, to_string_view(format), args);
+ internal::write(os, buffer);
+ return static_cast<int>(buffer.size());
+}
+
+/** Formats arguments and writes the output to the range. */
+template <typename ArgFormatter, typename Char,
+ typename Context =
+ basic_printf_context<typename ArgFormatter::iterator, Char>>
+typename ArgFormatter::iterator vprintf(internal::buffer<Char>& out,
+ basic_string_view<Char> format_str,
+ basic_format_args<Context> args) {
+ typename ArgFormatter::iterator iter(out);
+ Context(iter, format_str, args).template format<ArgFormatter>();
+ return iter;
+}
+
+/**
+ \rst
+ Prints formatted data to the stream *os*.
+
+ **Example**::
+
+ fmt::fprintf(cerr, "Don't %s!", "panic");
+ \endrst
+ */
+template <typename S, typename... Args, typename Char = char_t<S>>
+inline int fprintf(std::basic_ostream<Char>& os, const S& format_str,
+ const Args&... args) {
+ using context = basic_printf_context_t<Char>;
+ return vfprintf(os, to_string_view(format_str),
+ {make_format_args<context>(args...)});
+}
+FMT_END_NAMESPACE
+
+#endif // FMT_PRINTF_H_
--- /dev/null
+// Formatting library for C++ - experimental range support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+//
+// Copyright (c) 2018 - present, Remotion (Igor Schulz)
+// All Rights Reserved
+// {fmt} support for ranges, containers and types tuple interface.
+
+#ifndef FMT_RANGES_H_
+#define FMT_RANGES_H_
+
+#include <type_traits>
+#include "format.h"
+
+// output only up to N items from the range.
+#ifndef FMT_RANGE_OUTPUT_LENGTH_LIMIT
+# define FMT_RANGE_OUTPUT_LENGTH_LIMIT 256
+#endif
+
+FMT_BEGIN_NAMESPACE
+
+template <typename Char> struct formatting_base {
+ template <typename ParseContext>
+ FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+ return ctx.begin();
+ }
+};
+
+template <typename Char, typename Enable = void>
+struct formatting_range : formatting_base<Char> {
+ static FMT_CONSTEXPR_DECL const std::size_t range_length_limit =
+ FMT_RANGE_OUTPUT_LENGTH_LIMIT; // output only up to N items from the
+ // range.
+ Char prefix;
+ Char delimiter;
+ Char postfix;
+ formatting_range() : prefix('{'), delimiter(','), postfix('}') {}
+ static FMT_CONSTEXPR_DECL const bool add_delimiter_spaces = true;
+ static FMT_CONSTEXPR_DECL const bool add_prepostfix_space = false;
+};
+
+template <typename Char, typename Enable = void>
+struct formatting_tuple : formatting_base<Char> {
+ Char prefix;
+ Char delimiter;
+ Char postfix;
+ formatting_tuple() : prefix('('), delimiter(','), postfix(')') {}
+ static FMT_CONSTEXPR_DECL const bool add_delimiter_spaces = true;
+ static FMT_CONSTEXPR_DECL const bool add_prepostfix_space = false;
+};
+
+namespace internal {
+
+template <typename RangeT, typename OutputIterator>
+OutputIterator copy(const RangeT& range, OutputIterator out) {
+ for (auto it = range.begin(), end = range.end(); it != end; ++it)
+ *out++ = *it;
+ return out;
+}
+
+template <typename OutputIterator>
+OutputIterator copy(const char* str, OutputIterator out) {
+ while (*str) *out++ = *str++;
+ return out;
+}
+
+template <typename OutputIterator>
+OutputIterator copy(char ch, OutputIterator out) {
+ *out++ = ch;
+ return out;
+}
+
+/// Return true value if T has std::string interface, like std::string_view.
+template <typename T> class is_like_std_string {
+ template <typename U>
+ static auto check(U* p)
+ -> decltype((void)p->find('a'), p->length(), (void)p->data(), int());
+ template <typename> static void check(...);
+
+ public:
+ static FMT_CONSTEXPR_DECL const bool value =
+ is_string<T>::value || !std::is_void<decltype(check<T>(nullptr))>::value;
+};
+
+template <typename Char>
+struct is_like_std_string<fmt::basic_string_view<Char>> : std::true_type {};
+
+template <typename... Ts> struct conditional_helper {};
+
+template <typename T, typename _ = void> struct is_range_ : std::false_type {};
+
+#if !FMT_MSC_VER || FMT_MSC_VER > 1800
+template <typename T>
+struct is_range_<
+ T, conditional_t<false,
+ conditional_helper<decltype(std::declval<T>().begin()),
+ decltype(std::declval<T>().end())>,
+ void>> : std::true_type {};
+#endif
+
+/// tuple_size and tuple_element check.
+template <typename T> class is_tuple_like_ {
+ template <typename U>
+ static auto check(U* p)
+ -> decltype(std::tuple_size<U>::value,
+ (void)std::declval<typename std::tuple_element<0, U>::type>(),
+ int());
+ template <typename> static void check(...);
+
+ public:
+ static FMT_CONSTEXPR_DECL const bool value =
+ !std::is_void<decltype(check<T>(nullptr))>::value;
+};
+
+// Check for integer_sequence
+#if defined(__cpp_lib_integer_sequence) || FMT_MSC_VER >= 1900
+template <typename T, T... N>
+using integer_sequence = std::integer_sequence<T, N...>;
+template <std::size_t... N> using index_sequence = std::index_sequence<N...>;
+template <std::size_t N>
+using make_index_sequence = std::make_index_sequence<N>;
+#else
+template <typename T, T... N> struct integer_sequence {
+ using value_type = T;
+
+ static FMT_CONSTEXPR std::size_t size() { return sizeof...(N); }
+};
+
+template <std::size_t... N>
+using index_sequence = integer_sequence<std::size_t, N...>;
+
+template <typename T, std::size_t N, T... Ns>
+struct make_integer_sequence : make_integer_sequence<T, N - 1, N - 1, Ns...> {};
+template <typename T, T... Ns>
+struct make_integer_sequence<T, 0, Ns...> : integer_sequence<T, Ns...> {};
+
+template <std::size_t N>
+using make_index_sequence = make_integer_sequence<std::size_t, N>;
+#endif
+
+template <class Tuple, class F, size_t... Is>
+void for_each(index_sequence<Is...>, Tuple&& tup, F&& f) FMT_NOEXCEPT {
+ using std::get;
+ // using free function get<I>(T) now.
+ const int _[] = {0, ((void)f(get<Is>(tup)), 0)...};
+ (void)_; // blocks warnings
+}
+
+template <class T>
+FMT_CONSTEXPR make_index_sequence<std::tuple_size<T>::value> get_indexes(
+ T const&) {
+ return {};
+}
+
+template <class Tuple, class F> void for_each(Tuple&& tup, F&& f) {
+ const auto indexes = get_indexes(tup);
+ for_each(indexes, std::forward<Tuple>(tup), std::forward<F>(f));
+}
+
+template <typename Arg, FMT_ENABLE_IF(!is_like_std_string<
+ typename std::decay<Arg>::type>::value)>
+FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const Arg&) {
+ return add_space ? " {}" : "{}";
+}
+
+template <typename Arg, FMT_ENABLE_IF(is_like_std_string<
+ typename std::decay<Arg>::type>::value)>
+FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const Arg&) {
+ return add_space ? " \"{}\"" : "\"{}\"";
+}
+
+FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const char*) {
+ return add_space ? " \"{}\"" : "\"{}\"";
+}
+FMT_CONSTEXPR const wchar_t* format_str_quoted(bool add_space, const wchar_t*) {
+ return add_space ? L" \"{}\"" : L"\"{}\"";
+}
+
+FMT_CONSTEXPR const char* format_str_quoted(bool add_space, const char) {
+ return add_space ? " '{}'" : "'{}'";
+}
+FMT_CONSTEXPR const wchar_t* format_str_quoted(bool add_space, const wchar_t) {
+ return add_space ? L" '{}'" : L"'{}'";
+}
+
+} // namespace internal
+
+template <typename T> struct is_tuple_like {
+ static FMT_CONSTEXPR_DECL const bool value =
+ internal::is_tuple_like_<T>::value && !internal::is_range_<T>::value;
+};
+
+template <typename TupleT, typename Char>
+struct formatter<TupleT, Char, enable_if_t<fmt::is_tuple_like<TupleT>::value>> {
+ private:
+ // C++11 generic lambda for format()
+ template <typename FormatContext> struct format_each {
+ template <typename T> void operator()(const T& v) {
+ if (i > 0) {
+ if (formatting.add_prepostfix_space) {
+ *out++ = ' ';
+ }
+ out = internal::copy(formatting.delimiter, out);
+ }
+ out = format_to(out,
+ internal::format_str_quoted(
+ (formatting.add_delimiter_spaces && i > 0), v),
+ v);
+ ++i;
+ }
+
+ formatting_tuple<Char>& formatting;
+ std::size_t& i;
+ typename std::add_lvalue_reference<decltype(
+ std::declval<FormatContext>().out())>::type out;
+ };
+
+ public:
+ formatting_tuple<Char> formatting;
+
+ template <typename ParseContext>
+ FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+ return formatting.parse(ctx);
+ }
+
+ template <typename FormatContext = format_context>
+ auto format(const TupleT& values, FormatContext& ctx) -> decltype(ctx.out()) {
+ auto out = ctx.out();
+ std::size_t i = 0;
+ internal::copy(formatting.prefix, out);
+
+ internal::for_each(values, format_each<FormatContext>{formatting, i, out});
+ if (formatting.add_prepostfix_space) {
+ *out++ = ' ';
+ }
+ internal::copy(formatting.postfix, out);
+
+ return ctx.out();
+ }
+};
+
+template <typename T, typename Char> struct is_range {
+ static FMT_CONSTEXPR_DECL const bool value =
+ internal::is_range_<T>::value &&
+ !internal::is_like_std_string<T>::value &&
+ !std::is_convertible<T, std::basic_string<Char>>::value &&
+ !std::is_constructible<internal::std_string_view<Char>, T>::value;
+};
+
+template <typename RangeT, typename Char>
+struct formatter<RangeT, Char,
+ enable_if_t<fmt::is_range<RangeT, Char>::value>> {
+ formatting_range<Char> formatting;
+
+ template <typename ParseContext>
+ FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+ return formatting.parse(ctx);
+ }
+
+ template <typename FormatContext>
+ typename FormatContext::iterator format(const RangeT& values,
+ FormatContext& ctx) {
+ auto out = internal::copy(formatting.prefix, ctx.out());
+ std::size_t i = 0;
+ for (auto it = values.begin(), end = values.end(); it != end; ++it) {
+ if (i > 0) {
+ if (formatting.add_prepostfix_space) *out++ = ' ';
+ out = internal::copy(formatting.delimiter, out);
+ }
+ out = format_to(out,
+ internal::format_str_quoted(
+ (formatting.add_delimiter_spaces && i > 0), *it),
+ *it);
+ if (++i > formatting.range_length_limit) {
+ out = format_to(out, " ... <other elements>");
+ break;
+ }
+ }
+ if (formatting.add_prepostfix_space) *out++ = ' ';
+ return internal::copy(formatting.postfix, out);
+ }
+};
+
+template <typename Char, typename... T> struct tuple_arg_join : internal::view {
+ const std::tuple<T...>& tuple;
+ basic_string_view<Char> sep;
+
+ tuple_arg_join(const std::tuple<T...>& t, basic_string_view<Char> s)
+ : tuple{t}, sep{s} {}
+};
+
+template <typename Char, typename... T>
+struct formatter<tuple_arg_join<Char, T...>, Char> {
+ template <typename ParseContext>
+ FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+ return ctx.begin();
+ }
+
+ template <typename FormatContext>
+ typename FormatContext::iterator format(
+ const tuple_arg_join<Char, T...>& value, FormatContext& ctx) {
+ return format(value, ctx, internal::make_index_sequence<sizeof...(T)>{});
+ }
+
+ private:
+ template <typename FormatContext, size_t... N>
+ typename FormatContext::iterator format(
+ const tuple_arg_join<Char, T...>& value, FormatContext& ctx,
+ internal::index_sequence<N...>) {
+ return format_args(value, ctx, std::get<N>(value.tuple)...);
+ }
+
+ template <typename FormatContext>
+ typename FormatContext::iterator format_args(
+ const tuple_arg_join<Char, T...>&, FormatContext& ctx) {
+ // NOTE: for compilers that support C++17, this empty function instantiation
+ // can be replaced with a constexpr branch in the variadic overload.
+ return ctx.out();
+ }
+
+ template <typename FormatContext, typename Arg, typename... Args>
+ typename FormatContext::iterator format_args(
+ const tuple_arg_join<Char, T...>& value, FormatContext& ctx,
+ const Arg& arg, const Args&... args) {
+ using base = formatter<typename std::decay<Arg>::type, Char>;
+ auto out = ctx.out();
+ out = base{}.format(arg, ctx);
+ if (sizeof...(Args) > 0) {
+ out = std::copy(value.sep.begin(), value.sep.end(), out);
+ ctx.advance_to(out);
+ return format_args(value, ctx, args...);
+ }
+ return out;
+ }
+};
+
+/**
+ \rst
+ Returns an object that formats `tuple` with elements separated by `sep`.
+
+ **Example**::
+
+ std::tuple<int, char> t = {1, 'a'};
+ fmt::print("{}", fmt::join(t, ", "));
+ // Output: "1, a"
+ \endrst
+ */
+template <typename... T>
+FMT_CONSTEXPR tuple_arg_join<char, T...> join(const std::tuple<T...>& tuple,
+ string_view sep) {
+ return {tuple, sep};
+}
+
+template <typename... T>
+FMT_CONSTEXPR tuple_arg_join<wchar_t, T...> join(const std::tuple<T...>& tuple,
+ wstring_view sep) {
+ return {tuple, sep};
+}
+
+FMT_END_NAMESPACE
+
+#endif // FMT_RANGES_H_
--- /dev/null
+//
+// Copyright(c) 2016-2018 Gabi Melman.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+//
+
+#pragma once
+
+//
+// Include a bundled header-only copy of fmtlib or an external one.
+// By default spdlog include its own copy.
+//
+
+#if !defined(SPDLOG_FMT_EXTERNAL)
+#ifdef SPDLOG_HEADER_ONLY
+#ifndef FMT_HEADER_ONLY
+#define FMT_HEADER_ONLY
+#endif
+#endif
+#ifndef FMT_USE_WINDOWS_H
+#define FMT_USE_WINDOWS_H 0
+#endif
+#include <spdlog/fmt/bundled/core.h>
+#include <spdlog/fmt/bundled/format.h>
+#else // SPDLOG_FMT_EXTERNAL is defined - use external fmtlib
+#include <fmt/core.h>
+#include <fmt/format.h>
+#endif
\ No newline at end of file
--- /dev/null
+//
+// Copyright(c) 2016 Gabi Melman.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+//
+
+#pragma once
+//
+// include bundled or external copy of fmtlib's ostream support
+//
+
+#if !defined(SPDLOG_FMT_EXTERNAL)
+#ifdef SPDLOG_HEADER_ONLY
+#ifndef FMT_HEADER_ONLY
+#define FMT_HEADER_ONLY
+#endif
+#endif
+#include <spdlog/fmt/bundled/ostream.h>
+#else
+#include <fmt/ostream.h>
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/fmt/fmt.h>
+#include <spdlog/details/log_msg.h>
+
+namespace spdlog {
+
+class formatter
+{
+public:
+ virtual ~formatter() = default;
+ virtual void format(const details::log_msg &msg, memory_buf_t &dest) = 0;
+ virtual std::unique_ptr<formatter> clone() const = 0;
+};
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/logger.h>
+#endif
+
+#include <spdlog/sinks/sink.h>
+#include <spdlog/details/backtracer.h>
+#include <spdlog/details/pattern_formatter.h>
+
+#include <cstdio>
+
+namespace spdlog {
+
+// public methods
+SPDLOG_INLINE logger::logger(const logger &other)
+ : name_(other.name_)
+ , sinks_(other.sinks_)
+ , level_(other.level_.load(std::memory_order_relaxed))
+ , flush_level_(other.flush_level_.load(std::memory_order_relaxed))
+ , custom_err_handler_(other.custom_err_handler_)
+ , tracer_(other.tracer_)
+{}
+
+SPDLOG_INLINE logger::logger(logger &&other) SPDLOG_NOEXCEPT : name_(std::move(other.name_)),
+ sinks_(std::move(other.sinks_)),
+ level_(other.level_.load(std::memory_order_relaxed)),
+ flush_level_(other.flush_level_.load(std::memory_order_relaxed)),
+ custom_err_handler_(std::move(other.custom_err_handler_)),
+ tracer_(std::move(other.tracer_))
+
+{}
+
+SPDLOG_INLINE logger &logger::operator=(logger other) SPDLOG_NOEXCEPT
+{
+ this->swap(other);
+ return *this;
+}
+
+SPDLOG_INLINE void logger::swap(spdlog::logger &other) SPDLOG_NOEXCEPT
+{
+ name_.swap(other.name_);
+ sinks_.swap(other.sinks_);
+
+ // swap level_
+ auto other_level = other.level_.load();
+ auto my_level = level_.exchange(other_level);
+ other.level_.store(my_level);
+
+ // swap flush level_
+ other_level = other.flush_level_.load();
+ my_level = flush_level_.exchange(other_level);
+ other.flush_level_.store(my_level);
+
+ custom_err_handler_.swap(other.custom_err_handler_);
+ std::swap(tracer_, other.tracer_);
+}
+
+SPDLOG_INLINE void swap(logger &a, logger &b)
+{
+ a.swap(b);
+}
+
+SPDLOG_INLINE void logger::set_level(level::level_enum log_level)
+{
+ level_.store(log_level);
+}
+
+SPDLOG_INLINE level::level_enum logger::level() const
+{
+ return static_cast<level::level_enum>(level_.load(std::memory_order_relaxed));
+}
+
+SPDLOG_INLINE const std::string &logger::name() const
+{
+ return name_;
+}
+
+// set formatting for the sinks in this logger.
+// each sink will get a separate instance of the formatter object.
+SPDLOG_INLINE void logger::set_formatter(std::unique_ptr<formatter> f)
+{
+ for (auto it = sinks_.begin(); it != sinks_.end(); ++it)
+ {
+ if (std::next(it) == sinks_.end())
+ {
+ // last element - we can be move it.
+ (*it)->set_formatter(std::move(f));
+ }
+ else
+ {
+ (*it)->set_formatter(f->clone());
+ }
+ }
+}
+
+SPDLOG_INLINE void logger::set_pattern(std::string pattern, pattern_time_type time_type)
+{
+ auto new_formatter = details::make_unique<pattern_formatter>(std::move(pattern), time_type);
+ set_formatter(std::move(new_formatter));
+}
+
+// create new backtrace sink and move to it all our child sinks
+SPDLOG_INLINE void logger::enable_backtrace(size_t n_messages)
+{
+ tracer_.enable(n_messages);
+}
+
+// restore orig sinks and level and delete the backtrace sink
+SPDLOG_INLINE void logger::disable_backtrace()
+{
+ tracer_.disable();
+}
+
+SPDLOG_INLINE void logger::dump_backtrace()
+{
+ dump_backtrace_();
+}
+
+// flush functions
+SPDLOG_INLINE void logger::flush()
+{
+ flush_();
+}
+
+SPDLOG_INLINE void logger::flush_on(level::level_enum log_level)
+{
+ flush_level_.store(log_level);
+}
+
+SPDLOG_INLINE level::level_enum logger::flush_level() const
+{
+ return static_cast<level::level_enum>(flush_level_.load(std::memory_order_relaxed));
+}
+
+// sinks
+SPDLOG_INLINE const std::vector<sink_ptr> &logger::sinks() const
+{
+ return sinks_;
+}
+
+SPDLOG_INLINE std::vector<sink_ptr> &logger::sinks()
+{
+ return sinks_;
+}
+
+// error handler
+SPDLOG_INLINE void logger::set_error_handler(err_handler handler)
+{
+ custom_err_handler_ = std::move(handler);
+}
+
+// create new logger with same sinks and configuration.
+SPDLOG_INLINE std::shared_ptr<logger> logger::clone(std::string logger_name)
+{
+ auto cloned = std::make_shared<logger>(*this);
+ cloned->name_ = std::move(logger_name);
+ return cloned;
+}
+
+// protected methods
+SPDLOG_INLINE void logger::log_it_(const spdlog::details::log_msg &log_msg, bool log_enabled, bool traceback_enabled)
+{
+ if (log_enabled)
+ {
+ sink_it_(log_msg);
+ }
+ if (traceback_enabled)
+ {
+ tracer_.push_back(log_msg);
+ }
+}
+
+SPDLOG_INLINE void logger::sink_it_(const details::log_msg &msg)
+{
+ for (auto &sink : sinks_)
+ {
+ if (sink->should_log(msg.level))
+ {
+ SPDLOG_TRY
+ {
+ sink->log(msg);
+ }
+ SPDLOG_LOGGER_CATCH()
+ }
+ }
+
+ if (should_flush_(msg))
+ {
+ flush_();
+ }
+}
+
+SPDLOG_INLINE void logger::flush_()
+{
+ for (auto &sink : sinks_)
+ {
+ SPDLOG_TRY
+ {
+ sink->flush();
+ }
+ SPDLOG_LOGGER_CATCH()
+ }
+}
+
+SPDLOG_INLINE void logger::dump_backtrace_()
+{
+ using details::log_msg;
+ if (tracer_.enabled())
+ {
+ sink_it_(log_msg{name(), level::info, "****************** Backtrace Start ******************"});
+ tracer_.foreach_pop([this](const log_msg &msg) { this->sink_it_(msg); });
+ sink_it_(log_msg{name(), level::info, "****************** Backtrace End ********************"});
+ }
+}
+
+SPDLOG_INLINE bool logger::should_flush_(const details::log_msg &msg)
+{
+ auto flush_level = flush_level_.load(std::memory_order_relaxed);
+ return (msg.level >= flush_level) && (msg.level != level::off);
+}
+
+SPDLOG_INLINE void logger::err_handler_(const std::string &msg)
+{
+ if (custom_err_handler_)
+ {
+ custom_err_handler_(msg);
+ }
+ else
+ {
+ using std::chrono::system_clock;
+ static std::mutex mutex;
+ static std::chrono::system_clock::time_point last_report_time;
+ static size_t err_counter = 0;
+ std::lock_guard<std::mutex> lk{mutex};
+ auto now = system_clock::now();
+ err_counter++;
+ if (now - last_report_time < std::chrono::seconds(1))
+ {
+ return;
+ }
+ last_report_time = now;
+ auto tm_time = details::os::localtime(system_clock::to_time_t(now));
+ char date_buf[64];
+ std::strftime(date_buf, sizeof(date_buf), "%Y-%m-%d %H:%M:%S", &tm_time);
+ fprintf(stderr, "[*** LOG ERROR #%04zu ***] [%s] [%s] {%s}\n", err_counter, date_buf, name().c_str(), msg.c_str());
+ }
+}
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+// Thread safe logger (except for set_error_handler())
+// Has name, log level, vector of std::shared sink pointers and formatter
+// Upon each log write the logger:
+// 1. Checks if its log level is enough to log the message and if yes:
+// 2. Call the underlying sinks to do the job.
+// 3. Each sink use its own private copy of a formatter to format the message
+// and send to its destination.
+//
+// The use of private formatter per sink provides the opportunity to cache some
+// formatted data, and support for different format per sink.
+
+#include <spdlog/common.h>
+#include <spdlog/details/log_msg.h>
+#include <spdlog/details/backtracer.h>
+
+#ifdef SPDLOG_WCHAR_TO_UTF8_SUPPORT
+#include <spdlog/details/os.h>
+#endif
+
+#include <vector>
+#ifndef SPDLOG_NO_EXCEPTIONS
+#define SPDLOG_LOGGER_CATCH() \
+ catch (const std::exception &ex) \
+ { \
+ err_handler_(ex.what()); \
+ } \
+ catch (...) \
+ { \
+ err_handler_("Unknown exception in logger"); \
+ }
+#else
+#define SPDLOG_LOGGER_CATCH()
+#endif
+
+namespace spdlog {
+
+class logger
+{
+public:
+ // Empty logger
+ explicit logger(std::string name)
+ : name_(std::move(name))
+ , sinks_()
+ {}
+
+ // Logger with range on sinks
+ template<typename It>
+ logger(std::string name, It begin, It end)
+ : name_(std::move(name))
+ , sinks_(begin, end)
+ {}
+
+ // Logger with single sink
+ logger(std::string name, sink_ptr single_sink)
+ : logger(std::move(name), {std::move(single_sink)})
+ {}
+
+ // Logger with sinks init list
+ logger(std::string name, sinks_init_list sinks)
+ : logger(std::move(name), sinks.begin(), sinks.end())
+ {}
+
+ virtual ~logger() = default;
+
+ logger(const logger &other);
+ logger(logger &&other) SPDLOG_NOEXCEPT;
+ logger &operator=(logger other) SPDLOG_NOEXCEPT;
+
+ void swap(spdlog::logger &other) SPDLOG_NOEXCEPT;
+
+ template<typename... Args>
+ void log(source_loc loc, level::level_enum lvl, string_view_t fmt, const Args &... args)
+ {
+ bool log_enabled = should_log(lvl);
+ bool traceback_enabled = tracer_.enabled();
+ if (!log_enabled && !traceback_enabled)
+ {
+ return;
+ }
+ SPDLOG_TRY
+ {
+ memory_buf_t buf;
+ fmt::format_to(buf, fmt, args...);
+ details::log_msg log_msg(loc, name_, lvl, string_view_t(buf.data(), buf.size()));
+ log_it_(log_msg, log_enabled, traceback_enabled);
+ }
+ SPDLOG_LOGGER_CATCH()
+ }
+
+ template<typename... Args>
+ void log(level::level_enum lvl, string_view_t fmt, const Args &... args)
+ {
+ log(source_loc{}, lvl, fmt, args...);
+ }
+
+ template<typename... Args>
+ void trace(string_view_t fmt, const Args &... args)
+ {
+ log(level::trace, fmt, args...);
+ }
+
+ template<typename... Args>
+ void debug(string_view_t fmt, const Args &... args)
+ {
+ log(level::debug, fmt, args...);
+ }
+
+ template<typename... Args>
+ void info(string_view_t fmt, const Args &... args)
+ {
+ log(level::info, fmt, args...);
+ }
+
+ template<typename... Args>
+ void warn(string_view_t fmt, const Args &... args)
+ {
+ log(level::warn, fmt, args...);
+ }
+
+ template<typename... Args>
+ void error(string_view_t fmt, const Args &... args)
+ {
+ log(level::err, fmt, args...);
+ }
+
+ template<typename... Args>
+ void critical(string_view_t fmt, const Args &... args)
+ {
+ log(level::critical, fmt, args...);
+ }
+
+ template<typename T>
+ void log(level::level_enum lvl, const T &msg)
+ {
+ log(source_loc{}, lvl, msg);
+ }
+
+ // T can be statically converted to string_view
+ template<class T, typename std::enable_if<std::is_convertible<const T &, spdlog::string_view_t>::value, T>::type * = nullptr>
+ void log(source_loc loc, level::level_enum lvl, const T &msg)
+ {
+ bool log_enabled = should_log(lvl);
+ bool traceback_enabled = tracer_.enabled();
+ if (!log_enabled && !traceback_enabled)
+ {
+ return;
+ }
+
+ details::log_msg log_msg(loc, name_, lvl, msg);
+ log_it_(log_msg, log_enabled, traceback_enabled);
+ }
+
+ void log(level::level_enum lvl, string_view_t msg)
+ {
+ log(source_loc{}, lvl, msg);
+ }
+
+ // T cannot be statically converted to string_view or wstring_view
+ template<class T, typename std::enable_if<!std::is_convertible<const T &, spdlog::string_view_t>::value &&
+ !is_convertible_to_wstring_view<const T &>::value,
+ T>::type * = nullptr>
+ void log(source_loc loc, level::level_enum lvl, const T &msg)
+ {
+ log(loc, lvl, "{}", msg);
+ }
+
+ template<typename T>
+ void trace(const T &msg)
+ {
+ log(level::trace, msg);
+ }
+
+ template<typename T>
+ void debug(const T &msg)
+ {
+ log(level::debug, msg);
+ }
+
+ template<typename T>
+ void info(const T &msg)
+ {
+ log(level::info, msg);
+ }
+
+ template<typename T>
+ void warn(const T &msg)
+ {
+ log(level::warn, msg);
+ }
+
+ template<typename T>
+ void error(const T &msg)
+ {
+ log(level::err, msg);
+ }
+
+ template<typename T>
+ void critical(const T &msg)
+ {
+ log(level::critical, msg);
+ }
+
+#ifdef SPDLOG_WCHAR_TO_UTF8_SUPPORT
+#ifndef _WIN32
+#error SPDLOG_WCHAR_TO_UTF8_SUPPORT only supported on windows
+#else
+
+ template<typename... Args>
+ void log(source_loc loc, level::level_enum lvl, wstring_view_t fmt, const Args &... args)
+ {
+ bool log_enabled = should_log(lvl);
+ bool traceback_enabled = tracer_.enabled();
+ if (!log_enabled && !traceback_enabled)
+ {
+ return;
+ }
+ SPDLOG_TRY
+ {
+ // format to wmemory_buffer and convert to utf8
+ fmt::wmemory_buffer wbuf;
+ fmt::format_to(wbuf, fmt, args...);
+
+ memory_buf_t buf;
+ details::os::wstr_to_utf8buf(wstring_view_t(wbuf.data(), wbuf.size()), buf);
+ details::log_msg log_msg(loc, name_, lvl, string_view_t(buf.data(), buf.size()));
+ log_it_(log_msg, log_enabled, traceback_enabled);
+ }
+ SPDLOG_LOGGER_CATCH()
+ }
+
+ template<typename... Args>
+ void log(level::level_enum lvl, wstring_view_t fmt, const Args &... args)
+ {
+ log(source_loc{}, lvl, fmt, args...);
+ }
+
+ template<typename... Args>
+ void trace(wstring_view_t fmt, const Args &... args)
+ {
+ log(level::trace, fmt, args...);
+ }
+
+ template<typename... Args>
+ void debug(wstring_view_t fmt, const Args &... args)
+ {
+ log(level::debug, fmt, args...);
+ }
+
+ template<typename... Args>
+ void info(wstring_view_t fmt, const Args &... args)
+ {
+ log(level::info, fmt, args...);
+ }
+
+ template<typename... Args>
+ void warn(wstring_view_t fmt, const Args &... args)
+ {
+ log(level::warn, fmt, args...);
+ }
+
+ template<typename... Args>
+ void error(wstring_view_t fmt, const Args &... args)
+ {
+ log(level::err, fmt, args...);
+ }
+
+ template<typename... Args>
+ void critical(wstring_view_t fmt, const Args &... args)
+ {
+ log(level::critical, fmt, args...);
+ }
+
+ // T can be statically converted to wstring_view
+ template<class T, typename std::enable_if<is_convertible_to_wstring_view<const T &>::value, T>::type * = nullptr>
+ void log(source_loc loc, level::level_enum lvl, const T &msg)
+ {
+ bool log_enabled = should_log(lvl);
+ bool traceback_enabled = tracer_.enabled();
+ if (!log_enabled && !traceback_enabled)
+ {
+ return;
+ }
+
+ SPDLOG_TRY
+ {
+ memory_buf_t buf;
+ details::os::wstr_to_utf8buf(msg, buf);
+ details::log_msg log_msg(loc, name_, lvl, string_view_t(buf.data(), buf.size()));
+ log_it_(log_msg, log_enabled, traceback_enabled);
+ }
+ SPDLOG_LOGGER_CATCH()
+ }
+#endif // _WIN32
+#endif // SPDLOG_WCHAR_TO_UTF8_SUPPORT
+
+ // return true logging is enabled for the given level.
+ bool should_log(level::level_enum msg_level) const
+ {
+ return msg_level >= level_.load(std::memory_order_relaxed);
+ }
+
+ // return true if backtrace logging is enabled.
+ bool should_backtrace() const
+ {
+ return tracer_.enabled();
+ }
+
+ void set_level(level::level_enum log_level);
+
+ level::level_enum level() const;
+
+ const std::string &name() const;
+
+ // set formatting for the sinks in this logger.
+ // each sink will get a separate instance of the formatter object.
+ void set_formatter(std::unique_ptr<formatter> f);
+
+ void set_pattern(std::string pattern, pattern_time_type time_type = pattern_time_type::local);
+
+ // backtrace support.
+ // efficiently store all debug/trace messages in a circular buffer until needed for debugging.
+ void enable_backtrace(size_t n_messages);
+ void disable_backtrace();
+ void dump_backtrace();
+
+ // flush functions
+ void flush();
+ void flush_on(level::level_enum log_level);
+ level::level_enum flush_level() const;
+
+ // sinks
+ const std::vector<sink_ptr> &sinks() const;
+
+ std::vector<sink_ptr> &sinks();
+
+ // error handler
+ void set_error_handler(err_handler);
+
+ // create new logger with same sinks and configuration.
+ virtual std::shared_ptr<logger> clone(std::string logger_name);
+
+protected:
+ std::string name_;
+ std::vector<sink_ptr> sinks_;
+ spdlog::level_t level_{level::info};
+ spdlog::level_t flush_level_{level::off};
+ err_handler custom_err_handler_{nullptr};
+ details::backtracer tracer_;
+
+ // log the given message (if the given log level is high enough),
+ // and save backtrace (if backtrace is enabled).
+ void log_it_(const details::log_msg &log_msg, bool log_enabled, bool traceback_enabled);
+ virtual void sink_it_(const details::log_msg &msg);
+ virtual void flush_();
+ void dump_backtrace_();
+ bool should_flush_(const details::log_msg &msg);
+
+ // handle errors during logging.
+ // default handler prints the error to stderr at max rate of 1 message/sec.
+ void err_handler_(const std::string &msg);
+};
+
+void swap(logger &a, logger &b);
+
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "logger-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifdef __ANDROID__
+
+#include <spdlog/details/fmt_helper.h>
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/details/os.h>
+#include <spdlog/sinks/base_sink.h>
+#include <spdlog/details/synchronous_factory.h>
+
+#include <android/log.h>
+#include <chrono>
+#include <mutex>
+#include <string>
+#include <thread>
+
+#if !defined(SPDLOG_ANDROID_RETRIES)
+#define SPDLOG_ANDROID_RETRIES 2
+#endif
+
+namespace spdlog {
+namespace sinks {
+
+/*
+ * Android sink (logging using __android_log_write)
+ */
+template<typename Mutex>
+class android_sink final : public base_sink<Mutex>
+{
+public:
+ explicit android_sink(std::string tag = "spdlog", bool use_raw_msg = false)
+ : tag_(std::move(tag))
+ , use_raw_msg_(use_raw_msg)
+ {}
+
+protected:
+ void sink_it_(const details::log_msg &msg) override
+ {
+ const android_LogPriority priority = convert_to_android_(msg.level);
+ memory_buf_t formatted;
+ if (use_raw_msg_)
+ {
+ details::fmt_helper::append_string_view(msg.payload, formatted);
+ }
+ else
+ {
+ base_sink<Mutex>::formatter_->format(msg, formatted);
+ }
+ formatted.push_back('\0');
+ const char *msg_output = formatted.data();
+
+ // See system/core/liblog/logger_write.c for explanation of return value
+ int ret = __android_log_write(priority, tag_.c_str(), msg_output);
+ int retry_count = 0;
+ while ((ret == -11 /*EAGAIN*/) && (retry_count < SPDLOG_ANDROID_RETRIES))
+ {
+ details::os::sleep_for_millis(5);
+ ret = __android_log_write(priority, tag_.c_str(), msg_output);
+ retry_count++;
+ }
+
+ if (ret < 0)
+ {
+ SPDLOG_THROW(spdlog_ex("__android_log_write() failed", ret));
+ }
+ }
+
+ void flush_() override {}
+
+private:
+ static android_LogPriority convert_to_android_(spdlog::level::level_enum level)
+ {
+ switch (level)
+ {
+ case spdlog::level::trace:
+ return ANDROID_LOG_VERBOSE;
+ case spdlog::level::debug:
+ return ANDROID_LOG_DEBUG;
+ case spdlog::level::info:
+ return ANDROID_LOG_INFO;
+ case spdlog::level::warn:
+ return ANDROID_LOG_WARN;
+ case spdlog::level::err:
+ return ANDROID_LOG_ERROR;
+ case spdlog::level::critical:
+ return ANDROID_LOG_FATAL;
+ default:
+ return ANDROID_LOG_DEFAULT;
+ }
+ }
+
+ std::string tag_;
+ bool use_raw_msg_;
+};
+
+using android_sink_mt = android_sink<std::mutex>;
+using android_sink_st = android_sink<details::null_mutex>;
+} // namespace sinks
+
+// Create and register android syslog logger
+
+template<typename Factory = spdlog::synchronous_factory>
+inline std::shared_ptr<logger> android_logger_mt(const std::string &logger_name, const std::string &tag = "spdlog")
+{
+ return Factory::template create<sinks::android_sink_mt>(logger_name, tag);
+}
+
+template<typename Factory = spdlog::synchronous_factory>
+inline std::shared_ptr<logger> android_logger_st(const std::string &logger_name, const std::string &tag = "spdlog")
+{
+ return Factory::template create<sinks::android_sink_st>(logger_name, tag);
+}
+
+} // namespace spdlog
+
+#endif // __ANDROID__
\ No newline at end of file
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/sinks/ansicolor_sink.h>
+#endif
+
+#include <spdlog/details/pattern_formatter.h>
+#include <spdlog/details/os.h>
+
+namespace spdlog {
+namespace sinks {
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE ansicolor_sink<ConsoleMutex>::ansicolor_sink(FILE *target_file, color_mode mode)
+ : target_file_(target_file)
+ , mutex_(ConsoleMutex::mutex())
+ , formatter_(details::make_unique<spdlog::pattern_formatter>())
+
+{
+ set_color_mode(mode);
+ colors_[level::trace] = white;
+ colors_[level::debug] = cyan;
+ colors_[level::info] = green;
+ colors_[level::warn] = yellow_bold;
+ colors_[level::err] = red_bold;
+ colors_[level::critical] = bold_on_red;
+ colors_[level::off] = reset;
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE void ansicolor_sink<ConsoleMutex>::set_color(level::level_enum color_level, string_view_t color)
+{
+ std::lock_guard<mutex_t> lock(mutex_);
+ colors_[color_level] = color;
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE void ansicolor_sink<ConsoleMutex>::log(const details::log_msg &msg)
+{
+ // Wrap the originally formatted message in color codes.
+ // If color is not supported in the terminal, log as is instead.
+ std::lock_guard<mutex_t> lock(mutex_);
+
+ memory_buf_t formatted;
+ formatter_->format(msg, formatted);
+ if (should_do_colors_ && msg.color_range_end > msg.color_range_start)
+ {
+ // before color range
+ print_range_(formatted, 0, msg.color_range_start);
+ // in color range
+ print_ccode_(colors_[msg.level]);
+ print_range_(formatted, msg.color_range_start, msg.color_range_end);
+ print_ccode_(reset);
+ // after color range
+ print_range_(formatted, msg.color_range_end, formatted.size());
+ }
+ else // no color
+ {
+ print_range_(formatted, 0, formatted.size());
+ }
+ fflush(target_file_);
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE void ansicolor_sink<ConsoleMutex>::flush()
+{
+ std::lock_guard<mutex_t> lock(mutex_);
+ fflush(target_file_);
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE void ansicolor_sink<ConsoleMutex>::set_pattern(const std::string &pattern)
+{
+ std::lock_guard<mutex_t> lock(mutex_);
+ formatter_ = std::unique_ptr<spdlog::formatter>(new pattern_formatter(pattern));
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE void ansicolor_sink<ConsoleMutex>::set_formatter(std::unique_ptr<spdlog::formatter> sink_formatter)
+{
+ std::lock_guard<mutex_t> lock(mutex_);
+ formatter_ = std::move(sink_formatter);
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE bool ansicolor_sink<ConsoleMutex>::should_color()
+{
+ return should_do_colors_;
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE void ansicolor_sink<ConsoleMutex>::set_color_mode(color_mode mode)
+{
+ switch (mode)
+ {
+ case color_mode::always:
+ should_do_colors_ = true;
+ return;
+ case color_mode::automatic:
+ should_do_colors_ = details::os::in_terminal(target_file_) && details::os::is_color_terminal();
+ return;
+ case color_mode::never:
+ should_do_colors_ = false;
+ return;
+ }
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE void ansicolor_sink<ConsoleMutex>::print_ccode_(const string_view_t &color_code)
+{
+ fwrite(color_code.data(), sizeof(string_view_t::char_type), color_code.size(), target_file_);
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE void ansicolor_sink<ConsoleMutex>::print_range_(const memory_buf_t &formatted, size_t start, size_t end)
+{
+ fwrite(formatted.data() + start, sizeof(char), end - start, target_file_);
+}
+
+// ansicolor_stdout_sink
+template<typename ConsoleMutex>
+SPDLOG_INLINE ansicolor_stdout_sink<ConsoleMutex>::ansicolor_stdout_sink(color_mode mode)
+ : ansicolor_sink<ConsoleMutex>(stdout, mode)
+{}
+
+// ansicolor_stderr_sink
+template<typename ConsoleMutex>
+SPDLOG_INLINE ansicolor_stderr_sink<ConsoleMutex>::ansicolor_stderr_sink(color_mode mode)
+ : ansicolor_sink<ConsoleMutex>(stderr, mode)
+{}
+
+} // namespace sinks
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/details/console_globals.h>
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/sinks/sink.h>
+#include <memory>
+#include <mutex>
+#include <string>
+#include <unordered_map>
+
+namespace spdlog {
+namespace sinks {
+
+/**
+ * This sink prefixes the output with an ANSI escape sequence color code
+ * depending on the severity
+ * of the message.
+ * If no color terminal detected, omit the escape codes.
+ */
+
+template<typename ConsoleMutex>
+class ansicolor_sink : public sink
+{
+public:
+ using mutex_t = typename ConsoleMutex::mutex_t;
+ ansicolor_sink(FILE *target_file, color_mode mode);
+ ~ansicolor_sink() override = default;
+
+ ansicolor_sink(const ansicolor_sink &other) = delete;
+ ansicolor_sink &operator=(const ansicolor_sink &other) = delete;
+ void set_color(level::level_enum color_level, string_view_t color);
+ void set_color_mode(color_mode mode);
+ bool should_color();
+
+ void log(const details::log_msg &msg) override;
+ void flush() override;
+ void set_pattern(const std::string &pattern) final;
+ void set_formatter(std::unique_ptr<spdlog::formatter> sink_formatter) override;
+
+ // Formatting codes
+ const string_view_t reset = "\033[m";
+ const string_view_t bold = "\033[1m";
+ const string_view_t dark = "\033[2m";
+ const string_view_t underline = "\033[4m";
+ const string_view_t blink = "\033[5m";
+ const string_view_t reverse = "\033[7m";
+ const string_view_t concealed = "\033[8m";
+ const string_view_t clear_line = "\033[K";
+
+ // Foreground colors
+ const string_view_t black = "\033[30m";
+ const string_view_t red = "\033[31m";
+ const string_view_t green = "\033[32m";
+ const string_view_t yellow = "\033[33m";
+ const string_view_t blue = "\033[34m";
+ const string_view_t magenta = "\033[35m";
+ const string_view_t cyan = "\033[36m";
+ const string_view_t white = "\033[37m";
+
+ /// Background colors
+ const string_view_t on_black = "\033[40m";
+ const string_view_t on_red = "\033[41m";
+ const string_view_t on_green = "\033[42m";
+ const string_view_t on_yellow = "\033[43m";
+ const string_view_t on_blue = "\033[44m";
+ const string_view_t on_magenta = "\033[45m";
+ const string_view_t on_cyan = "\033[46m";
+ const string_view_t on_white = "\033[47m";
+
+ /// Bold colors
+ const string_view_t yellow_bold = "\033[33m\033[1m";
+ const string_view_t red_bold = "\033[31m\033[1m";
+ const string_view_t bold_on_red = "\033[1m\033[41m";
+
+private:
+ FILE *target_file_;
+ mutex_t &mutex_;
+ bool should_do_colors_;
+ std::unique_ptr<spdlog::formatter> formatter_;
+ std::unordered_map<level::level_enum, string_view_t, level::level_hasher> colors_;
+ void print_ccode_(const string_view_t &color_code);
+ void print_range_(const memory_buf_t &formatted, size_t start, size_t end);
+};
+
+template<typename ConsoleMutex>
+class ansicolor_stdout_sink : public ansicolor_sink<ConsoleMutex>
+{
+public:
+ explicit ansicolor_stdout_sink(color_mode mode = color_mode::automatic);
+};
+
+template<typename ConsoleMutex>
+class ansicolor_stderr_sink : public ansicolor_sink<ConsoleMutex>
+{
+public:
+ explicit ansicolor_stderr_sink(color_mode mode = color_mode::automatic);
+};
+
+using ansicolor_stdout_sink_mt = ansicolor_stdout_sink<details::console_mutex>;
+using ansicolor_stdout_sink_st = ansicolor_stdout_sink<details::console_nullmutex>;
+
+using ansicolor_stderr_sink_mt = ansicolor_stderr_sink<details::console_mutex>;
+using ansicolor_stderr_sink_st = ansicolor_stderr_sink<details::console_nullmutex>;
+
+} // namespace sinks
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "ansicolor_sink-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/sinks/base_sink.h>
+#endif
+
+#include <spdlog/common.h>
+#include <spdlog/details/pattern_formatter.h>
+
+#include <memory>
+
+template<typename Mutex>
+SPDLOG_INLINE spdlog::sinks::base_sink<Mutex>::base_sink()
+ : formatter_{details::make_unique<spdlog::pattern_formatter>()}
+{}
+
+template<typename Mutex>
+SPDLOG_INLINE spdlog::sinks::base_sink<Mutex>::base_sink(std::unique_ptr<spdlog::formatter> formatter)
+ : formatter_{std::move(formatter)}
+{}
+
+template<typename Mutex>
+void SPDLOG_INLINE spdlog::sinks::base_sink<Mutex>::log(const details::log_msg &msg)
+{
+ std::lock_guard<Mutex> lock(mutex_);
+ sink_it_(msg);
+}
+
+template<typename Mutex>
+void SPDLOG_INLINE spdlog::sinks::base_sink<Mutex>::flush()
+{
+ std::lock_guard<Mutex> lock(mutex_);
+ flush_();
+}
+
+template<typename Mutex>
+void SPDLOG_INLINE spdlog::sinks::base_sink<Mutex>::set_pattern(const std::string &pattern)
+{
+ std::lock_guard<Mutex> lock(mutex_);
+ set_pattern_(pattern);
+}
+
+template<typename Mutex>
+void SPDLOG_INLINE spdlog::sinks::base_sink<Mutex>::set_formatter(std::unique_ptr<spdlog::formatter> sink_formatter)
+{
+ std::lock_guard<Mutex> lock(mutex_);
+ set_formatter_(std::move(sink_formatter));
+}
+
+template<typename Mutex>
+void SPDLOG_INLINE spdlog::sinks::base_sink<Mutex>::set_pattern_(const std::string &pattern)
+{
+ set_formatter_(details::make_unique<spdlog::pattern_formatter>(pattern));
+}
+
+template<typename Mutex>
+void SPDLOG_INLINE spdlog::sinks::base_sink<Mutex>::set_formatter_(std::unique_ptr<spdlog::formatter> sink_formatter)
+{
+ formatter_ = std::move(sink_formatter);
+}
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+//
+// base sink templated over a mutex (either dummy or real)
+// concrete implementation should override the sink_it_() and flush_() methods.
+// locking is taken care of in this class - no locking needed by the
+// implementers..
+//
+
+#include <spdlog/common.h>
+#include <spdlog/details/log_msg.h>
+#include <spdlog/sinks/sink.h>
+
+namespace spdlog {
+namespace sinks {
+template<typename Mutex>
+class base_sink : public sink
+{
+public:
+ base_sink();
+ explicit base_sink(std::unique_ptr<spdlog::formatter> formatter);
+ base_sink(const base_sink &) = delete;
+ base_sink &operator=(const base_sink &) = delete;
+ void log(const details::log_msg &msg) final;
+ void flush() final;
+ void set_pattern(const std::string &pattern) final;
+ void set_formatter(std::unique_ptr<spdlog::formatter> sink_formatter) final;
+
+protected:
+ // sink formatter
+ std::unique_ptr<spdlog::formatter> formatter_;
+ Mutex mutex_;
+
+ virtual void sink_it_(const details::log_msg &msg) = 0;
+ virtual void flush_() = 0;
+ virtual void set_pattern_(const std::string &pattern);
+ virtual void set_formatter_(std::unique_ptr<spdlog::formatter> sink_formatter);
+};
+} // namespace sinks
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "base_sink-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/sinks/basic_file_sink.h>
+#endif
+
+#include <spdlog/common.h>
+#include <spdlog/details/os.h>
+
+namespace spdlog {
+namespace sinks {
+
+template<typename Mutex>
+SPDLOG_INLINE basic_file_sink<Mutex>::basic_file_sink(const filename_t &filename, bool truncate)
+{
+ file_helper_.open(filename, truncate);
+}
+
+template<typename Mutex>
+SPDLOG_INLINE const filename_t &basic_file_sink<Mutex>::filename() const
+{
+ return file_helper_.filename();
+}
+
+template<typename Mutex>
+SPDLOG_INLINE void basic_file_sink<Mutex>::sink_it_(const details::log_msg &msg)
+{
+ memory_buf_t formatted;
+ base_sink<Mutex>::formatter_->format(msg, formatted);
+ file_helper_.write(formatted);
+}
+
+template<typename Mutex>
+SPDLOG_INLINE void basic_file_sink<Mutex>::flush_()
+{
+ file_helper_.flush();
+}
+
+} // namespace sinks
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/details/file_helper.h>
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/sinks/base_sink.h>
+#include <spdlog/details/synchronous_factory.h>
+
+#include <mutex>
+#include <string>
+
+namespace spdlog {
+namespace sinks {
+/*
+ * Trivial file sink with single file as target
+ */
+template<typename Mutex>
+class basic_file_sink final : public base_sink<Mutex>
+{
+public:
+ explicit basic_file_sink(const filename_t &filename, bool truncate = false);
+ const filename_t &filename() const;
+
+protected:
+ void sink_it_(const details::log_msg &msg) override;
+ void flush_() override;
+
+private:
+ details::file_helper file_helper_;
+};
+
+using basic_file_sink_mt = basic_file_sink<std::mutex>;
+using basic_file_sink_st = basic_file_sink<details::null_mutex>;
+
+} // namespace sinks
+
+//
+// factory functions
+//
+template<typename Factory = spdlog::synchronous_factory>
+inline std::shared_ptr<logger> basic_logger_mt(const std::string &logger_name, const filename_t &filename, bool truncate = false)
+{
+ return Factory::template create<sinks::basic_file_sink_mt>(logger_name, filename, truncate);
+}
+
+template<typename Factory = spdlog::synchronous_factory>
+inline std::shared_ptr<logger> basic_logger_st(const std::string &logger_name, const filename_t &filename, bool truncate = false)
+{
+ return Factory::template create<sinks::basic_file_sink_st>(logger_name, filename, truncate);
+}
+
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "basic_file_sink-inl.h"
+#endif
\ No newline at end of file
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/common.h>
+#include <spdlog/details/file_helper.h>
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/fmt/fmt.h>
+#include <spdlog/sinks/base_sink.h>
+#include <spdlog/details/os.h>
+#include <spdlog/details/circular_q.h>
+#include <spdlog/details/synchronous_factory.h>
+
+#include <chrono>
+#include <cstdio>
+#include <ctime>
+#include <mutex>
+#include <string>
+
+namespace spdlog {
+namespace sinks {
+
+/*
+ * Generator of daily log file names in format basename.YYYY-MM-DD.ext
+ */
+struct daily_filename_calculator
+{
+ // Create filename for the form basename.YYYY-MM-DD
+ static filename_t calc_filename(const filename_t &filename, const tm &now_tm)
+ {
+ filename_t basename, ext;
+ std::tie(basename, ext) = details::file_helper::split_by_extension(filename);
+ return fmt::format(
+ SPDLOG_FILENAME_T("{}_{:04d}-{:02d}-{:02d}{}"), basename, now_tm.tm_year + 1900, now_tm.tm_mon + 1, now_tm.tm_mday, ext);
+ }
+};
+
+/*
+ * Rotating file sink based on date.
+ * If truncate != false , the created file will be truncated.
+ * If max_files > 0, retain only the last max_files and delete previous.
+ */
+template<typename Mutex, typename FileNameCalc = daily_filename_calculator>
+class daily_file_sink final : public base_sink<Mutex>
+{
+public:
+ // create daily file sink which rotates on given time
+ daily_file_sink(filename_t base_filename, int rotation_hour, int rotation_minute, bool truncate = false, uint16_t max_files = 0)
+ : base_filename_(std::move(base_filename))
+ , rotation_h_(rotation_hour)
+ , rotation_m_(rotation_minute)
+ , truncate_(truncate)
+ , max_files_(max_files)
+ , filenames_q_()
+ {
+ if (rotation_hour < 0 || rotation_hour > 23 || rotation_minute < 0 || rotation_minute > 59)
+ {
+ SPDLOG_THROW(spdlog_ex("daily_file_sink: Invalid rotation time in ctor"));
+ }
+
+ auto now = log_clock::now();
+ auto filename = FileNameCalc::calc_filename(base_filename_, now_tm(now));
+ file_helper_.open(filename, truncate_);
+ rotation_tp_ = next_rotation_tp_();
+
+ if (max_files_ > 0)
+ {
+ filenames_q_ = details::circular_q<filename_t>(static_cast<size_t>(max_files_));
+ filenames_q_.push_back(std::move(filename));
+ }
+ }
+
+ const filename_t &filename() const
+ {
+ return file_helper_.filename();
+ }
+
+protected:
+ void sink_it_(const details::log_msg &msg) override
+ {
+ auto time = msg.time;
+ bool should_rotate = time >= rotation_tp_;
+ if (should_rotate)
+ {
+ auto filename = FileNameCalc::calc_filename(base_filename_, now_tm(time));
+ file_helper_.open(filename, truncate_);
+ rotation_tp_ = next_rotation_tp_();
+ }
+ memory_buf_t formatted;
+ base_sink<Mutex>::formatter_->format(msg, formatted);
+ file_helper_.write(formatted);
+
+ // Do the cleaning only at the end because it might throw on failure.
+ if (should_rotate && max_files_ > 0)
+ {
+ delete_old_();
+ }
+ }
+
+ void flush_() override
+ {
+ file_helper_.flush();
+ }
+
+private:
+ tm now_tm(log_clock::time_point tp)
+ {
+ time_t tnow = log_clock::to_time_t(tp);
+ return spdlog::details::os::localtime(tnow);
+ }
+
+ log_clock::time_point next_rotation_tp_()
+ {
+ auto now = log_clock::now();
+ tm date = now_tm(now);
+ date.tm_hour = rotation_h_;
+ date.tm_min = rotation_m_;
+ date.tm_sec = 0;
+ auto rotation_time = log_clock::from_time_t(std::mktime(&date));
+ if (rotation_time > now)
+ {
+ return rotation_time;
+ }
+ return {rotation_time + std::chrono::hours(24)};
+ }
+
+ // Delete the file N rotations ago.
+ // Throw spdlog_ex on failure to delete the old file.
+ void delete_old_()
+ {
+ using details::os::filename_to_str;
+ using details::os::remove_if_exists;
+
+ filename_t current_file = filename();
+ if (filenames_q_.full())
+ {
+ auto old_filename = std::move(filenames_q_.front());
+ filenames_q_.pop_front();
+ bool ok = remove_if_exists(old_filename) == 0;
+ if (!ok)
+ {
+ filenames_q_.push_back(std::move(current_file));
+ SPDLOG_THROW(spdlog_ex("Failed removing daily file " + filename_to_str(old_filename), errno));
+ }
+ }
+ filenames_q_.push_back(std::move(current_file));
+ }
+
+ filename_t base_filename_;
+ int rotation_h_;
+ int rotation_m_;
+ log_clock::time_point rotation_tp_;
+ details::file_helper file_helper_;
+ bool truncate_;
+ uint16_t max_files_;
+ details::circular_q<filename_t> filenames_q_;
+};
+
+using daily_file_sink_mt = daily_file_sink<std::mutex>;
+using daily_file_sink_st = daily_file_sink<details::null_mutex>;
+
+} // namespace sinks
+
+//
+// factory functions
+//
+template<typename Factory = spdlog::synchronous_factory>
+inline std::shared_ptr<logger> daily_logger_mt(
+ const std::string &logger_name, const filename_t &filename, int hour = 0, int minute = 0, bool truncate = false)
+{
+ return Factory::template create<sinks::daily_file_sink_mt>(logger_name, filename, hour, minute, truncate);
+}
+
+template<typename Factory = spdlog::synchronous_factory>
+inline std::shared_ptr<logger> daily_logger_st(
+ const std::string &logger_name, const filename_t &filename, int hour = 0, int minute = 0, bool truncate = false)
+{
+ return Factory::template create<sinks::daily_file_sink_st>(logger_name, filename, hour, minute, truncate);
+}
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include "base_sink.h"
+#include <spdlog/details/log_msg.h>
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/details/pattern_formatter.h>
+
+#include <algorithm>
+#include <memory>
+#include <mutex>
+#include <vector>
+
+// Distribution sink (mux). Stores a vector of sinks which get called when log
+// is called
+
+namespace spdlog {
+namespace sinks {
+
+template<typename Mutex>
+class dist_sink : public base_sink<Mutex>
+{
+public:
+ dist_sink() = default;
+ explicit dist_sink(std::vector<std::shared_ptr<sink>> sinks)
+ : sinks_(sinks)
+ {}
+
+ dist_sink(const dist_sink &) = delete;
+ dist_sink &operator=(const dist_sink &) = delete;
+
+ void add_sink(std::shared_ptr<sink> sink)
+ {
+ std::lock_guard<Mutex> lock(base_sink<Mutex>::mutex_);
+ sinks_.push_back(sink);
+ }
+
+ void remove_sink(std::shared_ptr<sink> sink)
+ {
+ std::lock_guard<Mutex> lock(base_sink<Mutex>::mutex_);
+ sinks_.erase(std::remove(sinks_.begin(), sinks_.end(), sink), sinks_.end());
+ }
+
+ void set_sinks(std::vector<std::shared_ptr<sink>> sinks)
+ {
+ std::lock_guard<Mutex> lock(base_sink<Mutex>::mutex_);
+ sinks_ = std::move(sinks);
+ }
+
+ std::vector<std::shared_ptr<sink>> &sinks()
+ {
+ return sinks_;
+ }
+
+protected:
+ void sink_it_(const details::log_msg &msg) override
+ {
+ for (auto &sink : sinks_)
+ {
+ if (sink->should_log(msg.level))
+ {
+ sink->log(msg);
+ }
+ }
+ }
+
+ void flush_() override
+ {
+ for (auto &sink : sinks_)
+ {
+ sink->flush();
+ }
+ }
+
+ void set_pattern_(const std::string &pattern) override
+ {
+ set_formatter_(details::make_unique<spdlog::pattern_formatter>(pattern));
+ }
+
+ void set_formatter_(std::unique_ptr<spdlog::formatter> sink_formatter) override
+ {
+ base_sink<Mutex>::formatter_ = std::move(sink_formatter);
+ for (auto &sink : sinks_)
+ {
+ sink->set_formatter(base_sink<Mutex>::formatter_->clone());
+ }
+ }
+ std::vector<std::shared_ptr<sink>> sinks_;
+};
+
+using dist_sink_mt = dist_sink<std::mutex>;
+using dist_sink_st = dist_sink<details::null_mutex>;
+
+} // namespace sinks
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include "dist_sink.h"
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/details/log_msg.h>
+
+#include <mutex>
+#include <string>
+#include <chrono>
+
+// Duplicate message removal sink.
+// Skip the message if previous one is identical and less than "max_skip_duration" have passed
+//
+// Example:
+//
+// #include <spdlog/sinks/dup_filter_sink.h>
+//
+// int main() {
+// auto dup_filter = std::make_shared<dup_filter_sink_st>(std::chrono::seconds(5));
+// dup_filter->add_sink(std::make_shared<stdout_color_sink_mt>());
+// spdlog::logger l("logger", dup_filter);
+// l.info("Hello");
+// l.info("Hello");
+// l.info("Hello");
+// l.info("Different Hello");
+// }
+//
+// Will produce:
+// [2019-06-25 17:50:56.511] [logger] [info] Hello
+// [2019-06-25 17:50:56.512] [logger] [info] Skipped 3 duplicate messages..
+// [2019-06-25 17:50:56.512] [logger] [info] Different Hello
+
+namespace spdlog {
+namespace sinks {
+template<typename Mutex>
+class dup_filter_sink : public dist_sink<Mutex>
+{
+public:
+ template<class Rep, class Period>
+ explicit dup_filter_sink(std::chrono::duration<Rep, Period> max_skip_duration)
+ : max_skip_duration_{max_skip_duration}
+ {}
+
+protected:
+ std::chrono::microseconds max_skip_duration_;
+ log_clock::time_point last_msg_time_;
+ std::string last_msg_payload_;
+ size_t skip_counter_ = 0;
+
+ void sink_it_(const details::log_msg &msg) override
+ {
+ bool filtered = filter_(msg);
+ if (!filtered)
+ {
+ skip_counter_ += 1;
+ return;
+ }
+
+ // log the "skipped.." message
+ if (skip_counter_ > 0)
+ {
+ memory_buf_t buf;
+ fmt::format_to(buf, "Skipped {} duplicate messages..", skip_counter_);
+ details::log_msg skipped_msg{msg.logger_name, msg.level, string_view_t{buf.data(), buf.size()}};
+ dist_sink<Mutex>::sink_it_(skipped_msg);
+ }
+
+ // log current message
+ dist_sink<Mutex>::sink_it_(msg);
+ last_msg_time_ = msg.time;
+ skip_counter_ = 0;
+ last_msg_payload_.assign(msg.payload.data(), msg.payload.data() + msg.payload.size());
+ }
+
+ // return whether the log msg should be displayed (true) or skipped (false)
+ bool filter_(const details::log_msg &msg)
+ {
+ auto filter_duration = msg.time - last_msg_time_;
+ return (filter_duration > max_skip_duration_) || (msg.payload != last_msg_payload_);
+ }
+};
+
+using dup_filter_sink_mt = dup_filter_sink<std::mutex>;
+using dup_filter_sink_st = dup_filter_sink<details::null_mutex>;
+
+} // namespace sinks
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2016 Alexander Dalshov.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#if defined(_WIN32)
+
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/sinks/base_sink.h>
+
+#include <winbase.h>
+
+#include <mutex>
+#include <string>
+
+namespace spdlog {
+namespace sinks {
+/*
+ * MSVC sink (logging using OutputDebugStringA)
+ */
+template<typename Mutex>
+class msvc_sink : public base_sink<Mutex>
+{
+public:
+ explicit msvc_sink() {}
+
+protected:
+ void sink_it_(const details::log_msg &msg) override
+ {
+
+ memory_buf_t formatted;
+ base_sink<Mutex>::formatter_->format(msg, formatted);
+ OutputDebugStringA(fmt::to_string(formatted).c_str());
+ }
+
+ void flush_() override {}
+};
+
+using msvc_sink_mt = msvc_sink<std::mutex>;
+using msvc_sink_st = msvc_sink<details::null_mutex>;
+
+using windebug_sink_mt = msvc_sink_mt;
+using windebug_sink_st = msvc_sink_st;
+
+} // namespace sinks
+} // namespace spdlog
+
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/sinks/base_sink.h>
+#include <spdlog/details/synchronous_factory.h>
+
+#include <mutex>
+
+namespace spdlog {
+namespace sinks {
+
+template<typename Mutex>
+class null_sink : public base_sink<Mutex>
+{
+protected:
+ void sink_it_(const details::log_msg &) override {}
+ void flush_() override {}
+};
+
+using null_sink_mt = null_sink<details::null_mutex>;
+using null_sink_st = null_sink<details::null_mutex>;
+
+} // namespace sinks
+
+template<typename Factory = spdlog::synchronous_factory>
+inline std::shared_ptr<logger> null_logger_mt(const std::string &logger_name)
+{
+ auto null_logger = Factory::template create<sinks::null_sink_mt>(logger_name);
+ null_logger->set_level(level::off);
+ return null_logger;
+}
+
+template<typename Factory = spdlog::synchronous_factory>
+inline std::shared_ptr<logger> null_logger_st(const std::string &logger_name)
+{
+ auto null_logger = Factory::template create<sinks::null_sink_st>(logger_name);
+ null_logger->set_level(level::off);
+ return null_logger;
+}
+
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/sinks/base_sink.h>
+
+#include <mutex>
+#include <ostream>
+
+namespace spdlog {
+namespace sinks {
+template<typename Mutex>
+class ostream_sink final : public base_sink<Mutex>
+{
+public:
+ explicit ostream_sink(std::ostream &os, bool force_flush = false)
+ : ostream_(os)
+ , force_flush_(force_flush)
+ {}
+ ostream_sink(const ostream_sink &) = delete;
+ ostream_sink &operator=(const ostream_sink &) = delete;
+
+protected:
+ void sink_it_(const details::log_msg &msg) override
+ {
+ memory_buf_t formatted;
+ base_sink<Mutex>::formatter_->format(msg, formatted);
+ ostream_.write(formatted.data(), static_cast<std::streamsize>(formatted.size()));
+ if (force_flush_)
+ {
+ ostream_.flush();
+ }
+ }
+
+ void flush_() override
+ {
+ ostream_.flush();
+ }
+
+ std::ostream &ostream_;
+ bool force_flush_;
+};
+
+using ostream_sink_mt = ostream_sink<std::mutex>;
+using ostream_sink_st = ostream_sink<details::null_mutex>;
+
+} // namespace sinks
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include "spdlog/sinks/base_sink.h"
+#include "spdlog/details/circular_q.h"
+#include "spdlog/details/log_msg_buffer.h"
+#include "spdlog/details/null_mutex.h"
+
+#include <mutex>
+#include <string>
+#include <vector>
+
+namespace spdlog {
+namespace sinks {
+/*
+ * Ring buffer sink
+ */
+template<typename Mutex>
+class ringbuffer_sink final : public base_sink<Mutex>
+{
+public:
+ explicit ringbuffer_sink(size_t n_items)
+ : q_{n_items}
+ {}
+
+ std::vector<details::log_msg_buffer> last_raw(size_t lim = 0)
+ {
+ std::lock_guard<Mutex> lock(base_sink<Mutex>::mutex_);
+ auto n_items = lim > 0 ? (std::min)(lim, q_.size()) : q_.size();
+ std::vector<details::log_msg_buffer> ret;
+ ret.reserve(n_items);
+ for (size_t i = 0; i < n_items; i++)
+ {
+ ret.push_back(q_.at(i));
+ }
+ return ret;
+ }
+
+ std::vector<std::string> last_formatted(size_t lim = 0)
+ {
+ std::lock_guard<Mutex> lock(base_sink<Mutex>::mutex_);
+ auto n_items = lim > 0 ? (std::min)(lim, q_.size()) : q_.size();
+ std::vector<std::string> ret;
+ ret.reserve(n_items);
+ for (size_t i = 0; i < n_items; i++)
+ {
+ memory_buf_t formatted;
+ base_sink<Mutex>::formatter_->format(q_.at(i), formatted);
+ ret.push_back(fmt::to_string(formatted));
+ }
+ return ret;
+ }
+
+protected:
+ void sink_it_(const details::log_msg &msg) override
+ {
+ q_.push_back(details::log_msg_buffer{msg});
+ }
+ void flush_() override {}
+
+private:
+ details::circular_q<details::log_msg_buffer> q_;
+};
+
+using ringbuffer_sink_mt = ringbuffer_sink<std::mutex>;
+using ringbuffer_sink_st = ringbuffer_sink<details::null_mutex>;
+
+} // namespace sinks
+
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/sinks/rotating_file_sink.h>
+#endif
+
+#include <spdlog/common.h>
+
+#include <spdlog/details/file_helper.h>
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/fmt/fmt.h>
+
+#include <cerrno>
+#include <chrono>
+#include <ctime>
+#include <mutex>
+#include <string>
+#include <tuple>
+
+namespace spdlog {
+namespace sinks {
+
+template<typename Mutex>
+SPDLOG_INLINE rotating_file_sink<Mutex>::rotating_file_sink(
+ filename_t base_filename, std::size_t max_size, std::size_t max_files, bool rotate_on_open)
+ : base_filename_(std::move(base_filename))
+ , max_size_(max_size)
+ , max_files_(max_files)
+{
+ file_helper_.open(calc_filename(base_filename_, 0));
+ current_size_ = file_helper_.size(); // expensive. called only once
+ if (rotate_on_open && current_size_ > 0)
+ {
+ rotate_();
+ }
+}
+
+// calc filename according to index and file extension if exists.
+// e.g. calc_filename("logs/mylog.txt, 3) => "logs/mylog.3.txt".
+template<typename Mutex>
+SPDLOG_INLINE filename_t rotating_file_sink<Mutex>::calc_filename(const filename_t &filename, std::size_t index)
+{
+ if (index == 0u)
+ {
+ return filename;
+ }
+
+ filename_t basename, ext;
+ std::tie(basename, ext) = details::file_helper::split_by_extension(filename);
+ return fmt::format(SPDLOG_FILENAME_T("{}.{}{}"), basename, index, ext);
+}
+
+template<typename Mutex>
+SPDLOG_INLINE const filename_t &rotating_file_sink<Mutex>::filename() const
+{
+ return file_helper_.filename();
+}
+
+template<typename Mutex>
+SPDLOG_INLINE void rotating_file_sink<Mutex>::sink_it_(const details::log_msg &msg)
+{
+ memory_buf_t formatted;
+ base_sink<Mutex>::formatter_->format(msg, formatted);
+ current_size_ += formatted.size();
+ if (current_size_ > max_size_)
+ {
+ rotate_();
+ current_size_ = formatted.size();
+ }
+ file_helper_.write(formatted);
+}
+
+template<typename Mutex>
+SPDLOG_INLINE void rotating_file_sink<Mutex>::flush_()
+{
+ file_helper_.flush();
+}
+
+// Rotate files:
+// log.txt -> log.1.txt
+// log.1.txt -> log.2.txt
+// log.2.txt -> log.3.txt
+// log.3.txt -> delete
+template<typename Mutex>
+SPDLOG_INLINE void rotating_file_sink<Mutex>::rotate_()
+{
+ using details::os::filename_to_str;
+ using details::os::path_exists;
+ file_helper_.close();
+ for (auto i = max_files_; i > 0; --i)
+ {
+ filename_t src = calc_filename(base_filename_, i - 1);
+ if (!path_exists(src))
+ {
+ continue;
+ }
+ filename_t target = calc_filename(base_filename_, i);
+
+ if (!rename_file(src, target))
+ {
+ // if failed try again after a small delay.
+ // this is a workaround to a windows issue, where very high rotation
+ // rates can cause the rename to fail with permission denied (because of antivirus?).
+ details::os::sleep_for_millis(100);
+ if (!rename_file(src, target))
+ {
+ file_helper_.reopen(true); // truncate the log file anyway to prevent it to grow beyond its limit!
+ current_size_ = 0;
+ SPDLOG_THROW(
+ spdlog_ex("rotating_file_sink: failed renaming " + filename_to_str(src) + " to " + filename_to_str(target), errno));
+ }
+ }
+ }
+ file_helper_.reopen(true);
+}
+
+// delete the target if exists, and rename the src file to target
+// return true on success, false otherwise.
+template<typename Mutex>
+SPDLOG_INLINE bool rotating_file_sink<Mutex>::rename_file(const filename_t &src_filename, const filename_t &target_filename)
+{
+ // try to delete the target file in case it already exists.
+ (void)details::os::remove(target_filename);
+ return details::os::rename(src_filename, target_filename) == 0;
+}
+
+} // namespace sinks
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/sinks/base_sink.h>
+#include <spdlog/details/file_helper.h>
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/details/synchronous_factory.h>
+
+#include <chrono>
+#include <mutex>
+#include <string>
+
+namespace spdlog {
+namespace sinks {
+
+//
+// Rotating file sink based on size
+//
+template<typename Mutex>
+class rotating_file_sink final : public base_sink<Mutex>
+{
+public:
+ rotating_file_sink(filename_t base_filename, std::size_t max_size, std::size_t max_files, bool rotate_on_open = false);
+ static filename_t calc_filename(const filename_t &filename, std::size_t index);
+ const filename_t &filename() const;
+
+protected:
+ void sink_it_(const details::log_msg &msg) override;
+ void flush_() override;
+
+private:
+ // Rotate files:
+ // log.txt -> log.1.txt
+ // log.1.txt -> log.2.txt
+ // log.2.txt -> log.3.txt
+ // log.3.txt -> delete
+ void rotate_();
+
+ // delete the target if exists, and rename the src file to target
+ // return true on success, false otherwise.
+ bool rename_file(const filename_t &src_filename, const filename_t &target_filename);
+
+ filename_t base_filename_;
+ std::size_t max_size_;
+ std::size_t max_files_;
+ std::size_t current_size_;
+ details::file_helper file_helper_;
+};
+
+using rotating_file_sink_mt = rotating_file_sink<std::mutex>;
+using rotating_file_sink_st = rotating_file_sink<details::null_mutex>;
+
+} // namespace sinks
+
+//
+// factory functions
+//
+
+template<typename Factory = spdlog::synchronous_factory>
+inline std::shared_ptr<logger> rotating_logger_mt(
+ const std::string &logger_name, const filename_t &filename, size_t max_file_size, size_t max_files, bool rotate_on_open = false)
+{
+ return Factory::template create<sinks::rotating_file_sink_mt>(logger_name, filename, max_file_size, max_files, rotate_on_open);
+}
+
+template<typename Factory = spdlog::synchronous_factory>
+inline std::shared_ptr<logger> rotating_logger_st(
+ const std::string &logger_name, const filename_t &filename, size_t max_file_size, size_t max_files, bool rotate_on_open = false)
+{
+ return Factory::template create<sinks::rotating_file_sink_st>(logger_name, filename, max_file_size, max_files, rotate_on_open);
+}
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "rotating_file_sink-inl.h"
+#endif
\ No newline at end of file
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/sinks/sink.h>
+#endif
+
+#include <spdlog/common.h>
+
+SPDLOG_INLINE bool spdlog::sinks::sink::should_log(spdlog::level::level_enum msg_level) const
+{
+ return msg_level >= level_.load(std::memory_order_relaxed);
+}
+
+SPDLOG_INLINE void spdlog::sinks::sink::set_level(level::level_enum log_level)
+{
+ level_.store(log_level, std::memory_order_relaxed);
+}
+
+SPDLOG_INLINE spdlog::level::level_enum spdlog::sinks::sink::level() const
+{
+ return static_cast<spdlog::level::level_enum>(level_.load(std::memory_order_relaxed));
+}
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/details/log_msg.h>
+#include <spdlog/formatter.h>
+
+namespace spdlog {
+
+namespace sinks {
+class sink
+{
+public:
+ virtual ~sink() = default;
+ virtual void log(const details::log_msg &msg) = 0;
+ virtual void flush() = 0;
+ virtual void set_pattern(const std::string &pattern) = 0;
+ virtual void set_formatter(std::unique_ptr<spdlog::formatter> sink_formatter) = 0;
+
+ void set_level(level::level_enum log_level);
+ level::level_enum level() const;
+ bool should_log(level::level_enum msg_level) const;
+
+protected:
+ // sink log level - default is all
+ level_t level_{level::trace};
+};
+
+} // namespace sinks
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "sink-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/sinks/stdout_color_sinks.h>
+#endif
+
+#include <spdlog/logger.h>
+#include <spdlog/common.h>
+
+namespace spdlog {
+
+template<typename Factory>
+SPDLOG_INLINE std::shared_ptr<logger> stdout_color_mt(const std::string &logger_name, color_mode mode)
+{
+ return Factory::template create<sinks::stdout_color_sink_mt>(logger_name, mode);
+}
+
+template<typename Factory>
+SPDLOG_INLINE std::shared_ptr<logger> stdout_color_st(const std::string &logger_name, color_mode mode)
+{
+ return Factory::template create<sinks::stdout_color_sink_st>(logger_name, mode);
+}
+
+template<typename Factory>
+SPDLOG_INLINE std::shared_ptr<logger> stderr_color_mt(const std::string &logger_name, color_mode mode)
+{
+ return Factory::template create<sinks::stderr_color_sink_mt>(logger_name, mode);
+}
+
+template<typename Factory>
+SPDLOG_INLINE std::shared_ptr<logger> stderr_color_st(const std::string &logger_name, color_mode mode)
+{
+ return Factory::template create<sinks::stderr_color_sink_st>(logger_name, mode);
+}
+} // namespace spdlog
\ No newline at end of file
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifdef _WIN32
+#include <spdlog/sinks/wincolor_sink.h>
+#else
+#include <spdlog/sinks/ansicolor_sink.h>
+#endif
+
+#include <spdlog/details/synchronous_factory.h>
+
+namespace spdlog {
+namespace sinks {
+#ifdef _WIN32
+using stdout_color_sink_mt = wincolor_stdout_sink_mt;
+using stdout_color_sink_st = wincolor_stdout_sink_st;
+using stderr_color_sink_mt = wincolor_stderr_sink_mt;
+using stderr_color_sink_st = wincolor_stderr_sink_st;
+#else
+using stdout_color_sink_mt = ansicolor_stdout_sink_mt;
+using stdout_color_sink_st = ansicolor_stdout_sink_st;
+using stderr_color_sink_mt = ansicolor_stderr_sink_mt;
+using stderr_color_sink_st = ansicolor_stderr_sink_st;
+#endif
+} // namespace sinks
+
+template<typename Factory = spdlog::synchronous_factory>
+std::shared_ptr<logger> stdout_color_mt(const std::string &logger_name, color_mode mode = color_mode::automatic);
+
+template<typename Factory = spdlog::synchronous_factory>
+std::shared_ptr<logger> stdout_color_st(const std::string &logger_name, color_mode mode = color_mode::automatic);
+
+template<typename Factory = spdlog::synchronous_factory>
+std::shared_ptr<logger> stderr_color_mt(const std::string &logger_name, color_mode mode = color_mode::automatic);
+
+template<typename Factory = spdlog::synchronous_factory>
+std::shared_ptr<logger> stderr_color_st(const std::string &logger_name, color_mode mode = color_mode::automatic);
+
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "stdout_color_sinks-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/sinks/stdout_sinks.h>
+#endif
+
+#include <spdlog/details/console_globals.h>
+#include <spdlog/details/pattern_formatter.h>
+#include <memory>
+
+namespace spdlog {
+
+namespace sinks {
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE stdout_sink_base<ConsoleMutex>::stdout_sink_base(FILE *file)
+ : mutex_(ConsoleMutex::mutex())
+ , file_(file)
+ , formatter_(details::make_unique<spdlog::pattern_formatter>())
+{}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE void stdout_sink_base<ConsoleMutex>::log(const details::log_msg &msg)
+{
+ std::lock_guard<mutex_t> lock(mutex_);
+ memory_buf_t formatted;
+ formatter_->format(msg, formatted);
+ fwrite(formatted.data(), sizeof(char), formatted.size(), file_);
+ fflush(file_); // flush every line to terminal
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE void stdout_sink_base<ConsoleMutex>::flush()
+{
+ std::lock_guard<mutex_t> lock(mutex_);
+ fflush(file_);
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE void stdout_sink_base<ConsoleMutex>::set_pattern(const std::string &pattern)
+{
+ std::lock_guard<mutex_t> lock(mutex_);
+ formatter_ = std::unique_ptr<spdlog::formatter>(new pattern_formatter(pattern));
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE void stdout_sink_base<ConsoleMutex>::set_formatter(std::unique_ptr<spdlog::formatter> sink_formatter)
+{
+ std::lock_guard<mutex_t> lock(mutex_);
+ formatter_ = std::move(sink_formatter);
+}
+
+// stdout sink
+template<typename ConsoleMutex>
+SPDLOG_INLINE stdout_sink<ConsoleMutex>::stdout_sink()
+ : stdout_sink_base<ConsoleMutex>(stdout)
+{}
+
+// stderr sink
+template<typename ConsoleMutex>
+SPDLOG_INLINE stderr_sink<ConsoleMutex>::stderr_sink()
+ : stdout_sink_base<ConsoleMutex>(stderr)
+{}
+
+} // namespace sinks
+
+// factory methods
+template<typename Factory>
+SPDLOG_INLINE std::shared_ptr<logger> stdout_logger_mt(const std::string &logger_name)
+{
+ return Factory::template create<sinks::stdout_sink_mt>(logger_name);
+}
+
+template<typename Factory>
+SPDLOG_INLINE std::shared_ptr<logger> stdout_logger_st(const std::string &logger_name)
+{
+ return Factory::template create<sinks::stdout_sink_st>(logger_name);
+}
+
+template<typename Factory>
+SPDLOG_INLINE std::shared_ptr<logger> stderr_logger_mt(const std::string &logger_name)
+{
+ return Factory::template create<sinks::stderr_sink_mt>(logger_name);
+}
+
+template<typename Factory>
+SPDLOG_INLINE std::shared_ptr<logger> stderr_logger_st(const std::string &logger_name)
+{
+ return Factory::template create<sinks::stderr_sink_st>(logger_name);
+}
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/details/console_globals.h>
+#include <spdlog/details/synchronous_factory.h>
+#include <spdlog/sinks/sink.h>
+#include <cstdio>
+
+namespace spdlog {
+
+namespace sinks {
+
+template<typename ConsoleMutex>
+class stdout_sink_base : public sink
+{
+public:
+ using mutex_t = typename ConsoleMutex::mutex_t;
+ explicit stdout_sink_base(FILE *file);
+ ~stdout_sink_base() override = default;
+ stdout_sink_base(const stdout_sink_base &other) = delete;
+ stdout_sink_base &operator=(const stdout_sink_base &other) = delete;
+
+ void log(const details::log_msg &msg) override;
+ void flush() override;
+ void set_pattern(const std::string &pattern) override;
+
+ void set_formatter(std::unique_ptr<spdlog::formatter> sink_formatter) override;
+
+protected:
+ mutex_t &mutex_;
+ FILE *file_;
+ std::unique_ptr<spdlog::formatter> formatter_;
+};
+
+template<typename ConsoleMutex>
+class stdout_sink : public stdout_sink_base<ConsoleMutex>
+{
+public:
+ stdout_sink();
+};
+
+template<typename ConsoleMutex>
+class stderr_sink : public stdout_sink_base<ConsoleMutex>
+{
+public:
+ stderr_sink();
+};
+
+using stdout_sink_mt = stdout_sink<details::console_mutex>;
+using stdout_sink_st = stdout_sink<details::console_nullmutex>;
+
+using stderr_sink_mt = stderr_sink<details::console_mutex>;
+using stderr_sink_st = stderr_sink<details::console_nullmutex>;
+
+} // namespace sinks
+
+// factory methods
+template<typename Factory = spdlog::synchronous_factory>
+std::shared_ptr<logger> stdout_logger_mt(const std::string &logger_name);
+
+template<typename Factory = spdlog::synchronous_factory>
+std::shared_ptr<logger> stdout_logger_st(const std::string &logger_name);
+
+template<typename Factory = spdlog::synchronous_factory>
+std::shared_ptr<logger> stderr_logger_mt(const std::string &logger_name);
+
+template<typename Factory = spdlog::synchronous_factory>
+std::shared_ptr<logger> stderr_logger_st(const std::string &logger_name);
+
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "stdout_sinks-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/sinks/base_sink.h>
+#include <spdlog/details/null_mutex.h>
+
+#include <array>
+#include <string>
+#include <syslog.h>
+
+namespace spdlog {
+namespace sinks {
+/**
+ * Sink that write to syslog using the `syscall()` library call.
+ */
+template<typename Mutex>
+class syslog_sink : public base_sink<Mutex>
+{
+
+public:
+ syslog_sink(std::string ident, int syslog_option, int syslog_facility, bool enable_formatting)
+ : enable_formatting_{enable_formatting}
+ , syslog_levels_{{/* spdlog::level::trace */ LOG_DEBUG,
+ /* spdlog::level::debug */ LOG_DEBUG,
+ /* spdlog::level::info */ LOG_INFO,
+ /* spdlog::level::warn */ LOG_WARNING,
+ /* spdlog::level::err */ LOG_ERR,
+ /* spdlog::level::critical */ LOG_CRIT,
+ /* spdlog::level::off */ LOG_INFO}}
+ , ident_{std::move(ident)}
+ {
+ // set ident to be program name if empty
+ ::openlog(ident_.empty() ? nullptr : ident_.c_str(), syslog_option, syslog_facility);
+ }
+
+ ~syslog_sink() override
+ {
+ ::closelog();
+ }
+
+ syslog_sink(const syslog_sink &) = delete;
+ syslog_sink &operator=(const syslog_sink &) = delete;
+
+protected:
+ void sink_it_(const details::log_msg &msg) override
+ {
+ string_view_t payload;
+ memory_buf_t formatted;
+ if (enable_formatting_)
+ {
+ base_sink<Mutex>::formatter_->format(msg, formatted);
+ payload = string_view_t(formatted.data(), formatted.size());
+ }
+ else
+ {
+ payload = msg.payload;
+ }
+
+ size_t length = payload.size();
+ // limit to max int
+ if (length > static_cast<size_t>(std::numeric_limits<int>::max()))
+ {
+ length = static_cast<size_t>(std::numeric_limits<int>::max());
+ }
+
+ ::syslog(syslog_prio_from_level(msg), "%.*s", static_cast<int>(length), payload.data());
+ }
+
+ void flush_() override {}
+ bool enable_formatting_ = false;
+
+private:
+ using levels_array = std::array<int, 7>;
+ levels_array syslog_levels_;
+ // must store the ident because the man says openlog might use the pointer as
+ // is and not a string copy
+ const std::string ident_;
+
+ //
+ // Simply maps spdlog's log level to syslog priority level.
+ //
+ int syslog_prio_from_level(const details::log_msg &msg) const
+ {
+ return syslog_levels_.at(static_cast<levels_array::size_type>(msg.level));
+ }
+};
+
+using syslog_sink_mt = syslog_sink<std::mutex>;
+using syslog_sink_st = syslog_sink<details::null_mutex>;
+} // namespace sinks
+
+// Create and register a syslog logger
+template<typename Factory = default_factory>
+inline std::shared_ptr<logger> syslog_logger_mt(const std::string &logger_name, const std::string &syslog_ident = "", int syslog_option = 0,
+ int syslog_facility = LOG_USER, bool enable_formatting = false)
+{
+ return Factory::template create<sinks::syslog_sink_mt>(logger_name, syslog_ident, syslog_option, syslog_facility, enable_formatting);
+}
+
+template<typename Factory = default_factory>
+inline std::shared_ptr<logger> syslog_logger_st(const std::string &logger_name, const std::string &syslog_ident = "", int syslog_option = 0,
+ int syslog_facility = LOG_USER, bool enable_formatting = false)
+{
+ return Factory::template create<sinks::syslog_sink_st>(logger_name, syslog_ident, syslog_option, syslog_facility, enable_formatting);
+}
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2019 ZVYAGIN.Alexander@gmail.com
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/sinks/base_sink.h>
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/details/synchronous_factory.h>
+
+#include <array>
+#ifndef SD_JOURNAL_SUPPRESS_LOCATION
+#define SD_JOURNAL_SUPPRESS_LOCATION
+#endif
+#include <systemd/sd-journal.h>
+
+namespace spdlog {
+namespace sinks {
+
+/**
+ * Sink that write to systemd journal using the `sd_journal_send()` library call.
+ *
+ * Locking is not needed, as `sd_journal_send()` itself is thread-safe.
+ */
+template<typename Mutex>
+class systemd_sink : public base_sink<Mutex>
+{
+public:
+ //
+ systemd_sink()
+ : syslog_levels_{{/* spdlog::level::trace */ LOG_DEBUG,
+ /* spdlog::level::debug */ LOG_DEBUG,
+ /* spdlog::level::info */ LOG_INFO,
+ /* spdlog::level::warn */ LOG_WARNING,
+ /* spdlog::level::err */ LOG_ERR,
+ /* spdlog::level::critical */ LOG_CRIT,
+ /* spdlog::level::off */ LOG_INFO}}
+ {}
+
+ ~systemd_sink() override {}
+
+ systemd_sink(const systemd_sink &) = delete;
+ systemd_sink &operator=(const systemd_sink &) = delete;
+
+protected:
+ using levels_array = std::array<int, 7>;
+ levels_array syslog_levels_;
+
+ void sink_it_(const details::log_msg &msg) override
+ {
+ int err;
+
+ size_t length = msg.payload.size();
+ // limit to max int
+ if (length > static_cast<size_t>(std::numeric_limits<int>::max()))
+ {
+ length = static_cast<size_t>(std::numeric_limits<int>::max());
+ }
+
+ // Do not send source location if not available
+ if (msg.source.empty())
+ {
+ // Note: function call inside '()' to avoid macro expansion
+ err = (sd_journal_send)("MESSAGE=%.*s", static_cast<int>(length), msg.payload.data(), "PRIORITY=%d", syslog_level(msg.level),
+ "SYSLOG_IDENTIFIER=%.*s", static_cast<int>(msg.logger_name.size()), msg.logger_name.data(), nullptr);
+ }
+ else
+ {
+ err = (sd_journal_send)("MESSAGE=%.*s", static_cast<int>(length), msg.payload.data(), "PRIORITY=%d", syslog_level(msg.level),
+ "SYSLOG_IDENTIFIER=%.*s", static_cast<int>(msg.logger_name.size()), msg.logger_name.data(), "CODE_FILE=%s",
+ msg.source.filename, "CODE_LINE=%d", msg.source.line, "CODE_FUNC=%s", msg.source.funcname, nullptr);
+ }
+
+ if (err)
+ {
+ SPDLOG_THROW(spdlog_ex("Failed writing to systemd", errno));
+ }
+ }
+
+ int syslog_level(level::level_enum l)
+ {
+ return syslog_levels_.at(static_cast<levels_array::size_type>(l));
+ }
+
+ void flush_() override {}
+};
+
+using systemd_sink_mt = systemd_sink<std::mutex>;
+using systemd_sink_st = systemd_sink<details::null_mutex>;
+} // namespace sinks
+
+// Create and register a syslog logger
+template<typename Factory = spdlog::synchronous_factory>
+inline std::shared_ptr<logger> systemd_logger_mt(const std::string &logger_name)
+{
+ return Factory::template create<sinks::systemd_sink_mt>(logger_name);
+}
+
+template<typename Factory = spdlog::synchronous_factory>
+inline std::shared_ptr<logger> systemd_logger_st(const std::string &logger_name)
+{
+ return Factory::template create<sinks::systemd_sink_st>(logger_name);
+}
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/sinks/wincolor_sink.h>
+#endif
+
+#include <spdlog/common.h>
+#include <spdlog/details/pattern_formatter.h>
+
+namespace spdlog {
+namespace sinks {
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE wincolor_sink<ConsoleMutex>::wincolor_sink(HANDLE out_handle, color_mode mode)
+ : out_handle_(out_handle)
+ , mutex_(ConsoleMutex::mutex())
+ , formatter_(details::make_unique<spdlog::pattern_formatter>())
+{
+ // check if out_handle is points to the actual console.
+ // ::GetConsoleMode() should return 0 if it is redirected or not valid console handle.
+ DWORD console_mode;
+ in_console_ = ::GetConsoleMode(out_handle, &console_mode) != 0;
+
+ set_color_mode(mode);
+ colors_[level::trace] = WHITE;
+ colors_[level::debug] = CYAN;
+ colors_[level::info] = GREEN;
+ colors_[level::warn] = YELLOW | BOLD;
+ colors_[level::err] = RED | BOLD; // red bold
+ colors_[level::critical] = BACKGROUND_RED | WHITE | BOLD; // white bold on red background
+ colors_[level::off] = 0;
+}
+
+template<typename ConsoleMutex>
+SPDLOG_INLINE wincolor_sink<ConsoleMutex>::~wincolor_sink()
+{
+ this->flush();
+}
+
+// change the color for the given level
+template<typename ConsoleMutex>
+void SPDLOG_INLINE wincolor_sink<ConsoleMutex>::set_color(level::level_enum level, WORD color)
+{
+ std::lock_guard<mutex_t> lock(mutex_);
+ colors_[level] = color;
+}
+
+template<typename ConsoleMutex>
+void SPDLOG_INLINE wincolor_sink<ConsoleMutex>::log(const details::log_msg &msg)
+{
+ std::lock_guard<mutex_t> lock(mutex_);
+ memory_buf_t formatted;
+ formatter_->format(msg, formatted);
+ if (!in_console_)
+ {
+ write_to_file_(formatted);
+ return;
+ }
+
+ if (should_do_colors_ && msg.color_range_end > msg.color_range_start)
+ {
+ // before color range
+ print_range_(formatted, 0, msg.color_range_start);
+
+ // in color range
+ auto orig_attribs = set_foreground_color_(colors_[msg.level]);
+ print_range_(formatted, msg.color_range_start, msg.color_range_end);
+ // reset to orig colors
+ ::SetConsoleTextAttribute(out_handle_, orig_attribs);
+ print_range_(formatted, msg.color_range_end, formatted.size());
+ }
+ else // print without colors if color range is invalid (or color is disabled)
+ {
+ print_range_(formatted, 0, formatted.size());
+ }
+}
+
+template<typename ConsoleMutex>
+void SPDLOG_INLINE wincolor_sink<ConsoleMutex>::flush()
+{
+ // windows console always flushed?
+}
+
+template<typename ConsoleMutex>
+void SPDLOG_INLINE wincolor_sink<ConsoleMutex>::set_pattern(const std::string &pattern)
+{
+ std::lock_guard<mutex_t> lock(mutex_);
+ formatter_ = std::unique_ptr<spdlog::formatter>(new pattern_formatter(pattern));
+}
+
+template<typename ConsoleMutex>
+void SPDLOG_INLINE wincolor_sink<ConsoleMutex>::set_formatter(std::unique_ptr<spdlog::formatter> sink_formatter)
+{
+ std::lock_guard<mutex_t> lock(mutex_);
+ formatter_ = std::move(sink_formatter);
+}
+
+template<typename ConsoleMutex>
+void SPDLOG_INLINE wincolor_sink<ConsoleMutex>::set_color_mode(color_mode mode)
+{
+ switch (mode)
+ {
+ case color_mode::always:
+ case color_mode::automatic:
+ should_do_colors_ = true;
+ break;
+ case color_mode::never:
+ should_do_colors_ = false;
+ break;
+ default:
+ should_do_colors_ = true;
+ }
+}
+
+// set foreground color and return the orig console attributes (for resetting later)
+template<typename ConsoleMutex>
+WORD SPDLOG_INLINE wincolor_sink<ConsoleMutex>::set_foreground_color_(WORD attribs)
+{
+ CONSOLE_SCREEN_BUFFER_INFO orig_buffer_info;
+ ::GetConsoleScreenBufferInfo(out_handle_, &orig_buffer_info);
+ WORD back_color = orig_buffer_info.wAttributes;
+ // retrieve the current background color
+ back_color &= static_cast<WORD>(~(FOREGROUND_RED | FOREGROUND_GREEN | FOREGROUND_BLUE | FOREGROUND_INTENSITY));
+ // keep the background color unchanged
+ ::SetConsoleTextAttribute(out_handle_, attribs | back_color);
+ return orig_buffer_info.wAttributes; // return orig attribs
+}
+
+// print a range of formatted message to console
+template<typename ConsoleMutex>
+void SPDLOG_INLINE wincolor_sink<ConsoleMutex>::print_range_(const memory_buf_t &formatted, size_t start, size_t end)
+{
+ auto size = static_cast<DWORD>(end - start);
+ ::WriteConsoleA(out_handle_, formatted.data() + start, size, nullptr, nullptr);
+}
+
+template<typename ConsoleMutex>
+void SPDLOG_INLINE wincolor_sink<ConsoleMutex>::write_to_file_(const memory_buf_t &formatted)
+{
+ if (out_handle_ == nullptr) // no console and no file redirect
+ {
+ return;
+ }
+ auto size = static_cast<DWORD>(formatted.size());
+ if (size == 0)
+ {
+ return;
+ }
+
+ DWORD total_written = 0;
+ do
+ {
+ DWORD bytes_written = 0;
+ bool ok = ::WriteFile(out_handle_, formatted.data() + total_written, size - total_written, &bytes_written, nullptr) != 0;
+ if (!ok || bytes_written == 0)
+ {
+ SPDLOG_THROW(spdlog_ex("wincolor_sink: write_to_file_ failed. GetLastError(): " + std::to_string(::GetLastError())));
+ }
+ total_written += bytes_written;
+ } while (total_written < size);
+}
+
+// wincolor_stdout_sink
+template<typename ConsoleMutex>
+SPDLOG_INLINE wincolor_stdout_sink<ConsoleMutex>::wincolor_stdout_sink(color_mode mode)
+ : wincolor_sink<ConsoleMutex>(::GetStdHandle(STD_OUTPUT_HANDLE), mode)
+{}
+
+// wincolor_stderr_sink
+template<typename ConsoleMutex>
+SPDLOG_INLINE wincolor_stderr_sink<ConsoleMutex>::wincolor_stderr_sink(color_mode mode)
+ : wincolor_sink<ConsoleMutex>(::GetStdHandle(STD_ERROR_HANDLE), mode)
+{}
+
+} // namespace sinks
+} // namespace spdlog
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#include <spdlog/common.h>
+#include <spdlog/details/console_globals.h>
+#include <spdlog/details/null_mutex.h>
+#include <spdlog/sinks/sink.h>
+
+#include <memory>
+#include <mutex>
+#include <string>
+#include <unordered_map>
+#include <wincon.h>
+
+namespace spdlog {
+namespace sinks {
+/*
+ * Windows color console sink. Uses WriteConsoleA to write to the console with
+ * colors
+ */
+template<typename ConsoleMutex>
+class wincolor_sink : public sink
+{
+public:
+ const WORD BOLD = FOREGROUND_INTENSITY;
+ const WORD RED = FOREGROUND_RED;
+ const WORD GREEN = FOREGROUND_GREEN;
+ const WORD CYAN = FOREGROUND_GREEN | FOREGROUND_BLUE;
+ const WORD WHITE = FOREGROUND_RED | FOREGROUND_GREEN | FOREGROUND_BLUE;
+ const WORD YELLOW = FOREGROUND_RED | FOREGROUND_GREEN;
+
+ wincolor_sink(HANDLE out_handle, color_mode mode);
+ ~wincolor_sink() override;
+
+ wincolor_sink(const wincolor_sink &other) = delete;
+ wincolor_sink &operator=(const wincolor_sink &other) = delete;
+
+ // change the color for the given level
+ void set_color(level::level_enum level, WORD color);
+ void log(const details::log_msg &msg) final override;
+ void flush() final override;
+ void set_pattern(const std::string &pattern) override final;
+ void set_formatter(std::unique_ptr<spdlog::formatter> sink_formatter) override final;
+ void set_color_mode(color_mode mode);
+
+protected:
+ using mutex_t = typename ConsoleMutex::mutex_t;
+ HANDLE out_handle_;
+ mutex_t &mutex_;
+ bool in_console_;
+ bool should_do_colors_;
+ std::unique_ptr<spdlog::formatter> formatter_;
+ std::unordered_map<level::level_enum, WORD, level::level_hasher> colors_;
+
+ // set foreground color and return the orig console attributes (for resetting later)
+ WORD set_foreground_color_(WORD attribs);
+
+ // print a range of formatted message to console
+ void print_range_(const memory_buf_t &formatted, size_t start, size_t end);
+
+ // in case we are redirected to file (not in console mode)
+ void write_to_file_(const memory_buf_t &formatted);
+};
+
+template<typename ConsoleMutex>
+class wincolor_stdout_sink : public wincolor_sink<ConsoleMutex>
+{
+public:
+ explicit wincolor_stdout_sink(color_mode mode = color_mode::automatic);
+};
+
+template<typename ConsoleMutex>
+class wincolor_stderr_sink : public wincolor_sink<ConsoleMutex>
+{
+public:
+ explicit wincolor_stderr_sink(color_mode mode = color_mode::automatic);
+};
+
+using wincolor_stdout_sink_mt = wincolor_stdout_sink<details::console_mutex>;
+using wincolor_stdout_sink_st = wincolor_stdout_sink<details::console_nullmutex>;
+
+using wincolor_stderr_sink_mt = wincolor_stderr_sink<details::console_mutex>;
+using wincolor_stderr_sink_st = wincolor_stderr_sink<details::console_nullmutex>;
+
+} // namespace sinks
+} // namespace spdlog
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "wincolor_sink-inl.h"
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#ifndef SPDLOG_HEADER_ONLY
+#include <spdlog/spdlog.h>
+#endif
+
+#include <spdlog/common.h>
+#include <spdlog/details/pattern_formatter.h>
+
+namespace spdlog {
+
+SPDLOG_INLINE void initialize_logger(std::shared_ptr<logger> logger)
+{
+ details::registry::instance().initialize_logger(std::move(logger));
+}
+
+SPDLOG_INLINE std::shared_ptr<logger> get(const std::string &name)
+{
+ return details::registry::instance().get(name);
+}
+
+SPDLOG_INLINE void set_formatter(std::unique_ptr<spdlog::formatter> formatter)
+{
+ details::registry::instance().set_formatter(std::move(formatter));
+}
+
+SPDLOG_INLINE void set_pattern(std::string pattern, pattern_time_type time_type)
+{
+ set_formatter(std::unique_ptr<spdlog::formatter>(new pattern_formatter(std::move(pattern), time_type)));
+}
+
+SPDLOG_INLINE void enable_backtrace(size_t n_messages)
+{
+ details::registry::instance().enable_backtrace(n_messages);
+}
+
+SPDLOG_INLINE void disable_backtrace()
+{
+ details::registry::instance().disable_backtrace();
+}
+
+SPDLOG_INLINE void dump_backtrace()
+{
+ default_logger_raw()->dump_backtrace();
+}
+
+SPDLOG_INLINE void set_level(level::level_enum log_level)
+{
+ details::registry::instance().set_level(log_level);
+}
+
+SPDLOG_INLINE void flush_on(level::level_enum log_level)
+{
+ details::registry::instance().flush_on(log_level);
+}
+
+SPDLOG_INLINE void flush_every(std::chrono::seconds interval)
+{
+ details::registry::instance().flush_every(interval);
+}
+
+SPDLOG_INLINE void set_error_handler(void (*handler)(const std::string &msg))
+{
+ details::registry::instance().set_error_handler(handler);
+}
+
+SPDLOG_INLINE void register_logger(std::shared_ptr<logger> logger)
+{
+ details::registry::instance().register_logger(std::move(logger));
+}
+
+SPDLOG_INLINE void apply_all(const std::function<void(std::shared_ptr<logger>)> &fun)
+{
+ details::registry::instance().apply_all(fun);
+}
+
+SPDLOG_INLINE void drop(const std::string &name)
+{
+ details::registry::instance().drop(name);
+}
+
+SPDLOG_INLINE void drop_all()
+{
+ details::registry::instance().drop_all();
+}
+
+SPDLOG_INLINE void shutdown()
+{
+ details::registry::instance().shutdown();
+}
+
+SPDLOG_INLINE void set_automatic_registration(bool automatic_registration)
+{
+ details::registry::instance().set_automatic_registration(automatic_registration);
+}
+
+SPDLOG_INLINE std::shared_ptr<spdlog::logger> default_logger()
+{
+ return details::registry::instance().default_logger();
+}
+
+SPDLOG_INLINE spdlog::logger *default_logger_raw()
+{
+ return details::registry::instance().get_default_raw();
+}
+
+SPDLOG_INLINE void set_default_logger(std::shared_ptr<spdlog::logger> default_logger)
+{
+ details::registry::instance().set_default_logger(std::move(default_logger));
+}
+
+} // namespace spdlog
\ No newline at end of file
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+// spdlog main header file.
+// see example.cpp for usage example
+
+#ifndef SPDLOG_H
+#define SPDLOG_H
+
+#pragma once
+
+#include <spdlog/common.h>
+#include <spdlog/details/registry.h>
+#include <spdlog/logger.h>
+#include <spdlog/version.h>
+#include <spdlog/details/synchronous_factory.h>
+
+#include <chrono>
+#include <functional>
+#include <memory>
+#include <string>
+
+namespace spdlog {
+
+using default_factory = synchronous_factory;
+
+// Create and register a logger with a templated sink type
+// The logger's level, formatter and flush level will be set according the
+// global settings.
+//
+// Example:
+// spdlog::create<daily_file_sink_st>("logger_name", "dailylog_filename", 11, 59);
+template<typename Sink, typename... SinkArgs>
+inline std::shared_ptr<spdlog::logger> create(std::string logger_name, SinkArgs &&... sink_args)
+{
+ return default_factory::create<Sink>(std::move(logger_name), std::forward<SinkArgs>(sink_args)...);
+}
+
+// Initialize and register a logger,
+// formatter and flush level will be set according the global settings.
+//
+// NOTE:
+// Use this function when creating loggers manually.
+//
+// Example:
+// auto console_sink = std::make_shared<spdlog::sinks::stdout_sink_mt>();
+// auto console_logger = std::make_shared<spdlog::logger>("console_logger", console_sink);
+// spdlog::initialize_logger(console_logger);
+void initialize_logger(std::shared_ptr<logger> logger);
+
+// Return an existing logger or nullptr if a logger with such name doesn't
+// exist.
+// example: spdlog::get("my_logger")->info("hello {}", "world");
+std::shared_ptr<logger> get(const std::string &name);
+
+// Set global formatter. Each sink in each logger will get a clone of this object
+void set_formatter(std::unique_ptr<spdlog::formatter> formatter);
+
+// Set global format string.
+// example: spdlog::set_pattern("%Y-%m-%d %H:%M:%S.%e %l : %v");
+void set_pattern(std::string pattern, pattern_time_type time_type = pattern_time_type::local);
+
+// enable global backtrace support
+void enable_backtrace(size_t n_messages);
+
+// disable global backtrace support
+void disable_backtrace();
+
+// call dump backtrace on default logger
+void dump_backtrace();
+
+// Set global logging level
+void set_level(level::level_enum log_level);
+
+// Set global flush level
+void flush_on(level::level_enum log_level);
+
+// Start/Restart a periodic flusher thread
+// Warning: Use only if all your loggers are thread safe!
+void flush_every(std::chrono::seconds interval);
+
+// Set global error handler
+void set_error_handler(void (*handler)(const std::string &msg));
+
+// Register the given logger with the given name
+void register_logger(std::shared_ptr<logger> logger);
+
+// Apply a user defined function on all registered loggers
+// Example:
+// spdlog::apply_all([&](std::shared_ptr<spdlog::logger> l) {l->flush();});
+void apply_all(const std::function<void(std::shared_ptr<logger>)> &fun);
+
+// Drop the reference to the given logger
+void drop(const std::string &name);
+
+// Drop all references from the registry
+void drop_all();
+
+// stop any running threads started by spdlog and clean registry loggers
+void shutdown();
+
+// Automatic registration of loggers when using spdlog::create() or spdlog::create_async
+void set_automatic_registration(bool automatic_registration);
+
+// API for using default logger (stdout_color_mt),
+// e.g: spdlog::info("Message {}", 1);
+//
+// The default logger object can be accessed using the spdlog::default_logger():
+// For example, to add another sink to it:
+// spdlog::default_logger()->sinks()->push_back(some_sink);
+//
+// The default logger can replaced using spdlog::set_default_logger(new_logger).
+// For example, to replace it with a file logger.
+//
+// IMPORTANT:
+// The default API is thread safe (for _mt loggers), but:
+// set_default_logger() *should not* be used concurrently with the default API.
+// e.g do not call set_default_logger() from one thread while calling spdlog::info() from another.
+
+std::shared_ptr<spdlog::logger> default_logger();
+
+spdlog::logger *default_logger_raw();
+
+void set_default_logger(std::shared_ptr<spdlog::logger> default_logger);
+
+template<typename... Args>
+inline void log(source_loc source, level::level_enum lvl, string_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->log(source, lvl, fmt, args...);
+}
+
+template<typename... Args>
+inline void log(level::level_enum lvl, string_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->log(source_loc{}, lvl, fmt, args...);
+}
+
+template<typename... Args>
+inline void trace(string_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->trace(fmt, args...);
+}
+
+template<typename... Args>
+inline void debug(string_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->debug(fmt, args...);
+}
+
+template<typename... Args>
+inline void info(string_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->info(fmt, args...);
+}
+
+template<typename... Args>
+inline void warn(string_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->warn(fmt, args...);
+}
+
+template<typename... Args>
+inline void error(string_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->error(fmt, args...);
+}
+
+template<typename... Args>
+inline void critical(string_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->critical(fmt, args...);
+}
+
+template<typename T>
+inline void log(source_loc source, level::level_enum lvl, const T &msg)
+{
+ default_logger_raw()->log(source, lvl, msg);
+}
+
+template<typename T>
+inline void log(level::level_enum lvl, const T &msg)
+{
+ default_logger_raw()->log(lvl, msg);
+}
+
+template<typename T>
+inline void trace(const T &msg)
+{
+ default_logger_raw()->trace(msg);
+}
+
+template<typename T>
+inline void debug(const T &msg)
+{
+ default_logger_raw()->debug(msg);
+}
+
+template<typename T>
+inline void info(const T &msg)
+{
+ default_logger_raw()->info(msg);
+}
+
+template<typename T>
+inline void warn(const T &msg)
+{
+ default_logger_raw()->warn(msg);
+}
+
+template<typename T>
+inline void error(const T &msg)
+{
+ default_logger_raw()->error(msg);
+}
+
+template<typename T>
+inline void critical(const T &msg)
+{
+ default_logger_raw()->critical(msg);
+}
+
+#ifdef SPDLOG_WCHAR_TO_UTF8_SUPPORT
+template<typename... Args>
+inline void log(source_loc source, level::level_enum lvl, wstring_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->log(source, lvl, fmt, args...);
+}
+
+template<typename... Args>
+inline void log(level::level_enum lvl, wstring_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->log(lvl, fmt, args...);
+}
+
+template<typename... Args>
+inline void trace(wstring_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->trace(fmt, args...);
+}
+
+template<typename... Args>
+inline void debug(wstring_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->debug(fmt, args...);
+}
+
+template<typename... Args>
+inline void info(wstring_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->info(fmt, args...);
+}
+
+template<typename... Args>
+inline void warn(wstring_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->warn(fmt, args...);
+}
+
+template<typename... Args>
+inline void error(wstring_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->error(fmt, args...);
+}
+
+template<typename... Args>
+inline void critical(wstring_view_t fmt, const Args &... args)
+{
+ default_logger_raw()->critical(fmt, args...);
+}
+
+#endif // SPDLOG_WCHAR_TO_UTF8_SUPPORT
+
+} // namespace spdlog
+
+//
+// enable/disable log calls at compile time according to global level.
+//
+// define SPDLOG_ACTIVE_LEVEL to one of those (before including spdlog.h):
+// SPDLOG_LEVEL_TRACE,
+// SPDLOG_LEVEL_DEBUG,
+// SPDLOG_LEVEL_INFO,
+// SPDLOG_LEVEL_WARN,
+// SPDLOG_LEVEL_ERROR,
+// SPDLOG_LEVEL_CRITICAL,
+// SPDLOG_LEVEL_OFF
+//
+
+#define SPDLOG_LOGGER_CALL(logger, level, ...) (logger)->log(spdlog::source_loc{__FILE__, __LINE__, SPDLOG_FUNCTION}, level, __VA_ARGS__)
+
+#if SPDLOG_ACTIVE_LEVEL <= SPDLOG_LEVEL_TRACE
+#define SPDLOG_LOGGER_TRACE(logger, ...) SPDLOG_LOGGER_CALL(logger, spdlog::level::trace, __VA_ARGS__)
+#define SPDLOG_TRACE(...) SPDLOG_LOGGER_TRACE(spdlog::default_logger_raw(), __VA_ARGS__)
+#else
+#define SPDLOG_LOGGER_TRACE(logger, ...) (void)0
+#define SPDLOG_TRACE(...) (void)0
+#endif
+
+#if SPDLOG_ACTIVE_LEVEL <= SPDLOG_LEVEL_DEBUG
+#define SPDLOG_LOGGER_DEBUG(logger, ...) SPDLOG_LOGGER_CALL(logger, spdlog::level::debug, __VA_ARGS__)
+#define SPDLOG_DEBUG(...) SPDLOG_LOGGER_DEBUG(spdlog::default_logger_raw(), __VA_ARGS__)
+#else
+#define SPDLOG_LOGGER_DEBUG(logger, ...) (void)0
+#define SPDLOG_DEBUG(...) (void)0
+#endif
+
+#if SPDLOG_ACTIVE_LEVEL <= SPDLOG_LEVEL_INFO
+#define SPDLOG_LOGGER_INFO(logger, ...) SPDLOG_LOGGER_CALL(logger, spdlog::level::info, __VA_ARGS__)
+#define SPDLOG_INFO(...) SPDLOG_LOGGER_INFO(spdlog::default_logger_raw(), __VA_ARGS__)
+#else
+#define SPDLOG_LOGGER_INFO(logger, ...) (void)0
+#define SPDLOG_INFO(...) (void)0
+#endif
+
+#if SPDLOG_ACTIVE_LEVEL <= SPDLOG_LEVEL_WARN
+#define SPDLOG_LOGGER_WARN(logger, ...) SPDLOG_LOGGER_CALL(logger, spdlog::level::warn, __VA_ARGS__)
+#define SPDLOG_WARN(...) SPDLOG_LOGGER_WARN(spdlog::default_logger_raw(), __VA_ARGS__)
+#else
+#define SPDLOG_LOGGER_WARN(logger, ...) (void)0
+#define SPDLOG_WARN(...) (void)0
+#endif
+
+#if SPDLOG_ACTIVE_LEVEL <= SPDLOG_LEVEL_ERROR
+#define SPDLOG_LOGGER_ERROR(logger, ...) SPDLOG_LOGGER_CALL(logger, spdlog::level::err, __VA_ARGS__)
+#define SPDLOG_ERROR(...) SPDLOG_LOGGER_ERROR(spdlog::default_logger_raw(), __VA_ARGS__)
+#else
+#define SPDLOG_LOGGER_ERROR(logger, ...) (void)0
+#define SPDLOG_ERROR(...) (void)0
+#endif
+
+#if SPDLOG_ACTIVE_LEVEL <= SPDLOG_LEVEL_CRITICAL
+#define SPDLOG_LOGGER_CRITICAL(logger, ...) SPDLOG_LOGGER_CALL(logger, spdlog::level::critical, __VA_ARGS__)
+#define SPDLOG_CRITICAL(...) SPDLOG_LOGGER_CRITICAL(spdlog::default_logger_raw(), __VA_ARGS__)
+#else
+#define SPDLOG_LOGGER_CRITICAL(logger, ...) (void)0
+#define SPDLOG_CRITICAL(...) (void)0
+#endif
+
+#ifdef SPDLOG_HEADER_ONLY
+#include "spdlog-inl.h"
+#endif
+
+#endif // SPDLOG_H
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+///////////////////////////////////////////////////////////////////////////////
+//
+// Edit this file to squeeze more performance, and to customize supported
+// features
+//
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Under Linux, the much faster CLOCK_REALTIME_COARSE clock can be used.
+// This clock is less accurate - can be off by dozens of millis - depending on
+// the kernel HZ.
+// Uncomment to use it instead of the regular clock.
+//
+// #define SPDLOG_CLOCK_COARSE
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment if thread id logging is not needed (i.e. no %t in the log pattern).
+// This will prevent spdlog from querying the thread id on each log call.
+//
+// WARNING: If the log pattern contains thread id (i.e, %t) while this flag is
+// on, the result is undefined.
+//
+// #define SPDLOG_NO_THREAD_ID
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment to prevent spdlog from using thread local storage.
+//
+// WARNING: if your program forks, UNCOMMENT this flag to prevent undefined
+// thread ids in the children logs.
+//
+// #define SPDLOG_NO_TLS
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment if logger name logging is not needed.
+// This will prevent spdlog from copying the logger name on each log call.
+//
+// #define SPDLOG_NO_NAME
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment to avoid spdlog's usage of atomic log levels
+// Use only if your code never modifies a logger's log levels concurrently by
+// different threads.
+//
+// #define SPDLOG_NO_ATOMIC_LEVELS
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment to enable usage of wchar_t for file names on Windows.
+//
+// #define SPDLOG_WCHAR_FILENAMES
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment to override default eol ("\n" or "\r\n" under Linux/Windows)
+//
+// #define SPDLOG_EOL ";-)\n"
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment to use your own copy of the fmt library instead of spdlog's copy.
+// In this case spdlog will try to include <fmt/format.h> so set your -I flag
+// accordingly.
+//
+// #define SPDLOG_FMT_EXTERNAL
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment to enable wchar_t support (convert to utf8)
+//
+// #define SPDLOG_WCHAR_TO_UTF8_SUPPORT
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment to prevent child processes from inheriting log file descriptors
+//
+// #define SPDLOG_PREVENT_CHILD_FD
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment to customize level names (e.g. "MT TRACE")
+//
+// #define SPDLOG_LEVEL_NAMES { "MY TRACE", "MY DEBUG", "MY INFO", "MY WARNING",
+// "MY ERROR", "MY CRITICAL", "OFF" }
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment to customize short level names (e.g. "MT")
+// These can be longer than one character.
+//
+// #define SPDLOG_SHORT_LEVEL_NAMES { "T", "D", "I", "W", "E", "C", "O" }
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment to disable default logger creation.
+// This might save some (very) small initialization time if no default logger is needed.
+//
+// #define SPDLOG_DISABLE_DEFAULT_LOGGER
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment and set to compile time level with zero cost (default is INFO).
+// Macros like SPDLOG_DEBUG(..), SPDLOG_INFO(..) will expand to empty statements if not enabled
+//
+// #define SPDLOG_ACTIVE_LEVEL SPDLOG_LEVEL_INFO
+///////////////////////////////////////////////////////////////////////////////
+
+///////////////////////////////////////////////////////////////////////////////
+// Uncomment (and change if desired) macro to use for function names.
+// This is compiler dependent.
+// __PRETTY_FUNCTION__ might be nicer in clang/gcc, and __FUNCTION__ in msvc.
+// Defaults to __FUNCTION__ (should work on all compilers) if not defined.
+//
+// #define SPDLOG_FUNCTION __PRETTY_FUNCTION__
+///////////////////////////////////////////////////////////////////////////////
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#pragma once
+
+#define SPDLOG_VER_MAJOR 1
+#define SPDLOG_VER_MINOR 5
+#define SPDLOG_VER_PATCH 0
+
+#define SPDLOG_VERSION (SPDLOG_VER_MAJOR * 10000 + SPDLOG_VER_MINOR * 100 + SPDLOG_VER_PATCH)
--- /dev/null
+project('spdlog', ['cpp'],
+ license : 'MIT',
+ version : run_command(find_program('scripts/extract_version.py')).stdout().strip(),
+ default_options : [
+ 'warning_level=3',
+ 'cpp_std=c++11',
+ 'buildtype=release',
+ 'b_colorout=always',
+ ],
+)
+
+# ------------------------
+# --- Dependencies ---
+# ------------------------
+dep_list = []
+compile_args = []
+
+# Threads
+dep_list += dependency('threads')
+
+# Check for FMT
+if get_option('external_fmt')
+ if not meson.version().version_compare('>=0.49.0')
+ warning('Finding fmt can fail with meson versions before 0.49.0')
+ endif
+ dep_list += dependency('fmt', fallback : ['fmt', 'fmt_dep'])
+ compile_args += '-DSPDLOG_FMT_EXTERNAL'
+endif
+
+if get_option('no_exceptions')
+ compile_args += '-DSPDLOG_NO_EXCEPTIONS'
+endif
+
+if get_option('wchar_support')
+ if build_machine.system() != 'windows'
+ error('wchar_support only supported under windows')
+ endif
+ compile_args += '-DSPDLOG_WCHAR_TO_UTF8_SUPPORT'
+endif
+
+if get_option('wchar_filenames')
+ if build_machine.system() != 'windows'
+ error('wchar_filenames only supported under windows')
+ endif
+ compile_args += '-DSPDLOG_WCHAR_FILENAMES'
+endif
+
+if get_option('clock_coarse')
+ if build_machine.system() != 'linux'
+ error('clock_coarse only supported under linux')
+ endif
+ compile_args += '-DSPDLOG_CLOCK_COARSE'
+endif
+
+if get_option('prevent_child_fd')
+ compile_args += '-DSPDLOG_PREVENT_CHILD_FD'
+endif
+
+if get_option('no_thread_id')
+ compile_args += '-DSPDLOG_NO_THREAD_ID'
+endif
+
+if get_option('no_tls')
+ compile_args += '-DSPDLOG_NO_TLS'
+endif
+
+if get_option('no_atomic_levels')
+ compile_args += '-DSPDLOG_NO_ATOMIC_LEVELS'
+endif
+
+compile_args_compiled = compile_args + ['-DSPDLOG_COMPILED_LIB']
+compile_args_ho = compile_args
+
+# ------------------------------------
+# --- Compiled library version ---
+# ------------------------------------
+
+spdlog_inc = include_directories('./include')
+
+spdlog_srcs = files([
+ 'src/async.cpp',
+ 'src/color_sinks.cpp',
+ 'src/file_sinks.cpp',
+ 'src/spdlog.cpp',
+ 'src/stdout_sinks.cpp'
+])
+
+if not get_option('external_fmt')
+ spdlog_srcs+= 'src/fmt.cpp'
+endif
+
+if get_option('library_type') == 'static'
+ spdlog = static_library(
+ 'spdlog',
+ spdlog_srcs,
+ cpp_args : compile_args_compiled,
+ include_directories : spdlog_inc,
+ dependencies : dep_list,
+ install : not meson.is_subproject()
+ )
+else
+ spdlog = shared_library('spdlog',
+ spdlog_srcs,
+ cpp_args : compile_args_compiled,
+ include_directories : spdlog_inc,
+ dependencies : dep_list,
+ install : not meson.is_subproject(),
+ version : meson.project_version(),
+ )
+endif
+
+spdlog_dep = declare_dependency(
+ link_with : spdlog,
+ include_directories : spdlog_inc,
+ compile_args : compile_args_compiled,
+ dependencies : dep_list,
+ version : meson.project_version(),
+)
+
+# ----------------------------------
+# --- Header only dependency ---
+# ----------------------------------
+spdlog_headeronly_dep = declare_dependency(
+ include_directories : spdlog_inc,
+ compile_args : compile_args_ho,
+ dependencies : dep_list,
+ version : meson.project_version(),
+)
+
+# ------------------------
+# --- Installation ---
+# ------------------------
+
+# Do not install when spdlog is used as a subproject
+if not meson.is_subproject()
+ install_subdir('include/spdlog', install_dir: get_option('includedir'))
+
+ pkg = import('pkgconfig')
+ pkg.generate(spdlog,
+ name : 'spdlog',
+ description : 'Fast C++ logging library',
+ url : 'https://github.com/gabime/spdlog',
+ extra_cflags : compile_args_compiled
+ )
+endif
+
+# -------------------------------------
+# --- Conditionally add subdirs ---
+# -------------------------------------
+
+if get_option('enable_tests') or get_option('enable_tests_ho')
+ subdir('tests')
+endif
+
+if get_option('enable_examples')
+ subdir('example')
+endif
+
+if get_option('enable_benchmarks')
+ subdir('bench')
+endif
+
+# -------------------
+# --- Summary ---
+# -------------------
+
+summary_str = '''spdlog build summary:
+ - using external fmt: @0@
+ - building tests: @1@
+ - building examples: @2@
+ - building benchmarks: @3@
+ - library type: @4@
+ - no exceptions: @5@
+'''.format(
+ get_option('external_fmt'),
+ get_option('enable_tests'),
+ get_option('enable_examples'),
+ get_option('enable_benchmarks'),
+ get_option('library_type'),
+ get_option('no_exceptions')
+)
+
+message(summary_str)
--- /dev/null
+option('external_fmt', type: 'boolean', value: false, description: 'Use external fmt package instead of the bundled')
+option('enable_examples', type: 'boolean', value: true, description: 'Build examples')
+option('enable_benchmarks', type: 'boolean', value: false, description: 'Build benchmarks')
+option('enable_tests', type: 'boolean', value: true, description: 'Build tests')
+option('enable_tests_ho', type: 'boolean', value: false, description: 'Build header-only tests')
+option('library_type', type: 'combo', choices: ['static', 'shared'], value: 'static', description: 'Library build type')
+option('no_exceptions', type: 'boolean', value: false, description: 'Disabled exceptions - abort() instead any error')
+
+option('wchar_support', type: 'boolean', value: false, description:'(Windows only) Support wchar api')
+option('wchar_filenames', type: 'boolean', value: false, description: '(Windows only) Support wchar filenames')
+option('clock_coarse', type: 'boolean', value: false, description: '(Linux only) Use the much faster (but much less accurate) CLOCK_REALTIME_COARSE instead of the regular clock')
+option('prevent_child_fd', type: 'boolean', value: false, description: 'Prevent from child processes to inherit log file descriptors')
+option('no_thread_id', type: 'boolean', value: false, description: 'prevent spdlog from querying the thread id on each log call if thread id is not needed')
+option('no_tls', type: 'boolean', value: false, description: 'prevent spdlog from using thread local storage')
+option('no_atomic_levels', type: 'boolean', value: false, description: 'prevent spdlog from using of std::atomic log levels (use only if your code never modifies log levels concurrently')
--- /dev/null
+---
+Language: Cpp
+# BasedOnStyle: LLVM
+AccessModifierOffset: -4
+AlignAfterOpenBracket: DontAlign
+AlignConsecutiveAssignments: false
+AlignConsecutiveDeclarations: false
+AlignEscapedNewlines: Right
+AlignOperands: true
+AlignTrailingComments: true
+AllowAllParametersOfDeclarationOnNextLine: true
+AllowShortBlocksOnASingleLine: true
+AllowShortCaseLabelsOnASingleLine: false
+AllowShortFunctionsOnASingleLine: Empty
+AllowShortIfStatementsOnASingleLine: false
+AllowShortLoopsOnASingleLine: false
+AlwaysBreakAfterDefinitionReturnType: None
+AlwaysBreakAfterReturnType: None
+AlwaysBreakBeforeMultilineStrings: false
+AlwaysBreakTemplateDeclarations: true
+BinPackArguments: true
+BinPackParameters: true
+BraceWrapping:
+ AfterClass: true
+ AfterControlStatement: true
+ AfterEnum: true
+ AfterFunction: true
+ AfterNamespace: false
+ AfterObjCDeclaration: true
+ AfterStruct: true
+ AfterUnion: true
+ BeforeCatch: true
+ BeforeElse: true
+ IndentBraces: false
+ SplitEmptyFunction: false
+ SplitEmptyRecord: false
+ SplitEmptyNamespace: false
+BreakBeforeBinaryOperators: None
+BreakBeforeBraces: Custom
+BreakBeforeInheritanceComma: false
+BreakBeforeTernaryOperators: true
+BreakConstructorInitializersBeforeComma: true
+BreakConstructorInitializers: BeforeColon
+BreakAfterJavaFieldAnnotations: false
+BreakStringLiterals: true
+ColumnLimit: 140
+CommentPragmas: '^ IWYU pragma:'
+CompactNamespaces: false
+ConstructorInitializerAllOnOneLineOrOnePerLine: false
+ConstructorInitializerIndentWidth: 4
+ContinuationIndentWidth: 4
+Cpp11BracedListStyle: true
+DerivePointerAlignment: false
+DisableFormat: false
+ExperimentalAutoDetectBinPacking: false
+FixNamespaceComments: true
+ForEachMacros:
+ - foreach
+ - Q_FOREACH
+ - BOOST_FOREACH
+IncludeCategories:
+ - Regex: '^"(llvm|llvm-c|clang|clang-c)/'
+ Priority: 2
+ - Regex: '^(<|"(gtest|gmock|isl|json)/)'
+ Priority: 3
+ - Regex: '.*'
+ Priority: 1
+IncludeIsMainRegex: '(Test)?$'
+IndentCaseLabels: false
+IndentWidth: 4
+IndentWrappedFunctionNames: false
+JavaScriptQuotes: Leave
+JavaScriptWrapImports: true
+KeepEmptyLinesAtTheStartOfBlocks: true
+MacroBlockBegin: ''
+MacroBlockEnd: ''
+MaxEmptyLinesToKeep: 1
+NamespaceIndentation: None
+ObjCBlockIndentWidth: 2
+ObjCSpaceAfterProperty: false
+ObjCSpaceBeforeProtocolList: true
+PenaltyBreakAssignment: 2
+PenaltyBreakBeforeFirstCallParameter: 19
+PenaltyBreakComment: 300
+PenaltyBreakFirstLessLess: 120
+PenaltyBreakString: 1000
+PenaltyExcessCharacter: 1000000
+PenaltyReturnTypeOnItsOwnLine: 60
+PointerAlignment: Right
+ReflowComments: true
+SortIncludes: false
+SortUsingDeclarations: true
+SpaceAfterCStyleCast: false
+SpaceAfterTemplateKeyword: false
+SpaceBeforeAssignmentOperators: true
+SpaceBeforeParens: ControlStatements
+SpaceInEmptyParentheses: false
+SpacesBeforeTrailingComments: 1
+SpacesInAngles: false
+SpacesInContainerLiterals: true
+SpacesInCStyleCastParentheses: false
+SpacesInParentheses: false
+SpacesInSquareBrackets: false
+Standard: Cpp11
+TabWidth: 8
+UseTab: Never
+...
+
--- /dev/null
+Checks: '\
+cppcoreguidelines-*,\
+performance-*,\
+-performance-unnecessary-value-param,\
+modernize-*,\
+-modernize-use-trailing-return-type,\
+google-*,\
+-google-runtime-references,\
+misc-*,\
+-misc-non-private-member-variables-in-classes,\
+cert-*,\
+readability-*,\
+clang-analyzer-*'
+
+WarningsAsErrors: ''
+HeaderFilterRegex: 'async.h|async_logger.h|common.h|details|formatter.h|logger.h|sinks|spdlog.h|tweakme.h|version.h'
+AnalyzeTemporaryDtors: false
+FormatStyle: none
+
+CheckOptions:
+ - key: google-readability-braces-around-statements.ShortStatementLines
+ value: '1'
+ - key: google-readability-function-size.StatementThreshold
+ value: '800'
+ - key: google-readability-namespace-comments.ShortNamespaceLines
+ value: '10'
+ - key: google-readability-namespace-comments.SpacesBeforeComments
+ value: '2'
+ - key: modernize-loop-convert.MaxCopySize
+ value: '16'
+ - key: modernize-loop-convert.MinConfidence
+ value: reasonable
+ - key: modernize-loop-convert.NamingStyle
+ value: CamelCase
+ - key: modernize-pass-by-value.IncludeStyle
+ value: llvm
+ - key: modernize-replace-auto-ptr.IncludeStyle
+ value: llvm
+ - key: modernize-use-nullptr.NullMacros
+ value: 'NULL'
+
--- /dev/null
+#!/bin/bash
+
+cd "$(dirname "$0")"
+
+clang-tidy ../example/example.cpp -- -I ../include
--- /dev/null
+#!/usr/bin/env python3
+
+import os
+import re
+
+base_path = os.path.abspath(os.path.join(os.path.dirname(__file__), '..'))
+config_h = os.path.join(base_path, 'include', 'spdlog', 'version.h')
+data = {'MAJOR': 0, 'MINOR': 0, 'PATCH': 0}
+reg = re.compile(r'^\s*#define\s+SPDLOG_VER_([A-Z]+)\s+([0-9]+).*$')
+
+with open(config_h, 'r') as fp:
+ for l in fp:
+ m = reg.match(l)
+ if m:
+ data[m.group(1)] = int(m.group(2))
+
+print('{}.{}.{}'.format(data['MAJOR'], data['MINOR'], data['PATCH']))
--- /dev/null
+#!/bin/bash
+
+cd "$(dirname "$0")"
+
+echo -n "Running dos2unix "
+find .. -name "*\.h" -o -name "*\.cpp"|grep -v bundled|xargs -I {} sh -c "dos2unix '{}' 2>/dev/null; echo -n '.'"
+echo
+echo -n "Running clang-format "
+find .. -name "*\.h" -o -name "*\.cpp"|grep -v bundled|xargs -I {} sh -c "clang-format -i {}; echo -n '.'"
+echo
+
+
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#ifndef SPDLOG_COMPILED_LIB
+#error Please define SPDLOG_COMPILED_LIB to compile this file.
+#endif
+
+#include "spdlog/async.h"
+#include "spdlog/async_logger-inl.h"
+#include "spdlog/details/periodic_worker-inl.h"
+#include "spdlog/details/thread_pool-inl.h"
+template class spdlog::details::mpmc_blocking_queue<spdlog::details::async_msg>;
\ No newline at end of file
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#ifndef SPDLOG_COMPILED_LIB
+#error Please define SPDLOG_COMPILED_LIB to compile this file.
+#endif
+
+#include <mutex>
+
+#include "spdlog/details/null_mutex.h"
+#include "spdlog/async.h"
+//
+// color sinks
+//
+#ifdef _WIN32
+#include "spdlog/sinks/wincolor_sink-inl.h"
+template class spdlog::sinks::wincolor_sink<spdlog::details::console_mutex>;
+template class spdlog::sinks::wincolor_sink<spdlog::details::console_nullmutex>;
+template class spdlog::sinks::wincolor_stdout_sink<spdlog::details::console_mutex>;
+template class spdlog::sinks::wincolor_stdout_sink<spdlog::details::console_nullmutex>;
+template class spdlog::sinks::wincolor_stderr_sink<spdlog::details::console_mutex>;
+template class spdlog::sinks::wincolor_stderr_sink<spdlog::details::console_nullmutex>;
+#else
+#include "spdlog/sinks/ansicolor_sink-inl.h"
+template class spdlog::sinks::ansicolor_sink<spdlog::details::console_mutex>;
+template class spdlog::sinks::ansicolor_sink<spdlog::details::console_nullmutex>;
+template class spdlog::sinks::ansicolor_stdout_sink<spdlog::details::console_mutex>;
+template class spdlog::sinks::ansicolor_stdout_sink<spdlog::details::console_nullmutex>;
+template class spdlog::sinks::ansicolor_stderr_sink<spdlog::details::console_mutex>;
+template class spdlog::sinks::ansicolor_stderr_sink<spdlog::details::console_nullmutex>;
+#endif
+
+// factory methods for color loggers
+#include "spdlog/sinks/stdout_color_sinks-inl.h"
+template std::shared_ptr<spdlog::logger> spdlog::stdout_color_mt<spdlog::synchronous_factory>(
+ const std::string &logger_name, color_mode mode);
+template std::shared_ptr<spdlog::logger> spdlog::stdout_color_st<spdlog::synchronous_factory>(
+ const std::string &logger_name, color_mode mode);
+template std::shared_ptr<spdlog::logger> spdlog::stderr_color_mt<spdlog::synchronous_factory>(
+ const std::string &logger_name, color_mode mode);
+template std::shared_ptr<spdlog::logger> spdlog::stderr_color_st<spdlog::synchronous_factory>(
+ const std::string &logger_name, color_mode mode);
+
+template std::shared_ptr<spdlog::logger> spdlog::stdout_color_mt<spdlog::async_factory>(const std::string &logger_name, color_mode mode);
+template std::shared_ptr<spdlog::logger> spdlog::stdout_color_st<spdlog::async_factory>(const std::string &logger_name, color_mode mode);
+template std::shared_ptr<spdlog::logger> spdlog::stderr_color_mt<spdlog::async_factory>(const std::string &logger_name, color_mode mode);
+template std::shared_ptr<spdlog::logger> spdlog::stderr_color_st<spdlog::async_factory>(const std::string &logger_name, color_mode mode);
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#ifndef SPDLOG_COMPILED_LIB
+#error Please define SPDLOG_COMPILED_LIB to compile this file.
+#endif
+
+#include <mutex>
+#include "spdlog/details/null_mutex.h"
+#include "spdlog/details/file_helper-inl.h"
+#include "spdlog/sinks/basic_file_sink-inl.h"
+
+template class spdlog::sinks::basic_file_sink<std::mutex>;
+template class spdlog::sinks::basic_file_sink<spdlog::details::null_mutex>;
+
+#include "spdlog/sinks/rotating_file_sink-inl.h"
+template class spdlog::sinks::rotating_file_sink<std::mutex>;
+template class spdlog::sinks::rotating_file_sink<spdlog::details::null_mutex>;
\ No newline at end of file
--- /dev/null
+#ifndef SPDLOG_COMPILED_LIB
+#error Please define SPDLOG_COMPILED_LIB to compile this file.
+#endif
+
+// Slightly modified version of fmt lib's format.cc source file.
+// Copyright (c) 2012 - 2016, Victor Zverovich
+// All rights reserved.
+
+#if !defined(SPDLOG_FMT_EXTERNAL)
+#include "spdlog/fmt/bundled/format-inl.h"
+
+
+FMT_BEGIN_NAMESPACE
+ namespace internal {
+
+ template <typename T>
+ int format_float(char* buf, std::size_t size, const char* format, int precision,
+ T value) {
+#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION
+ if (precision > 100000)
+ throw std::runtime_error(
+ "fuzz mode - avoid large allocation inside snprintf");
+#endif
+ // Suppress the warning about nonliteral format string.
+ auto snprintf_ptr = FMT_SNPRINTF;
+ return precision < 0 ? snprintf_ptr(buf, size, format, value)
+ : snprintf_ptr(buf, size, format, precision, value);
+ }
+ struct sprintf_specs {
+ int precision;
+ char type;
+ bool alt : 1;
+
+ template <typename Char>
+ constexpr sprintf_specs(basic_format_specs<Char> specs)
+ : precision(specs.precision), type(specs.type), alt(specs.alt) {}
+
+ constexpr bool has_precision() const { return precision >= 0; }
+ };
+
+// This is deprecated and is kept only to preserve ABI compatibility.
+ template <typename Double>
+ char* sprintf_format(Double value, internal::buffer<char>& buf,
+ sprintf_specs specs) {
+ // Buffer capacity must be non-zero, otherwise MSVC's vsnprintf_s will fail.
+ FMT_ASSERT(buf.capacity() != 0, "empty buffer");
+
+ // Build format string.
+ enum { max_format_size = 10 }; // longest format: %#-*.*Lg
+ char format[max_format_size];
+ char* format_ptr = format;
+ *format_ptr++ = '%';
+ if (specs.alt || !specs.type) *format_ptr++ = '#';
+ if (specs.precision >= 0) {
+ *format_ptr++ = '.';
+ *format_ptr++ = '*';
+ }
+ if (std::is_same<Double, long double>::value) *format_ptr++ = 'L';
+
+ char type = specs.type;
+
+ if (type == '%')
+ type = 'f';
+ else if (type == 0 || type == 'n')
+ type = 'g';
+#if FMT_MSC_VER
+ if (type == 'F') {
+ // MSVC's printf doesn't support 'F'.
+ type = 'f';
+ }
+#endif
+ *format_ptr++ = type;
+ *format_ptr = '\0';
+
+ // Format using snprintf.
+ char* start = nullptr;
+ char* decimal_point_pos = nullptr;
+ for (;;) {
+ std::size_t buffer_size = buf.capacity();
+ start = &buf[0];
+ int result =
+ format_float(start, buffer_size, format, specs.precision, value);
+ if (result >= 0) {
+ unsigned n = internal::to_unsigned(result);
+ if (n < buf.capacity()) {
+ // Find the decimal point.
+ auto p = buf.data(), end = p + n;
+ if (*p == '+' || *p == '-') ++p;
+ if (specs.type != 'a' && specs.type != 'A') {
+ while (p < end && *p >= '0' && *p <= '9') ++p;
+ if (p < end && *p != 'e' && *p != 'E') {
+ decimal_point_pos = p;
+ if (!specs.type) {
+ // Keep only one trailing zero after the decimal point.
+ ++p;
+ if (*p == '0') ++p;
+ while (p != end && *p >= '1' && *p <= '9') ++p;
+ char* where = p;
+ while (p != end && *p == '0') ++p;
+ if (p == end || *p < '0' || *p > '9') {
+ if (p != end) std::memmove(where, p, to_unsigned(end - p));
+ n -= static_cast<unsigned>(p - where);
+ }
+ }
+ }
+ }
+ buf.resize(n);
+ break; // The buffer is large enough - continue with formatting.
+ }
+ buf.reserve(n + 1);
+ } else {
+ // If result is negative we ask to increase the capacity by at least 1,
+ // but as std::vector, the buffer grows exponentially.
+ buf.reserve(buf.capacity() + 1);
+ }
+ }
+ return decimal_point_pos;
+ }
+ } // namespace internal
+
+ template FMT_API char* internal::sprintf_format(double, internal::buffer<char>&,
+ sprintf_specs);
+ template FMT_API char* internal::sprintf_format(long double,
+ internal::buffer<char>&,
+ sprintf_specs);
+
+ template struct FMT_API internal::basic_data<void>;
+
+// Workaround a bug in MSVC2013 that prevents instantiation of format_float.
+ int (*instantiate_format_float)(double, int, internal::float_specs,
+ internal::buffer<char>&) =
+ internal::format_float;
+
+#ifndef FMT_STATIC_THOUSANDS_SEPARATOR
+ template FMT_API internal::locale_ref::locale_ref(const std::locale& loc);
+ template FMT_API std::locale internal::locale_ref::get<std::locale>() const;
+#endif
+
+// Explicit instantiations for char.
+
+ template FMT_API std::string internal::grouping_impl<char>(locale_ref);
+ template FMT_API char internal::thousands_sep_impl(locale_ref);
+ template FMT_API char internal::decimal_point_impl(locale_ref);
+
+ template FMT_API void internal::buffer<char>::append(const char*, const char*);
+
+ template FMT_API void internal::arg_map<format_context>::init(
+ const basic_format_args<format_context>& args);
+
+ template FMT_API std::string internal::vformat<char>(
+ string_view, basic_format_args<format_context>);
+
+ template FMT_API format_context::iterator internal::vformat_to(
+ internal::buffer<char>&, string_view, basic_format_args<format_context>);
+
+ template FMT_API int internal::snprintf_float(double, int,
+ internal::float_specs,
+ internal::buffer<char>&);
+ template FMT_API int internal::snprintf_float(long double, int,
+ internal::float_specs,
+ internal::buffer<char>&);
+ template FMT_API int internal::format_float(double, int, internal::float_specs,
+ internal::buffer<char>&);
+ template FMT_API int internal::format_float(long double, int,
+ internal::float_specs,
+ internal::buffer<char>&);
+
+// Explicit instantiations for wchar_t.
+
+ template FMT_API std::string internal::grouping_impl<wchar_t>(locale_ref);
+ template FMT_API wchar_t internal::thousands_sep_impl(locale_ref);
+ template FMT_API wchar_t internal::decimal_point_impl(locale_ref);
+
+ template FMT_API void internal::buffer<wchar_t>::append(const wchar_t*,
+ const wchar_t*);
+
+ template FMT_API std::wstring internal::vformat<wchar_t>(
+ wstring_view, basic_format_args<wformat_context>);
+FMT_END_NAMESPACE
+
+
+#endif
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#ifndef SPDLOG_COMPILED_LIB
+#error Please define SPDLOG_COMPILED_LIB to compile this file.
+#endif
+
+#include "spdlog/spdlog-inl.h"
+#include "spdlog/common-inl.h"
+#include "spdlog/details/backtracer-inl.h"
+#include "spdlog/details/registry-inl.h"
+#include "spdlog/details/os-inl.h"
+#include "spdlog/details/pattern_formatter-inl.h"
+#include "spdlog/details/log_msg-inl.h"
+#include "spdlog/details/log_msg_buffer-inl.h"
+#include "spdlog/logger-inl.h"
+#include "spdlog/sinks/sink-inl.h"
+#include "spdlog/sinks/base_sink-inl.h"
+#include "spdlog/details/null_mutex.h"
+
+#include <mutex>
+
+// template instantiate logger constructor with sinks init list
+template spdlog::logger::logger(std::string name, sinks_init_list::iterator begin, sinks_init_list::iterator end);
+template class spdlog::sinks::base_sink<std::mutex>;
+template class spdlog::sinks::base_sink<spdlog::details::null_mutex>;
\ No newline at end of file
--- /dev/null
+// Copyright(c) 2015-present, Gabi Melman & spdlog contributors.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+
+#ifndef SPDLOG_COMPILED_LIB
+#error Please define SPDLOG_COMPILED_LIB to compile this file.
+#endif
+
+#include <mutex>
+
+#include "spdlog/details/null_mutex.h"
+#include "spdlog/async.h"
+#include "spdlog/sinks/stdout_sinks-inl.h"
+
+template class spdlog::sinks::stdout_sink_base<spdlog::details::console_mutex>;
+template class spdlog::sinks::stdout_sink_base<spdlog::details::console_nullmutex>;
+template class spdlog::sinks::stdout_sink<spdlog::details::console_mutex>;
+template class spdlog::sinks::stdout_sink<spdlog::details::console_nullmutex>;
+template class spdlog::sinks::stderr_sink<spdlog::details::console_mutex>;
+template class spdlog::sinks::stderr_sink<spdlog::details::console_nullmutex>;
+
+template std::shared_ptr<spdlog::logger> spdlog::stdout_logger_mt<spdlog::synchronous_factory>(const std::string &logger_name);
+template std::shared_ptr<spdlog::logger> spdlog::stdout_logger_st<spdlog::synchronous_factory>(const std::string &logger_name);
+template std::shared_ptr<spdlog::logger> spdlog::stderr_logger_mt<spdlog::synchronous_factory>(const std::string &logger_name);
+template std::shared_ptr<spdlog::logger> spdlog::stderr_logger_st<spdlog::synchronous_factory>(const std::string &logger_name);
+
+template std::shared_ptr<spdlog::logger> spdlog::stdout_logger_mt<spdlog::async_factory>(const std::string &logger_name);
+template std::shared_ptr<spdlog::logger> spdlog::stdout_logger_st<spdlog::async_factory>(const std::string &logger_name);
+template std::shared_ptr<spdlog::logger> spdlog::stderr_logger_mt<spdlog::async_factory>(const std::string &logger_name);
+template std::shared_ptr<spdlog::logger> spdlog::stderr_logger_st<spdlog::async_factory>(const std::string &logger_name);
\ No newline at end of file
--- /dev/null
+project(spdlog_utests CXX)
+
+include(../cmake/utils.cmake)
+
+find_package(PkgConfig)
+if(PkgConfig_FOUND)
+ pkg_check_modules(systemd libsystemd)
+endif()
+
+set(SPDLOG_UTESTS_SOURCES
+ test_file_helper.cpp
+ test_file_logging.cpp
+ test_daily_logger.cpp
+ test_misc.cpp
+ test_pattern_formatter.cpp
+ test_async.cpp
+ test_registry.cpp
+ test_macros.cpp
+ utils.cpp
+ main.cpp
+ test_mpmc_q.cpp
+ test_dup_filter.cpp
+ test_fmt_helper.cpp
+ test_stdout_api.cpp
+ test_backtrace.cpp
+ test_create_dir.cpp)
+
+if(NOT SPDLOG_NO_EXCEPTIONS)
+ list(APPEND SPDLOG_UTESTS_SOURCES test_errors.cpp)
+endif()
+
+if(systemd_FOUND)
+ list(APPEND SPDLOG_UTESTS_SOURCES test_systemd.cpp)
+endif()
+
+
+enable_testing()
+
+function(spdlog_prepare_test test_target spdlog_lib)
+ add_executable(${test_target} ${SPDLOG_UTESTS_SOURCES})
+ spdlog_enable_warnings(${test_target})
+ target_link_libraries(${test_target} PRIVATE ${spdlog_lib})
+ if(systemd_FOUND)
+ target_link_libraries(${test_target} PRIVATE ${systemd_LIBRARIES})
+ endif()
+ if(SPDLOG_SANITIZE_ADDRESS)
+ spdlog_enable_sanitizer(${test_target})
+ endif()
+ add_test(NAME ${test_target} COMMAND ${test_target})
+endfunction()
+
+# The compiled library tests
+if(SPDLOG_BUILD_TESTS)
+ spdlog_prepare_test(spdlog-utests spdlog::spdlog)
+endif()
+
+# The header-only library version tests
+if(SPDLOG_BUILD_TESTS_HO)
+ spdlog_prepare_test(spdlog-utests-ho spdlog::spdlog_header_only)
+endif()
--- /dev/null
+/*
+ * Catch v2.8.0
+ * Generated: 2019-05-26 21:29:22.235281
+ * ----------------------------------------------------------
+ * This file has been merged from multiple headers. Please don't edit it directly
+ * Copyright (c) 2019 Two Blue Cubes Ltd. All rights reserved.
+ *
+ * Distributed under the Boost Software License, Version 1.0. (See accompanying
+ * file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
+ */
+#ifndef TWOBLUECUBES_SINGLE_INCLUDE_CATCH_HPP_INCLUDED
+#define TWOBLUECUBES_SINGLE_INCLUDE_CATCH_HPP_INCLUDED
+// start catch.hpp
+
+
+#define CATCH_VERSION_MAJOR 2
+#define CATCH_VERSION_MINOR 8
+#define CATCH_VERSION_PATCH 0
+
+#ifdef __clang__
+# pragma clang system_header
+#elif defined __GNUC__
+# pragma GCC system_header
+#endif
+
+// start catch_suppress_warnings.h
+
+#ifdef __clang__
+# ifdef __ICC // icpc defines the __clang__ macro
+# pragma warning(push)
+# pragma warning(disable: 161 1682)
+# else // __ICC
+# pragma clang diagnostic push
+# pragma clang diagnostic ignored "-Wpadded"
+# pragma clang diagnostic ignored "-Wswitch-enum"
+# pragma clang diagnostic ignored "-Wcovered-switch-default"
+# endif
+#elif defined __GNUC__
+ // Because REQUIREs trigger GCC's -Wparentheses, and because still
+ // supported version of g++ have only buggy support for _Pragmas,
+ // Wparentheses have to be suppressed globally.
+# pragma GCC diagnostic ignored "-Wparentheses" // See #674 for details
+
+# pragma GCC diagnostic push
+# pragma GCC diagnostic ignored "-Wunused-variable"
+# pragma GCC diagnostic ignored "-Wpadded"
+#endif
+// end catch_suppress_warnings.h
+#if defined(CATCH_CONFIG_MAIN) || defined(CATCH_CONFIG_RUNNER)
+# define CATCH_IMPL
+# define CATCH_CONFIG_ALL_PARTS
+#endif
+
+// In the impl file, we want to have access to all parts of the headers
+// Can also be used to sanely support PCHs
+#if defined(CATCH_CONFIG_ALL_PARTS)
+# define CATCH_CONFIG_EXTERNAL_INTERFACES
+# if defined(CATCH_CONFIG_DISABLE_MATCHERS)
+# undef CATCH_CONFIG_DISABLE_MATCHERS
+# endif
+# if !defined(CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER)
+# define CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER
+# endif
+#endif
+
+#if !defined(CATCH_CONFIG_IMPL_ONLY)
+// start catch_platform.h
+
+#ifdef __APPLE__
+# include <TargetConditionals.h>
+# if TARGET_OS_OSX == 1
+# define CATCH_PLATFORM_MAC
+# elif TARGET_OS_IPHONE == 1
+# define CATCH_PLATFORM_IPHONE
+# endif
+
+#elif defined(linux) || defined(__linux) || defined(__linux__)
+# define CATCH_PLATFORM_LINUX
+
+#elif defined(WIN32) || defined(__WIN32__) || defined(_WIN32) || defined(_MSC_VER) || defined(__MINGW32__)
+# define CATCH_PLATFORM_WINDOWS
+#endif
+
+// end catch_platform.h
+
+#ifdef CATCH_IMPL
+# ifndef CLARA_CONFIG_MAIN
+# define CLARA_CONFIG_MAIN_NOT_DEFINED
+# define CLARA_CONFIG_MAIN
+# endif
+#endif
+
+// start catch_user_interfaces.h
+
+namespace Catch {
+ unsigned int rngSeed();
+}
+
+// end catch_user_interfaces.h
+// start catch_tag_alias_autoregistrar.h
+
+// start catch_common.h
+
+// start catch_compiler_capabilities.h
+
+// Detect a number of compiler features - by compiler
+// The following features are defined:
+//
+// CATCH_CONFIG_COUNTER : is the __COUNTER__ macro supported?
+// CATCH_CONFIG_WINDOWS_SEH : is Windows SEH supported?
+// CATCH_CONFIG_POSIX_SIGNALS : are POSIX signals supported?
+// CATCH_CONFIG_DISABLE_EXCEPTIONS : Are exceptions enabled?
+// ****************
+// Note to maintainers: if new toggles are added please document them
+// in configuration.md, too
+// ****************
+
+// In general each macro has a _NO_<feature name> form
+// (e.g. CATCH_CONFIG_NO_POSIX_SIGNALS) which disables the feature.
+// Many features, at point of detection, define an _INTERNAL_ macro, so they
+// can be combined, en-mass, with the _NO_ forms later.
+
+#ifdef __cplusplus
+
+# if (__cplusplus >= 201402L) || (defined(_MSVC_LANG) && _MSVC_LANG >= 201402L)
+# define CATCH_CPP14_OR_GREATER
+# endif
+
+# if (__cplusplus >= 201703L) || (defined(_MSVC_LANG) && _MSVC_LANG >= 201703L)
+# define CATCH_CPP17_OR_GREATER
+# endif
+
+#endif
+
+#if defined(CATCH_CPP17_OR_GREATER)
+# define CATCH_INTERNAL_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS
+#endif
+
+#ifdef __clang__
+
+# define CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ _Pragma( "clang diagnostic push" ) \
+ _Pragma( "clang diagnostic ignored \"-Wexit-time-destructors\"" ) \
+ _Pragma( "clang diagnostic ignored \"-Wglobal-constructors\"")
+# define CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ _Pragma( "clang diagnostic pop" )
+
+# define CATCH_INTERNAL_SUPPRESS_PARENTHESES_WARNINGS \
+ _Pragma( "clang diagnostic push" ) \
+ _Pragma( "clang diagnostic ignored \"-Wparentheses\"" )
+# define CATCH_INTERNAL_UNSUPPRESS_PARENTHESES_WARNINGS \
+ _Pragma( "clang diagnostic pop" )
+
+# define CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS \
+ _Pragma( "clang diagnostic push" ) \
+ _Pragma( "clang diagnostic ignored \"-Wunused-variable\"" )
+# define CATCH_INTERNAL_UNSUPPRESS_UNUSED_WARNINGS \
+ _Pragma( "clang diagnostic pop" )
+
+# define CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \
+ _Pragma( "clang diagnostic push" ) \
+ _Pragma( "clang diagnostic ignored \"-Wgnu-zero-variadic-macro-arguments\"" )
+# define CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS \
+ _Pragma( "clang diagnostic pop" )
+
+#endif // __clang__
+
+////////////////////////////////////////////////////////////////////////////////
+// Assume that non-Windows platforms support posix signals by default
+#if !defined(CATCH_PLATFORM_WINDOWS)
+ #define CATCH_INTERNAL_CONFIG_POSIX_SIGNALS
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// We know some environments not to support full POSIX signals
+#if defined(__CYGWIN__) || defined(__QNX__) || defined(__EMSCRIPTEN__) || defined(__DJGPP__)
+ #define CATCH_INTERNAL_CONFIG_NO_POSIX_SIGNALS
+#endif
+
+#ifdef __OS400__
+# define CATCH_INTERNAL_CONFIG_NO_POSIX_SIGNALS
+# define CATCH_CONFIG_COLOUR_NONE
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// Android somehow still does not support std::to_string
+#if defined(__ANDROID__)
+# define CATCH_INTERNAL_CONFIG_NO_CPP11_TO_STRING
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// Not all Windows environments support SEH properly
+#if defined(__MINGW32__)
+# define CATCH_INTERNAL_CONFIG_NO_WINDOWS_SEH
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// PS4
+#if defined(__ORBIS__)
+# define CATCH_INTERNAL_CONFIG_NO_NEW_CAPTURE
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// Cygwin
+#ifdef __CYGWIN__
+
+// Required for some versions of Cygwin to declare gettimeofday
+// see: http://stackoverflow.com/questions/36901803/gettimeofday-not-declared-in-this-scope-cygwin
+# define _BSD_SOURCE
+// some versions of cygwin (most) do not support std::to_string. Use the libstd check.
+// https://gcc.gnu.org/onlinedocs/gcc-4.8.2/libstdc++/api/a01053_source.html line 2812-2813
+# if !((__cplusplus >= 201103L) && defined(_GLIBCXX_USE_C99) \
+ && !defined(_GLIBCXX_HAVE_BROKEN_VSWPRINTF))
+
+# define CATCH_INTERNAL_CONFIG_NO_CPP11_TO_STRING
+
+# endif
+#endif // __CYGWIN__
+
+////////////////////////////////////////////////////////////////////////////////
+// Visual C++
+#ifdef _MSC_VER
+
+# if _MSC_VER >= 1900 // Visual Studio 2015 or newer
+# define CATCH_INTERNAL_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS
+# endif
+
+// Universal Windows platform does not support SEH
+// Or console colours (or console at all...)
+# if defined(WINAPI_FAMILY) && (WINAPI_FAMILY == WINAPI_FAMILY_APP)
+# define CATCH_CONFIG_COLOUR_NONE
+# else
+# define CATCH_INTERNAL_CONFIG_WINDOWS_SEH
+# endif
+
+// MSVC traditional preprocessor needs some workaround for __VA_ARGS__
+// _MSVC_TRADITIONAL == 0 means new conformant preprocessor
+// _MSVC_TRADITIONAL == 1 means old traditional non-conformant preprocessor
+# if !defined(_MSVC_TRADITIONAL) || (defined(_MSVC_TRADITIONAL) && _MSVC_TRADITIONAL)
+# define CATCH_INTERNAL_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+# endif
+
+#endif // _MSC_VER
+
+////////////////////////////////////////////////////////////////////////////////
+// Check if we are compiled with -fno-exceptions or equivalent
+#if defined(__EXCEPTIONS) || defined(__cpp_exceptions) || defined(_CPPUNWIND)
+# define CATCH_INTERNAL_CONFIG_EXCEPTIONS_ENABLED
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// DJGPP
+#ifdef __DJGPP__
+# define CATCH_INTERNAL_CONFIG_NO_WCHAR
+#endif // __DJGPP__
+
+////////////////////////////////////////////////////////////////////////////////
+// Embarcadero C++Build
+#if defined(__BORLANDC__)
+ #define CATCH_INTERNAL_CONFIG_POLYFILL_ISNAN
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+
+// Use of __COUNTER__ is suppressed during code analysis in
+// CLion/AppCode 2017.2.x and former, because __COUNTER__ is not properly
+// handled by it.
+// Otherwise all supported compilers support COUNTER macro,
+// but user still might want to turn it off
+#if ( !defined(__JETBRAINS_IDE__) || __JETBRAINS_IDE__ >= 20170300L )
+ #define CATCH_INTERNAL_CONFIG_COUNTER
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// Check if string_view is available and usable
+// The check is split apart to work around v140 (VS2015) preprocessor issue...
+#if defined(__has_include)
+#if __has_include(<string_view>) && defined(CATCH_CPP17_OR_GREATER)
+# define CATCH_INTERNAL_CONFIG_CPP17_STRING_VIEW
+#endif
+#endif
+
+////////////////////////////////////////////////////////////////////////////////
+// Check if optional is available and usable
+#if defined(__has_include)
+# if __has_include(<optional>) && defined(CATCH_CPP17_OR_GREATER)
+# define CATCH_INTERNAL_CONFIG_CPP17_OPTIONAL
+# endif // __has_include(<optional>) && defined(CATCH_CPP17_OR_GREATER)
+#endif // __has_include
+
+////////////////////////////////////////////////////////////////////////////////
+// Check if variant is available and usable
+#if defined(__has_include)
+# if __has_include(<variant>) && defined(CATCH_CPP17_OR_GREATER)
+# if defined(__clang__) && (__clang_major__ < 8)
+ // work around clang bug with libstdc++ https://bugs.llvm.org/show_bug.cgi?id=31852
+ // fix should be in clang 8, workaround in libstdc++ 8.2
+# include <ciso646>
+# if defined(__GLIBCXX__) && defined(_GLIBCXX_RELEASE) && (_GLIBCXX_RELEASE < 9)
+# define CATCH_CONFIG_NO_CPP17_VARIANT
+# else
+# define CATCH_INTERNAL_CONFIG_CPP17_VARIANT
+# endif // defined(__GLIBCXX__) && defined(_GLIBCXX_RELEASE) && (_GLIBCXX_RELEASE < 9)
+# else
+# define CATCH_INTERNAL_CONFIG_CPP17_VARIANT
+# endif // defined(__clang__) && (__clang_major__ < 8)
+# endif // __has_include(<variant>) && defined(CATCH_CPP17_OR_GREATER)
+#endif // __has_include
+
+#if defined(CATCH_INTERNAL_CONFIG_COUNTER) && !defined(CATCH_CONFIG_NO_COUNTER) && !defined(CATCH_CONFIG_COUNTER)
+# define CATCH_CONFIG_COUNTER
+#endif
+#if defined(CATCH_INTERNAL_CONFIG_WINDOWS_SEH) && !defined(CATCH_CONFIG_NO_WINDOWS_SEH) && !defined(CATCH_CONFIG_WINDOWS_SEH) && !defined(CATCH_INTERNAL_CONFIG_NO_WINDOWS_SEH)
+# define CATCH_CONFIG_WINDOWS_SEH
+#endif
+// This is set by default, because we assume that unix compilers are posix-signal-compatible by default.
+#if defined(CATCH_INTERNAL_CONFIG_POSIX_SIGNALS) && !defined(CATCH_INTERNAL_CONFIG_NO_POSIX_SIGNALS) && !defined(CATCH_CONFIG_NO_POSIX_SIGNALS) && !defined(CATCH_CONFIG_POSIX_SIGNALS)
+# define CATCH_CONFIG_POSIX_SIGNALS
+#endif
+// This is set by default, because we assume that compilers with no wchar_t support are just rare exceptions.
+#if !defined(CATCH_INTERNAL_CONFIG_NO_WCHAR) && !defined(CATCH_CONFIG_NO_WCHAR) && !defined(CATCH_CONFIG_WCHAR)
+# define CATCH_CONFIG_WCHAR
+#endif
+
+#if !defined(CATCH_INTERNAL_CONFIG_NO_CPP11_TO_STRING) && !defined(CATCH_CONFIG_NO_CPP11_TO_STRING) && !defined(CATCH_CONFIG_CPP11_TO_STRING)
+# define CATCH_CONFIG_CPP11_TO_STRING
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_CPP17_OPTIONAL) && !defined(CATCH_CONFIG_NO_CPP17_OPTIONAL) && !defined(CATCH_CONFIG_CPP17_OPTIONAL)
+# define CATCH_CONFIG_CPP17_OPTIONAL
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS) && !defined(CATCH_CONFIG_NO_CPP17_UNCAUGHT_EXCEPTIONS) && !defined(CATCH_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS)
+# define CATCH_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_CPP17_STRING_VIEW) && !defined(CATCH_CONFIG_NO_CPP17_STRING_VIEW) && !defined(CATCH_CONFIG_CPP17_STRING_VIEW)
+# define CATCH_CONFIG_CPP17_STRING_VIEW
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_CPP17_VARIANT) && !defined(CATCH_CONFIG_NO_CPP17_VARIANT) && !defined(CATCH_CONFIG_CPP17_VARIANT)
+# define CATCH_CONFIG_CPP17_VARIANT
+#endif
+
+#if defined(CATCH_CONFIG_EXPERIMENTAL_REDIRECT)
+# define CATCH_INTERNAL_CONFIG_NEW_CAPTURE
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_NEW_CAPTURE) && !defined(CATCH_INTERNAL_CONFIG_NO_NEW_CAPTURE) && !defined(CATCH_CONFIG_NO_NEW_CAPTURE) && !defined(CATCH_CONFIG_NEW_CAPTURE)
+# define CATCH_CONFIG_NEW_CAPTURE
+#endif
+
+#if !defined(CATCH_INTERNAL_CONFIG_EXCEPTIONS_ENABLED) && !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+# define CATCH_CONFIG_DISABLE_EXCEPTIONS
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_POLYFILL_ISNAN) && !defined(CATCH_CONFIG_NO_POLYFILL_ISNAN) && !defined(CATCH_CONFIG_POLYFILL_ISNAN)
+# define CATCH_CONFIG_POLYFILL_ISNAN
+#endif
+
+#if !defined(CATCH_INTERNAL_SUPPRESS_PARENTHESES_WARNINGS)
+# define CATCH_INTERNAL_SUPPRESS_PARENTHESES_WARNINGS
+# define CATCH_INTERNAL_UNSUPPRESS_PARENTHESES_WARNINGS
+#endif
+#if !defined(CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS)
+# define CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS
+# define CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS
+#endif
+#if !defined(CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS)
+# define CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS
+# define CATCH_INTERNAL_UNSUPPRESS_UNUSED_WARNINGS
+#endif
+#if !defined(CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS)
+# define CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS
+# define CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS
+#endif
+
+#if defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+#define CATCH_TRY if ((true))
+#define CATCH_CATCH_ALL if ((false))
+#define CATCH_CATCH_ANON(type) if ((false))
+#else
+#define CATCH_TRY try
+#define CATCH_CATCH_ALL catch (...)
+#define CATCH_CATCH_ANON(type) catch (type)
+#endif
+
+#if defined(CATCH_INTERNAL_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR) && !defined(CATCH_CONFIG_NO_TRADITIONAL_MSVC_PREPROCESSOR) && !defined(CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR)
+#define CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#endif
+
+// end catch_compiler_capabilities.h
+#define INTERNAL_CATCH_UNIQUE_NAME_LINE2( name, line ) name##line
+#define INTERNAL_CATCH_UNIQUE_NAME_LINE( name, line ) INTERNAL_CATCH_UNIQUE_NAME_LINE2( name, line )
+#ifdef CATCH_CONFIG_COUNTER
+# define INTERNAL_CATCH_UNIQUE_NAME( name ) INTERNAL_CATCH_UNIQUE_NAME_LINE( name, __COUNTER__ )
+#else
+# define INTERNAL_CATCH_UNIQUE_NAME( name ) INTERNAL_CATCH_UNIQUE_NAME_LINE( name, __LINE__ )
+#endif
+
+#include <iosfwd>
+#include <string>
+#include <cstdint>
+
+// We need a dummy global operator<< so we can bring it into Catch namespace later
+struct Catch_global_namespace_dummy {};
+std::ostream& operator<<(std::ostream&, Catch_global_namespace_dummy);
+
+namespace Catch {
+
+ struct CaseSensitive { enum Choice {
+ Yes,
+ No
+ }; };
+
+ class NonCopyable {
+ NonCopyable( NonCopyable const& ) = delete;
+ NonCopyable( NonCopyable && ) = delete;
+ NonCopyable& operator = ( NonCopyable const& ) = delete;
+ NonCopyable& operator = ( NonCopyable && ) = delete;
+
+ protected:
+ NonCopyable();
+ virtual ~NonCopyable();
+ };
+
+ struct SourceLineInfo {
+
+ SourceLineInfo() = delete;
+ SourceLineInfo( char const* _file, std::size_t _line ) noexcept
+ : file( _file ),
+ line( _line )
+ {}
+
+ SourceLineInfo( SourceLineInfo const& other ) = default;
+ SourceLineInfo& operator = ( SourceLineInfo const& ) = default;
+ SourceLineInfo( SourceLineInfo&& ) noexcept = default;
+ SourceLineInfo& operator = ( SourceLineInfo&& ) noexcept = default;
+
+ bool empty() const noexcept;
+ bool operator == ( SourceLineInfo const& other ) const noexcept;
+ bool operator < ( SourceLineInfo const& other ) const noexcept;
+
+ char const* file;
+ std::size_t line;
+ };
+
+ std::ostream& operator << ( std::ostream& os, SourceLineInfo const& info );
+
+ // Bring in operator<< from global namespace into Catch namespace
+ // This is necessary because the overload of operator<< above makes
+ // lookup stop at namespace Catch
+ using ::operator<<;
+
+ // Use this in variadic streaming macros to allow
+ // >> +StreamEndStop
+ // as well as
+ // >> stuff +StreamEndStop
+ struct StreamEndStop {
+ std::string operator+() const;
+ };
+ template<typename T>
+ T const& operator + ( T const& value, StreamEndStop ) {
+ return value;
+ }
+}
+
+#define CATCH_INTERNAL_LINEINFO \
+ ::Catch::SourceLineInfo( __FILE__, static_cast<std::size_t>( __LINE__ ) )
+
+// end catch_common.h
+namespace Catch {
+
+ struct RegistrarForTagAliases {
+ RegistrarForTagAliases( char const* alias, char const* tag, SourceLineInfo const& lineInfo );
+ };
+
+} // end namespace Catch
+
+#define CATCH_REGISTER_TAG_ALIAS( alias, spec ) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ Catch::RegistrarForTagAliases INTERNAL_CATCH_UNIQUE_NAME( AutoRegisterTagAlias )( alias, spec, CATCH_INTERNAL_LINEINFO ); } \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS
+
+// end catch_tag_alias_autoregistrar.h
+// start catch_test_registry.h
+
+// start catch_interfaces_testcase.h
+
+#include <vector>
+
+namespace Catch {
+
+ class TestSpec;
+
+ struct ITestInvoker {
+ virtual void invoke () const = 0;
+ virtual ~ITestInvoker();
+ };
+
+ class TestCase;
+ struct IConfig;
+
+ struct ITestCaseRegistry {
+ virtual ~ITestCaseRegistry();
+ virtual std::vector<TestCase> const& getAllTests() const = 0;
+ virtual std::vector<TestCase> const& getAllTestsSorted( IConfig const& config ) const = 0;
+ };
+
+ bool matchTest( TestCase const& testCase, TestSpec const& testSpec, IConfig const& config );
+ std::vector<TestCase> filterTests( std::vector<TestCase> const& testCases, TestSpec const& testSpec, IConfig const& config );
+ std::vector<TestCase> const& getAllTestCasesSorted( IConfig const& config );
+
+}
+
+// end catch_interfaces_testcase.h
+// start catch_stringref.h
+
+#include <cstddef>
+#include <string>
+#include <iosfwd>
+
+namespace Catch {
+
+ /// A non-owning string class (similar to the forthcoming std::string_view)
+ /// Note that, because a StringRef may be a substring of another string,
+ /// it may not be null terminated. c_str() must return a null terminated
+ /// string, however, and so the StringRef will internally take ownership
+ /// (taking a copy), if necessary. In theory this ownership is not externally
+ /// visible - but it does mean (substring) StringRefs should not be shared between
+ /// threads.
+ class StringRef {
+ public:
+ using size_type = std::size_t;
+
+ private:
+ friend struct StringRefTestAccess;
+
+ char const* m_start;
+ size_type m_size;
+
+ char* m_data = nullptr;
+
+ void takeOwnership();
+
+ static constexpr char const* const s_empty = "";
+
+ public: // construction/ assignment
+ StringRef() noexcept
+ : StringRef( s_empty, 0 )
+ {}
+
+ StringRef( StringRef const& other ) noexcept
+ : m_start( other.m_start ),
+ m_size( other.m_size )
+ {}
+
+ StringRef( StringRef&& other ) noexcept
+ : m_start( other.m_start ),
+ m_size( other.m_size ),
+ m_data( other.m_data )
+ {
+ other.m_data = nullptr;
+ }
+
+ StringRef( char const* rawChars ) noexcept;
+
+ StringRef( char const* rawChars, size_type size ) noexcept
+ : m_start( rawChars ),
+ m_size( size )
+ {}
+
+ StringRef( std::string const& stdString ) noexcept
+ : m_start( stdString.c_str() ),
+ m_size( stdString.size() )
+ {}
+
+ ~StringRef() noexcept {
+ delete[] m_data;
+ }
+
+ auto operator = ( StringRef const &other ) noexcept -> StringRef& {
+ delete[] m_data;
+ m_data = nullptr;
+ m_start = other.m_start;
+ m_size = other.m_size;
+ return *this;
+ }
+
+ operator std::string() const;
+
+ void swap( StringRef& other ) noexcept;
+
+ public: // operators
+ auto operator == ( StringRef const& other ) const noexcept -> bool;
+ auto operator != ( StringRef const& other ) const noexcept -> bool;
+
+ auto operator[] ( size_type index ) const noexcept -> char;
+
+ public: // named queries
+ auto empty() const noexcept -> bool {
+ return m_size == 0;
+ }
+ auto size() const noexcept -> size_type {
+ return m_size;
+ }
+
+ auto numberOfCharacters() const noexcept -> size_type;
+ auto c_str() const -> char const*;
+
+ public: // substrings and searches
+ auto substr( size_type start, size_type size ) const noexcept -> StringRef;
+
+ // Returns the current start pointer.
+ // Note that the pointer can change when if the StringRef is a substring
+ auto currentData() const noexcept -> char const*;
+
+ private: // ownership queries - may not be consistent between calls
+ auto isOwned() const noexcept -> bool;
+ auto isSubstring() const noexcept -> bool;
+ };
+
+ auto operator + ( StringRef const& lhs, StringRef const& rhs ) -> std::string;
+ auto operator + ( StringRef const& lhs, char const* rhs ) -> std::string;
+ auto operator + ( char const* lhs, StringRef const& rhs ) -> std::string;
+
+ auto operator += ( std::string& lhs, StringRef const& sr ) -> std::string&;
+ auto operator << ( std::ostream& os, StringRef const& sr ) -> std::ostream&;
+
+ inline auto operator "" _sr( char const* rawChars, std::size_t size ) noexcept -> StringRef {
+ return StringRef( rawChars, size );
+ }
+
+} // namespace Catch
+
+inline auto operator "" _catch_sr( char const* rawChars, std::size_t size ) noexcept -> Catch::StringRef {
+ return Catch::StringRef( rawChars, size );
+}
+
+// end catch_stringref.h
+// start catch_type_traits.hpp
+
+
+#include <type_traits>
+
+namespace Catch{
+
+#ifdef CATCH_CPP17_OR_GREATER
+ template <typename...>
+ inline constexpr auto is_unique = std::true_type{};
+
+ template <typename T, typename... Rest>
+ inline constexpr auto is_unique<T, Rest...> = std::bool_constant<
+ (!std::is_same_v<T, Rest> && ...) && is_unique<Rest...>
+ >{};
+#else
+
+template <typename...>
+struct is_unique : std::true_type{};
+
+template <typename T0, typename T1, typename... Rest>
+struct is_unique<T0, T1, Rest...> : std::integral_constant
+<bool,
+ !std::is_same<T0, T1>::value
+ && is_unique<T0, Rest...>::value
+ && is_unique<T1, Rest...>::value
+>{};
+
+#endif
+}
+
+// end catch_type_traits.hpp
+// start catch_preprocessor.hpp
+
+
+#define CATCH_RECURSION_LEVEL0(...) __VA_ARGS__
+#define CATCH_RECURSION_LEVEL1(...) CATCH_RECURSION_LEVEL0(CATCH_RECURSION_LEVEL0(CATCH_RECURSION_LEVEL0(__VA_ARGS__)))
+#define CATCH_RECURSION_LEVEL2(...) CATCH_RECURSION_LEVEL1(CATCH_RECURSION_LEVEL1(CATCH_RECURSION_LEVEL1(__VA_ARGS__)))
+#define CATCH_RECURSION_LEVEL3(...) CATCH_RECURSION_LEVEL2(CATCH_RECURSION_LEVEL2(CATCH_RECURSION_LEVEL2(__VA_ARGS__)))
+#define CATCH_RECURSION_LEVEL4(...) CATCH_RECURSION_LEVEL3(CATCH_RECURSION_LEVEL3(CATCH_RECURSION_LEVEL3(__VA_ARGS__)))
+#define CATCH_RECURSION_LEVEL5(...) CATCH_RECURSION_LEVEL4(CATCH_RECURSION_LEVEL4(CATCH_RECURSION_LEVEL4(__VA_ARGS__)))
+
+#ifdef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define INTERNAL_CATCH_EXPAND_VARGS(...) __VA_ARGS__
+// MSVC needs more evaluations
+#define CATCH_RECURSION_LEVEL6(...) CATCH_RECURSION_LEVEL5(CATCH_RECURSION_LEVEL5(CATCH_RECURSION_LEVEL5(__VA_ARGS__)))
+#define CATCH_RECURSE(...) CATCH_RECURSION_LEVEL6(CATCH_RECURSION_LEVEL6(__VA_ARGS__))
+#else
+#define CATCH_RECURSE(...) CATCH_RECURSION_LEVEL5(__VA_ARGS__)
+#endif
+
+#define CATCH_REC_END(...)
+#define CATCH_REC_OUT
+
+#define CATCH_EMPTY()
+#define CATCH_DEFER(id) id CATCH_EMPTY()
+
+#define CATCH_REC_GET_END2() 0, CATCH_REC_END
+#define CATCH_REC_GET_END1(...) CATCH_REC_GET_END2
+#define CATCH_REC_GET_END(...) CATCH_REC_GET_END1
+#define CATCH_REC_NEXT0(test, next, ...) next CATCH_REC_OUT
+#define CATCH_REC_NEXT1(test, next) CATCH_DEFER ( CATCH_REC_NEXT0 ) ( test, next, 0)
+#define CATCH_REC_NEXT(test, next) CATCH_REC_NEXT1(CATCH_REC_GET_END test, next)
+
+#define CATCH_REC_LIST0(f, x, peek, ...) , f(x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST1) ) ( f, peek, __VA_ARGS__ )
+#define CATCH_REC_LIST1(f, x, peek, ...) , f(x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST0) ) ( f, peek, __VA_ARGS__ )
+#define CATCH_REC_LIST2(f, x, peek, ...) f(x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST1) ) ( f, peek, __VA_ARGS__ )
+
+#define CATCH_REC_LIST0_UD(f, userdata, x, peek, ...) , f(userdata, x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST1_UD) ) ( f, userdata, peek, __VA_ARGS__ )
+#define CATCH_REC_LIST1_UD(f, userdata, x, peek, ...) , f(userdata, x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST0_UD) ) ( f, userdata, peek, __VA_ARGS__ )
+#define CATCH_REC_LIST2_UD(f, userdata, x, peek, ...) f(userdata, x) CATCH_DEFER ( CATCH_REC_NEXT(peek, CATCH_REC_LIST1_UD) ) ( f, userdata, peek, __VA_ARGS__ )
+
+// Applies the function macro `f` to each of the remaining parameters, inserts commas between the results,
+// and passes userdata as the first parameter to each invocation,
+// e.g. CATCH_REC_LIST_UD(f, x, a, b, c) evaluates to f(x, a), f(x, b), f(x, c)
+#define CATCH_REC_LIST_UD(f, userdata, ...) CATCH_RECURSE(CATCH_REC_LIST2_UD(f, userdata, __VA_ARGS__, ()()(), ()()(), ()()(), 0))
+
+#define CATCH_REC_LIST(f, ...) CATCH_RECURSE(CATCH_REC_LIST2(f, __VA_ARGS__, ()()(), ()()(), ()()(), 0))
+
+#define INTERNAL_CATCH_EXPAND1(param) INTERNAL_CATCH_EXPAND2(param)
+#define INTERNAL_CATCH_EXPAND2(...) INTERNAL_CATCH_NO## __VA_ARGS__
+#define INTERNAL_CATCH_DEF(...) INTERNAL_CATCH_DEF __VA_ARGS__
+#define INTERNAL_CATCH_NOINTERNAL_CATCH_DEF
+#define INTERNAL_CATCH_STRINGIZE(...) INTERNAL_CATCH_STRINGIZE2(__VA_ARGS__)
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define INTERNAL_CATCH_STRINGIZE2(...) #__VA_ARGS__
+#define INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS(param) INTERNAL_CATCH_STRINGIZE(INTERNAL_CATCH_REMOVE_PARENS(param))
+#else
+// MSVC is adding extra space and needs another indirection to expand INTERNAL_CATCH_NOINTERNAL_CATCH_DEF
+#define INTERNAL_CATCH_STRINGIZE2(...) INTERNAL_CATCH_STRINGIZE3(__VA_ARGS__)
+#define INTERNAL_CATCH_STRINGIZE3(...) #__VA_ARGS__
+#define INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS(param) (INTERNAL_CATCH_STRINGIZE(INTERNAL_CATCH_REMOVE_PARENS(param)) + 1)
+#endif
+
+#define INTERNAL_CATCH_MAKE_NAMESPACE2(...) ns_##__VA_ARGS__
+#define INTERNAL_CATCH_MAKE_NAMESPACE(name) INTERNAL_CATCH_MAKE_NAMESPACE2(name)
+
+#define INTERNAL_CATCH_REMOVE_PARENS(...) INTERNAL_CATCH_EXPAND1(INTERNAL_CATCH_DEF __VA_ARGS__)
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define INTERNAL_CATCH_MAKE_TYPE_LIST2(...) decltype(get_wrapper<INTERNAL_CATCH_REMOVE_PARENS_GEN(__VA_ARGS__)>())
+#define INTERNAL_CATCH_MAKE_TYPE_LIST(...) INTERNAL_CATCH_MAKE_TYPE_LIST2(INTERNAL_CATCH_REMOVE_PARENS(__VA_ARGS__))
+#else
+#define INTERNAL_CATCH_MAKE_TYPE_LIST2(...) INTERNAL_CATCH_EXPAND_VARGS(decltype(get_wrapper<INTERNAL_CATCH_REMOVE_PARENS_GEN(__VA_ARGS__)>()))
+#define INTERNAL_CATCH_MAKE_TYPE_LIST(...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_MAKE_TYPE_LIST2(INTERNAL_CATCH_REMOVE_PARENS(__VA_ARGS__)))
+#endif
+
+#define INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(...)\
+ CATCH_REC_LIST(INTERNAL_CATCH_MAKE_TYPE_LIST,__VA_ARGS__)
+
+#define INTERNAL_CATCH_REMOVE_PARENS_1_ARG(_0) INTERNAL_CATCH_REMOVE_PARENS(_0)
+#define INTERNAL_CATCH_REMOVE_PARENS_2_ARG(_0, _1) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_1_ARG(_1)
+#define INTERNAL_CATCH_REMOVE_PARENS_3_ARG(_0, _1, _2) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_2_ARG(_1, _2)
+#define INTERNAL_CATCH_REMOVE_PARENS_4_ARG(_0, _1, _2, _3) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_3_ARG(_1, _2, _3)
+#define INTERNAL_CATCH_REMOVE_PARENS_5_ARG(_0, _1, _2, _3, _4) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_4_ARG(_1, _2, _3, _4)
+#define INTERNAL_CATCH_REMOVE_PARENS_6_ARG(_0, _1, _2, _3, _4, _5) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_5_ARG(_1, _2, _3, _4, _5)
+#define INTERNAL_CATCH_REMOVE_PARENS_7_ARG(_0, _1, _2, _3, _4, _5, _6) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_6_ARG(_1, _2, _4, _5, _6)
+#define INTERNAL_CATCH_REMOVE_PARENS_8_ARG(_0, _1, _2, _3, _4, _5, _6, _7) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_7_ARG(_1, _2, _3, _4, _5, _6, _7)
+#define INTERNAL_CATCH_REMOVE_PARENS_9_ARG(_0, _1, _2, _3, _4, _5, _6, _7, _8) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_8_ARG(_1, _2, _3, _4, _5, _6, _7, _8)
+#define INTERNAL_CATCH_REMOVE_PARENS_10_ARG(_0, _1, _2, _3, _4, _5, _6, _7, _8, _9) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_9_ARG(_1, _2, _3, _4, _5, _6, _7, _8, _9)
+#define INTERNAL_CATCH_REMOVE_PARENS_11_ARG(_0, _1, _2, _3, _4, _5, _6, _7, _8, _9, _10) INTERNAL_CATCH_REMOVE_PARENS(_0), INTERNAL_CATCH_REMOVE_PARENS_10_ARG(_1, _2, _3, _4, _5, _6, _7, _8, _9, _10)
+
+#define INTERNAL_CATCH_VA_NARGS_IMPL(_0, _1, _2, _3, _4, _5, _6, _7, _8, _9, _10, N, ...) N
+
+#define INTERNAL_CATCH_TYPE_GEN\
+ template<typename...> struct TypeList {};\
+ template<typename...Ts>\
+ constexpr auto get_wrapper() noexcept -> TypeList<Ts...> { return {}; }\
+ \
+ template<template<typename...> class L1, typename...E1, template<typename...> class L2, typename...E2> \
+ constexpr auto append(L1<E1...>, L2<E2...>) noexcept -> L1<E1...,E2...> { return {}; }\
+ template< template<typename...> class L1, typename...E1, template<typename...> class L2, typename...E2, typename...Rest>\
+ constexpr auto append(L1<E1...>, L2<E2...>, Rest...) noexcept -> decltype(append(L1<E1...,E2...>{}, Rest{}...)) { return {}; }\
+ \
+ template< template<typename...> class Container, template<typename...> class List, typename...elems>\
+ constexpr auto rewrap(List<elems...>) noexcept -> TypeList<Container<elems...>> { return {}; }\
+ template< template<typename...> class Container, template<typename...> class List, class...Elems, typename...Elements>\
+ constexpr auto rewrap(List<Elems...>,Elements...) noexcept -> decltype(append(TypeList<Container<Elems...>>{}, rewrap<Container>(Elements{}...))) { return {}; }\
+ \
+ template<template <typename...> class Final, template< typename...> class...Containers, typename...Types>\
+ constexpr auto create(TypeList<Types...>) noexcept -> decltype(append(Final<>{}, rewrap<Containers>(Types{}...)...)) { return {}; }
+
+#define INTERNAL_CATCH_NTTP_1(signature, ...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)> struct Nttp{};\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ constexpr auto get_wrapper() noexcept -> Nttp<__VA_ARGS__> { return {}; } \
+ \
+ template< template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class Container, template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class List, INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ constexpr auto rewrap(List<__VA_ARGS__>) noexcept -> TypeList<Container<__VA_ARGS__>> { return {}; }\
+ template< template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class Container, template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class List, INTERNAL_CATCH_REMOVE_PARENS(signature), typename...Elements>\
+ constexpr auto rewrap(List<__VA_ARGS__>,Elements...elems) noexcept -> decltype(append(TypeList<Container<__VA_ARGS__>>{}, rewrap<Container>(elems...))) { return {}; }\
+ template<template <typename...> class Final, template<INTERNAL_CATCH_REMOVE_PARENS(signature)> class...Containers, typename...Types>\
+ constexpr auto create(TypeList<Types...>) noexcept -> decltype(append(Final<>{}, rewrap<Containers>(Types{}...)...)) { return {}; }
+
+#define INTERNAL_CATCH_DECLARE_SIG_TEST0(TestName)
+#define INTERNAL_CATCH_DECLARE_SIG_TEST1(TestName, signature)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ static void TestName()
+#define INTERNAL_CATCH_DECLARE_SIG_TEST_X(TestName, signature, ...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ static void TestName()
+
+#define INTERNAL_CATCH_DEFINE_SIG_TEST0(TestName)
+#define INTERNAL_CATCH_DEFINE_SIG_TEST1(TestName, signature)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ static void TestName()
+#define INTERNAL_CATCH_DEFINE_SIG_TEST_X(TestName, signature,...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ static void TestName()
+
+#define INTERNAL_CATCH_NTTP_REGISTER0(TestFunc, signature)\
+ template<typename Type>\
+ void reg_test(TypeList<Type>, Catch::NameAndTags nameAndTags)\
+ {\
+ Catch::AutoReg( Catch::makeTestInvoker(&TestFunc<Type>), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), nameAndTags);\
+ }
+
+#define INTERNAL_CATCH_NTTP_REGISTER(TestFunc, signature, ...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ void reg_test(Nttp<__VA_ARGS__>, Catch::NameAndTags nameAndTags)\
+ {\
+ Catch::AutoReg( Catch::makeTestInvoker(&TestFunc<__VA_ARGS__>), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), nameAndTags);\
+ }
+
+#define INTERNAL_CATCH_NTTP_REGISTER_METHOD0(TestName, signature, ...)\
+ template<typename Type>\
+ void reg_test(TypeList<Type>, Catch::StringRef className, Catch::NameAndTags nameAndTags)\
+ {\
+ Catch::AutoReg( Catch::makeTestInvoker(&TestName<Type>::test), CATCH_INTERNAL_LINEINFO, className, nameAndTags);\
+ }
+
+#define INTERNAL_CATCH_NTTP_REGISTER_METHOD(TestName, signature, ...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)>\
+ void reg_test(Nttp<__VA_ARGS__>, Catch::StringRef className, Catch::NameAndTags nameAndTags)\
+ {\
+ Catch::AutoReg( Catch::makeTestInvoker(&TestName<__VA_ARGS__>::test), CATCH_INTERNAL_LINEINFO, className, nameAndTags);\
+ }
+
+#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD0(TestName, ClassName)
+#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD1(TestName, ClassName, signature)\
+ template<typename TestType> \
+ struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName)<TestType> { \
+ void test();\
+ }
+
+#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X(TestName, ClassName, signature, ...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)> \
+ struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName)<__VA_ARGS__> { \
+ void test();\
+ }
+
+#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD0(TestName)
+#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD1(TestName, signature)\
+ template<typename TestType> \
+ void INTERNAL_CATCH_MAKE_NAMESPACE(TestName)::TestName<TestType>::test()
+#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X(TestName, signature, ...)\
+ template<INTERNAL_CATCH_REMOVE_PARENS(signature)> \
+ void INTERNAL_CATCH_MAKE_NAMESPACE(TestName)::TestName<__VA_ARGS__>::test()
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define INTERNAL_CATCH_NTTP_0
+#define INTERNAL_CATCH_NTTP_GEN(...) INTERNAL_CATCH_VA_NARGS_IMPL(__VA_ARGS__, INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1(__VA_ARGS__), INTERNAL_CATCH_NTTP_1( __VA_ARGS__), INTERNAL_CATCH_NTTP_1( __VA_ARGS__), INTERNAL_CATCH_NTTP_1( __VA_ARGS__), INTERNAL_CATCH_NTTP_1( __VA_ARGS__),INTERNAL_CATCH_NTTP_1( __VA_ARGS__), INTERNAL_CATCH_NTTP_0)
+#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD(TestName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD1, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD0)(TestName, __VA_ARGS__)
+#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD(TestName, ClassName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD1, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD0)(TestName, ClassName, __VA_ARGS__)
+#define INTERNAL_CATCH_NTTP_REG_METHOD_GEN(TestName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD0, INTERNAL_CATCH_NTTP_REGISTER_METHOD0)(TestName, __VA_ARGS__)
+#define INTERNAL_CATCH_NTTP_REG_GEN(TestFunc, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER0, INTERNAL_CATCH_NTTP_REGISTER0)(TestFunc, __VA_ARGS__)
+#define INTERNAL_CATCH_DEFINE_SIG_TEST(TestName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DEFINE_SIG_TEST1, INTERNAL_CATCH_DEFINE_SIG_TEST0)(TestName, __VA_ARGS__)
+#define INTERNAL_CATCH_DECLARE_SIG_TEST(TestName, ...) INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DECLARE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST1, INTERNAL_CATCH_DECLARE_SIG_TEST0)(TestName, __VA_ARGS__)
+#define INTERNAL_CATCH_REMOVE_PARENS_GEN(...) INTERNAL_CATCH_VA_NARGS_IMPL(__VA_ARGS__, INTERNAL_CATCH_REMOVE_PARENS_11_ARG,INTERNAL_CATCH_REMOVE_PARENS_10_ARG,INTERNAL_CATCH_REMOVE_PARENS_9_ARG,INTERNAL_CATCH_REMOVE_PARENS_8_ARG,INTERNAL_CATCH_REMOVE_PARENS_7_ARG,INTERNAL_CATCH_REMOVE_PARENS_6_ARG,INTERNAL_CATCH_REMOVE_PARENS_5_ARG,INTERNAL_CATCH_REMOVE_PARENS_4_ARG,INTERNAL_CATCH_REMOVE_PARENS_3_ARG,INTERNAL_CATCH_REMOVE_PARENS_2_ARG,INTERNAL_CATCH_REMOVE_PARENS_1_ARG)(__VA_ARGS__)
+#else
+#define INTERNAL_CATCH_NTTP_0(signature)
+#define INTERNAL_CATCH_NTTP_GEN(...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL(__VA_ARGS__, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_1,INTERNAL_CATCH_NTTP_1, INTERNAL_CATCH_NTTP_0)( __VA_ARGS__))
+#define INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD(TestName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD1, INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD0)(TestName, __VA_ARGS__))
+#define INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD(TestName, ClassName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X,INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD_X, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD1, INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD0)(TestName, ClassName, __VA_ARGS__))
+#define INTERNAL_CATCH_NTTP_REG_METHOD_GEN(TestName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD, INTERNAL_CATCH_NTTP_REGISTER_METHOD0, INTERNAL_CATCH_NTTP_REGISTER_METHOD0)(TestName, __VA_ARGS__))
+#define INTERNAL_CATCH_NTTP_REG_GEN(TestFunc, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER, INTERNAL_CATCH_NTTP_REGISTER0, INTERNAL_CATCH_NTTP_REGISTER0)(TestFunc, __VA_ARGS__))
+#define INTERNAL_CATCH_DEFINE_SIG_TEST(TestName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DEFINE_SIG_TEST1, INTERNAL_CATCH_DEFINE_SIG_TEST0)(TestName, __VA_ARGS__))
+#define INTERNAL_CATCH_DECLARE_SIG_TEST(TestName, ...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL( "dummy", __VA_ARGS__, INTERNAL_CATCH_DECLARE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DEFINE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X,INTERNAL_CATCH_DECLARE_SIG_TEST_X, INTERNAL_CATCH_DECLARE_SIG_TEST1, INTERNAL_CATCH_DECLARE_SIG_TEST0)(TestName, __VA_ARGS__))
+#define INTERNAL_CATCH_REMOVE_PARENS_GEN(...) INTERNAL_CATCH_EXPAND_VARGS(INTERNAL_CATCH_VA_NARGS_IMPL(__VA_ARGS__, INTERNAL_CATCH_REMOVE_PARENS_11_ARG,INTERNAL_CATCH_REMOVE_PARENS_10_ARG,INTERNAL_CATCH_REMOVE_PARENS_9_ARG,INTERNAL_CATCH_REMOVE_PARENS_8_ARG,INTERNAL_CATCH_REMOVE_PARENS_7_ARG,INTERNAL_CATCH_REMOVE_PARENS_6_ARG,INTERNAL_CATCH_REMOVE_PARENS_5_ARG,INTERNAL_CATCH_REMOVE_PARENS_4_ARG,INTERNAL_CATCH_REMOVE_PARENS_3_ARG,INTERNAL_CATCH_REMOVE_PARENS_2_ARG,INTERNAL_CATCH_REMOVE_PARENS_1_ARG)(__VA_ARGS__))
+#endif
+
+// end catch_preprocessor.hpp
+// start catch_meta.hpp
+
+
+#include <type_traits>
+
+namespace Catch {
+ template<typename T>
+ struct always_false : std::false_type {};
+} // namespace Catch
+
+// end catch_meta.hpp
+namespace Catch {
+
+template<typename C>
+class TestInvokerAsMethod : public ITestInvoker {
+ void (C::*m_testAsMethod)();
+public:
+ TestInvokerAsMethod( void (C::*testAsMethod)() ) noexcept : m_testAsMethod( testAsMethod ) {}
+
+ void invoke() const override {
+ C obj;
+ (obj.*m_testAsMethod)();
+ }
+};
+
+auto makeTestInvoker( void(*testAsFunction)() ) noexcept -> ITestInvoker*;
+
+template<typename C>
+auto makeTestInvoker( void (C::*testAsMethod)() ) noexcept -> ITestInvoker* {
+ return new(std::nothrow) TestInvokerAsMethod<C>( testAsMethod );
+}
+
+struct NameAndTags {
+ NameAndTags( StringRef const& name_ = StringRef(), StringRef const& tags_ = StringRef() ) noexcept;
+ StringRef name;
+ StringRef tags;
+};
+
+struct AutoReg : NonCopyable {
+ AutoReg( ITestInvoker* invoker, SourceLineInfo const& lineInfo, StringRef const& classOrMethod, NameAndTags const& nameAndTags ) noexcept;
+ ~AutoReg();
+};
+
+} // end namespace Catch
+
+#if defined(CATCH_CONFIG_DISABLE)
+ #define INTERNAL_CATCH_TESTCASE_NO_REGISTRATION( TestName, ... ) \
+ static void TestName()
+ #define INTERNAL_CATCH_TESTCASE_METHOD_NO_REGISTRATION( TestName, ClassName, ... ) \
+ namespace{ \
+ struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName) { \
+ void test(); \
+ }; \
+ } \
+ void TestName::test()
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( TestName, TestFunc, Name, Tags, Signature, ... ) \
+ INTERNAL_CATCH_DEFINE_SIG_TEST(TestFunc, INTERNAL_CATCH_REMOVE_PARENS(Signature))
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( TestNameClass, TestName, ClassName, Name, Tags, Signature, ... ) \
+ namespace{ \
+ namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName) { \
+ INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD(TestName, ClassName, INTERNAL_CATCH_REMOVE_PARENS(Signature));\
+ } \
+ } \
+ INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD(TestName, INTERNAL_CATCH_REMOVE_PARENS(Signature))
+
+ #ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(Name, Tags, ...) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename TestType, __VA_ARGS__ )
+ #else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(Name, Tags, ...) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename TestType, __VA_ARGS__ ) )
+ #endif
+
+ #ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(Name, Tags, Signature, ...) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ )
+ #else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(Name, Tags, Signature, ...) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ ) )
+ #endif
+
+ #ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION( ClassName, Name, Tags,... ) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, typename T, __VA_ARGS__ )
+ #else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION( ClassName, Name, Tags,... ) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, typename T, __VA_ARGS__ ) )
+ #endif
+
+ #ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION( ClassName, Name, Tags, Signature, ... ) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, Signature, __VA_ARGS__ )
+ #else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION( ClassName, Name, Tags, Signature, ... ) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, Signature, __VA_ARGS__ ) )
+ #endif
+#endif
+
+ ///////////////////////////////////////////////////////////////////////////////
+ #define INTERNAL_CATCH_TESTCASE2( TestName, ... ) \
+ static void TestName(); \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ Catch::AutoReg INTERNAL_CATCH_UNIQUE_NAME( autoRegistrar )( Catch::makeTestInvoker( &TestName ), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), Catch::NameAndTags{ __VA_ARGS__ } ); } /* NOLINT */ \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ static void TestName()
+ #define INTERNAL_CATCH_TESTCASE( ... ) \
+ INTERNAL_CATCH_TESTCASE2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ), __VA_ARGS__ )
+
+ ///////////////////////////////////////////////////////////////////////////////
+ #define INTERNAL_CATCH_METHOD_AS_TEST_CASE( QualifiedMethod, ... ) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ Catch::AutoReg INTERNAL_CATCH_UNIQUE_NAME( autoRegistrar )( Catch::makeTestInvoker( &QualifiedMethod ), CATCH_INTERNAL_LINEINFO, "&" #QualifiedMethod, Catch::NameAndTags{ __VA_ARGS__ } ); } /* NOLINT */ \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS
+
+ ///////////////////////////////////////////////////////////////////////////////
+ #define INTERNAL_CATCH_TEST_CASE_METHOD2( TestName, ClassName, ... )\
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ \
+ struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName) { \
+ void test(); \
+ }; \
+ Catch::AutoReg INTERNAL_CATCH_UNIQUE_NAME( autoRegistrar ) ( Catch::makeTestInvoker( &TestName::test ), CATCH_INTERNAL_LINEINFO, #ClassName, Catch::NameAndTags{ __VA_ARGS__ } ); /* NOLINT */ \
+ } \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ void TestName::test()
+ #define INTERNAL_CATCH_TEST_CASE_METHOD( ClassName, ... ) \
+ INTERNAL_CATCH_TEST_CASE_METHOD2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ), ClassName, __VA_ARGS__ )
+
+ ///////////////////////////////////////////////////////////////////////////////
+ #define INTERNAL_CATCH_REGISTER_TESTCASE( Function, ... ) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ Catch::AutoReg INTERNAL_CATCH_UNIQUE_NAME( autoRegistrar )( Catch::makeTestInvoker( Function ), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), Catch::NameAndTags{ __VA_ARGS__ } ); /* NOLINT */ \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS
+
+ ///////////////////////////////////////////////////////////////////////////////
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_2(TestName, TestFunc, Name, Tags, Signature, ... )\
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \
+ INTERNAL_CATCH_DECLARE_SIG_TEST(TestFunc, INTERNAL_CATCH_REMOVE_PARENS(Signature));\
+ namespace {\
+ namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName){\
+ INTERNAL_CATCH_TYPE_GEN\
+ INTERNAL_CATCH_NTTP_GEN(INTERNAL_CATCH_REMOVE_PARENS(Signature))\
+ INTERNAL_CATCH_NTTP_REG_GEN(TestFunc,INTERNAL_CATCH_REMOVE_PARENS(Signature))\
+ template<typename...Types> \
+ struct TestName{\
+ TestName(){\
+ int index = 0; \
+ constexpr char const* tmpl_types[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, __VA_ARGS__)};\
+ using expander = int[];\
+ (void)expander{(reg_test(Types{}, Catch::NameAndTags{ Name " - " + std::string(tmpl_types[index]), Tags } ), index++, 0)... };/* NOLINT */ \
+ }\
+ };\
+ static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){\
+ TestName<INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(__VA_ARGS__)>();\
+ return 0;\
+ }();\
+ }\
+ }\
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS \
+ INTERNAL_CATCH_DEFINE_SIG_TEST(TestFunc,INTERNAL_CATCH_REMOVE_PARENS(Signature))
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE(Name, Tags, ...) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename TestType, __VA_ARGS__ )
+#else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE(Name, Tags, ...) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename TestType, __VA_ARGS__ ) )
+#endif
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG(Name, Tags, Signature, ...) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ )
+#else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG(Name, Tags, Signature, ...) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ ) )
+#endif
+
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2(TestName, TestFuncName, Name, Tags, Signature, TmplTypes, TypesList) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \
+ template<typename TestType> static void TestFuncName(); \
+ namespace {\
+ namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName) { \
+ INTERNAL_CATCH_TYPE_GEN \
+ INTERNAL_CATCH_NTTP_GEN(INTERNAL_CATCH_REMOVE_PARENS(Signature)) \
+ template<typename... Types> \
+ struct TestName { \
+ void reg_tests() { \
+ int index = 0; \
+ using expander = int[]; \
+ constexpr char const* tmpl_types[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, INTERNAL_CATCH_REMOVE_PARENS(TmplTypes))};\
+ constexpr char const* types_list[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, INTERNAL_CATCH_REMOVE_PARENS(TypesList))};\
+ constexpr auto num_types = sizeof(types_list) / sizeof(types_list[0]);\
+ (void)expander{(Catch::AutoReg( Catch::makeTestInvoker( &TestFuncName<Types> ), CATCH_INTERNAL_LINEINFO, Catch::StringRef(), Catch::NameAndTags{ Name " - " + std::string(tmpl_types[index / num_types]) + "<" + std::string(types_list[index % num_types]) + ">", Tags } ), index++, 0)... };/* NOLINT */\
+ } \
+ }; \
+ static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){ \
+ using TestInit = decltype(create<TestName, INTERNAL_CATCH_REMOVE_PARENS(TmplTypes)>(TypeList<INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(INTERNAL_CATCH_REMOVE_PARENS(TypesList))>{})); \
+ TestInit t; \
+ t.reg_tests(); \
+ return 0; \
+ }(); \
+ } \
+ } \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS \
+ template<typename TestType> \
+ static void TestFuncName()
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE(Name, Tags, ...)\
+ INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename T,__VA_ARGS__)
+#else
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE(Name, Tags, ...)\
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, typename T, __VA_ARGS__ ) )
+#endif
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG(Name, Tags, Signature, ...)\
+ INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__)
+#else
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG(Name, Tags, Signature, ...)\
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), Name, Tags, Signature, __VA_ARGS__ ) )
+#endif
+
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( TestNameClass, TestName, ClassName, Name, Tags, Signature, ... ) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \
+ namespace {\
+ namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestName){ \
+ INTERNAL_CATCH_TYPE_GEN\
+ INTERNAL_CATCH_NTTP_GEN(INTERNAL_CATCH_REMOVE_PARENS(Signature))\
+ INTERNAL_CATCH_DECLARE_SIG_TEST_METHOD(TestName, ClassName, INTERNAL_CATCH_REMOVE_PARENS(Signature));\
+ INTERNAL_CATCH_NTTP_REG_METHOD_GEN(TestName, INTERNAL_CATCH_REMOVE_PARENS(Signature))\
+ template<typename...Types> \
+ struct TestNameClass{\
+ TestNameClass(){\
+ int index = 0; \
+ constexpr char const* tmpl_types[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, __VA_ARGS__)};\
+ using expander = int[];\
+ (void)expander{(reg_test(Types{}, #ClassName, Catch::NameAndTags{ Name " - " + std::string(tmpl_types[index]), Tags } ), index++, 0)... };/* NOLINT */ \
+ }\
+ };\
+ static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){\
+ TestNameClass<INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(__VA_ARGS__)>();\
+ return 0;\
+ }();\
+ }\
+ }\
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS\
+ CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS\
+ INTERNAL_CATCH_DEFINE_SIG_TEST_METHOD(TestName, INTERNAL_CATCH_REMOVE_PARENS(Signature))
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( ClassName, Name, Tags,... ) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, typename T, __VA_ARGS__ )
+#else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( ClassName, Name, Tags,... ) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, typename T, __VA_ARGS__ ) )
+#endif
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( ClassName, Name, Tags, Signature, ... ) \
+ INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, Signature, __VA_ARGS__ )
+#else
+ #define INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( ClassName, Name, Tags, Signature, ... ) \
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____C_L_A_S_S____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ) , ClassName, Name, Tags, Signature, __VA_ARGS__ ) )
+#endif
+
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2(TestNameClass, TestName, ClassName, Name, Tags, Signature, TmplTypes, TypesList)\
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_SUPPRESS_ZERO_VARIADIC_WARNINGS \
+ template<typename TestType> \
+ struct TestName : INTERNAL_CATCH_REMOVE_PARENS(ClassName <TestType>) { \
+ void test();\
+ };\
+ namespace {\
+ namespace INTERNAL_CATCH_MAKE_NAMESPACE(TestNameClass) {\
+ INTERNAL_CATCH_TYPE_GEN \
+ INTERNAL_CATCH_NTTP_GEN(INTERNAL_CATCH_REMOVE_PARENS(Signature))\
+ template<typename...Types>\
+ struct TestNameClass{\
+ void reg_tests(){\
+ int index = 0;\
+ using expander = int[];\
+ constexpr char const* tmpl_types[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, INTERNAL_CATCH_REMOVE_PARENS(TmplTypes))};\
+ constexpr char const* types_list[] = {CATCH_REC_LIST(INTERNAL_CATCH_STRINGIZE_WITHOUT_PARENS, INTERNAL_CATCH_REMOVE_PARENS(TypesList))};\
+ constexpr auto num_types = sizeof(types_list) / sizeof(types_list[0]);\
+ (void)expander{(Catch::AutoReg( Catch::makeTestInvoker( &TestName<Types>::test ), CATCH_INTERNAL_LINEINFO, #ClassName, Catch::NameAndTags{ Name " - " + std::string(tmpl_types[index / num_types]) + "<" + std::string(types_list[index % num_types]) + ">", Tags } ), index++, 0)... };/* NOLINT */ \
+ }\
+ };\
+ static int INTERNAL_CATCH_UNIQUE_NAME( globalRegistrar ) = [](){\
+ using TestInit = decltype(create<TestNameClass, INTERNAL_CATCH_REMOVE_PARENS(TmplTypes)>(TypeList<INTERNAL_CATCH_MAKE_TYPE_LISTS_FROM_TYPES(INTERNAL_CATCH_REMOVE_PARENS(TypesList))>{}));\
+ TestInit t;\
+ t.reg_tests();\
+ return 0;\
+ }(); \
+ }\
+ }\
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ CATCH_INTERNAL_UNSUPPRESS_ZERO_VARIADIC_WARNINGS \
+ template<typename TestType> \
+ void TestName<TestType>::test()
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( ClassName, Name, Tags, ... )\
+ INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, typename T, __VA_ARGS__ )
+#else
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( ClassName, Name, Tags, ... )\
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, typename T,__VA_ARGS__ ) )
+#endif
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( ClassName, Name, Tags, Signature, ... )\
+ INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, Signature, __VA_ARGS__ )
+#else
+ #define INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( ClassName, Name, Tags, Signature, ... )\
+ INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_2( INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____ ), INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_M_P_L_A_T_E____T_E_S_T____F_U_N_C____ ), ClassName, Name, Tags, Signature,__VA_ARGS__ ) )
+#endif
+
+// end catch_test_registry.h
+// start catch_capture.hpp
+
+// start catch_assertionhandler.h
+
+// start catch_assertioninfo.h
+
+// start catch_result_type.h
+
+namespace Catch {
+
+ // ResultWas::OfType enum
+ struct ResultWas { enum OfType {
+ Unknown = -1,
+ Ok = 0,
+ Info = 1,
+ Warning = 2,
+
+ FailureBit = 0x10,
+
+ ExpressionFailed = FailureBit | 1,
+ ExplicitFailure = FailureBit | 2,
+
+ Exception = 0x100 | FailureBit,
+
+ ThrewException = Exception | 1,
+ DidntThrowException = Exception | 2,
+
+ FatalErrorCondition = 0x200 | FailureBit
+
+ }; };
+
+ bool isOk( ResultWas::OfType resultType );
+ bool isJustInfo( int flags );
+
+ // ResultDisposition::Flags enum
+ struct ResultDisposition { enum Flags {
+ Normal = 0x01,
+
+ ContinueOnFailure = 0x02, // Failures fail test, but execution continues
+ FalseTest = 0x04, // Prefix expression with !
+ SuppressFail = 0x08 // Failures are reported but do not fail the test
+ }; };
+
+ ResultDisposition::Flags operator | ( ResultDisposition::Flags lhs, ResultDisposition::Flags rhs );
+
+ bool shouldContinueOnFailure( int flags );
+ inline bool isFalseTest( int flags ) { return ( flags & ResultDisposition::FalseTest ) != 0; }
+ bool shouldSuppressFailure( int flags );
+
+} // end namespace Catch
+
+// end catch_result_type.h
+namespace Catch {
+
+ struct AssertionInfo
+ {
+ StringRef macroName;
+ SourceLineInfo lineInfo;
+ StringRef capturedExpression;
+ ResultDisposition::Flags resultDisposition;
+
+ // We want to delete this constructor but a compiler bug in 4.8 means
+ // the struct is then treated as non-aggregate
+ //AssertionInfo() = delete;
+ };
+
+} // end namespace Catch
+
+// end catch_assertioninfo.h
+// start catch_decomposer.h
+
+// start catch_tostring.h
+
+#include <vector>
+#include <cstddef>
+#include <type_traits>
+#include <string>
+// start catch_stream.h
+
+#include <iosfwd>
+#include <cstddef>
+#include <ostream>
+
+namespace Catch {
+
+ std::ostream& cout();
+ std::ostream& cerr();
+ std::ostream& clog();
+
+ class StringRef;
+
+ struct IStream {
+ virtual ~IStream();
+ virtual std::ostream& stream() const = 0;
+ };
+
+ auto makeStream( StringRef const &filename ) -> IStream const*;
+
+ class ReusableStringStream {
+ std::size_t m_index;
+ std::ostream* m_oss;
+ public:
+ ReusableStringStream();
+ ~ReusableStringStream();
+
+ auto str() const -> std::string;
+
+ template<typename T>
+ auto operator << ( T const& value ) -> ReusableStringStream& {
+ *m_oss << value;
+ return *this;
+ }
+ auto get() -> std::ostream& { return *m_oss; }
+ };
+}
+
+// end catch_stream.h
+// start catch_interfaces_enum_values_registry.h
+
+#include <vector>
+
+namespace Catch {
+
+ namespace Detail {
+ struct EnumInfo {
+ StringRef m_name;
+ std::vector<std::pair<int, std::string>> m_values;
+
+ ~EnumInfo();
+
+ StringRef lookup( int value ) const;
+ };
+ } // namespace Detail
+
+ struct IMutableEnumValuesRegistry {
+ virtual ~IMutableEnumValuesRegistry();
+
+ virtual Detail::EnumInfo const& registerEnum( StringRef enumName, StringRef allEnums, std::vector<int> const& values ) = 0;
+
+ template<typename E>
+ Detail::EnumInfo const& registerEnum( StringRef enumName, StringRef allEnums, std::initializer_list<E> values ) {
+ std::vector<int> intValues;
+ intValues.reserve( values.size() );
+ for( auto enumValue : values )
+ intValues.push_back( static_cast<int>( enumValue ) );
+ return registerEnum( enumName, allEnums, intValues );
+ }
+ };
+
+} // Catch
+
+// end catch_interfaces_enum_values_registry.h
+
+#ifdef CATCH_CONFIG_CPP17_STRING_VIEW
+#include <string_view>
+#endif
+
+#ifdef __OBJC__
+// start catch_objc_arc.hpp
+
+#import <Foundation/Foundation.h>
+
+#ifdef __has_feature
+#define CATCH_ARC_ENABLED __has_feature(objc_arc)
+#else
+#define CATCH_ARC_ENABLED 0
+#endif
+
+void arcSafeRelease( NSObject* obj );
+id performOptionalSelector( id obj, SEL sel );
+
+#if !CATCH_ARC_ENABLED
+inline void arcSafeRelease( NSObject* obj ) {
+ [obj release];
+}
+inline id performOptionalSelector( id obj, SEL sel ) {
+ if( [obj respondsToSelector: sel] )
+ return [obj performSelector: sel];
+ return nil;
+}
+#define CATCH_UNSAFE_UNRETAINED
+#define CATCH_ARC_STRONG
+#else
+inline void arcSafeRelease( NSObject* ){}
+inline id performOptionalSelector( id obj, SEL sel ) {
+#ifdef __clang__
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Warc-performSelector-leaks"
+#endif
+ if( [obj respondsToSelector: sel] )
+ return [obj performSelector: sel];
+#ifdef __clang__
+#pragma clang diagnostic pop
+#endif
+ return nil;
+}
+#define CATCH_UNSAFE_UNRETAINED __unsafe_unretained
+#define CATCH_ARC_STRONG __strong
+#endif
+
+// end catch_objc_arc.hpp
+#endif
+
+#ifdef _MSC_VER
+#pragma warning(push)
+#pragma warning(disable:4180) // We attempt to stream a function (address) by const&, which MSVC complains about but is harmless
+#endif
+
+namespace Catch {
+ namespace Detail {
+
+ extern const std::string unprintableString;
+
+ std::string rawMemoryToString( const void *object, std::size_t size );
+
+ template<typename T>
+ std::string rawMemoryToString( const T& object ) {
+ return rawMemoryToString( &object, sizeof(object) );
+ }
+
+ template<typename T>
+ class IsStreamInsertable {
+ template<typename SS, typename TT>
+ static auto test(int)
+ -> decltype(std::declval<SS&>() << std::declval<TT>(), std::true_type());
+
+ template<typename, typename>
+ static auto test(...)->std::false_type;
+
+ public:
+ static const bool value = decltype(test<std::ostream, const T&>(0))::value;
+ };
+
+ template<typename E>
+ std::string convertUnknownEnumToString( E e );
+
+ template<typename T>
+ typename std::enable_if<
+ !std::is_enum<T>::value && !std::is_base_of<std::exception, T>::value,
+ std::string>::type convertUnstreamable( T const& ) {
+ return Detail::unprintableString;
+ }
+ template<typename T>
+ typename std::enable_if<
+ !std::is_enum<T>::value && std::is_base_of<std::exception, T>::value,
+ std::string>::type convertUnstreamable(T const& ex) {
+ return ex.what();
+ }
+
+ template<typename T>
+ typename std::enable_if<
+ std::is_enum<T>::value
+ , std::string>::type convertUnstreamable( T const& value ) {
+ return convertUnknownEnumToString( value );
+ }
+
+#if defined(_MANAGED)
+ //! Convert a CLR string to a utf8 std::string
+ template<typename T>
+ std::string clrReferenceToString( T^ ref ) {
+ if (ref == nullptr)
+ return std::string("null");
+ auto bytes = System::Text::Encoding::UTF8->GetBytes(ref->ToString());
+ cli::pin_ptr<System::Byte> p = &bytes[0];
+ return std::string(reinterpret_cast<char const *>(p), bytes->Length);
+ }
+#endif
+
+ } // namespace Detail
+
+ // If we decide for C++14, change these to enable_if_ts
+ template <typename T, typename = void>
+ struct StringMaker {
+ template <typename Fake = T>
+ static
+ typename std::enable_if<::Catch::Detail::IsStreamInsertable<Fake>::value, std::string>::type
+ convert(const Fake& value) {
+ ReusableStringStream rss;
+ // NB: call using the function-like syntax to avoid ambiguity with
+ // user-defined templated operator<< under clang.
+ rss.operator<<(value);
+ return rss.str();
+ }
+
+ template <typename Fake = T>
+ static
+ typename std::enable_if<!::Catch::Detail::IsStreamInsertable<Fake>::value, std::string>::type
+ convert( const Fake& value ) {
+#if !defined(CATCH_CONFIG_FALLBACK_STRINGIFIER)
+ return Detail::convertUnstreamable(value);
+#else
+ return CATCH_CONFIG_FALLBACK_STRINGIFIER(value);
+#endif
+ }
+ };
+
+ namespace Detail {
+
+ // This function dispatches all stringification requests inside of Catch.
+ // Should be preferably called fully qualified, like ::Catch::Detail::stringify
+ template <typename T>
+ std::string stringify(const T& e) {
+ return ::Catch::StringMaker<typename std::remove_cv<typename std::remove_reference<T>::type>::type>::convert(e);
+ }
+
+ template<typename E>
+ std::string convertUnknownEnumToString( E e ) {
+ return ::Catch::Detail::stringify(static_cast<typename std::underlying_type<E>::type>(e));
+ }
+
+#if defined(_MANAGED)
+ template <typename T>
+ std::string stringify( T^ e ) {
+ return ::Catch::StringMaker<T^>::convert(e);
+ }
+#endif
+
+ } // namespace Detail
+
+ // Some predefined specializations
+
+ template<>
+ struct StringMaker<std::string> {
+ static std::string convert(const std::string& str);
+ };
+
+#ifdef CATCH_CONFIG_CPP17_STRING_VIEW
+ template<>
+ struct StringMaker<std::string_view> {
+ static std::string convert(std::string_view str);
+ };
+#endif
+
+ template<>
+ struct StringMaker<char const *> {
+ static std::string convert(char const * str);
+ };
+ template<>
+ struct StringMaker<char *> {
+ static std::string convert(char * str);
+ };
+
+#ifdef CATCH_CONFIG_WCHAR
+ template<>
+ struct StringMaker<std::wstring> {
+ static std::string convert(const std::wstring& wstr);
+ };
+
+# ifdef CATCH_CONFIG_CPP17_STRING_VIEW
+ template<>
+ struct StringMaker<std::wstring_view> {
+ static std::string convert(std::wstring_view str);
+ };
+# endif
+
+ template<>
+ struct StringMaker<wchar_t const *> {
+ static std::string convert(wchar_t const * str);
+ };
+ template<>
+ struct StringMaker<wchar_t *> {
+ static std::string convert(wchar_t * str);
+ };
+#endif
+
+ // TBD: Should we use `strnlen` to ensure that we don't go out of the buffer,
+ // while keeping string semantics?
+ template<int SZ>
+ struct StringMaker<char[SZ]> {
+ static std::string convert(char const* str) {
+ return ::Catch::Detail::stringify(std::string{ str });
+ }
+ };
+ template<int SZ>
+ struct StringMaker<signed char[SZ]> {
+ static std::string convert(signed char const* str) {
+ return ::Catch::Detail::stringify(std::string{ reinterpret_cast<char const *>(str) });
+ }
+ };
+ template<int SZ>
+ struct StringMaker<unsigned char[SZ]> {
+ static std::string convert(unsigned char const* str) {
+ return ::Catch::Detail::stringify(std::string{ reinterpret_cast<char const *>(str) });
+ }
+ };
+
+ template<>
+ struct StringMaker<int> {
+ static std::string convert(int value);
+ };
+ template<>
+ struct StringMaker<long> {
+ static std::string convert(long value);
+ };
+ template<>
+ struct StringMaker<long long> {
+ static std::string convert(long long value);
+ };
+ template<>
+ struct StringMaker<unsigned int> {
+ static std::string convert(unsigned int value);
+ };
+ template<>
+ struct StringMaker<unsigned long> {
+ static std::string convert(unsigned long value);
+ };
+ template<>
+ struct StringMaker<unsigned long long> {
+ static std::string convert(unsigned long long value);
+ };
+
+ template<>
+ struct StringMaker<bool> {
+ static std::string convert(bool b);
+ };
+
+ template<>
+ struct StringMaker<char> {
+ static std::string convert(char c);
+ };
+ template<>
+ struct StringMaker<signed char> {
+ static std::string convert(signed char c);
+ };
+ template<>
+ struct StringMaker<unsigned char> {
+ static std::string convert(unsigned char c);
+ };
+
+ template<>
+ struct StringMaker<std::nullptr_t> {
+ static std::string convert(std::nullptr_t);
+ };
+
+ template<>
+ struct StringMaker<float> {
+ static std::string convert(float value);
+ static int precision;
+ };
+
+ template<>
+ struct StringMaker<double> {
+ static std::string convert(double value);
+ static int precision;
+ };
+
+ template <typename T>
+ struct StringMaker<T*> {
+ template <typename U>
+ static std::string convert(U* p) {
+ if (p) {
+ return ::Catch::Detail::rawMemoryToString(p);
+ } else {
+ return "nullptr";
+ }
+ }
+ };
+
+ template <typename R, typename C>
+ struct StringMaker<R C::*> {
+ static std::string convert(R C::* p) {
+ if (p) {
+ return ::Catch::Detail::rawMemoryToString(p);
+ } else {
+ return "nullptr";
+ }
+ }
+ };
+
+#if defined(_MANAGED)
+ template <typename T>
+ struct StringMaker<T^> {
+ static std::string convert( T^ ref ) {
+ return ::Catch::Detail::clrReferenceToString(ref);
+ }
+ };
+#endif
+
+ namespace Detail {
+ template<typename InputIterator>
+ std::string rangeToString(InputIterator first, InputIterator last) {
+ ReusableStringStream rss;
+ rss << "{ ";
+ if (first != last) {
+ rss << ::Catch::Detail::stringify(*first);
+ for (++first; first != last; ++first)
+ rss << ", " << ::Catch::Detail::stringify(*first);
+ }
+ rss << " }";
+ return rss.str();
+ }
+ }
+
+#ifdef __OBJC__
+ template<>
+ struct StringMaker<NSString*> {
+ static std::string convert(NSString * nsstring) {
+ if (!nsstring)
+ return "nil";
+ return std::string("@") + [nsstring UTF8String];
+ }
+ };
+ template<>
+ struct StringMaker<NSObject*> {
+ static std::string convert(NSObject* nsObject) {
+ return ::Catch::Detail::stringify([nsObject description]);
+ }
+
+ };
+ namespace Detail {
+ inline std::string stringify( NSString* nsstring ) {
+ return StringMaker<NSString*>::convert( nsstring );
+ }
+
+ } // namespace Detail
+#endif // __OBJC__
+
+} // namespace Catch
+
+//////////////////////////////////////////////////////
+// Separate std-lib types stringification, so it can be selectively enabled
+// This means that we do not bring in
+
+#if defined(CATCH_CONFIG_ENABLE_ALL_STRINGMAKERS)
+# define CATCH_CONFIG_ENABLE_PAIR_STRINGMAKER
+# define CATCH_CONFIG_ENABLE_TUPLE_STRINGMAKER
+# define CATCH_CONFIG_ENABLE_VARIANT_STRINGMAKER
+# define CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER
+# define CATCH_CONFIG_ENABLE_OPTIONAL_STRINGMAKER
+#endif
+
+// Separate std::pair specialization
+#if defined(CATCH_CONFIG_ENABLE_PAIR_STRINGMAKER)
+#include <utility>
+namespace Catch {
+ template<typename T1, typename T2>
+ struct StringMaker<std::pair<T1, T2> > {
+ static std::string convert(const std::pair<T1, T2>& pair) {
+ ReusableStringStream rss;
+ rss << "{ "
+ << ::Catch::Detail::stringify(pair.first)
+ << ", "
+ << ::Catch::Detail::stringify(pair.second)
+ << " }";
+ return rss.str();
+ }
+ };
+}
+#endif // CATCH_CONFIG_ENABLE_PAIR_STRINGMAKER
+
+#if defined(CATCH_CONFIG_ENABLE_OPTIONAL_STRINGMAKER) && defined(CATCH_CONFIG_CPP17_OPTIONAL)
+#include <optional>
+namespace Catch {
+ template<typename T>
+ struct StringMaker<std::optional<T> > {
+ static std::string convert(const std::optional<T>& optional) {
+ ReusableStringStream rss;
+ if (optional.has_value()) {
+ rss << ::Catch::Detail::stringify(*optional);
+ } else {
+ rss << "{ }";
+ }
+ return rss.str();
+ }
+ };
+}
+#endif // CATCH_CONFIG_ENABLE_OPTIONAL_STRINGMAKER
+
+// Separate std::tuple specialization
+#if defined(CATCH_CONFIG_ENABLE_TUPLE_STRINGMAKER)
+#include <tuple>
+namespace Catch {
+ namespace Detail {
+ template<
+ typename Tuple,
+ std::size_t N = 0,
+ bool = (N < std::tuple_size<Tuple>::value)
+ >
+ struct TupleElementPrinter {
+ static void print(const Tuple& tuple, std::ostream& os) {
+ os << (N ? ", " : " ")
+ << ::Catch::Detail::stringify(std::get<N>(tuple));
+ TupleElementPrinter<Tuple, N + 1>::print(tuple, os);
+ }
+ };
+
+ template<
+ typename Tuple,
+ std::size_t N
+ >
+ struct TupleElementPrinter<Tuple, N, false> {
+ static void print(const Tuple&, std::ostream&) {}
+ };
+
+ }
+
+ template<typename ...Types>
+ struct StringMaker<std::tuple<Types...>> {
+ static std::string convert(const std::tuple<Types...>& tuple) {
+ ReusableStringStream rss;
+ rss << '{';
+ Detail::TupleElementPrinter<std::tuple<Types...>>::print(tuple, rss.get());
+ rss << " }";
+ return rss.str();
+ }
+ };
+}
+#endif // CATCH_CONFIG_ENABLE_TUPLE_STRINGMAKER
+
+#if defined(CATCH_CONFIG_ENABLE_VARIANT_STRINGMAKER) && defined(CATCH_CONFIG_CPP17_VARIANT)
+#include <variant>
+namespace Catch {
+ template<>
+ struct StringMaker<std::monostate> {
+ static std::string convert(const std::monostate&) {
+ return "{ }";
+ }
+ };
+
+ template<typename... Elements>
+ struct StringMaker<std::variant<Elements...>> {
+ static std::string convert(const std::variant<Elements...>& variant) {
+ if (variant.valueless_by_exception()) {
+ return "{valueless variant}";
+ } else {
+ return std::visit(
+ [](const auto& value) {
+ return ::Catch::Detail::stringify(value);
+ },
+ variant
+ );
+ }
+ }
+ };
+}
+#endif // CATCH_CONFIG_ENABLE_VARIANT_STRINGMAKER
+
+namespace Catch {
+ struct not_this_one {}; // Tag type for detecting which begin/ end are being selected
+
+ // Import begin/ end from std here so they are considered alongside the fallback (...) overloads in this namespace
+ using std::begin;
+ using std::end;
+
+ not_this_one begin( ... );
+ not_this_one end( ... );
+
+ template <typename T>
+ struct is_range {
+ static const bool value =
+ !std::is_same<decltype(begin(std::declval<T>())), not_this_one>::value &&
+ !std::is_same<decltype(end(std::declval<T>())), not_this_one>::value;
+ };
+
+#if defined(_MANAGED) // Managed types are never ranges
+ template <typename T>
+ struct is_range<T^> {
+ static const bool value = false;
+ };
+#endif
+
+ template<typename Range>
+ std::string rangeToString( Range const& range ) {
+ return ::Catch::Detail::rangeToString( begin( range ), end( range ) );
+ }
+
+ // Handle vector<bool> specially
+ template<typename Allocator>
+ std::string rangeToString( std::vector<bool, Allocator> const& v ) {
+ ReusableStringStream rss;
+ rss << "{ ";
+ bool first = true;
+ for( bool b : v ) {
+ if( first )
+ first = false;
+ else
+ rss << ", ";
+ rss << ::Catch::Detail::stringify( b );
+ }
+ rss << " }";
+ return rss.str();
+ }
+
+ template<typename R>
+ struct StringMaker<R, typename std::enable_if<is_range<R>::value && !::Catch::Detail::IsStreamInsertable<R>::value>::type> {
+ static std::string convert( R const& range ) {
+ return rangeToString( range );
+ }
+ };
+
+ template <typename T, int SZ>
+ struct StringMaker<T[SZ]> {
+ static std::string convert(T const(&arr)[SZ]) {
+ return rangeToString(arr);
+ }
+ };
+
+} // namespace Catch
+
+// Separate std::chrono::duration specialization
+#if defined(CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER)
+#include <ctime>
+#include <ratio>
+#include <chrono>
+
+namespace Catch {
+
+template <class Ratio>
+struct ratio_string {
+ static std::string symbol();
+};
+
+template <class Ratio>
+std::string ratio_string<Ratio>::symbol() {
+ Catch::ReusableStringStream rss;
+ rss << '[' << Ratio::num << '/'
+ << Ratio::den << ']';
+ return rss.str();
+}
+template <>
+struct ratio_string<std::atto> {
+ static std::string symbol();
+};
+template <>
+struct ratio_string<std::femto> {
+ static std::string symbol();
+};
+template <>
+struct ratio_string<std::pico> {
+ static std::string symbol();
+};
+template <>
+struct ratio_string<std::nano> {
+ static std::string symbol();
+};
+template <>
+struct ratio_string<std::micro> {
+ static std::string symbol();
+};
+template <>
+struct ratio_string<std::milli> {
+ static std::string symbol();
+};
+
+ ////////////
+ // std::chrono::duration specializations
+ template<typename Value, typename Ratio>
+ struct StringMaker<std::chrono::duration<Value, Ratio>> {
+ static std::string convert(std::chrono::duration<Value, Ratio> const& duration) {
+ ReusableStringStream rss;
+ rss << duration.count() << ' ' << ratio_string<Ratio>::symbol() << 's';
+ return rss.str();
+ }
+ };
+ template<typename Value>
+ struct StringMaker<std::chrono::duration<Value, std::ratio<1>>> {
+ static std::string convert(std::chrono::duration<Value, std::ratio<1>> const& duration) {
+ ReusableStringStream rss;
+ rss << duration.count() << " s";
+ return rss.str();
+ }
+ };
+ template<typename Value>
+ struct StringMaker<std::chrono::duration<Value, std::ratio<60>>> {
+ static std::string convert(std::chrono::duration<Value, std::ratio<60>> const& duration) {
+ ReusableStringStream rss;
+ rss << duration.count() << " m";
+ return rss.str();
+ }
+ };
+ template<typename Value>
+ struct StringMaker<std::chrono::duration<Value, std::ratio<3600>>> {
+ static std::string convert(std::chrono::duration<Value, std::ratio<3600>> const& duration) {
+ ReusableStringStream rss;
+ rss << duration.count() << " h";
+ return rss.str();
+ }
+ };
+
+ ////////////
+ // std::chrono::time_point specialization
+ // Generic time_point cannot be specialized, only std::chrono::time_point<system_clock>
+ template<typename Clock, typename Duration>
+ struct StringMaker<std::chrono::time_point<Clock, Duration>> {
+ static std::string convert(std::chrono::time_point<Clock, Duration> const& time_point) {
+ return ::Catch::Detail::stringify(time_point.time_since_epoch()) + " since epoch";
+ }
+ };
+ // std::chrono::time_point<system_clock> specialization
+ template<typename Duration>
+ struct StringMaker<std::chrono::time_point<std::chrono::system_clock, Duration>> {
+ static std::string convert(std::chrono::time_point<std::chrono::system_clock, Duration> const& time_point) {
+ auto converted = std::chrono::system_clock::to_time_t(time_point);
+
+#ifdef _MSC_VER
+ std::tm timeInfo = {};
+ gmtime_s(&timeInfo, &converted);
+#else
+ std::tm* timeInfo = std::gmtime(&converted);
+#endif
+
+ auto const timeStampSize = sizeof("2017-01-16T17:06:45Z");
+ char timeStamp[timeStampSize];
+ const char * const fmt = "%Y-%m-%dT%H:%M:%SZ";
+
+#ifdef _MSC_VER
+ std::strftime(timeStamp, timeStampSize, fmt, &timeInfo);
+#else
+ std::strftime(timeStamp, timeStampSize, fmt, timeInfo);
+#endif
+ return std::string(timeStamp);
+ }
+ };
+}
+#endif // CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER
+
+#define INTERNAL_CATCH_REGISTER_ENUM( enumName, ... ) \
+namespace Catch { \
+ template<> struct StringMaker<enumName> { \
+ static std::string convert( enumName value ) { \
+ static const auto& enumInfo = ::Catch::getMutableRegistryHub().getMutableEnumValuesRegistry().registerEnum( #enumName, #__VA_ARGS__, { __VA_ARGS__ } ); \
+ return enumInfo.lookup( static_cast<int>( value ) ); \
+ } \
+ }; \
+}
+
+#define CATCH_REGISTER_ENUM( enumName, ... ) INTERNAL_CATCH_REGISTER_ENUM( enumName, __VA_ARGS__ )
+
+#ifdef _MSC_VER
+#pragma warning(pop)
+#endif
+
+// end catch_tostring.h
+#include <iosfwd>
+
+#ifdef _MSC_VER
+#pragma warning(push)
+#pragma warning(disable:4389) // '==' : signed/unsigned mismatch
+#pragma warning(disable:4018) // more "signed/unsigned mismatch"
+#pragma warning(disable:4312) // Converting int to T* using reinterpret_cast (issue on x64 platform)
+#pragma warning(disable:4180) // qualifier applied to function type has no meaning
+#pragma warning(disable:4800) // Forcing result to true or false
+#endif
+
+namespace Catch {
+
+ struct ITransientExpression {
+ auto isBinaryExpression() const -> bool { return m_isBinaryExpression; }
+ auto getResult() const -> bool { return m_result; }
+ virtual void streamReconstructedExpression( std::ostream &os ) const = 0;
+
+ ITransientExpression( bool isBinaryExpression, bool result )
+ : m_isBinaryExpression( isBinaryExpression ),
+ m_result( result )
+ {}
+
+ // We don't actually need a virtual destructor, but many static analysers
+ // complain if it's not here :-(
+ virtual ~ITransientExpression();
+
+ bool m_isBinaryExpression;
+ bool m_result;
+
+ };
+
+ void formatReconstructedExpression( std::ostream &os, std::string const& lhs, StringRef op, std::string const& rhs );
+
+ template<typename LhsT, typename RhsT>
+ class BinaryExpr : public ITransientExpression {
+ LhsT m_lhs;
+ StringRef m_op;
+ RhsT m_rhs;
+
+ void streamReconstructedExpression( std::ostream &os ) const override {
+ formatReconstructedExpression
+ ( os, Catch::Detail::stringify( m_lhs ), m_op, Catch::Detail::stringify( m_rhs ) );
+ }
+
+ public:
+ BinaryExpr( bool comparisonResult, LhsT lhs, StringRef op, RhsT rhs )
+ : ITransientExpression{ true, comparisonResult },
+ m_lhs( lhs ),
+ m_op( op ),
+ m_rhs( rhs )
+ {}
+
+ template<typename T>
+ auto operator && ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator || ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator == ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator != ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator > ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator < ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator >= ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename T>
+ auto operator <= ( T ) const -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<T>::value,
+ "chained comparisons are not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+ };
+
+ template<typename LhsT>
+ class UnaryExpr : public ITransientExpression {
+ LhsT m_lhs;
+
+ void streamReconstructedExpression( std::ostream &os ) const override {
+ os << Catch::Detail::stringify( m_lhs );
+ }
+
+ public:
+ explicit UnaryExpr( LhsT lhs )
+ : ITransientExpression{ false, static_cast<bool>(lhs) },
+ m_lhs( lhs )
+ {}
+ };
+
+ // Specialised comparison functions to handle equality comparisons between ints and pointers (NULL deduces as an int)
+ template<typename LhsT, typename RhsT>
+ auto compareEqual( LhsT const& lhs, RhsT const& rhs ) -> bool { return static_cast<bool>(lhs == rhs); }
+ template<typename T>
+ auto compareEqual( T* const& lhs, int rhs ) -> bool { return lhs == reinterpret_cast<void const*>( rhs ); }
+ template<typename T>
+ auto compareEqual( T* const& lhs, long rhs ) -> bool { return lhs == reinterpret_cast<void const*>( rhs ); }
+ template<typename T>
+ auto compareEqual( int lhs, T* const& rhs ) -> bool { return reinterpret_cast<void const*>( lhs ) == rhs; }
+ template<typename T>
+ auto compareEqual( long lhs, T* const& rhs ) -> bool { return reinterpret_cast<void const*>( lhs ) == rhs; }
+
+ template<typename LhsT, typename RhsT>
+ auto compareNotEqual( LhsT const& lhs, RhsT&& rhs ) -> bool { return static_cast<bool>(lhs != rhs); }
+ template<typename T>
+ auto compareNotEqual( T* const& lhs, int rhs ) -> bool { return lhs != reinterpret_cast<void const*>( rhs ); }
+ template<typename T>
+ auto compareNotEqual( T* const& lhs, long rhs ) -> bool { return lhs != reinterpret_cast<void const*>( rhs ); }
+ template<typename T>
+ auto compareNotEqual( int lhs, T* const& rhs ) -> bool { return reinterpret_cast<void const*>( lhs ) != rhs; }
+ template<typename T>
+ auto compareNotEqual( long lhs, T* const& rhs ) -> bool { return reinterpret_cast<void const*>( lhs ) != rhs; }
+
+ template<typename LhsT>
+ class ExprLhs {
+ LhsT m_lhs;
+ public:
+ explicit ExprLhs( LhsT lhs ) : m_lhs( lhs ) {}
+
+ template<typename RhsT>
+ auto operator == ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const {
+ return { compareEqual( m_lhs, rhs ), m_lhs, "==", rhs };
+ }
+ auto operator == ( bool rhs ) -> BinaryExpr<LhsT, bool> const {
+ return { m_lhs == rhs, m_lhs, "==", rhs };
+ }
+
+ template<typename RhsT>
+ auto operator != ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const {
+ return { compareNotEqual( m_lhs, rhs ), m_lhs, "!=", rhs };
+ }
+ auto operator != ( bool rhs ) -> BinaryExpr<LhsT, bool> const {
+ return { m_lhs != rhs, m_lhs, "!=", rhs };
+ }
+
+ template<typename RhsT>
+ auto operator > ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const {
+ return { static_cast<bool>(m_lhs > rhs), m_lhs, ">", rhs };
+ }
+ template<typename RhsT>
+ auto operator < ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const {
+ return { static_cast<bool>(m_lhs < rhs), m_lhs, "<", rhs };
+ }
+ template<typename RhsT>
+ auto operator >= ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const {
+ return { static_cast<bool>(m_lhs >= rhs), m_lhs, ">=", rhs };
+ }
+ template<typename RhsT>
+ auto operator <= ( RhsT const& rhs ) -> BinaryExpr<LhsT, RhsT const&> const {
+ return { static_cast<bool>(m_lhs <= rhs), m_lhs, "<=", rhs };
+ }
+
+ template<typename RhsT>
+ auto operator && ( RhsT const& ) -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<RhsT>::value,
+ "operator&& is not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ template<typename RhsT>
+ auto operator || ( RhsT const& ) -> BinaryExpr<LhsT, RhsT const&> const {
+ static_assert(always_false<RhsT>::value,
+ "operator|| is not supported inside assertions, "
+ "wrap the expression inside parentheses, or decompose it");
+ }
+
+ auto makeUnaryExpr() const -> UnaryExpr<LhsT> {
+ return UnaryExpr<LhsT>{ m_lhs };
+ }
+ };
+
+ void handleExpression( ITransientExpression const& expr );
+
+ template<typename T>
+ void handleExpression( ExprLhs<T> const& expr ) {
+ handleExpression( expr.makeUnaryExpr() );
+ }
+
+ struct Decomposer {
+ template<typename T>
+ auto operator <= ( T const& lhs ) -> ExprLhs<T const&> {
+ return ExprLhs<T const&>{ lhs };
+ }
+
+ auto operator <=( bool value ) -> ExprLhs<bool> {
+ return ExprLhs<bool>{ value };
+ }
+ };
+
+} // end namespace Catch
+
+#ifdef _MSC_VER
+#pragma warning(pop)
+#endif
+
+// end catch_decomposer.h
+// start catch_interfaces_capture.h
+
+#include <string>
+
+namespace Catch {
+
+ class AssertionResult;
+ struct AssertionInfo;
+ struct SectionInfo;
+ struct SectionEndInfo;
+ struct MessageInfo;
+ struct MessageBuilder;
+ struct Counts;
+ struct BenchmarkInfo;
+ struct BenchmarkStats;
+ struct AssertionReaction;
+ struct SourceLineInfo;
+
+ struct ITransientExpression;
+ struct IGeneratorTracker;
+
+ struct IResultCapture {
+
+ virtual ~IResultCapture();
+
+ virtual bool sectionStarted( SectionInfo const& sectionInfo,
+ Counts& assertions ) = 0;
+ virtual void sectionEnded( SectionEndInfo const& endInfo ) = 0;
+ virtual void sectionEndedEarly( SectionEndInfo const& endInfo ) = 0;
+
+ virtual auto acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker& = 0;
+
+ virtual void benchmarkStarting( BenchmarkInfo const& info ) = 0;
+ virtual void benchmarkEnded( BenchmarkStats const& stats ) = 0;
+
+ virtual void pushScopedMessage( MessageInfo const& message ) = 0;
+ virtual void popScopedMessage( MessageInfo const& message ) = 0;
+
+ virtual void emplaceUnscopedMessage( MessageBuilder const& builder ) = 0;
+
+ virtual void handleFatalErrorCondition( StringRef message ) = 0;
+
+ virtual void handleExpr
+ ( AssertionInfo const& info,
+ ITransientExpression const& expr,
+ AssertionReaction& reaction ) = 0;
+ virtual void handleMessage
+ ( AssertionInfo const& info,
+ ResultWas::OfType resultType,
+ StringRef const& message,
+ AssertionReaction& reaction ) = 0;
+ virtual void handleUnexpectedExceptionNotThrown
+ ( AssertionInfo const& info,
+ AssertionReaction& reaction ) = 0;
+ virtual void handleUnexpectedInflightException
+ ( AssertionInfo const& info,
+ std::string const& message,
+ AssertionReaction& reaction ) = 0;
+ virtual void handleIncomplete
+ ( AssertionInfo const& info ) = 0;
+ virtual void handleNonExpr
+ ( AssertionInfo const &info,
+ ResultWas::OfType resultType,
+ AssertionReaction &reaction ) = 0;
+
+ virtual bool lastAssertionPassed() = 0;
+ virtual void assertionPassed() = 0;
+
+ // Deprecated, do not use:
+ virtual std::string getCurrentTestName() const = 0;
+ virtual const AssertionResult* getLastResult() const = 0;
+ virtual void exceptionEarlyReported() = 0;
+ };
+
+ IResultCapture& getResultCapture();
+}
+
+// end catch_interfaces_capture.h
+namespace Catch {
+
+ struct TestFailureException{};
+ struct AssertionResultData;
+ struct IResultCapture;
+ class RunContext;
+
+ class LazyExpression {
+ friend class AssertionHandler;
+ friend struct AssertionStats;
+ friend class RunContext;
+
+ ITransientExpression const* m_transientExpression = nullptr;
+ bool m_isNegated;
+ public:
+ LazyExpression( bool isNegated );
+ LazyExpression( LazyExpression const& other );
+ LazyExpression& operator = ( LazyExpression const& ) = delete;
+
+ explicit operator bool() const;
+
+ friend auto operator << ( std::ostream& os, LazyExpression const& lazyExpr ) -> std::ostream&;
+ };
+
+ struct AssertionReaction {
+ bool shouldDebugBreak = false;
+ bool shouldThrow = false;
+ };
+
+ class AssertionHandler {
+ AssertionInfo m_assertionInfo;
+ AssertionReaction m_reaction;
+ bool m_completed = false;
+ IResultCapture& m_resultCapture;
+
+ public:
+ AssertionHandler
+ ( StringRef const& macroName,
+ SourceLineInfo const& lineInfo,
+ StringRef capturedExpression,
+ ResultDisposition::Flags resultDisposition );
+ ~AssertionHandler() {
+ if ( !m_completed ) {
+ m_resultCapture.handleIncomplete( m_assertionInfo );
+ }
+ }
+
+ template<typename T>
+ void handleExpr( ExprLhs<T> const& expr ) {
+ handleExpr( expr.makeUnaryExpr() );
+ }
+ void handleExpr( ITransientExpression const& expr );
+
+ void handleMessage(ResultWas::OfType resultType, StringRef const& message);
+
+ void handleExceptionThrownAsExpected();
+ void handleUnexpectedExceptionNotThrown();
+ void handleExceptionNotThrownAsExpected();
+ void handleThrowingCallSkipped();
+ void handleUnexpectedInflightException();
+
+ void complete();
+ void setCompleted();
+
+ // query
+ auto allowThrows() const -> bool;
+ };
+
+ void handleExceptionMatchExpr( AssertionHandler& handler, std::string const& str, StringRef const& matcherString );
+
+} // namespace Catch
+
+// end catch_assertionhandler.h
+// start catch_message.h
+
+#include <string>
+#include <vector>
+
+namespace Catch {
+
+ struct MessageInfo {
+ MessageInfo( StringRef const& _macroName,
+ SourceLineInfo const& _lineInfo,
+ ResultWas::OfType _type );
+
+ StringRef macroName;
+ std::string message;
+ SourceLineInfo lineInfo;
+ ResultWas::OfType type;
+ unsigned int sequence;
+
+ bool operator == ( MessageInfo const& other ) const;
+ bool operator < ( MessageInfo const& other ) const;
+ private:
+ static unsigned int globalCount;
+ };
+
+ struct MessageStream {
+
+ template<typename T>
+ MessageStream& operator << ( T const& value ) {
+ m_stream << value;
+ return *this;
+ }
+
+ ReusableStringStream m_stream;
+ };
+
+ struct MessageBuilder : MessageStream {
+ MessageBuilder( StringRef const& macroName,
+ SourceLineInfo const& lineInfo,
+ ResultWas::OfType type );
+
+ template<typename T>
+ MessageBuilder& operator << ( T const& value ) {
+ m_stream << value;
+ return *this;
+ }
+
+ MessageInfo m_info;
+ };
+
+ class ScopedMessage {
+ public:
+ explicit ScopedMessage( MessageBuilder const& builder );
+ ScopedMessage( ScopedMessage& duplicate ) = delete;
+ ScopedMessage( ScopedMessage&& old );
+ ~ScopedMessage();
+
+ MessageInfo m_info;
+ bool m_moved;
+ };
+
+ class Capturer {
+ std::vector<MessageInfo> m_messages;
+ IResultCapture& m_resultCapture = getResultCapture();
+ size_t m_captured = 0;
+ public:
+ Capturer( StringRef macroName, SourceLineInfo const& lineInfo, ResultWas::OfType resultType, StringRef names );
+ ~Capturer();
+
+ void captureValue( size_t index, std::string const& value );
+
+ template<typename T>
+ void captureValues( size_t index, T const& value ) {
+ captureValue( index, Catch::Detail::stringify( value ) );
+ }
+
+ template<typename T, typename... Ts>
+ void captureValues( size_t index, T const& value, Ts const&... values ) {
+ captureValue( index, Catch::Detail::stringify(value) );
+ captureValues( index+1, values... );
+ }
+ };
+
+} // end namespace Catch
+
+// end catch_message.h
+#if !defined(CATCH_CONFIG_DISABLE)
+
+#if !defined(CATCH_CONFIG_DISABLE_STRINGIFICATION)
+ #define CATCH_INTERNAL_STRINGIFY(...) #__VA_ARGS__
+#else
+ #define CATCH_INTERNAL_STRINGIFY(...) "Disabled by CATCH_CONFIG_DISABLE_STRINGIFICATION"
+#endif
+
+#if defined(CATCH_CONFIG_FAST_COMPILE) || defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+
+///////////////////////////////////////////////////////////////////////////////
+// Another way to speed-up compilation is to omit local try-catch for REQUIRE*
+// macros.
+#define INTERNAL_CATCH_TRY
+#define INTERNAL_CATCH_CATCH( capturer )
+
+#else // CATCH_CONFIG_FAST_COMPILE
+
+#define INTERNAL_CATCH_TRY try
+#define INTERNAL_CATCH_CATCH( handler ) catch(...) { handler.handleUnexpectedInflightException(); }
+
+#endif
+
+#define INTERNAL_CATCH_REACT( handler ) handler.complete();
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_TEST( macroName, resultDisposition, ... ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__), resultDisposition ); \
+ INTERNAL_CATCH_TRY { \
+ CATCH_INTERNAL_SUPPRESS_PARENTHESES_WARNINGS \
+ catchAssertionHandler.handleExpr( Catch::Decomposer() <= __VA_ARGS__ ); \
+ CATCH_INTERNAL_UNSUPPRESS_PARENTHESES_WARNINGS \
+ } INTERNAL_CATCH_CATCH( catchAssertionHandler ) \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( (void)0, (false) && static_cast<bool>( !!(__VA_ARGS__) ) ) // the expression here is never evaluated at runtime but it forces the compiler to give it a look
+ // The double negation silences MSVC's C4800 warning, the static_cast forces short-circuit evaluation if the type has overloaded &&.
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_IF( macroName, resultDisposition, ... ) \
+ INTERNAL_CATCH_TEST( macroName, resultDisposition, __VA_ARGS__ ); \
+ if( Catch::getResultCapture().lastAssertionPassed() )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_ELSE( macroName, resultDisposition, ... ) \
+ INTERNAL_CATCH_TEST( macroName, resultDisposition, __VA_ARGS__ ); \
+ if( !Catch::getResultCapture().lastAssertionPassed() )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_NO_THROW( macroName, resultDisposition, ... ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__), resultDisposition ); \
+ try { \
+ static_cast<void>(__VA_ARGS__); \
+ catchAssertionHandler.handleExceptionNotThrownAsExpected(); \
+ } \
+ catch( ... ) { \
+ catchAssertionHandler.handleUnexpectedInflightException(); \
+ } \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_THROWS( macroName, resultDisposition, ... ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__), resultDisposition); \
+ if( catchAssertionHandler.allowThrows() ) \
+ try { \
+ static_cast<void>(__VA_ARGS__); \
+ catchAssertionHandler.handleUnexpectedExceptionNotThrown(); \
+ } \
+ catch( ... ) { \
+ catchAssertionHandler.handleExceptionThrownAsExpected(); \
+ } \
+ else \
+ catchAssertionHandler.handleThrowingCallSkipped(); \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_THROWS_AS( macroName, exceptionType, resultDisposition, expr ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(expr) ", " CATCH_INTERNAL_STRINGIFY(exceptionType), resultDisposition ); \
+ if( catchAssertionHandler.allowThrows() ) \
+ try { \
+ static_cast<void>(expr); \
+ catchAssertionHandler.handleUnexpectedExceptionNotThrown(); \
+ } \
+ catch( exceptionType const& ) { \
+ catchAssertionHandler.handleExceptionThrownAsExpected(); \
+ } \
+ catch( ... ) { \
+ catchAssertionHandler.handleUnexpectedInflightException(); \
+ } \
+ else \
+ catchAssertionHandler.handleThrowingCallSkipped(); \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_MSG( macroName, messageType, resultDisposition, ... ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, Catch::StringRef(), resultDisposition ); \
+ catchAssertionHandler.handleMessage( messageType, ( Catch::MessageStream() << __VA_ARGS__ + ::Catch::StreamEndStop() ).m_stream.str() ); \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_CAPTURE( varName, macroName, ... ) \
+ auto varName = Catch::Capturer( macroName, CATCH_INTERNAL_LINEINFO, Catch::ResultWas::Info, #__VA_ARGS__ ); \
+ varName.captureValues( 0, __VA_ARGS__ )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_INFO( macroName, log ) \
+ Catch::ScopedMessage INTERNAL_CATCH_UNIQUE_NAME( scopedMessage )( Catch::MessageBuilder( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, Catch::ResultWas::Info ) << log );
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_UNSCOPED_INFO( macroName, log ) \
+ Catch::getResultCapture().emplaceUnscopedMessage( Catch::MessageBuilder( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, Catch::ResultWas::Info ) << log )
+
+///////////////////////////////////////////////////////////////////////////////
+// Although this is matcher-based, it can be used with just a string
+#define INTERNAL_CATCH_THROWS_STR_MATCHES( macroName, resultDisposition, matcher, ... ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__) ", " CATCH_INTERNAL_STRINGIFY(matcher), resultDisposition ); \
+ if( catchAssertionHandler.allowThrows() ) \
+ try { \
+ static_cast<void>(__VA_ARGS__); \
+ catchAssertionHandler.handleUnexpectedExceptionNotThrown(); \
+ } \
+ catch( ... ) { \
+ Catch::handleExceptionMatchExpr( catchAssertionHandler, matcher, #matcher##_catch_sr ); \
+ } \
+ else \
+ catchAssertionHandler.handleThrowingCallSkipped(); \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+#endif // CATCH_CONFIG_DISABLE
+
+// end catch_capture.hpp
+// start catch_section.h
+
+// start catch_section_info.h
+
+// start catch_totals.h
+
+#include <cstddef>
+
+namespace Catch {
+
+ struct Counts {
+ Counts operator - ( Counts const& other ) const;
+ Counts& operator += ( Counts const& other );
+
+ std::size_t total() const;
+ bool allPassed() const;
+ bool allOk() const;
+
+ std::size_t passed = 0;
+ std::size_t failed = 0;
+ std::size_t failedButOk = 0;
+ };
+
+ struct Totals {
+
+ Totals operator - ( Totals const& other ) const;
+ Totals& operator += ( Totals const& other );
+
+ Totals delta( Totals const& prevTotals ) const;
+
+ int error = 0;
+ Counts assertions;
+ Counts testCases;
+ };
+}
+
+// end catch_totals.h
+#include <string>
+
+namespace Catch {
+
+ struct SectionInfo {
+ SectionInfo
+ ( SourceLineInfo const& _lineInfo,
+ std::string const& _name );
+
+ // Deprecated
+ SectionInfo
+ ( SourceLineInfo const& _lineInfo,
+ std::string const& _name,
+ std::string const& ) : SectionInfo( _lineInfo, _name ) {}
+
+ std::string name;
+ std::string description; // !Deprecated: this will always be empty
+ SourceLineInfo lineInfo;
+ };
+
+ struct SectionEndInfo {
+ SectionInfo sectionInfo;
+ Counts prevAssertions;
+ double durationInSeconds;
+ };
+
+} // end namespace Catch
+
+// end catch_section_info.h
+// start catch_timer.h
+
+#include <cstdint>
+
+namespace Catch {
+
+ auto getCurrentNanosecondsSinceEpoch() -> uint64_t;
+ auto getEstimatedClockResolution() -> uint64_t;
+
+ class Timer {
+ uint64_t m_nanoseconds = 0;
+ public:
+ void start();
+ auto getElapsedNanoseconds() const -> uint64_t;
+ auto getElapsedMicroseconds() const -> uint64_t;
+ auto getElapsedMilliseconds() const -> unsigned int;
+ auto getElapsedSeconds() const -> double;
+ };
+
+} // namespace Catch
+
+// end catch_timer.h
+#include <string>
+
+namespace Catch {
+
+ class Section : NonCopyable {
+ public:
+ Section( SectionInfo const& info );
+ ~Section();
+
+ // This indicates whether the section should be executed or not
+ explicit operator bool() const;
+
+ private:
+ SectionInfo m_info;
+
+ std::string m_name;
+ Counts m_assertions;
+ bool m_sectionIncluded;
+ Timer m_timer;
+ };
+
+} // end namespace Catch
+
+#define INTERNAL_CATCH_SECTION( ... ) \
+ CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS \
+ if( Catch::Section const& INTERNAL_CATCH_UNIQUE_NAME( catch_internal_Section ) = Catch::SectionInfo( CATCH_INTERNAL_LINEINFO, __VA_ARGS__ ) ) \
+ CATCH_INTERNAL_UNSUPPRESS_UNUSED_WARNINGS
+
+#define INTERNAL_CATCH_DYNAMIC_SECTION( ... ) \
+ CATCH_INTERNAL_SUPPRESS_UNUSED_WARNINGS \
+ if( Catch::Section const& INTERNAL_CATCH_UNIQUE_NAME( catch_internal_Section ) = Catch::SectionInfo( CATCH_INTERNAL_LINEINFO, (Catch::ReusableStringStream() << __VA_ARGS__).str() ) ) \
+ CATCH_INTERNAL_UNSUPPRESS_UNUSED_WARNINGS
+
+// end catch_section.h
+// start catch_benchmark.h
+
+#include <cstdint>
+#include <string>
+
+namespace Catch {
+
+ class BenchmarkLooper {
+
+ std::string m_name;
+ std::size_t m_count = 0;
+ std::size_t m_iterationsToRun = 1;
+ uint64_t m_resolution;
+ Timer m_timer;
+
+ static auto getResolution() -> uint64_t;
+ public:
+ // Keep most of this inline as it's on the code path that is being timed
+ BenchmarkLooper( StringRef name )
+ : m_name( name ),
+ m_resolution( getResolution() )
+ {
+ reportStart();
+ m_timer.start();
+ }
+
+ explicit operator bool() {
+ if( m_count < m_iterationsToRun )
+ return true;
+ return needsMoreIterations();
+ }
+
+ void increment() {
+ ++m_count;
+ }
+
+ void reportStart();
+ auto needsMoreIterations() -> bool;
+ };
+
+} // end namespace Catch
+
+#define BENCHMARK( name ) \
+ for( Catch::BenchmarkLooper looper( name ); looper; looper.increment() )
+
+// end catch_benchmark.h
+// start catch_interfaces_exception.h
+
+// start catch_interfaces_registry_hub.h
+
+#include <string>
+#include <memory>
+
+namespace Catch {
+
+ class TestCase;
+ struct ITestCaseRegistry;
+ struct IExceptionTranslatorRegistry;
+ struct IExceptionTranslator;
+ struct IReporterRegistry;
+ struct IReporterFactory;
+ struct ITagAliasRegistry;
+ struct IMutableEnumValuesRegistry;
+
+ class StartupExceptionRegistry;
+
+ using IReporterFactoryPtr = std::shared_ptr<IReporterFactory>;
+
+ struct IRegistryHub {
+ virtual ~IRegistryHub();
+
+ virtual IReporterRegistry const& getReporterRegistry() const = 0;
+ virtual ITestCaseRegistry const& getTestCaseRegistry() const = 0;
+ virtual ITagAliasRegistry const& getTagAliasRegistry() const = 0;
+ virtual IExceptionTranslatorRegistry const& getExceptionTranslatorRegistry() const = 0;
+
+ virtual StartupExceptionRegistry const& getStartupExceptionRegistry() const = 0;
+ };
+
+ struct IMutableRegistryHub {
+ virtual ~IMutableRegistryHub();
+ virtual void registerReporter( std::string const& name, IReporterFactoryPtr const& factory ) = 0;
+ virtual void registerListener( IReporterFactoryPtr const& factory ) = 0;
+ virtual void registerTest( TestCase const& testInfo ) = 0;
+ virtual void registerTranslator( const IExceptionTranslator* translator ) = 0;
+ virtual void registerTagAlias( std::string const& alias, std::string const& tag, SourceLineInfo const& lineInfo ) = 0;
+ virtual void registerStartupException() noexcept = 0;
+ virtual IMutableEnumValuesRegistry& getMutableEnumValuesRegistry() = 0;
+ };
+
+ IRegistryHub const& getRegistryHub();
+ IMutableRegistryHub& getMutableRegistryHub();
+ void cleanUp();
+ std::string translateActiveException();
+
+}
+
+// end catch_interfaces_registry_hub.h
+#if defined(CATCH_CONFIG_DISABLE)
+ #define INTERNAL_CATCH_TRANSLATE_EXCEPTION_NO_REG( translatorName, signature) \
+ static std::string translatorName( signature )
+#endif
+
+#include <exception>
+#include <string>
+#include <vector>
+
+namespace Catch {
+ using exceptionTranslateFunction = std::string(*)();
+
+ struct IExceptionTranslator;
+ using ExceptionTranslators = std::vector<std::unique_ptr<IExceptionTranslator const>>;
+
+ struct IExceptionTranslator {
+ virtual ~IExceptionTranslator();
+ virtual std::string translate( ExceptionTranslators::const_iterator it, ExceptionTranslators::const_iterator itEnd ) const = 0;
+ };
+
+ struct IExceptionTranslatorRegistry {
+ virtual ~IExceptionTranslatorRegistry();
+
+ virtual std::string translateActiveException() const = 0;
+ };
+
+ class ExceptionTranslatorRegistrar {
+ template<typename T>
+ class ExceptionTranslator : public IExceptionTranslator {
+ public:
+
+ ExceptionTranslator( std::string(*translateFunction)( T& ) )
+ : m_translateFunction( translateFunction )
+ {}
+
+ std::string translate( ExceptionTranslators::const_iterator it, ExceptionTranslators::const_iterator itEnd ) const override {
+ try {
+ if( it == itEnd )
+ std::rethrow_exception(std::current_exception());
+ else
+ return (*it)->translate( it+1, itEnd );
+ }
+ catch( T& ex ) {
+ return m_translateFunction( ex );
+ }
+ }
+
+ protected:
+ std::string(*m_translateFunction)( T& );
+ };
+
+ public:
+ template<typename T>
+ ExceptionTranslatorRegistrar( std::string(*translateFunction)( T& ) ) {
+ getMutableRegistryHub().registerTranslator
+ ( new ExceptionTranslator<T>( translateFunction ) );
+ }
+ };
+}
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_TRANSLATE_EXCEPTION2( translatorName, signature ) \
+ static std::string translatorName( signature ); \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ Catch::ExceptionTranslatorRegistrar INTERNAL_CATCH_UNIQUE_NAME( catch_internal_ExceptionRegistrar )( &translatorName ); } \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS \
+ static std::string translatorName( signature )
+
+#define INTERNAL_CATCH_TRANSLATE_EXCEPTION( signature ) INTERNAL_CATCH_TRANSLATE_EXCEPTION2( INTERNAL_CATCH_UNIQUE_NAME( catch_internal_ExceptionTranslator ), signature )
+
+// end catch_interfaces_exception.h
+// start catch_approx.h
+
+#include <type_traits>
+
+namespace Catch {
+namespace Detail {
+
+ class Approx {
+ private:
+ bool equalityComparisonImpl(double other) const;
+ // Validates the new margin (margin >= 0)
+ // out-of-line to avoid including stdexcept in the header
+ void setMargin(double margin);
+ // Validates the new epsilon (0 < epsilon < 1)
+ // out-of-line to avoid including stdexcept in the header
+ void setEpsilon(double epsilon);
+
+ public:
+ explicit Approx ( double value );
+
+ static Approx custom();
+
+ Approx operator-() const;
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ Approx operator()( T const& value ) {
+ Approx approx( static_cast<double>(value) );
+ approx.m_epsilon = m_epsilon;
+ approx.m_margin = m_margin;
+ approx.m_scale = m_scale;
+ return approx;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ explicit Approx( T const& value ): Approx(static_cast<double>(value))
+ {}
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator == ( const T& lhs, Approx const& rhs ) {
+ auto lhs_v = static_cast<double>(lhs);
+ return rhs.equalityComparisonImpl(lhs_v);
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator == ( Approx const& lhs, const T& rhs ) {
+ return operator==( rhs, lhs );
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator != ( T const& lhs, Approx const& rhs ) {
+ return !operator==( lhs, rhs );
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator != ( Approx const& lhs, T const& rhs ) {
+ return !operator==( rhs, lhs );
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator <= ( T const& lhs, Approx const& rhs ) {
+ return static_cast<double>(lhs) < rhs.m_value || lhs == rhs;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator <= ( Approx const& lhs, T const& rhs ) {
+ return lhs.m_value < static_cast<double>(rhs) || lhs == rhs;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator >= ( T const& lhs, Approx const& rhs ) {
+ return static_cast<double>(lhs) > rhs.m_value || lhs == rhs;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ friend bool operator >= ( Approx const& lhs, T const& rhs ) {
+ return lhs.m_value > static_cast<double>(rhs) || lhs == rhs;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ Approx& epsilon( T const& newEpsilon ) {
+ double epsilonAsDouble = static_cast<double>(newEpsilon);
+ setEpsilon(epsilonAsDouble);
+ return *this;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ Approx& margin( T const& newMargin ) {
+ double marginAsDouble = static_cast<double>(newMargin);
+ setMargin(marginAsDouble);
+ return *this;
+ }
+
+ template <typename T, typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ Approx& scale( T const& newScale ) {
+ m_scale = static_cast<double>(newScale);
+ return *this;
+ }
+
+ std::string toString() const;
+
+ private:
+ double m_epsilon;
+ double m_margin;
+ double m_scale;
+ double m_value;
+ };
+} // end namespace Detail
+
+namespace literals {
+ Detail::Approx operator "" _a(long double val);
+ Detail::Approx operator "" _a(unsigned long long val);
+} // end namespace literals
+
+template<>
+struct StringMaker<Catch::Detail::Approx> {
+ static std::string convert(Catch::Detail::Approx const& value);
+};
+
+} // end namespace Catch
+
+// end catch_approx.h
+// start catch_string_manip.h
+
+#include <string>
+#include <iosfwd>
+#include <vector>
+
+namespace Catch {
+
+ bool startsWith( std::string const& s, std::string const& prefix );
+ bool startsWith( std::string const& s, char prefix );
+ bool endsWith( std::string const& s, std::string const& suffix );
+ bool endsWith( std::string const& s, char suffix );
+ bool contains( std::string const& s, std::string const& infix );
+ void toLowerInPlace( std::string& s );
+ std::string toLower( std::string const& s );
+ std::string trim( std::string const& str );
+
+ // !!! Be aware, returns refs into original string - make sure original string outlives them
+ std::vector<StringRef> splitStringRef( StringRef str, char delimiter );
+ bool replaceInPlace( std::string& str, std::string const& replaceThis, std::string const& withThis );
+
+ struct pluralise {
+ pluralise( std::size_t count, std::string const& label );
+
+ friend std::ostream& operator << ( std::ostream& os, pluralise const& pluraliser );
+
+ std::size_t m_count;
+ std::string m_label;
+ };
+}
+
+// end catch_string_manip.h
+#ifndef CATCH_CONFIG_DISABLE_MATCHERS
+// start catch_capture_matchers.h
+
+// start catch_matchers.h
+
+#include <string>
+#include <vector>
+
+namespace Catch {
+namespace Matchers {
+ namespace Impl {
+
+ template<typename ArgT> struct MatchAllOf;
+ template<typename ArgT> struct MatchAnyOf;
+ template<typename ArgT> struct MatchNotOf;
+
+ class MatcherUntypedBase {
+ public:
+ MatcherUntypedBase() = default;
+ MatcherUntypedBase ( MatcherUntypedBase const& ) = default;
+ MatcherUntypedBase& operator = ( MatcherUntypedBase const& ) = delete;
+ std::string toString() const;
+
+ protected:
+ virtual ~MatcherUntypedBase();
+ virtual std::string describe() const = 0;
+ mutable std::string m_cachedToString;
+ };
+
+#ifdef __clang__
+# pragma clang diagnostic push
+# pragma clang diagnostic ignored "-Wnon-virtual-dtor"
+#endif
+
+ template<typename ObjectT>
+ struct MatcherMethod {
+ virtual bool match( ObjectT const& arg ) const = 0;
+ };
+
+#ifdef __clang__
+# pragma clang diagnostic pop
+#endif
+
+ template<typename T>
+ struct MatcherBase : MatcherUntypedBase, MatcherMethod<T> {
+
+ MatchAllOf<T> operator && ( MatcherBase const& other ) const;
+ MatchAnyOf<T> operator || ( MatcherBase const& other ) const;
+ MatchNotOf<T> operator ! () const;
+ };
+
+ template<typename ArgT>
+ struct MatchAllOf : MatcherBase<ArgT> {
+ bool match( ArgT const& arg ) const override {
+ for( auto matcher : m_matchers ) {
+ if (!matcher->match(arg))
+ return false;
+ }
+ return true;
+ }
+ std::string describe() const override {
+ std::string description;
+ description.reserve( 4 + m_matchers.size()*32 );
+ description += "( ";
+ bool first = true;
+ for( auto matcher : m_matchers ) {
+ if( first )
+ first = false;
+ else
+ description += " and ";
+ description += matcher->toString();
+ }
+ description += " )";
+ return description;
+ }
+
+ MatchAllOf<ArgT>& operator && ( MatcherBase<ArgT> const& other ) {
+ m_matchers.push_back( &other );
+ return *this;
+ }
+
+ std::vector<MatcherBase<ArgT> const*> m_matchers;
+ };
+ template<typename ArgT>
+ struct MatchAnyOf : MatcherBase<ArgT> {
+
+ bool match( ArgT const& arg ) const override {
+ for( auto matcher : m_matchers ) {
+ if (matcher->match(arg))
+ return true;
+ }
+ return false;
+ }
+ std::string describe() const override {
+ std::string description;
+ description.reserve( 4 + m_matchers.size()*32 );
+ description += "( ";
+ bool first = true;
+ for( auto matcher : m_matchers ) {
+ if( first )
+ first = false;
+ else
+ description += " or ";
+ description += matcher->toString();
+ }
+ description += " )";
+ return description;
+ }
+
+ MatchAnyOf<ArgT>& operator || ( MatcherBase<ArgT> const& other ) {
+ m_matchers.push_back( &other );
+ return *this;
+ }
+
+ std::vector<MatcherBase<ArgT> const*> m_matchers;
+ };
+
+ template<typename ArgT>
+ struct MatchNotOf : MatcherBase<ArgT> {
+
+ MatchNotOf( MatcherBase<ArgT> const& underlyingMatcher ) : m_underlyingMatcher( underlyingMatcher ) {}
+
+ bool match( ArgT const& arg ) const override {
+ return !m_underlyingMatcher.match( arg );
+ }
+
+ std::string describe() const override {
+ return "not " + m_underlyingMatcher.toString();
+ }
+ MatcherBase<ArgT> const& m_underlyingMatcher;
+ };
+
+ template<typename T>
+ MatchAllOf<T> MatcherBase<T>::operator && ( MatcherBase const& other ) const {
+ return MatchAllOf<T>() && *this && other;
+ }
+ template<typename T>
+ MatchAnyOf<T> MatcherBase<T>::operator || ( MatcherBase const& other ) const {
+ return MatchAnyOf<T>() || *this || other;
+ }
+ template<typename T>
+ MatchNotOf<T> MatcherBase<T>::operator ! () const {
+ return MatchNotOf<T>( *this );
+ }
+
+ } // namespace Impl
+
+} // namespace Matchers
+
+using namespace Matchers;
+using Matchers::Impl::MatcherBase;
+
+} // namespace Catch
+
+// end catch_matchers.h
+// start catch_matchers_floating.h
+
+#include <type_traits>
+#include <cmath>
+
+namespace Catch {
+namespace Matchers {
+
+ namespace Floating {
+
+ enum class FloatingPointKind : uint8_t;
+
+ struct WithinAbsMatcher : MatcherBase<double> {
+ WithinAbsMatcher(double target, double margin);
+ bool match(double const& matchee) const override;
+ std::string describe() const override;
+ private:
+ double m_target;
+ double m_margin;
+ };
+
+ struct WithinUlpsMatcher : MatcherBase<double> {
+ WithinUlpsMatcher(double target, int ulps, FloatingPointKind baseType);
+ bool match(double const& matchee) const override;
+ std::string describe() const override;
+ private:
+ double m_target;
+ int m_ulps;
+ FloatingPointKind m_type;
+ };
+
+ } // namespace Floating
+
+ // The following functions create the actual matcher objects.
+ // This allows the types to be inferred
+ Floating::WithinUlpsMatcher WithinULP(double target, int maxUlpDiff);
+ Floating::WithinUlpsMatcher WithinULP(float target, int maxUlpDiff);
+ Floating::WithinAbsMatcher WithinAbs(double target, double margin);
+
+} // namespace Matchers
+} // namespace Catch
+
+// end catch_matchers_floating.h
+// start catch_matchers_generic.hpp
+
+#include <functional>
+#include <string>
+
+namespace Catch {
+namespace Matchers {
+namespace Generic {
+
+namespace Detail {
+ std::string finalizeDescription(const std::string& desc);
+}
+
+template <typename T>
+class PredicateMatcher : public MatcherBase<T> {
+ std::function<bool(T const&)> m_predicate;
+ std::string m_description;
+public:
+
+ PredicateMatcher(std::function<bool(T const&)> const& elem, std::string const& descr)
+ :m_predicate(std::move(elem)),
+ m_description(Detail::finalizeDescription(descr))
+ {}
+
+ bool match( T const& item ) const override {
+ return m_predicate(item);
+ }
+
+ std::string describe() const override {
+ return m_description;
+ }
+};
+
+} // namespace Generic
+
+ // The following functions create the actual matcher objects.
+ // The user has to explicitly specify type to the function, because
+ // inferring std::function<bool(T const&)> is hard (but possible) and
+ // requires a lot of TMP.
+ template<typename T>
+ Generic::PredicateMatcher<T> Predicate(std::function<bool(T const&)> const& predicate, std::string const& description = "") {
+ return Generic::PredicateMatcher<T>(predicate, description);
+ }
+
+} // namespace Matchers
+} // namespace Catch
+
+// end catch_matchers_generic.hpp
+// start catch_matchers_string.h
+
+#include <string>
+
+namespace Catch {
+namespace Matchers {
+
+ namespace StdString {
+
+ struct CasedString
+ {
+ CasedString( std::string const& str, CaseSensitive::Choice caseSensitivity );
+ std::string adjustString( std::string const& str ) const;
+ std::string caseSensitivitySuffix() const;
+
+ CaseSensitive::Choice m_caseSensitivity;
+ std::string m_str;
+ };
+
+ struct StringMatcherBase : MatcherBase<std::string> {
+ StringMatcherBase( std::string const& operation, CasedString const& comparator );
+ std::string describe() const override;
+
+ CasedString m_comparator;
+ std::string m_operation;
+ };
+
+ struct EqualsMatcher : StringMatcherBase {
+ EqualsMatcher( CasedString const& comparator );
+ bool match( std::string const& source ) const override;
+ };
+ struct ContainsMatcher : StringMatcherBase {
+ ContainsMatcher( CasedString const& comparator );
+ bool match( std::string const& source ) const override;
+ };
+ struct StartsWithMatcher : StringMatcherBase {
+ StartsWithMatcher( CasedString const& comparator );
+ bool match( std::string const& source ) const override;
+ };
+ struct EndsWithMatcher : StringMatcherBase {
+ EndsWithMatcher( CasedString const& comparator );
+ bool match( std::string const& source ) const override;
+ };
+
+ struct RegexMatcher : MatcherBase<std::string> {
+ RegexMatcher( std::string regex, CaseSensitive::Choice caseSensitivity );
+ bool match( std::string const& matchee ) const override;
+ std::string describe() const override;
+
+ private:
+ std::string m_regex;
+ CaseSensitive::Choice m_caseSensitivity;
+ };
+
+ } // namespace StdString
+
+ // The following functions create the actual matcher objects.
+ // This allows the types to be inferred
+
+ StdString::EqualsMatcher Equals( std::string const& str, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes );
+ StdString::ContainsMatcher Contains( std::string const& str, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes );
+ StdString::EndsWithMatcher EndsWith( std::string const& str, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes );
+ StdString::StartsWithMatcher StartsWith( std::string const& str, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes );
+ StdString::RegexMatcher Matches( std::string const& regex, CaseSensitive::Choice caseSensitivity = CaseSensitive::Yes );
+
+} // namespace Matchers
+} // namespace Catch
+
+// end catch_matchers_string.h
+// start catch_matchers_vector.h
+
+#include <algorithm>
+
+namespace Catch {
+namespace Matchers {
+
+ namespace Vector {
+ template<typename T>
+ struct ContainsElementMatcher : MatcherBase<std::vector<T>> {
+
+ ContainsElementMatcher(T const &comparator) : m_comparator( comparator) {}
+
+ bool match(std::vector<T> const &v) const override {
+ for (auto const& el : v) {
+ if (el == m_comparator) {
+ return true;
+ }
+ }
+ return false;
+ }
+
+ std::string describe() const override {
+ return "Contains: " + ::Catch::Detail::stringify( m_comparator );
+ }
+
+ T const& m_comparator;
+ };
+
+ template<typename T>
+ struct ContainsMatcher : MatcherBase<std::vector<T>> {
+
+ ContainsMatcher(std::vector<T> const &comparator) : m_comparator( comparator ) {}
+
+ bool match(std::vector<T> const &v) const override {
+ // !TBD: see note in EqualsMatcher
+ if (m_comparator.size() > v.size())
+ return false;
+ for (auto const& comparator : m_comparator) {
+ auto present = false;
+ for (const auto& el : v) {
+ if (el == comparator) {
+ present = true;
+ break;
+ }
+ }
+ if (!present) {
+ return false;
+ }
+ }
+ return true;
+ }
+ std::string describe() const override {
+ return "Contains: " + ::Catch::Detail::stringify( m_comparator );
+ }
+
+ std::vector<T> const& m_comparator;
+ };
+
+ template<typename T>
+ struct EqualsMatcher : MatcherBase<std::vector<T>> {
+
+ EqualsMatcher(std::vector<T> const &comparator) : m_comparator( comparator ) {}
+
+ bool match(std::vector<T> const &v) const override {
+ // !TBD: This currently works if all elements can be compared using !=
+ // - a more general approach would be via a compare template that defaults
+ // to using !=. but could be specialised for, e.g. std::vector<T> etc
+ // - then just call that directly
+ if (m_comparator.size() != v.size())
+ return false;
+ for (std::size_t i = 0; i < v.size(); ++i)
+ if (m_comparator[i] != v[i])
+ return false;
+ return true;
+ }
+ std::string describe() const override {
+ return "Equals: " + ::Catch::Detail::stringify( m_comparator );
+ }
+ std::vector<T> const& m_comparator;
+ };
+
+ template<typename T>
+ struct ApproxMatcher : MatcherBase<std::vector<T>> {
+
+ ApproxMatcher(std::vector<T> const& comparator) : m_comparator( comparator ) {}
+
+ bool match(std::vector<T> const &v) const override {
+ if (m_comparator.size() != v.size())
+ return false;
+ for (std::size_t i = 0; i < v.size(); ++i)
+ if (m_comparator[i] != approx(v[i]))
+ return false;
+ return true;
+ }
+ std::string describe() const override {
+ return "is approx: " + ::Catch::Detail::stringify( m_comparator );
+ }
+ template <typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ ApproxMatcher& epsilon( T const& newEpsilon ) {
+ approx.epsilon(newEpsilon);
+ return *this;
+ }
+ template <typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ ApproxMatcher& margin( T const& newMargin ) {
+ approx.margin(newMargin);
+ return *this;
+ }
+ template <typename = typename std::enable_if<std::is_constructible<double, T>::value>::type>
+ ApproxMatcher& scale( T const& newScale ) {
+ approx.scale(newScale);
+ return *this;
+ }
+
+ std::vector<T> const& m_comparator;
+ mutable Catch::Detail::Approx approx = Catch::Detail::Approx::custom();
+ };
+
+ template<typename T>
+ struct UnorderedEqualsMatcher : MatcherBase<std::vector<T>> {
+ UnorderedEqualsMatcher(std::vector<T> const& target) : m_target(target) {}
+ bool match(std::vector<T> const& vec) const override {
+ // Note: This is a reimplementation of std::is_permutation,
+ // because I don't want to include <algorithm> inside the common path
+ if (m_target.size() != vec.size()) {
+ return false;
+ }
+ return std::is_permutation(m_target.begin(), m_target.end(), vec.begin());
+ }
+
+ std::string describe() const override {
+ return "UnorderedEquals: " + ::Catch::Detail::stringify(m_target);
+ }
+ private:
+ std::vector<T> const& m_target;
+ };
+
+ } // namespace Vector
+
+ // The following functions create the actual matcher objects.
+ // This allows the types to be inferred
+
+ template<typename T>
+ Vector::ContainsMatcher<T> Contains( std::vector<T> const& comparator ) {
+ return Vector::ContainsMatcher<T>( comparator );
+ }
+
+ template<typename T>
+ Vector::ContainsElementMatcher<T> VectorContains( T const& comparator ) {
+ return Vector::ContainsElementMatcher<T>( comparator );
+ }
+
+ template<typename T>
+ Vector::EqualsMatcher<T> Equals( std::vector<T> const& comparator ) {
+ return Vector::EqualsMatcher<T>( comparator );
+ }
+
+ template<typename T>
+ Vector::ApproxMatcher<T> Approx( std::vector<T> const& comparator ) {
+ return Vector::ApproxMatcher<T>( comparator );
+ }
+
+ template<typename T>
+ Vector::UnorderedEqualsMatcher<T> UnorderedEquals(std::vector<T> const& target) {
+ return Vector::UnorderedEqualsMatcher<T>(target);
+ }
+
+} // namespace Matchers
+} // namespace Catch
+
+// end catch_matchers_vector.h
+namespace Catch {
+
+ template<typename ArgT, typename MatcherT>
+ class MatchExpr : public ITransientExpression {
+ ArgT const& m_arg;
+ MatcherT m_matcher;
+ StringRef m_matcherString;
+ public:
+ MatchExpr( ArgT const& arg, MatcherT const& matcher, StringRef const& matcherString )
+ : ITransientExpression{ true, matcher.match( arg ) },
+ m_arg( arg ),
+ m_matcher( matcher ),
+ m_matcherString( matcherString )
+ {}
+
+ void streamReconstructedExpression( std::ostream &os ) const override {
+ auto matcherAsString = m_matcher.toString();
+ os << Catch::Detail::stringify( m_arg ) << ' ';
+ if( matcherAsString == Detail::unprintableString )
+ os << m_matcherString;
+ else
+ os << matcherAsString;
+ }
+ };
+
+ using StringMatcher = Matchers::Impl::MatcherBase<std::string>;
+
+ void handleExceptionMatchExpr( AssertionHandler& handler, StringMatcher const& matcher, StringRef const& matcherString );
+
+ template<typename ArgT, typename MatcherT>
+ auto makeMatchExpr( ArgT const& arg, MatcherT const& matcher, StringRef const& matcherString ) -> MatchExpr<ArgT, MatcherT> {
+ return MatchExpr<ArgT, MatcherT>( arg, matcher, matcherString );
+ }
+
+} // namespace Catch
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CHECK_THAT( macroName, matcher, resultDisposition, arg ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(arg) ", " CATCH_INTERNAL_STRINGIFY(matcher), resultDisposition ); \
+ INTERNAL_CATCH_TRY { \
+ catchAssertionHandler.handleExpr( Catch::makeMatchExpr( arg, matcher, #matcher##_catch_sr ) ); \
+ } INTERNAL_CATCH_CATCH( catchAssertionHandler ) \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+///////////////////////////////////////////////////////////////////////////////
+#define INTERNAL_CATCH_THROWS_MATCHES( macroName, exceptionType, resultDisposition, matcher, ... ) \
+ do { \
+ Catch::AssertionHandler catchAssertionHandler( macroName##_catch_sr, CATCH_INTERNAL_LINEINFO, CATCH_INTERNAL_STRINGIFY(__VA_ARGS__) ", " CATCH_INTERNAL_STRINGIFY(exceptionType) ", " CATCH_INTERNAL_STRINGIFY(matcher), resultDisposition ); \
+ if( catchAssertionHandler.allowThrows() ) \
+ try { \
+ static_cast<void>(__VA_ARGS__ ); \
+ catchAssertionHandler.handleUnexpectedExceptionNotThrown(); \
+ } \
+ catch( exceptionType const& ex ) { \
+ catchAssertionHandler.handleExpr( Catch::makeMatchExpr( ex, matcher, #matcher##_catch_sr ) ); \
+ } \
+ catch( ... ) { \
+ catchAssertionHandler.handleUnexpectedInflightException(); \
+ } \
+ else \
+ catchAssertionHandler.handleThrowingCallSkipped(); \
+ INTERNAL_CATCH_REACT( catchAssertionHandler ) \
+ } while( false )
+
+// end catch_capture_matchers.h
+#endif
+// start catch_generators.hpp
+
+// start catch_interfaces_generatortracker.h
+
+
+#include <memory>
+
+namespace Catch {
+
+ namespace Generators {
+ class GeneratorUntypedBase {
+ public:
+ GeneratorUntypedBase() = default;
+ virtual ~GeneratorUntypedBase();
+ // Attempts to move the generator to the next element
+ //
+ // Returns true iff the move succeeded (and a valid element
+ // can be retrieved).
+ virtual bool next() = 0;
+ };
+ using GeneratorBasePtr = std::unique_ptr<GeneratorUntypedBase>;
+
+ } // namespace Generators
+
+ struct IGeneratorTracker {
+ virtual ~IGeneratorTracker();
+ virtual auto hasGenerator() const -> bool = 0;
+ virtual auto getGenerator() const -> Generators::GeneratorBasePtr const& = 0;
+ virtual void setGenerator( Generators::GeneratorBasePtr&& generator ) = 0;
+ };
+
+} // namespace Catch
+
+// end catch_interfaces_generatortracker.h
+// start catch_enforce.h
+
+#include <stdexcept>
+
+namespace Catch {
+#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+ template <typename Ex>
+ [[noreturn]]
+ void throw_exception(Ex const& e) {
+ throw e;
+ }
+#else // ^^ Exceptions are enabled // Exceptions are disabled vv
+ [[noreturn]]
+ void throw_exception(std::exception const& e);
+#endif
+} // namespace Catch;
+
+#define CATCH_PREPARE_EXCEPTION( type, msg ) \
+ type( ( Catch::ReusableStringStream() << msg ).str() )
+#define CATCH_INTERNAL_ERROR( msg ) \
+ Catch::throw_exception(CATCH_PREPARE_EXCEPTION( std::logic_error, CATCH_INTERNAL_LINEINFO << ": Internal Catch error: " << msg))
+#define CATCH_ERROR( msg ) \
+ Catch::throw_exception(CATCH_PREPARE_EXCEPTION( std::domain_error, msg ))
+#define CATCH_RUNTIME_ERROR( msg ) \
+ Catch::throw_exception(CATCH_PREPARE_EXCEPTION( std::runtime_error, msg ))
+#define CATCH_ENFORCE( condition, msg ) \
+ do{ if( !(condition) ) CATCH_ERROR( msg ); } while(false)
+
+// end catch_enforce.h
+#include <memory>
+#include <vector>
+#include <cassert>
+
+#include <utility>
+#include <exception>
+
+namespace Catch {
+
+class GeneratorException : public std::exception {
+ const char* const m_msg = "";
+
+public:
+ GeneratorException(const char* msg):
+ m_msg(msg)
+ {}
+
+ const char* what() const noexcept override final;
+};
+
+namespace Generators {
+
+ // !TBD move this into its own location?
+ namespace pf{
+ template<typename T, typename... Args>
+ std::unique_ptr<T> make_unique( Args&&... args ) {
+ return std::unique_ptr<T>(new T(std::forward<Args>(args)...));
+ }
+ }
+
+ template<typename T>
+ struct IGenerator : GeneratorUntypedBase {
+ virtual ~IGenerator() = default;
+
+ // Returns the current element of the generator
+ //
+ // \Precondition The generator is either freshly constructed,
+ // or the last call to `next()` returned true
+ virtual T const& get() const = 0;
+ using type = T;
+ };
+
+ template<typename T>
+ class SingleValueGenerator final : public IGenerator<T> {
+ T m_value;
+ public:
+ SingleValueGenerator(T const& value) : m_value( value ) {}
+ SingleValueGenerator(T&& value) : m_value(std::move(value)) {}
+
+ T const& get() const override {
+ return m_value;
+ }
+ bool next() override {
+ return false;
+ }
+ };
+
+ template<typename T>
+ class FixedValuesGenerator final : public IGenerator<T> {
+ std::vector<T> m_values;
+ size_t m_idx = 0;
+ public:
+ FixedValuesGenerator( std::initializer_list<T> values ) : m_values( values ) {}
+
+ T const& get() const override {
+ return m_values[m_idx];
+ }
+ bool next() override {
+ ++m_idx;
+ return m_idx < m_values.size();
+ }
+ };
+
+ template <typename T>
+ class GeneratorWrapper final {
+ std::unique_ptr<IGenerator<T>> m_generator;
+ public:
+ GeneratorWrapper(std::unique_ptr<IGenerator<T>> generator):
+ m_generator(std::move(generator))
+ {}
+ T const& get() const {
+ return m_generator->get();
+ }
+ bool next() {
+ return m_generator->next();
+ }
+ };
+
+ template <typename T>
+ GeneratorWrapper<T> value(T&& value) {
+ return GeneratorWrapper<T>(pf::make_unique<SingleValueGenerator<T>>(std::forward<T>(value)));
+ }
+ template <typename T>
+ GeneratorWrapper<T> values(std::initializer_list<T> values) {
+ return GeneratorWrapper<T>(pf::make_unique<FixedValuesGenerator<T>>(values));
+ }
+
+ template<typename T>
+ class Generators : public IGenerator<T> {
+ std::vector<GeneratorWrapper<T>> m_generators;
+ size_t m_current = 0;
+
+ void populate(GeneratorWrapper<T>&& generator) {
+ m_generators.emplace_back(std::move(generator));
+ }
+ void populate(T&& val) {
+ m_generators.emplace_back(value(std::move(val)));
+ }
+ template<typename U>
+ void populate(U&& val) {
+ populate(T(std::move(val)));
+ }
+ template<typename U, typename... Gs>
+ void populate(U&& valueOrGenerator, Gs... moreGenerators) {
+ populate(std::forward<U>(valueOrGenerator));
+ populate(std::forward<Gs>(moreGenerators)...);
+ }
+
+ public:
+ template <typename... Gs>
+ Generators(Gs... moreGenerators) {
+ m_generators.reserve(sizeof...(Gs));
+ populate(std::forward<Gs>(moreGenerators)...);
+ }
+
+ T const& get() const override {
+ return m_generators[m_current].get();
+ }
+
+ bool next() override {
+ if (m_current >= m_generators.size()) {
+ return false;
+ }
+ const bool current_status = m_generators[m_current].next();
+ if (!current_status) {
+ ++m_current;
+ }
+ return m_current < m_generators.size();
+ }
+ };
+
+ template<typename... Ts>
+ GeneratorWrapper<std::tuple<Ts...>> table( std::initializer_list<std::tuple<typename std::decay<Ts>::type...>> tuples ) {
+ return values<std::tuple<Ts...>>( tuples );
+ }
+
+ // Tag type to signal that a generator sequence should convert arguments to a specific type
+ template <typename T>
+ struct as {};
+
+ template<typename T, typename... Gs>
+ auto makeGenerators( GeneratorWrapper<T>&& generator, Gs... moreGenerators ) -> Generators<T> {
+ return Generators<T>(std::move(generator), std::forward<Gs>(moreGenerators)...);
+ }
+ template<typename T>
+ auto makeGenerators( GeneratorWrapper<T>&& generator ) -> Generators<T> {
+ return Generators<T>(std::move(generator));
+ }
+ template<typename T, typename... Gs>
+ auto makeGenerators( T&& val, Gs... moreGenerators ) -> Generators<T> {
+ return makeGenerators( value( std::forward<T>( val ) ), std::forward<Gs>( moreGenerators )... );
+ }
+ template<typename T, typename U, typename... Gs>
+ auto makeGenerators( as<T>, U&& val, Gs... moreGenerators ) -> Generators<T> {
+ return makeGenerators( value( T( std::forward<U>( val ) ) ), std::forward<Gs>( moreGenerators )... );
+ }
+
+ auto acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker&;
+
+ template<typename L>
+ // Note: The type after -> is weird, because VS2015 cannot parse
+ // the expression used in the typedef inside, when it is in
+ // return type. Yeah.
+ auto generate( SourceLineInfo const& lineInfo, L const& generatorExpression ) -> decltype(std::declval<decltype(generatorExpression())>().get()) {
+ using UnderlyingType = typename decltype(generatorExpression())::type;
+
+ IGeneratorTracker& tracker = acquireGeneratorTracker( lineInfo );
+ if (!tracker.hasGenerator()) {
+ tracker.setGenerator(pf::make_unique<Generators<UnderlyingType>>(generatorExpression()));
+ }
+
+ auto const& generator = static_cast<IGenerator<UnderlyingType> const&>( *tracker.getGenerator() );
+ return generator.get();
+ }
+
+} // namespace Generators
+} // namespace Catch
+
+#define GENERATE( ... ) \
+ Catch::Generators::generate( CATCH_INTERNAL_LINEINFO, [ ]{ using namespace Catch::Generators; return makeGenerators( __VA_ARGS__ ); } )
+#define GENERATE_COPY( ... ) \
+ Catch::Generators::generate( CATCH_INTERNAL_LINEINFO, [=]{ using namespace Catch::Generators; return makeGenerators( __VA_ARGS__ ); } )
+#define GENERATE_REF( ... ) \
+ Catch::Generators::generate( CATCH_INTERNAL_LINEINFO, [&]{ using namespace Catch::Generators; return makeGenerators( __VA_ARGS__ ); } )
+
+// end catch_generators.hpp
+// start catch_generators_generic.hpp
+
+namespace Catch {
+namespace Generators {
+
+ template <typename T>
+ class TakeGenerator : public IGenerator<T> {
+ GeneratorWrapper<T> m_generator;
+ size_t m_returned = 0;
+ size_t m_target;
+ public:
+ TakeGenerator(size_t target, GeneratorWrapper<T>&& generator):
+ m_generator(std::move(generator)),
+ m_target(target)
+ {
+ assert(target != 0 && "Empty generators are not allowed");
+ }
+ T const& get() const override {
+ return m_generator.get();
+ }
+ bool next() override {
+ ++m_returned;
+ if (m_returned >= m_target) {
+ return false;
+ }
+
+ const auto success = m_generator.next();
+ // If the underlying generator does not contain enough values
+ // then we cut short as well
+ if (!success) {
+ m_returned = m_target;
+ }
+ return success;
+ }
+ };
+
+ template <typename T>
+ GeneratorWrapper<T> take(size_t target, GeneratorWrapper<T>&& generator) {
+ return GeneratorWrapper<T>(pf::make_unique<TakeGenerator<T>>(target, std::move(generator)));
+ }
+
+ template <typename T, typename Predicate>
+ class FilterGenerator : public IGenerator<T> {
+ GeneratorWrapper<T> m_generator;
+ Predicate m_predicate;
+ public:
+ template <typename P = Predicate>
+ FilterGenerator(P&& pred, GeneratorWrapper<T>&& generator):
+ m_generator(std::move(generator)),
+ m_predicate(std::forward<P>(pred))
+ {
+ if (!m_predicate(m_generator.get())) {
+ // It might happen that there are no values that pass the
+ // filter. In that case we throw an exception.
+ auto has_initial_value = next();
+ if (!has_initial_value) {
+ Catch::throw_exception(GeneratorException("No valid value found in filtered generator"));
+ }
+ }
+ }
+
+ T const& get() const override {
+ return m_generator.get();
+ }
+
+ bool next() override {
+ bool success = m_generator.next();
+ if (!success) {
+ return false;
+ }
+ while (!m_predicate(m_generator.get()) && (success = m_generator.next()) == true);
+ return success;
+ }
+ };
+
+ template <typename T, typename Predicate>
+ GeneratorWrapper<T> filter(Predicate&& pred, GeneratorWrapper<T>&& generator) {
+ return GeneratorWrapper<T>(std::unique_ptr<IGenerator<T>>(pf::make_unique<FilterGenerator<T, Predicate>>(std::forward<Predicate>(pred), std::move(generator))));
+ }
+
+ template <typename T>
+ class RepeatGenerator : public IGenerator<T> {
+ GeneratorWrapper<T> m_generator;
+ mutable std::vector<T> m_returned;
+ size_t m_target_repeats;
+ size_t m_current_repeat = 0;
+ size_t m_repeat_index = 0;
+ public:
+ RepeatGenerator(size_t repeats, GeneratorWrapper<T>&& generator):
+ m_generator(std::move(generator)),
+ m_target_repeats(repeats)
+ {
+ assert(m_target_repeats > 0 && "Repeat generator must repeat at least once");
+ }
+
+ T const& get() const override {
+ if (m_current_repeat == 0) {
+ m_returned.push_back(m_generator.get());
+ return m_returned.back();
+ }
+ return m_returned[m_repeat_index];
+ }
+
+ bool next() override {
+ // There are 2 basic cases:
+ // 1) We are still reading the generator
+ // 2) We are reading our own cache
+
+ // In the first case, we need to poke the underlying generator.
+ // If it happily moves, we are left in that state, otherwise it is time to start reading from our cache
+ if (m_current_repeat == 0) {
+ const auto success = m_generator.next();
+ if (!success) {
+ ++m_current_repeat;
+ }
+ return m_current_repeat < m_target_repeats;
+ }
+
+ // In the second case, we need to move indices forward and check that we haven't run up against the end
+ ++m_repeat_index;
+ if (m_repeat_index == m_returned.size()) {
+ m_repeat_index = 0;
+ ++m_current_repeat;
+ }
+ return m_current_repeat < m_target_repeats;
+ }
+ };
+
+ template <typename T>
+ GeneratorWrapper<T> repeat(size_t repeats, GeneratorWrapper<T>&& generator) {
+ return GeneratorWrapper<T>(pf::make_unique<RepeatGenerator<T>>(repeats, std::move(generator)));
+ }
+
+ template <typename T, typename U, typename Func>
+ class MapGenerator : public IGenerator<T> {
+ // TBD: provide static assert for mapping function, for friendly error message
+ GeneratorWrapper<U> m_generator;
+ Func m_function;
+ // To avoid returning dangling reference, we have to save the values
+ T m_cache;
+ public:
+ template <typename F2 = Func>
+ MapGenerator(F2&& function, GeneratorWrapper<U>&& generator) :
+ m_generator(std::move(generator)),
+ m_function(std::forward<F2>(function)),
+ m_cache(m_function(m_generator.get()))
+ {}
+
+ T const& get() const override {
+ return m_cache;
+ }
+ bool next() override {
+ const auto success = m_generator.next();
+ if (success) {
+ m_cache = m_function(m_generator.get());
+ }
+ return success;
+ }
+ };
+
+#if defined(__cpp_lib_is_invocable) && __cpp_lib_is_invocable >= 201703
+ // std::result_of is deprecated in C++17 and removed in C++20. Hence, it is
+ // replaced with std::invoke_result here. Also *_t format is preferred over
+ // typename *::type format.
+ template <typename Func, typename U>
+ using MapFunctionReturnType = std::remove_reference_t<std::remove_cv_t<std::invoke_result_t<Func, U>>>;
+#else
+ template <typename Func, typename U>
+ using MapFunctionReturnType = typename std::remove_reference<typename std::remove_cv<typename std::result_of<Func(U)>::type>::type>::type;
+#endif
+
+ template <typename Func, typename U, typename T = MapFunctionReturnType<Func, U>>
+ GeneratorWrapper<T> map(Func&& function, GeneratorWrapper<U>&& generator) {
+ return GeneratorWrapper<T>(
+ pf::make_unique<MapGenerator<T, U, Func>>(std::forward<Func>(function), std::move(generator))
+ );
+ }
+
+ template <typename T, typename U, typename Func>
+ GeneratorWrapper<T> map(Func&& function, GeneratorWrapper<U>&& generator) {
+ return GeneratorWrapper<T>(
+ pf::make_unique<MapGenerator<T, U, Func>>(std::forward<Func>(function), std::move(generator))
+ );
+ }
+
+ template <typename T>
+ class ChunkGenerator final : public IGenerator<std::vector<T>> {
+ std::vector<T> m_chunk;
+ size_t m_chunk_size;
+ GeneratorWrapper<T> m_generator;
+ bool m_used_up = false;
+ public:
+ ChunkGenerator(size_t size, GeneratorWrapper<T> generator) :
+ m_chunk_size(size), m_generator(std::move(generator))
+ {
+ m_chunk.reserve(m_chunk_size);
+ m_chunk.push_back(m_generator.get());
+ for (size_t i = 1; i < m_chunk_size; ++i) {
+ if (!m_generator.next()) {
+ Catch::throw_exception(GeneratorException("Not enough values to initialize the first chunk"));
+ }
+ m_chunk.push_back(m_generator.get());
+ }
+ }
+ std::vector<T> const& get() const override {
+ return m_chunk;
+ }
+ bool next() override {
+ m_chunk.clear();
+ for (size_t idx = 0; idx < m_chunk_size; ++idx) {
+ if (!m_generator.next()) {
+ return false;
+ }
+ m_chunk.push_back(m_generator.get());
+ }
+ return true;
+ }
+ };
+
+ template <typename T>
+ GeneratorWrapper<std::vector<T>> chunk(size_t size, GeneratorWrapper<T>&& generator) {
+ return GeneratorWrapper<std::vector<T>>(
+ pf::make_unique<ChunkGenerator<T>>(size, std::move(generator))
+ );
+ }
+
+} // namespace Generators
+} // namespace Catch
+
+// end catch_generators_generic.hpp
+// start catch_generators_specific.hpp
+
+// start catch_context.h
+
+#include <memory>
+
+namespace Catch {
+
+ struct IResultCapture;
+ struct IRunner;
+ struct IConfig;
+ struct IMutableContext;
+
+ using IConfigPtr = std::shared_ptr<IConfig const>;
+
+ struct IContext
+ {
+ virtual ~IContext();
+
+ virtual IResultCapture* getResultCapture() = 0;
+ virtual IRunner* getRunner() = 0;
+ virtual IConfigPtr const& getConfig() const = 0;
+ };
+
+ struct IMutableContext : IContext
+ {
+ virtual ~IMutableContext();
+ virtual void setResultCapture( IResultCapture* resultCapture ) = 0;
+ virtual void setRunner( IRunner* runner ) = 0;
+ virtual void setConfig( IConfigPtr const& config ) = 0;
+
+ private:
+ static IMutableContext *currentContext;
+ friend IMutableContext& getCurrentMutableContext();
+ friend void cleanUpContext();
+ static void createContext();
+ };
+
+ inline IMutableContext& getCurrentMutableContext()
+ {
+ if( !IMutableContext::currentContext )
+ IMutableContext::createContext();
+ return *IMutableContext::currentContext;
+ }
+
+ inline IContext& getCurrentContext()
+ {
+ return getCurrentMutableContext();
+ }
+
+ void cleanUpContext();
+}
+
+// end catch_context.h
+// start catch_interfaces_config.h
+
+#include <iosfwd>
+#include <string>
+#include <vector>
+#include <memory>
+
+namespace Catch {
+
+ enum class Verbosity {
+ Quiet = 0,
+ Normal,
+ High
+ };
+
+ struct WarnAbout { enum What {
+ Nothing = 0x00,
+ NoAssertions = 0x01,
+ NoTests = 0x02
+ }; };
+
+ struct ShowDurations { enum OrNot {
+ DefaultForReporter,
+ Always,
+ Never
+ }; };
+ struct RunTests { enum InWhatOrder {
+ InDeclarationOrder,
+ InLexicographicalOrder,
+ InRandomOrder
+ }; };
+ struct UseColour { enum YesOrNo {
+ Auto,
+ Yes,
+ No
+ }; };
+ struct WaitForKeypress { enum When {
+ Never,
+ BeforeStart = 1,
+ BeforeExit = 2,
+ BeforeStartAndExit = BeforeStart | BeforeExit
+ }; };
+
+ class TestSpec;
+
+ struct IConfig : NonCopyable {
+
+ virtual ~IConfig();
+
+ virtual bool allowThrows() const = 0;
+ virtual std::ostream& stream() const = 0;
+ virtual std::string name() const = 0;
+ virtual bool includeSuccessfulResults() const = 0;
+ virtual bool shouldDebugBreak() const = 0;
+ virtual bool warnAboutMissingAssertions() const = 0;
+ virtual bool warnAboutNoTests() const = 0;
+ virtual int abortAfter() const = 0;
+ virtual bool showInvisibles() const = 0;
+ virtual ShowDurations::OrNot showDurations() const = 0;
+ virtual TestSpec const& testSpec() const = 0;
+ virtual bool hasTestFilters() const = 0;
+ virtual std::vector<std::string> const& getTestsOrTags() const = 0;
+ virtual RunTests::InWhatOrder runOrder() const = 0;
+ virtual unsigned int rngSeed() const = 0;
+ virtual int benchmarkResolutionMultiple() const = 0;
+ virtual UseColour::YesOrNo useColour() const = 0;
+ virtual std::vector<std::string> const& getSectionsToRun() const = 0;
+ virtual Verbosity verbosity() const = 0;
+ };
+
+ using IConfigPtr = std::shared_ptr<IConfig const>;
+}
+
+// end catch_interfaces_config.h
+#include <random>
+
+namespace Catch {
+namespace Generators {
+
+template <typename Float>
+class RandomFloatingGenerator final : public IGenerator<Float> {
+ // FIXME: What is the right seed?
+ std::minstd_rand m_rand;
+ std::uniform_real_distribution<Float> m_dist;
+ Float m_current_number;
+public:
+
+ RandomFloatingGenerator(Float a, Float b):
+ m_rand(getCurrentContext().getConfig()->rngSeed()),
+ m_dist(a, b) {
+ static_cast<void>(next());
+ }
+
+ Float const& get() const override {
+ return m_current_number;
+ }
+ bool next() override {
+ m_current_number = m_dist(m_rand);
+ return true;
+ }
+};
+
+template <typename Integer>
+class RandomIntegerGenerator final : public IGenerator<Integer> {
+ std::minstd_rand m_rand;
+ std::uniform_int_distribution<Integer> m_dist;
+ Integer m_current_number;
+public:
+
+ RandomIntegerGenerator(Integer a, Integer b):
+ m_rand(getCurrentContext().getConfig()->rngSeed()),
+ m_dist(a, b) {
+ static_cast<void>(next());
+ }
+
+ Integer const& get() const override {
+ return m_current_number;
+ }
+ bool next() override {
+ m_current_number = m_dist(m_rand);
+ return true;
+ }
+};
+
+// TODO: Ideally this would be also constrained against the various char types,
+// but I don't expect users to run into that in practice.
+template <typename T>
+typename std::enable_if<std::is_integral<T>::value && !std::is_same<T, bool>::value,
+GeneratorWrapper<T>>::type
+random(T a, T b) {
+ return GeneratorWrapper<T>(
+ pf::make_unique<RandomIntegerGenerator<T>>(a, b)
+ );
+}
+
+template <typename T>
+typename std::enable_if<std::is_floating_point<T>::value,
+GeneratorWrapper<T>>::type
+random(T a, T b) {
+ return GeneratorWrapper<T>(
+ pf::make_unique<RandomFloatingGenerator<T>>(a, b)
+ );
+}
+
+template <typename T>
+class RangeGenerator final : public IGenerator<T> {
+ T m_current;
+ T m_end;
+ T m_step;
+ bool m_positive;
+
+public:
+ RangeGenerator(T const& start, T const& end, T const& step):
+ m_current(start),
+ m_end(end),
+ m_step(step),
+ m_positive(m_step > T(0))
+ {
+ assert(m_current != m_end && "Range start and end cannot be equal");
+ assert(m_step != T(0) && "Step size cannot be zero");
+ assert(((m_positive && m_current <= m_end) || (!m_positive && m_current >= m_end)) && "Step moves away from end");
+ }
+
+ RangeGenerator(T const& start, T const& end):
+ RangeGenerator(start, end, (start < end) ? T(1) : T(-1))
+ {}
+
+ T const& get() const override {
+ return m_current;
+ }
+
+ bool next() override {
+ m_current += m_step;
+ return (m_positive) ? (m_current < m_end) : (m_current > m_end);
+ }
+};
+
+template <typename T>
+GeneratorWrapper<T> range(T const& start, T const& end, T const& step) {
+ static_assert(std::is_integral<T>::value && !std::is_same<T, bool>::value, "Type must be an integer");
+ return GeneratorWrapper<T>(pf::make_unique<RangeGenerator<T>>(start, end, step));
+}
+
+template <typename T>
+GeneratorWrapper<T> range(T const& start, T const& end) {
+ static_assert(std::is_integral<T>::value && !std::is_same<T, bool>::value, "Type must be an integer");
+ return GeneratorWrapper<T>(pf::make_unique<RangeGenerator<T>>(start, end));
+}
+
+} // namespace Generators
+} // namespace Catch
+
+// end catch_generators_specific.hpp
+
+// These files are included here so the single_include script doesn't put them
+// in the conditionally compiled sections
+// start catch_test_case_info.h
+
+#include <string>
+#include <vector>
+#include <memory>
+
+#ifdef __clang__
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Wpadded"
+#endif
+
+namespace Catch {
+
+ struct ITestInvoker;
+
+ struct TestCaseInfo {
+ enum SpecialProperties{
+ None = 0,
+ IsHidden = 1 << 1,
+ ShouldFail = 1 << 2,
+ MayFail = 1 << 3,
+ Throws = 1 << 4,
+ NonPortable = 1 << 5,
+ Benchmark = 1 << 6
+ };
+
+ TestCaseInfo( std::string const& _name,
+ std::string const& _className,
+ std::string const& _description,
+ std::vector<std::string> const& _tags,
+ SourceLineInfo const& _lineInfo );
+
+ friend void setTags( TestCaseInfo& testCaseInfo, std::vector<std::string> tags );
+
+ bool isHidden() const;
+ bool throws() const;
+ bool okToFail() const;
+ bool expectedToFail() const;
+
+ std::string tagsAsString() const;
+
+ std::string name;
+ std::string className;
+ std::string description;
+ std::vector<std::string> tags;
+ std::vector<std::string> lcaseTags;
+ SourceLineInfo lineInfo;
+ SpecialProperties properties;
+ };
+
+ class TestCase : public TestCaseInfo {
+ public:
+
+ TestCase( ITestInvoker* testCase, TestCaseInfo&& info );
+
+ TestCase withName( std::string const& _newName ) const;
+
+ void invoke() const;
+
+ TestCaseInfo const& getTestCaseInfo() const;
+
+ bool operator == ( TestCase const& other ) const;
+ bool operator < ( TestCase const& other ) const;
+
+ private:
+ std::shared_ptr<ITestInvoker> test;
+ };
+
+ TestCase makeTestCase( ITestInvoker* testCase,
+ std::string const& className,
+ NameAndTags const& nameAndTags,
+ SourceLineInfo const& lineInfo );
+}
+
+#ifdef __clang__
+#pragma clang diagnostic pop
+#endif
+
+// end catch_test_case_info.h
+// start catch_interfaces_runner.h
+
+namespace Catch {
+
+ struct IRunner {
+ virtual ~IRunner();
+ virtual bool aborting() const = 0;
+ };
+}
+
+// end catch_interfaces_runner.h
+
+#ifdef __OBJC__
+// start catch_objc.hpp
+
+#import <objc/runtime.h>
+
+#include <string>
+
+// NB. Any general catch headers included here must be included
+// in catch.hpp first to make sure they are included by the single
+// header for non obj-usage
+
+///////////////////////////////////////////////////////////////////////////////
+// This protocol is really only here for (self) documenting purposes, since
+// all its methods are optional.
+@protocol OcFixture
+
+@optional
+
+-(void) setUp;
+-(void) tearDown;
+
+@end
+
+namespace Catch {
+
+ class OcMethod : public ITestInvoker {
+
+ public:
+ OcMethod( Class cls, SEL sel ) : m_cls( cls ), m_sel( sel ) {}
+
+ virtual void invoke() const {
+ id obj = [[m_cls alloc] init];
+
+ performOptionalSelector( obj, @selector(setUp) );
+ performOptionalSelector( obj, m_sel );
+ performOptionalSelector( obj, @selector(tearDown) );
+
+ arcSafeRelease( obj );
+ }
+ private:
+ virtual ~OcMethod() {}
+
+ Class m_cls;
+ SEL m_sel;
+ };
+
+ namespace Detail{
+
+ inline std::string getAnnotation( Class cls,
+ std::string const& annotationName,
+ std::string const& testCaseName ) {
+ NSString* selStr = [[NSString alloc] initWithFormat:@"Catch_%s_%s", annotationName.c_str(), testCaseName.c_str()];
+ SEL sel = NSSelectorFromString( selStr );
+ arcSafeRelease( selStr );
+ id value = performOptionalSelector( cls, sel );
+ if( value )
+ return [(NSString*)value UTF8String];
+ return "";
+ }
+ }
+
+ inline std::size_t registerTestMethods() {
+ std::size_t noTestMethods = 0;
+ int noClasses = objc_getClassList( nullptr, 0 );
+
+ Class* classes = (CATCH_UNSAFE_UNRETAINED Class *)malloc( sizeof(Class) * noClasses);
+ objc_getClassList( classes, noClasses );
+
+ for( int c = 0; c < noClasses; c++ ) {
+ Class cls = classes[c];
+ {
+ u_int count;
+ Method* methods = class_copyMethodList( cls, &count );
+ for( u_int m = 0; m < count ; m++ ) {
+ SEL selector = method_getName(methods[m]);
+ std::string methodName = sel_getName(selector);
+ if( startsWith( methodName, "Catch_TestCase_" ) ) {
+ std::string testCaseName = methodName.substr( 15 );
+ std::string name = Detail::getAnnotation( cls, "Name", testCaseName );
+ std::string desc = Detail::getAnnotation( cls, "Description", testCaseName );
+ const char* className = class_getName( cls );
+
+ getMutableRegistryHub().registerTest( makeTestCase( new OcMethod( cls, selector ), className, NameAndTags( name.c_str(), desc.c_str() ), SourceLineInfo("",0) ) );
+ noTestMethods++;
+ }
+ }
+ free(methods);
+ }
+ }
+ return noTestMethods;
+ }
+
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+
+ namespace Matchers {
+ namespace Impl {
+ namespace NSStringMatchers {
+
+ struct StringHolder : MatcherBase<NSString*>{
+ StringHolder( NSString* substr ) : m_substr( [substr copy] ){}
+ StringHolder( StringHolder const& other ) : m_substr( [other.m_substr copy] ){}
+ StringHolder() {
+ arcSafeRelease( m_substr );
+ }
+
+ bool match( NSString* const& str ) const override {
+ return false;
+ }
+
+ NSString* CATCH_ARC_STRONG m_substr;
+ };
+
+ struct Equals : StringHolder {
+ Equals( NSString* substr ) : StringHolder( substr ){}
+
+ bool match( NSString* const& str ) const override {
+ return (str != nil || m_substr == nil ) &&
+ [str isEqualToString:m_substr];
+ }
+
+ std::string describe() const override {
+ return "equals string: " + Catch::Detail::stringify( m_substr );
+ }
+ };
+
+ struct Contains : StringHolder {
+ Contains( NSString* substr ) : StringHolder( substr ){}
+
+ bool match( NSString* const& str ) const override {
+ return (str != nil || m_substr == nil ) &&
+ [str rangeOfString:m_substr].location != NSNotFound;
+ }
+
+ std::string describe() const override {
+ return "contains string: " + Catch::Detail::stringify( m_substr );
+ }
+ };
+
+ struct StartsWith : StringHolder {
+ StartsWith( NSString* substr ) : StringHolder( substr ){}
+
+ bool match( NSString* const& str ) const override {
+ return (str != nil || m_substr == nil ) &&
+ [str rangeOfString:m_substr].location == 0;
+ }
+
+ std::string describe() const override {
+ return "starts with: " + Catch::Detail::stringify( m_substr );
+ }
+ };
+ struct EndsWith : StringHolder {
+ EndsWith( NSString* substr ) : StringHolder( substr ){}
+
+ bool match( NSString* const& str ) const override {
+ return (str != nil || m_substr == nil ) &&
+ [str rangeOfString:m_substr].location == [str length] - [m_substr length];
+ }
+
+ std::string describe() const override {
+ return "ends with: " + Catch::Detail::stringify( m_substr );
+ }
+ };
+
+ } // namespace NSStringMatchers
+ } // namespace Impl
+
+ inline Impl::NSStringMatchers::Equals
+ Equals( NSString* substr ){ return Impl::NSStringMatchers::Equals( substr ); }
+
+ inline Impl::NSStringMatchers::Contains
+ Contains( NSString* substr ){ return Impl::NSStringMatchers::Contains( substr ); }
+
+ inline Impl::NSStringMatchers::StartsWith
+ StartsWith( NSString* substr ){ return Impl::NSStringMatchers::StartsWith( substr ); }
+
+ inline Impl::NSStringMatchers::EndsWith
+ EndsWith( NSString* substr ){ return Impl::NSStringMatchers::EndsWith( substr ); }
+
+ } // namespace Matchers
+
+ using namespace Matchers;
+
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+
+} // namespace Catch
+
+///////////////////////////////////////////////////////////////////////////////
+#define OC_MAKE_UNIQUE_NAME( root, uniqueSuffix ) root##uniqueSuffix
+#define OC_TEST_CASE2( name, desc, uniqueSuffix ) \
++(NSString*) OC_MAKE_UNIQUE_NAME( Catch_Name_test_, uniqueSuffix ) \
+{ \
+return @ name; \
+} \
++(NSString*) OC_MAKE_UNIQUE_NAME( Catch_Description_test_, uniqueSuffix ) \
+{ \
+return @ desc; \
+} \
+-(void) OC_MAKE_UNIQUE_NAME( Catch_TestCase_test_, uniqueSuffix )
+
+#define OC_TEST_CASE( name, desc ) OC_TEST_CASE2( name, desc, __LINE__ )
+
+// end catch_objc.hpp
+#endif
+
+#ifdef CATCH_CONFIG_EXTERNAL_INTERFACES
+// start catch_external_interfaces.h
+
+// start catch_reporter_bases.hpp
+
+// start catch_interfaces_reporter.h
+
+// start catch_config.hpp
+
+// start catch_test_spec_parser.h
+
+#ifdef __clang__
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Wpadded"
+#endif
+
+// start catch_test_spec.h
+
+#ifdef __clang__
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Wpadded"
+#endif
+
+// start catch_wildcard_pattern.h
+
+namespace Catch
+{
+ class WildcardPattern {
+ enum WildcardPosition {
+ NoWildcard = 0,
+ WildcardAtStart = 1,
+ WildcardAtEnd = 2,
+ WildcardAtBothEnds = WildcardAtStart | WildcardAtEnd
+ };
+
+ public:
+
+ WildcardPattern( std::string const& pattern, CaseSensitive::Choice caseSensitivity );
+ virtual ~WildcardPattern() = default;
+ virtual bool matches( std::string const& str ) const;
+
+ private:
+ std::string adjustCase( std::string const& str ) const;
+ CaseSensitive::Choice m_caseSensitivity;
+ WildcardPosition m_wildcard = NoWildcard;
+ std::string m_pattern;
+ };
+}
+
+// end catch_wildcard_pattern.h
+#include <string>
+#include <vector>
+#include <memory>
+
+namespace Catch {
+
+ class TestSpec {
+ struct Pattern {
+ virtual ~Pattern();
+ virtual bool matches( TestCaseInfo const& testCase ) const = 0;
+ };
+ using PatternPtr = std::shared_ptr<Pattern>;
+
+ class NamePattern : public Pattern {
+ public:
+ NamePattern( std::string const& name );
+ virtual ~NamePattern();
+ bool matches( TestCaseInfo const& testCase ) const override;
+ private:
+ WildcardPattern m_wildcardPattern;
+ };
+
+ class TagPattern : public Pattern {
+ public:
+ TagPattern( std::string const& tag );
+ virtual ~TagPattern();
+ bool matches( TestCaseInfo const& testCase ) const override;
+ private:
+ std::string m_tag;
+ };
+
+ class ExcludedPattern : public Pattern {
+ public:
+ ExcludedPattern( PatternPtr const& underlyingPattern );
+ virtual ~ExcludedPattern();
+ bool matches( TestCaseInfo const& testCase ) const override;
+ private:
+ PatternPtr m_underlyingPattern;
+ };
+
+ struct Filter {
+ std::vector<PatternPtr> m_patterns;
+
+ bool matches( TestCaseInfo const& testCase ) const;
+ };
+
+ public:
+ bool hasFilters() const;
+ bool matches( TestCaseInfo const& testCase ) const;
+
+ private:
+ std::vector<Filter> m_filters;
+
+ friend class TestSpecParser;
+ };
+}
+
+#ifdef __clang__
+#pragma clang diagnostic pop
+#endif
+
+// end catch_test_spec.h
+// start catch_interfaces_tag_alias_registry.h
+
+#include <string>
+
+namespace Catch {
+
+ struct TagAlias;
+
+ struct ITagAliasRegistry {
+ virtual ~ITagAliasRegistry();
+ // Nullptr if not present
+ virtual TagAlias const* find( std::string const& alias ) const = 0;
+ virtual std::string expandAliases( std::string const& unexpandedTestSpec ) const = 0;
+
+ static ITagAliasRegistry const& get();
+ };
+
+} // end namespace Catch
+
+// end catch_interfaces_tag_alias_registry.h
+namespace Catch {
+
+ class TestSpecParser {
+ enum Mode{ None, Name, QuotedName, Tag, EscapedName };
+ Mode m_mode = None;
+ bool m_exclusion = false;
+ std::size_t m_start = std::string::npos, m_pos = 0;
+ std::string m_arg;
+ std::vector<std::size_t> m_escapeChars;
+ TestSpec::Filter m_currentFilter;
+ TestSpec m_testSpec;
+ ITagAliasRegistry const* m_tagAliases = nullptr;
+
+ public:
+ TestSpecParser( ITagAliasRegistry const& tagAliases );
+
+ TestSpecParser& parse( std::string const& arg );
+ TestSpec testSpec();
+
+ private:
+ void visitChar( char c );
+ void startNewMode( Mode mode, std::size_t start );
+ void escape();
+ std::string subString() const;
+
+ template<typename T>
+ void addPattern() {
+ std::string token = subString();
+ for( std::size_t i = 0; i < m_escapeChars.size(); ++i )
+ token = token.substr( 0, m_escapeChars[i]-m_start-i ) + token.substr( m_escapeChars[i]-m_start-i+1 );
+ m_escapeChars.clear();
+ if( startsWith( token, "exclude:" ) ) {
+ m_exclusion = true;
+ token = token.substr( 8 );
+ }
+ if( !token.empty() ) {
+ TestSpec::PatternPtr pattern = std::make_shared<T>( token );
+ if( m_exclusion )
+ pattern = std::make_shared<TestSpec::ExcludedPattern>( pattern );
+ m_currentFilter.m_patterns.push_back( pattern );
+ }
+ m_exclusion = false;
+ m_mode = None;
+ }
+
+ void addFilter();
+ };
+ TestSpec parseTestSpec( std::string const& arg );
+
+} // namespace Catch
+
+#ifdef __clang__
+#pragma clang diagnostic pop
+#endif
+
+// end catch_test_spec_parser.h
+// Libstdc++ doesn't like incomplete classes for unique_ptr
+
+#include <memory>
+#include <vector>
+#include <string>
+
+#ifndef CATCH_CONFIG_CONSOLE_WIDTH
+#define CATCH_CONFIG_CONSOLE_WIDTH 80
+#endif
+
+namespace Catch {
+
+ struct IStream;
+
+ struct ConfigData {
+ bool listTests = false;
+ bool listTags = false;
+ bool listReporters = false;
+ bool listTestNamesOnly = false;
+
+ bool showSuccessfulTests = false;
+ bool shouldDebugBreak = false;
+ bool noThrow = false;
+ bool showHelp = false;
+ bool showInvisibles = false;
+ bool filenamesAsTags = false;
+ bool libIdentify = false;
+
+ int abortAfter = -1;
+ unsigned int rngSeed = 0;
+ int benchmarkResolutionMultiple = 100;
+
+ Verbosity verbosity = Verbosity::Normal;
+ WarnAbout::What warnings = WarnAbout::Nothing;
+ ShowDurations::OrNot showDurations = ShowDurations::DefaultForReporter;
+ RunTests::InWhatOrder runOrder = RunTests::InDeclarationOrder;
+ UseColour::YesOrNo useColour = UseColour::Auto;
+ WaitForKeypress::When waitForKeypress = WaitForKeypress::Never;
+
+ std::string outputFilename;
+ std::string name;
+ std::string processName;
+#ifndef CATCH_CONFIG_DEFAULT_REPORTER
+#define CATCH_CONFIG_DEFAULT_REPORTER "console"
+#endif
+ std::string reporterName = CATCH_CONFIG_DEFAULT_REPORTER;
+#undef CATCH_CONFIG_DEFAULT_REPORTER
+
+ std::vector<std::string> testsOrTags;
+ std::vector<std::string> sectionsToRun;
+ };
+
+ class Config : public IConfig {
+ public:
+
+ Config() = default;
+ Config( ConfigData const& data );
+ virtual ~Config() = default;
+
+ std::string const& getFilename() const;
+
+ bool listTests() const;
+ bool listTestNamesOnly() const;
+ bool listTags() const;
+ bool listReporters() const;
+
+ std::string getProcessName() const;
+ std::string const& getReporterName() const;
+
+ std::vector<std::string> const& getTestsOrTags() const override;
+ std::vector<std::string> const& getSectionsToRun() const override;
+
+ TestSpec const& testSpec() const override;
+ bool hasTestFilters() const override;
+
+ bool showHelp() const;
+
+ // IConfig interface
+ bool allowThrows() const override;
+ std::ostream& stream() const override;
+ std::string name() const override;
+ bool includeSuccessfulResults() const override;
+ bool warnAboutMissingAssertions() const override;
+ bool warnAboutNoTests() const override;
+ ShowDurations::OrNot showDurations() const override;
+ RunTests::InWhatOrder runOrder() const override;
+ unsigned int rngSeed() const override;
+ int benchmarkResolutionMultiple() const override;
+ UseColour::YesOrNo useColour() const override;
+ bool shouldDebugBreak() const override;
+ int abortAfter() const override;
+ bool showInvisibles() const override;
+ Verbosity verbosity() const override;
+
+ private:
+
+ IStream const* openStream();
+ ConfigData m_data;
+
+ std::unique_ptr<IStream const> m_stream;
+ TestSpec m_testSpec;
+ bool m_hasTestFilters = false;
+ };
+
+} // end namespace Catch
+
+// end catch_config.hpp
+// start catch_assertionresult.h
+
+#include <string>
+
+namespace Catch {
+
+ struct AssertionResultData
+ {
+ AssertionResultData() = delete;
+
+ AssertionResultData( ResultWas::OfType _resultType, LazyExpression const& _lazyExpression );
+
+ std::string message;
+ mutable std::string reconstructedExpression;
+ LazyExpression lazyExpression;
+ ResultWas::OfType resultType;
+
+ std::string reconstructExpression() const;
+ };
+
+ class AssertionResult {
+ public:
+ AssertionResult() = delete;
+ AssertionResult( AssertionInfo const& info, AssertionResultData const& data );
+
+ bool isOk() const;
+ bool succeeded() const;
+ ResultWas::OfType getResultType() const;
+ bool hasExpression() const;
+ bool hasMessage() const;
+ std::string getExpression() const;
+ std::string getExpressionInMacro() const;
+ bool hasExpandedExpression() const;
+ std::string getExpandedExpression() const;
+ std::string getMessage() const;
+ SourceLineInfo getSourceInfo() const;
+ StringRef getTestMacroName() const;
+
+ //protected:
+ AssertionInfo m_info;
+ AssertionResultData m_resultData;
+ };
+
+} // end namespace Catch
+
+// end catch_assertionresult.h
+// start catch_option.hpp
+
+namespace Catch {
+
+ // An optional type
+ template<typename T>
+ class Option {
+ public:
+ Option() : nullableValue( nullptr ) {}
+ Option( T const& _value )
+ : nullableValue( new( storage ) T( _value ) )
+ {}
+ Option( Option const& _other )
+ : nullableValue( _other ? new( storage ) T( *_other ) : nullptr )
+ {}
+
+ ~Option() {
+ reset();
+ }
+
+ Option& operator= ( Option const& _other ) {
+ if( &_other != this ) {
+ reset();
+ if( _other )
+ nullableValue = new( storage ) T( *_other );
+ }
+ return *this;
+ }
+ Option& operator = ( T const& _value ) {
+ reset();
+ nullableValue = new( storage ) T( _value );
+ return *this;
+ }
+
+ void reset() {
+ if( nullableValue )
+ nullableValue->~T();
+ nullableValue = nullptr;
+ }
+
+ T& operator*() { return *nullableValue; }
+ T const& operator*() const { return *nullableValue; }
+ T* operator->() { return nullableValue; }
+ const T* operator->() const { return nullableValue; }
+
+ T valueOr( T const& defaultValue ) const {
+ return nullableValue ? *nullableValue : defaultValue;
+ }
+
+ bool some() const { return nullableValue != nullptr; }
+ bool none() const { return nullableValue == nullptr; }
+
+ bool operator !() const { return nullableValue == nullptr; }
+ explicit operator bool() const {
+ return some();
+ }
+
+ private:
+ T *nullableValue;
+ alignas(alignof(T)) char storage[sizeof(T)];
+ };
+
+} // end namespace Catch
+
+// end catch_option.hpp
+#include <string>
+#include <iosfwd>
+#include <map>
+#include <set>
+#include <memory>
+
+namespace Catch {
+
+ struct ReporterConfig {
+ explicit ReporterConfig( IConfigPtr const& _fullConfig );
+
+ ReporterConfig( IConfigPtr const& _fullConfig, std::ostream& _stream );
+
+ std::ostream& stream() const;
+ IConfigPtr fullConfig() const;
+
+ private:
+ std::ostream* m_stream;
+ IConfigPtr m_fullConfig;
+ };
+
+ struct ReporterPreferences {
+ bool shouldRedirectStdOut = false;
+ bool shouldReportAllAssertions = false;
+ };
+
+ template<typename T>
+ struct LazyStat : Option<T> {
+ LazyStat& operator=( T const& _value ) {
+ Option<T>::operator=( _value );
+ used = false;
+ return *this;
+ }
+ void reset() {
+ Option<T>::reset();
+ used = false;
+ }
+ bool used = false;
+ };
+
+ struct TestRunInfo {
+ TestRunInfo( std::string const& _name );
+ std::string name;
+ };
+ struct GroupInfo {
+ GroupInfo( std::string const& _name,
+ std::size_t _groupIndex,
+ std::size_t _groupsCount );
+
+ std::string name;
+ std::size_t groupIndex;
+ std::size_t groupsCounts;
+ };
+
+ struct AssertionStats {
+ AssertionStats( AssertionResult const& _assertionResult,
+ std::vector<MessageInfo> const& _infoMessages,
+ Totals const& _totals );
+
+ AssertionStats( AssertionStats const& ) = default;
+ AssertionStats( AssertionStats && ) = default;
+ AssertionStats& operator = ( AssertionStats const& ) = delete;
+ AssertionStats& operator = ( AssertionStats && ) = delete;
+ virtual ~AssertionStats();
+
+ AssertionResult assertionResult;
+ std::vector<MessageInfo> infoMessages;
+ Totals totals;
+ };
+
+ struct SectionStats {
+ SectionStats( SectionInfo const& _sectionInfo,
+ Counts const& _assertions,
+ double _durationInSeconds,
+ bool _missingAssertions );
+ SectionStats( SectionStats const& ) = default;
+ SectionStats( SectionStats && ) = default;
+ SectionStats& operator = ( SectionStats const& ) = default;
+ SectionStats& operator = ( SectionStats && ) = default;
+ virtual ~SectionStats();
+
+ SectionInfo sectionInfo;
+ Counts assertions;
+ double durationInSeconds;
+ bool missingAssertions;
+ };
+
+ struct TestCaseStats {
+ TestCaseStats( TestCaseInfo const& _testInfo,
+ Totals const& _totals,
+ std::string const& _stdOut,
+ std::string const& _stdErr,
+ bool _aborting );
+
+ TestCaseStats( TestCaseStats const& ) = default;
+ TestCaseStats( TestCaseStats && ) = default;
+ TestCaseStats& operator = ( TestCaseStats const& ) = default;
+ TestCaseStats& operator = ( TestCaseStats && ) = default;
+ virtual ~TestCaseStats();
+
+ TestCaseInfo testInfo;
+ Totals totals;
+ std::string stdOut;
+ std::string stdErr;
+ bool aborting;
+ };
+
+ struct TestGroupStats {
+ TestGroupStats( GroupInfo const& _groupInfo,
+ Totals const& _totals,
+ bool _aborting );
+ TestGroupStats( GroupInfo const& _groupInfo );
+
+ TestGroupStats( TestGroupStats const& ) = default;
+ TestGroupStats( TestGroupStats && ) = default;
+ TestGroupStats& operator = ( TestGroupStats const& ) = default;
+ TestGroupStats& operator = ( TestGroupStats && ) = default;
+ virtual ~TestGroupStats();
+
+ GroupInfo groupInfo;
+ Totals totals;
+ bool aborting;
+ };
+
+ struct TestRunStats {
+ TestRunStats( TestRunInfo const& _runInfo,
+ Totals const& _totals,
+ bool _aborting );
+
+ TestRunStats( TestRunStats const& ) = default;
+ TestRunStats( TestRunStats && ) = default;
+ TestRunStats& operator = ( TestRunStats const& ) = default;
+ TestRunStats& operator = ( TestRunStats && ) = default;
+ virtual ~TestRunStats();
+
+ TestRunInfo runInfo;
+ Totals totals;
+ bool aborting;
+ };
+
+ struct BenchmarkInfo {
+ std::string name;
+ };
+ struct BenchmarkStats {
+ BenchmarkInfo info;
+ std::size_t iterations;
+ uint64_t elapsedTimeInNanoseconds;
+ };
+
+ struct IStreamingReporter {
+ virtual ~IStreamingReporter() = default;
+
+ // Implementing class must also provide the following static methods:
+ // static std::string getDescription();
+ // static std::set<Verbosity> getSupportedVerbosities()
+
+ virtual ReporterPreferences getPreferences() const = 0;
+
+ virtual void noMatchingTestCases( std::string const& spec ) = 0;
+
+ virtual void testRunStarting( TestRunInfo const& testRunInfo ) = 0;
+ virtual void testGroupStarting( GroupInfo const& groupInfo ) = 0;
+
+ virtual void testCaseStarting( TestCaseInfo const& testInfo ) = 0;
+ virtual void sectionStarting( SectionInfo const& sectionInfo ) = 0;
+
+ // *** experimental ***
+ virtual void benchmarkStarting( BenchmarkInfo const& ) {}
+
+ virtual void assertionStarting( AssertionInfo const& assertionInfo ) = 0;
+
+ // The return value indicates if the messages buffer should be cleared:
+ virtual bool assertionEnded( AssertionStats const& assertionStats ) = 0;
+
+ // *** experimental ***
+ virtual void benchmarkEnded( BenchmarkStats const& ) {}
+
+ virtual void sectionEnded( SectionStats const& sectionStats ) = 0;
+ virtual void testCaseEnded( TestCaseStats const& testCaseStats ) = 0;
+ virtual void testGroupEnded( TestGroupStats const& testGroupStats ) = 0;
+ virtual void testRunEnded( TestRunStats const& testRunStats ) = 0;
+
+ virtual void skipTest( TestCaseInfo const& testInfo ) = 0;
+
+ // Default empty implementation provided
+ virtual void fatalErrorEncountered( StringRef name );
+
+ virtual bool isMulti() const;
+ };
+ using IStreamingReporterPtr = std::unique_ptr<IStreamingReporter>;
+
+ struct IReporterFactory {
+ virtual ~IReporterFactory();
+ virtual IStreamingReporterPtr create( ReporterConfig const& config ) const = 0;
+ virtual std::string getDescription() const = 0;
+ };
+ using IReporterFactoryPtr = std::shared_ptr<IReporterFactory>;
+
+ struct IReporterRegistry {
+ using FactoryMap = std::map<std::string, IReporterFactoryPtr>;
+ using Listeners = std::vector<IReporterFactoryPtr>;
+
+ virtual ~IReporterRegistry();
+ virtual IStreamingReporterPtr create( std::string const& name, IConfigPtr const& config ) const = 0;
+ virtual FactoryMap const& getFactories() const = 0;
+ virtual Listeners const& getListeners() const = 0;
+ };
+
+} // end namespace Catch
+
+// end catch_interfaces_reporter.h
+#include <algorithm>
+#include <cstring>
+#include <cfloat>
+#include <cstdio>
+#include <cassert>
+#include <memory>
+#include <ostream>
+
+namespace Catch {
+ void prepareExpandedExpression(AssertionResult& result);
+
+ // Returns double formatted as %.3f (format expected on output)
+ std::string getFormattedDuration( double duration );
+
+ std::string serializeFilters( std::vector<std::string> const& container );
+
+ template<typename DerivedT>
+ struct StreamingReporterBase : IStreamingReporter {
+
+ StreamingReporterBase( ReporterConfig const& _config )
+ : m_config( _config.fullConfig() ),
+ stream( _config.stream() )
+ {
+ m_reporterPrefs.shouldRedirectStdOut = false;
+ if( !DerivedT::getSupportedVerbosities().count( m_config->verbosity() ) )
+ CATCH_ERROR( "Verbosity level not supported by this reporter" );
+ }
+
+ ReporterPreferences getPreferences() const override {
+ return m_reporterPrefs;
+ }
+
+ static std::set<Verbosity> getSupportedVerbosities() {
+ return { Verbosity::Normal };
+ }
+
+ ~StreamingReporterBase() override = default;
+
+ void noMatchingTestCases(std::string const&) override {}
+
+ void testRunStarting(TestRunInfo const& _testRunInfo) override {
+ currentTestRunInfo = _testRunInfo;
+ }
+
+ void testGroupStarting(GroupInfo const& _groupInfo) override {
+ currentGroupInfo = _groupInfo;
+ }
+
+ void testCaseStarting(TestCaseInfo const& _testInfo) override {
+ currentTestCaseInfo = _testInfo;
+ }
+ void sectionStarting(SectionInfo const& _sectionInfo) override {
+ m_sectionStack.push_back(_sectionInfo);
+ }
+
+ void sectionEnded(SectionStats const& /* _sectionStats */) override {
+ m_sectionStack.pop_back();
+ }
+ void testCaseEnded(TestCaseStats const& /* _testCaseStats */) override {
+ currentTestCaseInfo.reset();
+ }
+ void testGroupEnded(TestGroupStats const& /* _testGroupStats */) override {
+ currentGroupInfo.reset();
+ }
+ void testRunEnded(TestRunStats const& /* _testRunStats */) override {
+ currentTestCaseInfo.reset();
+ currentGroupInfo.reset();
+ currentTestRunInfo.reset();
+ }
+
+ void skipTest(TestCaseInfo const&) override {
+ // Don't do anything with this by default.
+ // It can optionally be overridden in the derived class.
+ }
+
+ IConfigPtr m_config;
+ std::ostream& stream;
+
+ LazyStat<TestRunInfo> currentTestRunInfo;
+ LazyStat<GroupInfo> currentGroupInfo;
+ LazyStat<TestCaseInfo> currentTestCaseInfo;
+
+ std::vector<SectionInfo> m_sectionStack;
+ ReporterPreferences m_reporterPrefs;
+ };
+
+ template<typename DerivedT>
+ struct CumulativeReporterBase : IStreamingReporter {
+ template<typename T, typename ChildNodeT>
+ struct Node {
+ explicit Node( T const& _value ) : value( _value ) {}
+ virtual ~Node() {}
+
+ using ChildNodes = std::vector<std::shared_ptr<ChildNodeT>>;
+ T value;
+ ChildNodes children;
+ };
+ struct SectionNode {
+ explicit SectionNode(SectionStats const& _stats) : stats(_stats) {}
+ virtual ~SectionNode() = default;
+
+ bool operator == (SectionNode const& other) const {
+ return stats.sectionInfo.lineInfo == other.stats.sectionInfo.lineInfo;
+ }
+ bool operator == (std::shared_ptr<SectionNode> const& other) const {
+ return operator==(*other);
+ }
+
+ SectionStats stats;
+ using ChildSections = std::vector<std::shared_ptr<SectionNode>>;
+ using Assertions = std::vector<AssertionStats>;
+ ChildSections childSections;
+ Assertions assertions;
+ std::string stdOut;
+ std::string stdErr;
+ };
+
+ struct BySectionInfo {
+ BySectionInfo( SectionInfo const& other ) : m_other( other ) {}
+ BySectionInfo( BySectionInfo const& other ) : m_other( other.m_other ) {}
+ bool operator() (std::shared_ptr<SectionNode> const& node) const {
+ return ((node->stats.sectionInfo.name == m_other.name) &&
+ (node->stats.sectionInfo.lineInfo == m_other.lineInfo));
+ }
+ void operator=(BySectionInfo const&) = delete;
+
+ private:
+ SectionInfo const& m_other;
+ };
+
+ using TestCaseNode = Node<TestCaseStats, SectionNode>;
+ using TestGroupNode = Node<TestGroupStats, TestCaseNode>;
+ using TestRunNode = Node<TestRunStats, TestGroupNode>;
+
+ CumulativeReporterBase( ReporterConfig const& _config )
+ : m_config( _config.fullConfig() ),
+ stream( _config.stream() )
+ {
+ m_reporterPrefs.shouldRedirectStdOut = false;
+ if( !DerivedT::getSupportedVerbosities().count( m_config->verbosity() ) )
+ CATCH_ERROR( "Verbosity level not supported by this reporter" );
+ }
+ ~CumulativeReporterBase() override = default;
+
+ ReporterPreferences getPreferences() const override {
+ return m_reporterPrefs;
+ }
+
+ static std::set<Verbosity> getSupportedVerbosities() {
+ return { Verbosity::Normal };
+ }
+
+ void testRunStarting( TestRunInfo const& ) override {}
+ void testGroupStarting( GroupInfo const& ) override {}
+
+ void testCaseStarting( TestCaseInfo const& ) override {}
+
+ void sectionStarting( SectionInfo const& sectionInfo ) override {
+ SectionStats incompleteStats( sectionInfo, Counts(), 0, false );
+ std::shared_ptr<SectionNode> node;
+ if( m_sectionStack.empty() ) {
+ if( !m_rootSection )
+ m_rootSection = std::make_shared<SectionNode>( incompleteStats );
+ node = m_rootSection;
+ }
+ else {
+ SectionNode& parentNode = *m_sectionStack.back();
+ auto it =
+ std::find_if( parentNode.childSections.begin(),
+ parentNode.childSections.end(),
+ BySectionInfo( sectionInfo ) );
+ if( it == parentNode.childSections.end() ) {
+ node = std::make_shared<SectionNode>( incompleteStats );
+ parentNode.childSections.push_back( node );
+ }
+ else
+ node = *it;
+ }
+ m_sectionStack.push_back( node );
+ m_deepestSection = std::move(node);
+ }
+
+ void assertionStarting(AssertionInfo const&) override {}
+
+ bool assertionEnded(AssertionStats const& assertionStats) override {
+ assert(!m_sectionStack.empty());
+ // AssertionResult holds a pointer to a temporary DecomposedExpression,
+ // which getExpandedExpression() calls to build the expression string.
+ // Our section stack copy of the assertionResult will likely outlive the
+ // temporary, so it must be expanded or discarded now to avoid calling
+ // a destroyed object later.
+ prepareExpandedExpression(const_cast<AssertionResult&>( assertionStats.assertionResult ) );
+ SectionNode& sectionNode = *m_sectionStack.back();
+ sectionNode.assertions.push_back(assertionStats);
+ return true;
+ }
+ void sectionEnded(SectionStats const& sectionStats) override {
+ assert(!m_sectionStack.empty());
+ SectionNode& node = *m_sectionStack.back();
+ node.stats = sectionStats;
+ m_sectionStack.pop_back();
+ }
+ void testCaseEnded(TestCaseStats const& testCaseStats) override {
+ auto node = std::make_shared<TestCaseNode>(testCaseStats);
+ assert(m_sectionStack.size() == 0);
+ node->children.push_back(m_rootSection);
+ m_testCases.push_back(node);
+ m_rootSection.reset();
+
+ assert(m_deepestSection);
+ m_deepestSection->stdOut = testCaseStats.stdOut;
+ m_deepestSection->stdErr = testCaseStats.stdErr;
+ }
+ void testGroupEnded(TestGroupStats const& testGroupStats) override {
+ auto node = std::make_shared<TestGroupNode>(testGroupStats);
+ node->children.swap(m_testCases);
+ m_testGroups.push_back(node);
+ }
+ void testRunEnded(TestRunStats const& testRunStats) override {
+ auto node = std::make_shared<TestRunNode>(testRunStats);
+ node->children.swap(m_testGroups);
+ m_testRuns.push_back(node);
+ testRunEndedCumulative();
+ }
+ virtual void testRunEndedCumulative() = 0;
+
+ void skipTest(TestCaseInfo const&) override {}
+
+ IConfigPtr m_config;
+ std::ostream& stream;
+ std::vector<AssertionStats> m_assertions;
+ std::vector<std::vector<std::shared_ptr<SectionNode>>> m_sections;
+ std::vector<std::shared_ptr<TestCaseNode>> m_testCases;
+ std::vector<std::shared_ptr<TestGroupNode>> m_testGroups;
+
+ std::vector<std::shared_ptr<TestRunNode>> m_testRuns;
+
+ std::shared_ptr<SectionNode> m_rootSection;
+ std::shared_ptr<SectionNode> m_deepestSection;
+ std::vector<std::shared_ptr<SectionNode>> m_sectionStack;
+ ReporterPreferences m_reporterPrefs;
+ };
+
+ template<char C>
+ char const* getLineOfChars() {
+ static char line[CATCH_CONFIG_CONSOLE_WIDTH] = {0};
+ if( !*line ) {
+ std::memset( line, C, CATCH_CONFIG_CONSOLE_WIDTH-1 );
+ line[CATCH_CONFIG_CONSOLE_WIDTH-1] = 0;
+ }
+ return line;
+ }
+
+ struct TestEventListenerBase : StreamingReporterBase<TestEventListenerBase> {
+ TestEventListenerBase( ReporterConfig const& _config );
+
+ static std::set<Verbosity> getSupportedVerbosities();
+
+ void assertionStarting(AssertionInfo const&) override;
+ bool assertionEnded(AssertionStats const&) override;
+ };
+
+} // end namespace Catch
+
+// end catch_reporter_bases.hpp
+// start catch_console_colour.h
+
+namespace Catch {
+
+ struct Colour {
+ enum Code {
+ None = 0,
+
+ White,
+ Red,
+ Green,
+ Blue,
+ Cyan,
+ Yellow,
+ Grey,
+
+ Bright = 0x10,
+
+ BrightRed = Bright | Red,
+ BrightGreen = Bright | Green,
+ LightGrey = Bright | Grey,
+ BrightWhite = Bright | White,
+ BrightYellow = Bright | Yellow,
+
+ // By intention
+ FileName = LightGrey,
+ Warning = BrightYellow,
+ ResultError = BrightRed,
+ ResultSuccess = BrightGreen,
+ ResultExpectedFailure = Warning,
+
+ Error = BrightRed,
+ Success = Green,
+
+ OriginalExpression = Cyan,
+ ReconstructedExpression = BrightYellow,
+
+ SecondaryText = LightGrey,
+ Headers = White
+ };
+
+ // Use constructed object for RAII guard
+ Colour( Code _colourCode );
+ Colour( Colour&& other ) noexcept;
+ Colour& operator=( Colour&& other ) noexcept;
+ ~Colour();
+
+ // Use static method for one-shot changes
+ static void use( Code _colourCode );
+
+ private:
+ bool m_moved = false;
+ };
+
+ std::ostream& operator << ( std::ostream& os, Colour const& );
+
+} // end namespace Catch
+
+// end catch_console_colour.h
+// start catch_reporter_registrars.hpp
+
+
+namespace Catch {
+
+ template<typename T>
+ class ReporterRegistrar {
+
+ class ReporterFactory : public IReporterFactory {
+
+ IStreamingReporterPtr create( ReporterConfig const& config ) const override {
+ return std::unique_ptr<T>( new T( config ) );
+ }
+
+ std::string getDescription() const override {
+ return T::getDescription();
+ }
+ };
+
+ public:
+
+ explicit ReporterRegistrar( std::string const& name ) {
+ getMutableRegistryHub().registerReporter( name, std::make_shared<ReporterFactory>() );
+ }
+ };
+
+ template<typename T>
+ class ListenerRegistrar {
+
+ class ListenerFactory : public IReporterFactory {
+
+ IStreamingReporterPtr create( ReporterConfig const& config ) const override {
+ return std::unique_ptr<T>( new T( config ) );
+ }
+ std::string getDescription() const override {
+ return std::string();
+ }
+ };
+
+ public:
+
+ ListenerRegistrar() {
+ getMutableRegistryHub().registerListener( std::make_shared<ListenerFactory>() );
+ }
+ };
+}
+
+#if !defined(CATCH_CONFIG_DISABLE)
+
+#define CATCH_REGISTER_REPORTER( name, reporterType ) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ Catch::ReporterRegistrar<reporterType> catch_internal_RegistrarFor##reporterType( name ); } \
+ CATCH_INTERNAL_UNSUPPRESS_GLOBALS_WARNINGS
+
+#define CATCH_REGISTER_LISTENER( listenerType ) \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS \
+ namespace{ Catch::ListenerRegistrar<listenerType> catch_internal_RegistrarFor##listenerType; } \
+ CATCH_INTERNAL_SUPPRESS_GLOBALS_WARNINGS
+#else // CATCH_CONFIG_DISABLE
+
+#define CATCH_REGISTER_REPORTER(name, reporterType)
+#define CATCH_REGISTER_LISTENER(listenerType)
+
+#endif // CATCH_CONFIG_DISABLE
+
+// end catch_reporter_registrars.hpp
+// Allow users to base their work off existing reporters
+// start catch_reporter_compact.h
+
+namespace Catch {
+
+ struct CompactReporter : StreamingReporterBase<CompactReporter> {
+
+ using StreamingReporterBase::StreamingReporterBase;
+
+ ~CompactReporter() override;
+
+ static std::string getDescription();
+
+ ReporterPreferences getPreferences() const override;
+
+ void noMatchingTestCases(std::string const& spec) override;
+
+ void assertionStarting(AssertionInfo const&) override;
+
+ bool assertionEnded(AssertionStats const& _assertionStats) override;
+
+ void sectionEnded(SectionStats const& _sectionStats) override;
+
+ void testRunEnded(TestRunStats const& _testRunStats) override;
+
+ };
+
+} // end namespace Catch
+
+// end catch_reporter_compact.h
+// start catch_reporter_console.h
+
+#if defined(_MSC_VER)
+#pragma warning(push)
+#pragma warning(disable:4061) // Not all labels are EXPLICITLY handled in switch
+ // Note that 4062 (not all labels are handled
+ // and default is missing) is enabled
+#endif
+
+namespace Catch {
+ // Fwd decls
+ struct SummaryColumn;
+ class TablePrinter;
+
+ struct ConsoleReporter : StreamingReporterBase<ConsoleReporter> {
+ std::unique_ptr<TablePrinter> m_tablePrinter;
+
+ ConsoleReporter(ReporterConfig const& config);
+ ~ConsoleReporter() override;
+ static std::string getDescription();
+
+ void noMatchingTestCases(std::string const& spec) override;
+
+ void assertionStarting(AssertionInfo const&) override;
+
+ bool assertionEnded(AssertionStats const& _assertionStats) override;
+
+ void sectionStarting(SectionInfo const& _sectionInfo) override;
+ void sectionEnded(SectionStats const& _sectionStats) override;
+
+ void benchmarkStarting(BenchmarkInfo const& info) override;
+ void benchmarkEnded(BenchmarkStats const& stats) override;
+
+ void testCaseEnded(TestCaseStats const& _testCaseStats) override;
+ void testGroupEnded(TestGroupStats const& _testGroupStats) override;
+ void testRunEnded(TestRunStats const& _testRunStats) override;
+ void testRunStarting(TestRunInfo const& _testRunInfo) override;
+ private:
+
+ void lazyPrint();
+
+ void lazyPrintWithoutClosingBenchmarkTable();
+ void lazyPrintRunInfo();
+ void lazyPrintGroupInfo();
+ void printTestCaseAndSectionHeader();
+
+ void printClosedHeader(std::string const& _name);
+ void printOpenHeader(std::string const& _name);
+
+ // if string has a : in first line will set indent to follow it on
+ // subsequent lines
+ void printHeaderString(std::string const& _string, std::size_t indent = 0);
+
+ void printTotals(Totals const& totals);
+ void printSummaryRow(std::string const& label, std::vector<SummaryColumn> const& cols, std::size_t row);
+
+ void printTotalsDivider(Totals const& totals);
+ void printSummaryDivider();
+ void printTestFilters();
+
+ private:
+ bool m_headerPrinted = false;
+ };
+
+} // end namespace Catch
+
+#if defined(_MSC_VER)
+#pragma warning(pop)
+#endif
+
+// end catch_reporter_console.h
+// start catch_reporter_junit.h
+
+// start catch_xmlwriter.h
+
+#include <vector>
+
+namespace Catch {
+
+ class XmlEncode {
+ public:
+ enum ForWhat { ForTextNodes, ForAttributes };
+
+ XmlEncode( std::string const& str, ForWhat forWhat = ForTextNodes );
+
+ void encodeTo( std::ostream& os ) const;
+
+ friend std::ostream& operator << ( std::ostream& os, XmlEncode const& xmlEncode );
+
+ private:
+ std::string m_str;
+ ForWhat m_forWhat;
+ };
+
+ class XmlWriter {
+ public:
+
+ class ScopedElement {
+ public:
+ ScopedElement( XmlWriter* writer );
+
+ ScopedElement( ScopedElement&& other ) noexcept;
+ ScopedElement& operator=( ScopedElement&& other ) noexcept;
+
+ ~ScopedElement();
+
+ ScopedElement& writeText( std::string const& text, bool indent = true );
+
+ template<typename T>
+ ScopedElement& writeAttribute( std::string const& name, T const& attribute ) {
+ m_writer->writeAttribute( name, attribute );
+ return *this;
+ }
+
+ private:
+ mutable XmlWriter* m_writer = nullptr;
+ };
+
+ XmlWriter( std::ostream& os = Catch::cout() );
+ ~XmlWriter();
+
+ XmlWriter( XmlWriter const& ) = delete;
+ XmlWriter& operator=( XmlWriter const& ) = delete;
+
+ XmlWriter& startElement( std::string const& name );
+
+ ScopedElement scopedElement( std::string const& name );
+
+ XmlWriter& endElement();
+
+ XmlWriter& writeAttribute( std::string const& name, std::string const& attribute );
+
+ XmlWriter& writeAttribute( std::string const& name, bool attribute );
+
+ template<typename T>
+ XmlWriter& writeAttribute( std::string const& name, T const& attribute ) {
+ ReusableStringStream rss;
+ rss << attribute;
+ return writeAttribute( name, rss.str() );
+ }
+
+ XmlWriter& writeText( std::string const& text, bool indent = true );
+
+ XmlWriter& writeComment( std::string const& text );
+
+ void writeStylesheetRef( std::string const& url );
+
+ XmlWriter& writeBlankLine();
+
+ void ensureTagClosed();
+
+ private:
+
+ void writeDeclaration();
+
+ void newlineIfNecessary();
+
+ bool m_tagIsOpen = false;
+ bool m_needsNewline = false;
+ std::vector<std::string> m_tags;
+ std::string m_indent;
+ std::ostream& m_os;
+ };
+
+}
+
+// end catch_xmlwriter.h
+namespace Catch {
+
+ class JunitReporter : public CumulativeReporterBase<JunitReporter> {
+ public:
+ JunitReporter(ReporterConfig const& _config);
+
+ ~JunitReporter() override;
+
+ static std::string getDescription();
+
+ void noMatchingTestCases(std::string const& /*spec*/) override;
+
+ void testRunStarting(TestRunInfo const& runInfo) override;
+
+ void testGroupStarting(GroupInfo const& groupInfo) override;
+
+ void testCaseStarting(TestCaseInfo const& testCaseInfo) override;
+ bool assertionEnded(AssertionStats const& assertionStats) override;
+
+ void testCaseEnded(TestCaseStats const& testCaseStats) override;
+
+ void testGroupEnded(TestGroupStats const& testGroupStats) override;
+
+ void testRunEndedCumulative() override;
+
+ void writeGroup(TestGroupNode const& groupNode, double suiteTime);
+
+ void writeTestCase(TestCaseNode const& testCaseNode);
+
+ void writeSection(std::string const& className,
+ std::string const& rootName,
+ SectionNode const& sectionNode);
+
+ void writeAssertions(SectionNode const& sectionNode);
+ void writeAssertion(AssertionStats const& stats);
+
+ XmlWriter xml;
+ Timer suiteTimer;
+ std::string stdOutForSuite;
+ std::string stdErrForSuite;
+ unsigned int unexpectedExceptions = 0;
+ bool m_okToFail = false;
+ };
+
+} // end namespace Catch
+
+// end catch_reporter_junit.h
+// start catch_reporter_xml.h
+
+namespace Catch {
+ class XmlReporter : public StreamingReporterBase<XmlReporter> {
+ public:
+ XmlReporter(ReporterConfig const& _config);
+
+ ~XmlReporter() override;
+
+ static std::string getDescription();
+
+ virtual std::string getStylesheetRef() const;
+
+ void writeSourceInfo(SourceLineInfo const& sourceInfo);
+
+ public: // StreamingReporterBase
+
+ void noMatchingTestCases(std::string const& s) override;
+
+ void testRunStarting(TestRunInfo const& testInfo) override;
+
+ void testGroupStarting(GroupInfo const& groupInfo) override;
+
+ void testCaseStarting(TestCaseInfo const& testInfo) override;
+
+ void sectionStarting(SectionInfo const& sectionInfo) override;
+
+ void assertionStarting(AssertionInfo const&) override;
+
+ bool assertionEnded(AssertionStats const& assertionStats) override;
+
+ void sectionEnded(SectionStats const& sectionStats) override;
+
+ void testCaseEnded(TestCaseStats const& testCaseStats) override;
+
+ void testGroupEnded(TestGroupStats const& testGroupStats) override;
+
+ void testRunEnded(TestRunStats const& testRunStats) override;
+
+ private:
+ Timer m_testCaseTimer;
+ XmlWriter m_xml;
+ int m_sectionDepth = 0;
+ };
+
+} // end namespace Catch
+
+// end catch_reporter_xml.h
+
+// end catch_external_interfaces.h
+#endif
+
+#endif // ! CATCH_CONFIG_IMPL_ONLY
+
+#ifdef CATCH_IMPL
+// start catch_impl.hpp
+
+#ifdef __clang__
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Wweak-vtables"
+#endif
+
+// Keep these here for external reporters
+// start catch_test_case_tracker.h
+
+#include <string>
+#include <vector>
+#include <memory>
+
+namespace Catch {
+namespace TestCaseTracking {
+
+ struct NameAndLocation {
+ std::string name;
+ SourceLineInfo location;
+
+ NameAndLocation( std::string const& _name, SourceLineInfo const& _location );
+ };
+
+ struct ITracker;
+
+ using ITrackerPtr = std::shared_ptr<ITracker>;
+
+ struct ITracker {
+ virtual ~ITracker();
+
+ // static queries
+ virtual NameAndLocation const& nameAndLocation() const = 0;
+
+ // dynamic queries
+ virtual bool isComplete() const = 0; // Successfully completed or failed
+ virtual bool isSuccessfullyCompleted() const = 0;
+ virtual bool isOpen() const = 0; // Started but not complete
+ virtual bool hasChildren() const = 0;
+
+ virtual ITracker& parent() = 0;
+
+ // actions
+ virtual void close() = 0; // Successfully complete
+ virtual void fail() = 0;
+ virtual void markAsNeedingAnotherRun() = 0;
+
+ virtual void addChild( ITrackerPtr const& child ) = 0;
+ virtual ITrackerPtr findChild( NameAndLocation const& nameAndLocation ) = 0;
+ virtual void openChild() = 0;
+
+ // Debug/ checking
+ virtual bool isSectionTracker() const = 0;
+ virtual bool isGeneratorTracker() const = 0;
+ };
+
+ class TrackerContext {
+
+ enum RunState {
+ NotStarted,
+ Executing,
+ CompletedCycle
+ };
+
+ ITrackerPtr m_rootTracker;
+ ITracker* m_currentTracker = nullptr;
+ RunState m_runState = NotStarted;
+
+ public:
+
+ ITracker& startRun();
+ void endRun();
+
+ void startCycle();
+ void completeCycle();
+
+ bool completedCycle() const;
+ ITracker& currentTracker();
+ void setCurrentTracker( ITracker* tracker );
+ };
+
+ class TrackerBase : public ITracker {
+ protected:
+ enum CycleState {
+ NotStarted,
+ Executing,
+ ExecutingChildren,
+ NeedsAnotherRun,
+ CompletedSuccessfully,
+ Failed
+ };
+
+ using Children = std::vector<ITrackerPtr>;
+ NameAndLocation m_nameAndLocation;
+ TrackerContext& m_ctx;
+ ITracker* m_parent;
+ Children m_children;
+ CycleState m_runState = NotStarted;
+
+ public:
+ TrackerBase( NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent );
+
+ NameAndLocation const& nameAndLocation() const override;
+ bool isComplete() const override;
+ bool isSuccessfullyCompleted() const override;
+ bool isOpen() const override;
+ bool hasChildren() const override;
+
+ void addChild( ITrackerPtr const& child ) override;
+
+ ITrackerPtr findChild( NameAndLocation const& nameAndLocation ) override;
+ ITracker& parent() override;
+
+ void openChild() override;
+
+ bool isSectionTracker() const override;
+ bool isGeneratorTracker() const override;
+
+ void open();
+
+ void close() override;
+ void fail() override;
+ void markAsNeedingAnotherRun() override;
+
+ private:
+ void moveToParent();
+ void moveToThis();
+ };
+
+ class SectionTracker : public TrackerBase {
+ std::vector<std::string> m_filters;
+ public:
+ SectionTracker( NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent );
+
+ bool isSectionTracker() const override;
+
+ bool isComplete() const override;
+
+ static SectionTracker& acquire( TrackerContext& ctx, NameAndLocation const& nameAndLocation );
+
+ void tryOpen();
+
+ void addInitialFilters( std::vector<std::string> const& filters );
+ void addNextFilters( std::vector<std::string> const& filters );
+ };
+
+} // namespace TestCaseTracking
+
+using TestCaseTracking::ITracker;
+using TestCaseTracking::TrackerContext;
+using TestCaseTracking::SectionTracker;
+
+} // namespace Catch
+
+// end catch_test_case_tracker.h
+
+// start catch_leak_detector.h
+
+namespace Catch {
+
+ struct LeakDetector {
+ LeakDetector();
+ ~LeakDetector();
+ };
+
+}
+// end catch_leak_detector.h
+// Cpp files will be included in the single-header file here
+// start catch_approx.cpp
+
+#include <cmath>
+#include <limits>
+
+namespace {
+
+// Performs equivalent check of std::fabs(lhs - rhs) <= margin
+// But without the subtraction to allow for INFINITY in comparison
+bool marginComparison(double lhs, double rhs, double margin) {
+ return (lhs + margin >= rhs) && (rhs + margin >= lhs);
+}
+
+}
+
+namespace Catch {
+namespace Detail {
+
+ Approx::Approx ( double value )
+ : m_epsilon( std::numeric_limits<float>::epsilon()*100 ),
+ m_margin( 0.0 ),
+ m_scale( 0.0 ),
+ m_value( value )
+ {}
+
+ Approx Approx::custom() {
+ return Approx( 0 );
+ }
+
+ Approx Approx::operator-() const {
+ auto temp(*this);
+ temp.m_value = -temp.m_value;
+ return temp;
+ }
+
+ std::string Approx::toString() const {
+ ReusableStringStream rss;
+ rss << "Approx( " << ::Catch::Detail::stringify( m_value ) << " )";
+ return rss.str();
+ }
+
+ bool Approx::equalityComparisonImpl(const double other) const {
+ // First try with fixed margin, then compute margin based on epsilon, scale and Approx's value
+ // Thanks to Richard Harris for his help refining the scaled margin value
+ return marginComparison(m_value, other, m_margin) || marginComparison(m_value, other, m_epsilon * (m_scale + std::fabs(m_value)));
+ }
+
+ void Approx::setMargin(double newMargin) {
+ CATCH_ENFORCE(newMargin >= 0,
+ "Invalid Approx::margin: " << newMargin << '.'
+ << " Approx::Margin has to be non-negative.");
+ m_margin = newMargin;
+ }
+
+ void Approx::setEpsilon(double newEpsilon) {
+ CATCH_ENFORCE(newEpsilon >= 0 && newEpsilon <= 1.0,
+ "Invalid Approx::epsilon: " << newEpsilon << '.'
+ << " Approx::epsilon has to be in [0, 1]");
+ m_epsilon = newEpsilon;
+ }
+
+} // end namespace Detail
+
+namespace literals {
+ Detail::Approx operator "" _a(long double val) {
+ return Detail::Approx(val);
+ }
+ Detail::Approx operator "" _a(unsigned long long val) {
+ return Detail::Approx(val);
+ }
+} // end namespace literals
+
+std::string StringMaker<Catch::Detail::Approx>::convert(Catch::Detail::Approx const& value) {
+ return value.toString();
+}
+
+} // end namespace Catch
+// end catch_approx.cpp
+// start catch_assertionhandler.cpp
+
+// start catch_debugger.h
+
+namespace Catch {
+ bool isDebuggerActive();
+}
+
+#ifdef CATCH_PLATFORM_MAC
+
+ #define CATCH_TRAP() __asm__("int $3\n" : : ) /* NOLINT */
+
+#elif defined(CATCH_PLATFORM_LINUX)
+ // If we can use inline assembler, do it because this allows us to break
+ // directly at the location of the failing check instead of breaking inside
+ // raise() called from it, i.e. one stack frame below.
+ #if defined(__GNUC__) && (defined(__i386) || defined(__x86_64))
+ #define CATCH_TRAP() asm volatile ("int $3") /* NOLINT */
+ #else // Fall back to the generic way.
+ #include <signal.h>
+
+ #define CATCH_TRAP() raise(SIGTRAP)
+ #endif
+#elif defined(_MSC_VER)
+ #define CATCH_TRAP() __debugbreak()
+#elif defined(__MINGW32__)
+ extern "C" __declspec(dllimport) void __stdcall DebugBreak();
+ #define CATCH_TRAP() DebugBreak()
+#endif
+
+#ifdef CATCH_TRAP
+ #define CATCH_BREAK_INTO_DEBUGGER() []{ if( Catch::isDebuggerActive() ) { CATCH_TRAP(); } }()
+#else
+ #define CATCH_BREAK_INTO_DEBUGGER() []{}()
+#endif
+
+// end catch_debugger.h
+// start catch_run_context.h
+
+// start catch_fatal_condition.h
+
+// start catch_windows_h_proxy.h
+
+
+#if defined(CATCH_PLATFORM_WINDOWS)
+
+#if !defined(NOMINMAX) && !defined(CATCH_CONFIG_NO_NOMINMAX)
+# define CATCH_DEFINED_NOMINMAX
+# define NOMINMAX
+#endif
+#if !defined(WIN32_LEAN_AND_MEAN) && !defined(CATCH_CONFIG_NO_WIN32_LEAN_AND_MEAN)
+# define CATCH_DEFINED_WIN32_LEAN_AND_MEAN
+# define WIN32_LEAN_AND_MEAN
+#endif
+
+#ifdef __AFXDLL
+#include <AfxWin.h>
+#else
+#include <windows.h>
+#endif
+
+#ifdef CATCH_DEFINED_NOMINMAX
+# undef NOMINMAX
+#endif
+#ifdef CATCH_DEFINED_WIN32_LEAN_AND_MEAN
+# undef WIN32_LEAN_AND_MEAN
+#endif
+
+#endif // defined(CATCH_PLATFORM_WINDOWS)
+
+// end catch_windows_h_proxy.h
+#if defined( CATCH_CONFIG_WINDOWS_SEH )
+
+namespace Catch {
+
+ struct FatalConditionHandler {
+
+ static LONG CALLBACK handleVectoredException(PEXCEPTION_POINTERS ExceptionInfo);
+ FatalConditionHandler();
+ static void reset();
+ ~FatalConditionHandler();
+
+ private:
+ static bool isSet;
+ static ULONG guaranteeSize;
+ static PVOID exceptionHandlerHandle;
+ };
+
+} // namespace Catch
+
+#elif defined ( CATCH_CONFIG_POSIX_SIGNALS )
+
+#include <signal.h>
+
+namespace Catch {
+
+ struct FatalConditionHandler {
+
+ static bool isSet;
+ static struct sigaction oldSigActions[];
+ static stack_t oldSigStack;
+ static char altStackMem[];
+
+ static void handleSignal( int sig );
+
+ FatalConditionHandler();
+ ~FatalConditionHandler();
+ static void reset();
+ };
+
+} // namespace Catch
+
+#else
+
+namespace Catch {
+ struct FatalConditionHandler {
+ void reset();
+ };
+}
+
+#endif
+
+// end catch_fatal_condition.h
+#include <string>
+
+namespace Catch {
+
+ struct IMutableContext;
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ class RunContext : public IResultCapture, public IRunner {
+
+ public:
+ RunContext( RunContext const& ) = delete;
+ RunContext& operator =( RunContext const& ) = delete;
+
+ explicit RunContext( IConfigPtr const& _config, IStreamingReporterPtr&& reporter );
+
+ ~RunContext() override;
+
+ void testGroupStarting( std::string const& testSpec, std::size_t groupIndex, std::size_t groupsCount );
+ void testGroupEnded( std::string const& testSpec, Totals const& totals, std::size_t groupIndex, std::size_t groupsCount );
+
+ Totals runTest(TestCase const& testCase);
+
+ IConfigPtr config() const;
+ IStreamingReporter& reporter() const;
+
+ public: // IResultCapture
+
+ // Assertion handlers
+ void handleExpr
+ ( AssertionInfo const& info,
+ ITransientExpression const& expr,
+ AssertionReaction& reaction ) override;
+ void handleMessage
+ ( AssertionInfo const& info,
+ ResultWas::OfType resultType,
+ StringRef const& message,
+ AssertionReaction& reaction ) override;
+ void handleUnexpectedExceptionNotThrown
+ ( AssertionInfo const& info,
+ AssertionReaction& reaction ) override;
+ void handleUnexpectedInflightException
+ ( AssertionInfo const& info,
+ std::string const& message,
+ AssertionReaction& reaction ) override;
+ void handleIncomplete
+ ( AssertionInfo const& info ) override;
+ void handleNonExpr
+ ( AssertionInfo const &info,
+ ResultWas::OfType resultType,
+ AssertionReaction &reaction ) override;
+
+ bool sectionStarted( SectionInfo const& sectionInfo, Counts& assertions ) override;
+
+ void sectionEnded( SectionEndInfo const& endInfo ) override;
+ void sectionEndedEarly( SectionEndInfo const& endInfo ) override;
+
+ auto acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker& override;
+
+ void benchmarkStarting( BenchmarkInfo const& info ) override;
+ void benchmarkEnded( BenchmarkStats const& stats ) override;
+
+ void pushScopedMessage( MessageInfo const& message ) override;
+ void popScopedMessage( MessageInfo const& message ) override;
+
+ void emplaceUnscopedMessage( MessageBuilder const& builder ) override;
+
+ std::string getCurrentTestName() const override;
+
+ const AssertionResult* getLastResult() const override;
+
+ void exceptionEarlyReported() override;
+
+ void handleFatalErrorCondition( StringRef message ) override;
+
+ bool lastAssertionPassed() override;
+
+ void assertionPassed() override;
+
+ public:
+ // !TBD We need to do this another way!
+ bool aborting() const final;
+
+ private:
+
+ void runCurrentTest( std::string& redirectedCout, std::string& redirectedCerr );
+ void invokeActiveTestCase();
+
+ void resetAssertionInfo();
+ bool testForMissingAssertions( Counts& assertions );
+
+ void assertionEnded( AssertionResult const& result );
+ void reportExpr
+ ( AssertionInfo const &info,
+ ResultWas::OfType resultType,
+ ITransientExpression const *expr,
+ bool negated );
+
+ void populateReaction( AssertionReaction& reaction );
+
+ private:
+
+ void handleUnfinishedSections();
+
+ TestRunInfo m_runInfo;
+ IMutableContext& m_context;
+ TestCase const* m_activeTestCase = nullptr;
+ ITracker* m_testCaseTracker = nullptr;
+ Option<AssertionResult> m_lastResult;
+
+ IConfigPtr m_config;
+ Totals m_totals;
+ IStreamingReporterPtr m_reporter;
+ std::vector<MessageInfo> m_messages;
+ std::vector<ScopedMessage> m_messageScopes; /* Keeps owners of so-called unscoped messages. */
+ AssertionInfo m_lastAssertionInfo;
+ std::vector<SectionEndInfo> m_unfinishedSections;
+ std::vector<ITracker*> m_activeSections;
+ TrackerContext m_trackerContext;
+ bool m_lastAssertionPassed = false;
+ bool m_shouldReportUnexpected = true;
+ bool m_includeSuccessfulResults;
+ };
+
+} // end namespace Catch
+
+// end catch_run_context.h
+namespace Catch {
+
+ namespace {
+ auto operator <<( std::ostream& os, ITransientExpression const& expr ) -> std::ostream& {
+ expr.streamReconstructedExpression( os );
+ return os;
+ }
+ }
+
+ LazyExpression::LazyExpression( bool isNegated )
+ : m_isNegated( isNegated )
+ {}
+
+ LazyExpression::LazyExpression( LazyExpression const& other ) : m_isNegated( other.m_isNegated ) {}
+
+ LazyExpression::operator bool() const {
+ return m_transientExpression != nullptr;
+ }
+
+ auto operator << ( std::ostream& os, LazyExpression const& lazyExpr ) -> std::ostream& {
+ if( lazyExpr.m_isNegated )
+ os << "!";
+
+ if( lazyExpr ) {
+ if( lazyExpr.m_isNegated && lazyExpr.m_transientExpression->isBinaryExpression() )
+ os << "(" << *lazyExpr.m_transientExpression << ")";
+ else
+ os << *lazyExpr.m_transientExpression;
+ }
+ else {
+ os << "{** error - unchecked empty expression requested **}";
+ }
+ return os;
+ }
+
+ AssertionHandler::AssertionHandler
+ ( StringRef const& macroName,
+ SourceLineInfo const& lineInfo,
+ StringRef capturedExpression,
+ ResultDisposition::Flags resultDisposition )
+ : m_assertionInfo{ macroName, lineInfo, capturedExpression, resultDisposition },
+ m_resultCapture( getResultCapture() )
+ {}
+
+ void AssertionHandler::handleExpr( ITransientExpression const& expr ) {
+ m_resultCapture.handleExpr( m_assertionInfo, expr, m_reaction );
+ }
+ void AssertionHandler::handleMessage(ResultWas::OfType resultType, StringRef const& message) {
+ m_resultCapture.handleMessage( m_assertionInfo, resultType, message, m_reaction );
+ }
+
+ auto AssertionHandler::allowThrows() const -> bool {
+ return getCurrentContext().getConfig()->allowThrows();
+ }
+
+ void AssertionHandler::complete() {
+ setCompleted();
+ if( m_reaction.shouldDebugBreak ) {
+
+ // If you find your debugger stopping you here then go one level up on the
+ // call-stack for the code that caused it (typically a failed assertion)
+
+ // (To go back to the test and change execution, jump over the throw, next)
+ CATCH_BREAK_INTO_DEBUGGER();
+ }
+ if (m_reaction.shouldThrow) {
+#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+ throw Catch::TestFailureException();
+#else
+ CATCH_ERROR( "Test failure requires aborting test!" );
+#endif
+ }
+ }
+ void AssertionHandler::setCompleted() {
+ m_completed = true;
+ }
+
+ void AssertionHandler::handleUnexpectedInflightException() {
+ m_resultCapture.handleUnexpectedInflightException( m_assertionInfo, Catch::translateActiveException(), m_reaction );
+ }
+
+ void AssertionHandler::handleExceptionThrownAsExpected() {
+ m_resultCapture.handleNonExpr(m_assertionInfo, ResultWas::Ok, m_reaction);
+ }
+ void AssertionHandler::handleExceptionNotThrownAsExpected() {
+ m_resultCapture.handleNonExpr(m_assertionInfo, ResultWas::Ok, m_reaction);
+ }
+
+ void AssertionHandler::handleUnexpectedExceptionNotThrown() {
+ m_resultCapture.handleUnexpectedExceptionNotThrown( m_assertionInfo, m_reaction );
+ }
+
+ void AssertionHandler::handleThrowingCallSkipped() {
+ m_resultCapture.handleNonExpr(m_assertionInfo, ResultWas::Ok, m_reaction);
+ }
+
+ // This is the overload that takes a string and infers the Equals matcher from it
+ // The more general overload, that takes any string matcher, is in catch_capture_matchers.cpp
+ void handleExceptionMatchExpr( AssertionHandler& handler, std::string const& str, StringRef const& matcherString ) {
+ handleExceptionMatchExpr( handler, Matchers::Equals( str ), matcherString );
+ }
+
+} // namespace Catch
+// end catch_assertionhandler.cpp
+// start catch_assertionresult.cpp
+
+namespace Catch {
+ AssertionResultData::AssertionResultData(ResultWas::OfType _resultType, LazyExpression const & _lazyExpression):
+ lazyExpression(_lazyExpression),
+ resultType(_resultType) {}
+
+ std::string AssertionResultData::reconstructExpression() const {
+
+ if( reconstructedExpression.empty() ) {
+ if( lazyExpression ) {
+ ReusableStringStream rss;
+ rss << lazyExpression;
+ reconstructedExpression = rss.str();
+ }
+ }
+ return reconstructedExpression;
+ }
+
+ AssertionResult::AssertionResult( AssertionInfo const& info, AssertionResultData const& data )
+ : m_info( info ),
+ m_resultData( data )
+ {}
+
+ // Result was a success
+ bool AssertionResult::succeeded() const {
+ return Catch::isOk( m_resultData.resultType );
+ }
+
+ // Result was a success, or failure is suppressed
+ bool AssertionResult::isOk() const {
+ return Catch::isOk( m_resultData.resultType ) || shouldSuppressFailure( m_info.resultDisposition );
+ }
+
+ ResultWas::OfType AssertionResult::getResultType() const {
+ return m_resultData.resultType;
+ }
+
+ bool AssertionResult::hasExpression() const {
+ return m_info.capturedExpression[0] != 0;
+ }
+
+ bool AssertionResult::hasMessage() const {
+ return !m_resultData.message.empty();
+ }
+
+ std::string AssertionResult::getExpression() const {
+ if( isFalseTest( m_info.resultDisposition ) )
+ return "!(" + m_info.capturedExpression + ")";
+ else
+ return m_info.capturedExpression;
+ }
+
+ std::string AssertionResult::getExpressionInMacro() const {
+ std::string expr;
+ if( m_info.macroName[0] == 0 )
+ expr = m_info.capturedExpression;
+ else {
+ expr.reserve( m_info.macroName.size() + m_info.capturedExpression.size() + 4 );
+ expr += m_info.macroName;
+ expr += "( ";
+ expr += m_info.capturedExpression;
+ expr += " )";
+ }
+ return expr;
+ }
+
+ bool AssertionResult::hasExpandedExpression() const {
+ return hasExpression() && getExpandedExpression() != getExpression();
+ }
+
+ std::string AssertionResult::getExpandedExpression() const {
+ std::string expr = m_resultData.reconstructExpression();
+ return expr.empty()
+ ? getExpression()
+ : expr;
+ }
+
+ std::string AssertionResult::getMessage() const {
+ return m_resultData.message;
+ }
+ SourceLineInfo AssertionResult::getSourceInfo() const {
+ return m_info.lineInfo;
+ }
+
+ StringRef AssertionResult::getTestMacroName() const {
+ return m_info.macroName;
+ }
+
+} // end namespace Catch
+// end catch_assertionresult.cpp
+// start catch_benchmark.cpp
+
+namespace Catch {
+
+ auto BenchmarkLooper::getResolution() -> uint64_t {
+ return getEstimatedClockResolution() * getCurrentContext().getConfig()->benchmarkResolutionMultiple();
+ }
+
+ void BenchmarkLooper::reportStart() {
+ getResultCapture().benchmarkStarting( { m_name } );
+ }
+ auto BenchmarkLooper::needsMoreIterations() -> bool {
+ auto elapsed = m_timer.getElapsedNanoseconds();
+
+ // Exponentially increasing iterations until we're confident in our timer resolution
+ if( elapsed < m_resolution ) {
+ m_iterationsToRun *= 10;
+ return true;
+ }
+
+ getResultCapture().benchmarkEnded( { { m_name }, m_count, elapsed } );
+ return false;
+ }
+
+} // end namespace Catch
+// end catch_benchmark.cpp
+// start catch_capture_matchers.cpp
+
+namespace Catch {
+
+ using StringMatcher = Matchers::Impl::MatcherBase<std::string>;
+
+ // This is the general overload that takes a any string matcher
+ // There is another overload, in catch_assertionhandler.h/.cpp, that only takes a string and infers
+ // the Equals matcher (so the header does not mention matchers)
+ void handleExceptionMatchExpr( AssertionHandler& handler, StringMatcher const& matcher, StringRef const& matcherString ) {
+ std::string exceptionMessage = Catch::translateActiveException();
+ MatchExpr<std::string, StringMatcher const&> expr( exceptionMessage, matcher, matcherString );
+ handler.handleExpr( expr );
+ }
+
+} // namespace Catch
+// end catch_capture_matchers.cpp
+// start catch_commandline.cpp
+
+// start catch_commandline.h
+
+// start catch_clara.h
+
+// Use Catch's value for console width (store Clara's off to the side, if present)
+#ifdef CLARA_CONFIG_CONSOLE_WIDTH
+#define CATCH_TEMP_CLARA_CONFIG_CONSOLE_WIDTH CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH
+#undef CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH
+#endif
+#define CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH CATCH_CONFIG_CONSOLE_WIDTH-1
+
+#ifdef __clang__
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Wweak-vtables"
+#pragma clang diagnostic ignored "-Wexit-time-destructors"
+#pragma clang diagnostic ignored "-Wshadow"
+#endif
+
+// start clara.hpp
+// Copyright 2017 Two Blue Cubes Ltd. All rights reserved.
+//
+// Distributed under the Boost Software License, Version 1.0. (See accompanying
+// file LICENSE_1_0.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
+//
+// See https://github.com/philsquared/Clara for more details
+
+// Clara v1.1.5
+
+
+#ifndef CATCH_CLARA_CONFIG_CONSOLE_WIDTH
+#define CATCH_CLARA_CONFIG_CONSOLE_WIDTH 80
+#endif
+
+#ifndef CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH
+#define CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH CATCH_CLARA_CONFIG_CONSOLE_WIDTH
+#endif
+
+#ifndef CLARA_CONFIG_OPTIONAL_TYPE
+#ifdef __has_include
+#if __has_include(<optional>) && __cplusplus >= 201703L
+#include <optional>
+#define CLARA_CONFIG_OPTIONAL_TYPE std::optional
+#endif
+#endif
+#endif
+
+// ----------- #included from clara_textflow.hpp -----------
+
+// TextFlowCpp
+//
+// A single-header library for wrapping and laying out basic text, by Phil Nash
+//
+// Distributed under the Boost Software License, Version 1.0. (See accompanying
+// file LICENSE.txt or copy at http://www.boost.org/LICENSE_1_0.txt)
+//
+// This project is hosted at https://github.com/philsquared/textflowcpp
+
+
+#include <cassert>
+#include <ostream>
+#include <sstream>
+#include <vector>
+
+#ifndef CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH
+#define CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH 80
+#endif
+
+namespace Catch {
+namespace clara {
+namespace TextFlow {
+
+inline auto isWhitespace(char c) -> bool {
+ static std::string chars = " \t\n\r";
+ return chars.find(c) != std::string::npos;
+}
+inline auto isBreakableBefore(char c) -> bool {
+ static std::string chars = "[({<|";
+ return chars.find(c) != std::string::npos;
+}
+inline auto isBreakableAfter(char c) -> bool {
+ static std::string chars = "])}>.,:;*+-=&/\\";
+ return chars.find(c) != std::string::npos;
+}
+
+class Columns;
+
+class Column {
+ std::vector<std::string> m_strings;
+ size_t m_width = CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH;
+ size_t m_indent = 0;
+ size_t m_initialIndent = std::string::npos;
+
+public:
+ class iterator {
+ friend Column;
+
+ Column const& m_column;
+ size_t m_stringIndex = 0;
+ size_t m_pos = 0;
+
+ size_t m_len = 0;
+ size_t m_end = 0;
+ bool m_suffix = false;
+
+ iterator(Column const& column, size_t stringIndex)
+ : m_column(column),
+ m_stringIndex(stringIndex) {}
+
+ auto line() const -> std::string const& { return m_column.m_strings[m_stringIndex]; }
+
+ auto isBoundary(size_t at) const -> bool {
+ assert(at > 0);
+ assert(at <= line().size());
+
+ return at == line().size() ||
+ (isWhitespace(line()[at]) && !isWhitespace(line()[at - 1])) ||
+ isBreakableBefore(line()[at]) ||
+ isBreakableAfter(line()[at - 1]);
+ }
+
+ void calcLength() {
+ assert(m_stringIndex < m_column.m_strings.size());
+
+ m_suffix = false;
+ auto width = m_column.m_width - indent();
+ m_end = m_pos;
+ if (line()[m_pos] == '\n') {
+ ++m_end;
+ }
+ while (m_end < line().size() && line()[m_end] != '\n')
+ ++m_end;
+
+ if (m_end < m_pos + width) {
+ m_len = m_end - m_pos;
+ } else {
+ size_t len = width;
+ while (len > 0 && !isBoundary(m_pos + len))
+ --len;
+ while (len > 0 && isWhitespace(line()[m_pos + len - 1]))
+ --len;
+
+ if (len > 0) {
+ m_len = len;
+ } else {
+ m_suffix = true;
+ m_len = width - 1;
+ }
+ }
+ }
+
+ auto indent() const -> size_t {
+ auto initial = m_pos == 0 && m_stringIndex == 0 ? m_column.m_initialIndent : std::string::npos;
+ return initial == std::string::npos ? m_column.m_indent : initial;
+ }
+
+ auto addIndentAndSuffix(std::string const &plain) const -> std::string {
+ return std::string(indent(), ' ') + (m_suffix ? plain + "-" : plain);
+ }
+
+ public:
+ using difference_type = std::ptrdiff_t;
+ using value_type = std::string;
+ using pointer = value_type * ;
+ using reference = value_type & ;
+ using iterator_category = std::forward_iterator_tag;
+
+ explicit iterator(Column const& column) : m_column(column) {
+ assert(m_column.m_width > m_column.m_indent);
+ assert(m_column.m_initialIndent == std::string::npos || m_column.m_width > m_column.m_initialIndent);
+ calcLength();
+ if (m_len == 0)
+ m_stringIndex++; // Empty string
+ }
+
+ auto operator *() const -> std::string {
+ assert(m_stringIndex < m_column.m_strings.size());
+ assert(m_pos <= m_end);
+ return addIndentAndSuffix(line().substr(m_pos, m_len));
+ }
+
+ auto operator ++() -> iterator& {
+ m_pos += m_len;
+ if (m_pos < line().size() && line()[m_pos] == '\n')
+ m_pos += 1;
+ else
+ while (m_pos < line().size() && isWhitespace(line()[m_pos]))
+ ++m_pos;
+
+ if (m_pos == line().size()) {
+ m_pos = 0;
+ ++m_stringIndex;
+ }
+ if (m_stringIndex < m_column.m_strings.size())
+ calcLength();
+ return *this;
+ }
+ auto operator ++(int) -> iterator {
+ iterator prev(*this);
+ operator++();
+ return prev;
+ }
+
+ auto operator ==(iterator const& other) const -> bool {
+ return
+ m_pos == other.m_pos &&
+ m_stringIndex == other.m_stringIndex &&
+ &m_column == &other.m_column;
+ }
+ auto operator !=(iterator const& other) const -> bool {
+ return !operator==(other);
+ }
+ };
+ using const_iterator = iterator;
+
+ explicit Column(std::string const& text) { m_strings.push_back(text); }
+
+ auto width(size_t newWidth) -> Column& {
+ assert(newWidth > 0);
+ m_width = newWidth;
+ return *this;
+ }
+ auto indent(size_t newIndent) -> Column& {
+ m_indent = newIndent;
+ return *this;
+ }
+ auto initialIndent(size_t newIndent) -> Column& {
+ m_initialIndent = newIndent;
+ return *this;
+ }
+
+ auto width() const -> size_t { return m_width; }
+ auto begin() const -> iterator { return iterator(*this); }
+ auto end() const -> iterator { return { *this, m_strings.size() }; }
+
+ inline friend std::ostream& operator << (std::ostream& os, Column const& col) {
+ bool first = true;
+ for (auto line : col) {
+ if (first)
+ first = false;
+ else
+ os << "\n";
+ os << line;
+ }
+ return os;
+ }
+
+ auto operator + (Column const& other)->Columns;
+
+ auto toString() const -> std::string {
+ std::ostringstream oss;
+ oss << *this;
+ return oss.str();
+ }
+};
+
+class Spacer : public Column {
+
+public:
+ explicit Spacer(size_t spaceWidth) : Column("") {
+ width(spaceWidth);
+ }
+};
+
+class Columns {
+ std::vector<Column> m_columns;
+
+public:
+
+ class iterator {
+ friend Columns;
+ struct EndTag {};
+
+ std::vector<Column> const& m_columns;
+ std::vector<Column::iterator> m_iterators;
+ size_t m_activeIterators;
+
+ iterator(Columns const& columns, EndTag)
+ : m_columns(columns.m_columns),
+ m_activeIterators(0) {
+ m_iterators.reserve(m_columns.size());
+
+ for (auto const& col : m_columns)
+ m_iterators.push_back(col.end());
+ }
+
+ public:
+ using difference_type = std::ptrdiff_t;
+ using value_type = std::string;
+ using pointer = value_type * ;
+ using reference = value_type & ;
+ using iterator_category = std::forward_iterator_tag;
+
+ explicit iterator(Columns const& columns)
+ : m_columns(columns.m_columns),
+ m_activeIterators(m_columns.size()) {
+ m_iterators.reserve(m_columns.size());
+
+ for (auto const& col : m_columns)
+ m_iterators.push_back(col.begin());
+ }
+
+ auto operator ==(iterator const& other) const -> bool {
+ return m_iterators == other.m_iterators;
+ }
+ auto operator !=(iterator const& other) const -> bool {
+ return m_iterators != other.m_iterators;
+ }
+ auto operator *() const -> std::string {
+ std::string row, padding;
+
+ for (size_t i = 0; i < m_columns.size(); ++i) {
+ auto width = m_columns[i].width();
+ if (m_iterators[i] != m_columns[i].end()) {
+ std::string col = *m_iterators[i];
+ row += padding + col;
+ if (col.size() < width)
+ padding = std::string(width - col.size(), ' ');
+ else
+ padding = "";
+ } else {
+ padding += std::string(width, ' ');
+ }
+ }
+ return row;
+ }
+ auto operator ++() -> iterator& {
+ for (size_t i = 0; i < m_columns.size(); ++i) {
+ if (m_iterators[i] != m_columns[i].end())
+ ++m_iterators[i];
+ }
+ return *this;
+ }
+ auto operator ++(int) -> iterator {
+ iterator prev(*this);
+ operator++();
+ return prev;
+ }
+ };
+ using const_iterator = iterator;
+
+ auto begin() const -> iterator { return iterator(*this); }
+ auto end() const -> iterator { return { *this, iterator::EndTag() }; }
+
+ auto operator += (Column const& col) -> Columns& {
+ m_columns.push_back(col);
+ return *this;
+ }
+ auto operator + (Column const& col) -> Columns {
+ Columns combined = *this;
+ combined += col;
+ return combined;
+ }
+
+ inline friend std::ostream& operator << (std::ostream& os, Columns const& cols) {
+
+ bool first = true;
+ for (auto line : cols) {
+ if (first)
+ first = false;
+ else
+ os << "\n";
+ os << line;
+ }
+ return os;
+ }
+
+ auto toString() const -> std::string {
+ std::ostringstream oss;
+ oss << *this;
+ return oss.str();
+ }
+};
+
+inline auto Column::operator + (Column const& other) -> Columns {
+ Columns cols;
+ cols += *this;
+ cols += other;
+ return cols;
+}
+}
+
+}
+}
+
+// ----------- end of #include from clara_textflow.hpp -----------
+// ........... back in clara.hpp
+
+#include <cctype>
+#include <string>
+#include <memory>
+#include <set>
+#include <algorithm>
+
+#if !defined(CATCH_PLATFORM_WINDOWS) && ( defined(WIN32) || defined(__WIN32__) || defined(_WIN32) || defined(_MSC_VER) )
+#define CATCH_PLATFORM_WINDOWS
+#endif
+
+namespace Catch { namespace clara {
+namespace detail {
+
+ // Traits for extracting arg and return type of lambdas (for single argument lambdas)
+ template<typename L>
+ struct UnaryLambdaTraits : UnaryLambdaTraits<decltype( &L::operator() )> {};
+
+ template<typename ClassT, typename ReturnT, typename... Args>
+ struct UnaryLambdaTraits<ReturnT( ClassT::* )( Args... ) const> {
+ static const bool isValid = false;
+ };
+
+ template<typename ClassT, typename ReturnT, typename ArgT>
+ struct UnaryLambdaTraits<ReturnT( ClassT::* )( ArgT ) const> {
+ static const bool isValid = true;
+ using ArgType = typename std::remove_const<typename std::remove_reference<ArgT>::type>::type;
+ using ReturnType = ReturnT;
+ };
+
+ class TokenStream;
+
+ // Transport for raw args (copied from main args, or supplied via init list for testing)
+ class Args {
+ friend TokenStream;
+ std::string m_exeName;
+ std::vector<std::string> m_args;
+
+ public:
+ Args( int argc, char const* const* argv )
+ : m_exeName(argv[0]),
+ m_args(argv + 1, argv + argc) {}
+
+ Args( std::initializer_list<std::string> args )
+ : m_exeName( *args.begin() ),
+ m_args( args.begin()+1, args.end() )
+ {}
+
+ auto exeName() const -> std::string {
+ return m_exeName;
+ }
+ };
+
+ // Wraps a token coming from a token stream. These may not directly correspond to strings as a single string
+ // may encode an option + its argument if the : or = form is used
+ enum class TokenType {
+ Option, Argument
+ };
+ struct Token {
+ TokenType type;
+ std::string token;
+ };
+
+ inline auto isOptPrefix( char c ) -> bool {
+ return c == '-'
+#ifdef CATCH_PLATFORM_WINDOWS
+ || c == '/'
+#endif
+ ;
+ }
+
+ // Abstracts iterators into args as a stream of tokens, with option arguments uniformly handled
+ class TokenStream {
+ using Iterator = std::vector<std::string>::const_iterator;
+ Iterator it;
+ Iterator itEnd;
+ std::vector<Token> m_tokenBuffer;
+
+ void loadBuffer() {
+ m_tokenBuffer.resize( 0 );
+
+ // Skip any empty strings
+ while( it != itEnd && it->empty() )
+ ++it;
+
+ if( it != itEnd ) {
+ auto const &next = *it;
+ if( isOptPrefix( next[0] ) ) {
+ auto delimiterPos = next.find_first_of( " :=" );
+ if( delimiterPos != std::string::npos ) {
+ m_tokenBuffer.push_back( { TokenType::Option, next.substr( 0, delimiterPos ) } );
+ m_tokenBuffer.push_back( { TokenType::Argument, next.substr( delimiterPos + 1 ) } );
+ } else {
+ if( next[1] != '-' && next.size() > 2 ) {
+ std::string opt = "- ";
+ for( size_t i = 1; i < next.size(); ++i ) {
+ opt[1] = next[i];
+ m_tokenBuffer.push_back( { TokenType::Option, opt } );
+ }
+ } else {
+ m_tokenBuffer.push_back( { TokenType::Option, next } );
+ }
+ }
+ } else {
+ m_tokenBuffer.push_back( { TokenType::Argument, next } );
+ }
+ }
+ }
+
+ public:
+ explicit TokenStream( Args const &args ) : TokenStream( args.m_args.begin(), args.m_args.end() ) {}
+
+ TokenStream( Iterator it, Iterator itEnd ) : it( it ), itEnd( itEnd ) {
+ loadBuffer();
+ }
+
+ explicit operator bool() const {
+ return !m_tokenBuffer.empty() || it != itEnd;
+ }
+
+ auto count() const -> size_t { return m_tokenBuffer.size() + (itEnd - it); }
+
+ auto operator*() const -> Token {
+ assert( !m_tokenBuffer.empty() );
+ return m_tokenBuffer.front();
+ }
+
+ auto operator->() const -> Token const * {
+ assert( !m_tokenBuffer.empty() );
+ return &m_tokenBuffer.front();
+ }
+
+ auto operator++() -> TokenStream & {
+ if( m_tokenBuffer.size() >= 2 ) {
+ m_tokenBuffer.erase( m_tokenBuffer.begin() );
+ } else {
+ if( it != itEnd )
+ ++it;
+ loadBuffer();
+ }
+ return *this;
+ }
+ };
+
+ class ResultBase {
+ public:
+ enum Type {
+ Ok, LogicError, RuntimeError
+ };
+
+ protected:
+ ResultBase( Type type ) : m_type( type ) {}
+ virtual ~ResultBase() = default;
+
+ virtual void enforceOk() const = 0;
+
+ Type m_type;
+ };
+
+ template<typename T>
+ class ResultValueBase : public ResultBase {
+ public:
+ auto value() const -> T const & {
+ enforceOk();
+ return m_value;
+ }
+
+ protected:
+ ResultValueBase( Type type ) : ResultBase( type ) {}
+
+ ResultValueBase( ResultValueBase const &other ) : ResultBase( other ) {
+ if( m_type == ResultBase::Ok )
+ new( &m_value ) T( other.m_value );
+ }
+
+ ResultValueBase( Type, T const &value ) : ResultBase( Ok ) {
+ new( &m_value ) T( value );
+ }
+
+ auto operator=( ResultValueBase const &other ) -> ResultValueBase & {
+ if( m_type == ResultBase::Ok )
+ m_value.~T();
+ ResultBase::operator=(other);
+ if( m_type == ResultBase::Ok )
+ new( &m_value ) T( other.m_value );
+ return *this;
+ }
+
+ ~ResultValueBase() override {
+ if( m_type == Ok )
+ m_value.~T();
+ }
+
+ union {
+ T m_value;
+ };
+ };
+
+ template<>
+ class ResultValueBase<void> : public ResultBase {
+ protected:
+ using ResultBase::ResultBase;
+ };
+
+ template<typename T = void>
+ class BasicResult : public ResultValueBase<T> {
+ public:
+ template<typename U>
+ explicit BasicResult( BasicResult<U> const &other )
+ : ResultValueBase<T>( other.type() ),
+ m_errorMessage( other.errorMessage() )
+ {
+ assert( type() != ResultBase::Ok );
+ }
+
+ template<typename U>
+ static auto ok( U const &value ) -> BasicResult { return { ResultBase::Ok, value }; }
+ static auto ok() -> BasicResult { return { ResultBase::Ok }; }
+ static auto logicError( std::string const &message ) -> BasicResult { return { ResultBase::LogicError, message }; }
+ static auto runtimeError( std::string const &message ) -> BasicResult { return { ResultBase::RuntimeError, message }; }
+
+ explicit operator bool() const { return m_type == ResultBase::Ok; }
+ auto type() const -> ResultBase::Type { return m_type; }
+ auto errorMessage() const -> std::string { return m_errorMessage; }
+
+ protected:
+ void enforceOk() const override {
+
+ // Errors shouldn't reach this point, but if they do
+ // the actual error message will be in m_errorMessage
+ assert( m_type != ResultBase::LogicError );
+ assert( m_type != ResultBase::RuntimeError );
+ if( m_type != ResultBase::Ok )
+ std::abort();
+ }
+
+ std::string m_errorMessage; // Only populated if resultType is an error
+
+ BasicResult( ResultBase::Type type, std::string const &message )
+ : ResultValueBase<T>(type),
+ m_errorMessage(message)
+ {
+ assert( m_type != ResultBase::Ok );
+ }
+
+ using ResultValueBase<T>::ResultValueBase;
+ using ResultBase::m_type;
+ };
+
+ enum class ParseResultType {
+ Matched, NoMatch, ShortCircuitAll, ShortCircuitSame
+ };
+
+ class ParseState {
+ public:
+
+ ParseState( ParseResultType type, TokenStream const &remainingTokens )
+ : m_type(type),
+ m_remainingTokens( remainingTokens )
+ {}
+
+ auto type() const -> ParseResultType { return m_type; }
+ auto remainingTokens() const -> TokenStream { return m_remainingTokens; }
+
+ private:
+ ParseResultType m_type;
+ TokenStream m_remainingTokens;
+ };
+
+ using Result = BasicResult<void>;
+ using ParserResult = BasicResult<ParseResultType>;
+ using InternalParseResult = BasicResult<ParseState>;
+
+ struct HelpColumns {
+ std::string left;
+ std::string right;
+ };
+
+ template<typename T>
+ inline auto convertInto( std::string const &source, T& target ) -> ParserResult {
+ std::stringstream ss;
+ ss << source;
+ ss >> target;
+ if( ss.fail() )
+ return ParserResult::runtimeError( "Unable to convert '" + source + "' to destination type" );
+ else
+ return ParserResult::ok( ParseResultType::Matched );
+ }
+ inline auto convertInto( std::string const &source, std::string& target ) -> ParserResult {
+ target = source;
+ return ParserResult::ok( ParseResultType::Matched );
+ }
+ inline auto convertInto( std::string const &source, bool &target ) -> ParserResult {
+ std::string srcLC = source;
+ std::transform( srcLC.begin(), srcLC.end(), srcLC.begin(), []( char c ) { return static_cast<char>( std::tolower(c) ); } );
+ if (srcLC == "y" || srcLC == "1" || srcLC == "true" || srcLC == "yes" || srcLC == "on")
+ target = true;
+ else if (srcLC == "n" || srcLC == "0" || srcLC == "false" || srcLC == "no" || srcLC == "off")
+ target = false;
+ else
+ return ParserResult::runtimeError( "Expected a boolean value but did not recognise: '" + source + "'" );
+ return ParserResult::ok( ParseResultType::Matched );
+ }
+#ifdef CLARA_CONFIG_OPTIONAL_TYPE
+ template<typename T>
+ inline auto convertInto( std::string const &source, CLARA_CONFIG_OPTIONAL_TYPE<T>& target ) -> ParserResult {
+ T temp;
+ auto result = convertInto( source, temp );
+ if( result )
+ target = std::move(temp);
+ return result;
+ }
+#endif // CLARA_CONFIG_OPTIONAL_TYPE
+
+ struct NonCopyable {
+ NonCopyable() = default;
+ NonCopyable( NonCopyable const & ) = delete;
+ NonCopyable( NonCopyable && ) = delete;
+ NonCopyable &operator=( NonCopyable const & ) = delete;
+ NonCopyable &operator=( NonCopyable && ) = delete;
+ };
+
+ struct BoundRef : NonCopyable {
+ virtual ~BoundRef() = default;
+ virtual auto isContainer() const -> bool { return false; }
+ virtual auto isFlag() const -> bool { return false; }
+ };
+ struct BoundValueRefBase : BoundRef {
+ virtual auto setValue( std::string const &arg ) -> ParserResult = 0;
+ };
+ struct BoundFlagRefBase : BoundRef {
+ virtual auto setFlag( bool flag ) -> ParserResult = 0;
+ virtual auto isFlag() const -> bool { return true; }
+ };
+
+ template<typename T>
+ struct BoundValueRef : BoundValueRefBase {
+ T &m_ref;
+
+ explicit BoundValueRef( T &ref ) : m_ref( ref ) {}
+
+ auto setValue( std::string const &arg ) -> ParserResult override {
+ return convertInto( arg, m_ref );
+ }
+ };
+
+ template<typename T>
+ struct BoundValueRef<std::vector<T>> : BoundValueRefBase {
+ std::vector<T> &m_ref;
+
+ explicit BoundValueRef( std::vector<T> &ref ) : m_ref( ref ) {}
+
+ auto isContainer() const -> bool override { return true; }
+
+ auto setValue( std::string const &arg ) -> ParserResult override {
+ T temp;
+ auto result = convertInto( arg, temp );
+ if( result )
+ m_ref.push_back( temp );
+ return result;
+ }
+ };
+
+ struct BoundFlagRef : BoundFlagRefBase {
+ bool &m_ref;
+
+ explicit BoundFlagRef( bool &ref ) : m_ref( ref ) {}
+
+ auto setFlag( bool flag ) -> ParserResult override {
+ m_ref = flag;
+ return ParserResult::ok( ParseResultType::Matched );
+ }
+ };
+
+ template<typename ReturnType>
+ struct LambdaInvoker {
+ static_assert( std::is_same<ReturnType, ParserResult>::value, "Lambda must return void or clara::ParserResult" );
+
+ template<typename L, typename ArgType>
+ static auto invoke( L const &lambda, ArgType const &arg ) -> ParserResult {
+ return lambda( arg );
+ }
+ };
+
+ template<>
+ struct LambdaInvoker<void> {
+ template<typename L, typename ArgType>
+ static auto invoke( L const &lambda, ArgType const &arg ) -> ParserResult {
+ lambda( arg );
+ return ParserResult::ok( ParseResultType::Matched );
+ }
+ };
+
+ template<typename ArgType, typename L>
+ inline auto invokeLambda( L const &lambda, std::string const &arg ) -> ParserResult {
+ ArgType temp{};
+ auto result = convertInto( arg, temp );
+ return !result
+ ? result
+ : LambdaInvoker<typename UnaryLambdaTraits<L>::ReturnType>::invoke( lambda, temp );
+ }
+
+ template<typename L>
+ struct BoundLambda : BoundValueRefBase {
+ L m_lambda;
+
+ static_assert( UnaryLambdaTraits<L>::isValid, "Supplied lambda must take exactly one argument" );
+ explicit BoundLambda( L const &lambda ) : m_lambda( lambda ) {}
+
+ auto setValue( std::string const &arg ) -> ParserResult override {
+ return invokeLambda<typename UnaryLambdaTraits<L>::ArgType>( m_lambda, arg );
+ }
+ };
+
+ template<typename L>
+ struct BoundFlagLambda : BoundFlagRefBase {
+ L m_lambda;
+
+ static_assert( UnaryLambdaTraits<L>::isValid, "Supplied lambda must take exactly one argument" );
+ static_assert( std::is_same<typename UnaryLambdaTraits<L>::ArgType, bool>::value, "flags must be boolean" );
+
+ explicit BoundFlagLambda( L const &lambda ) : m_lambda( lambda ) {}
+
+ auto setFlag( bool flag ) -> ParserResult override {
+ return LambdaInvoker<typename UnaryLambdaTraits<L>::ReturnType>::invoke( m_lambda, flag );
+ }
+ };
+
+ enum class Optionality { Optional, Required };
+
+ struct Parser;
+
+ class ParserBase {
+ public:
+ virtual ~ParserBase() = default;
+ virtual auto validate() const -> Result { return Result::ok(); }
+ virtual auto parse( std::string const& exeName, TokenStream const &tokens) const -> InternalParseResult = 0;
+ virtual auto cardinality() const -> size_t { return 1; }
+
+ auto parse( Args const &args ) const -> InternalParseResult {
+ return parse( args.exeName(), TokenStream( args ) );
+ }
+ };
+
+ template<typename DerivedT>
+ class ComposableParserImpl : public ParserBase {
+ public:
+ template<typename T>
+ auto operator|( T const &other ) const -> Parser;
+
+ template<typename T>
+ auto operator+( T const &other ) const -> Parser;
+ };
+
+ // Common code and state for Args and Opts
+ template<typename DerivedT>
+ class ParserRefImpl : public ComposableParserImpl<DerivedT> {
+ protected:
+ Optionality m_optionality = Optionality::Optional;
+ std::shared_ptr<BoundRef> m_ref;
+ std::string m_hint;
+ std::string m_description;
+
+ explicit ParserRefImpl( std::shared_ptr<BoundRef> const &ref ) : m_ref( ref ) {}
+
+ public:
+ template<typename T>
+ ParserRefImpl( T &ref, std::string const &hint )
+ : m_ref( std::make_shared<BoundValueRef<T>>( ref ) ),
+ m_hint( hint )
+ {}
+
+ template<typename LambdaT>
+ ParserRefImpl( LambdaT const &ref, std::string const &hint )
+ : m_ref( std::make_shared<BoundLambda<LambdaT>>( ref ) ),
+ m_hint(hint)
+ {}
+
+ auto operator()( std::string const &description ) -> DerivedT & {
+ m_description = description;
+ return static_cast<DerivedT &>( *this );
+ }
+
+ auto optional() -> DerivedT & {
+ m_optionality = Optionality::Optional;
+ return static_cast<DerivedT &>( *this );
+ };
+
+ auto required() -> DerivedT & {
+ m_optionality = Optionality::Required;
+ return static_cast<DerivedT &>( *this );
+ };
+
+ auto isOptional() const -> bool {
+ return m_optionality == Optionality::Optional;
+ }
+
+ auto cardinality() const -> size_t override {
+ if( m_ref->isContainer() )
+ return 0;
+ else
+ return 1;
+ }
+
+ auto hint() const -> std::string { return m_hint; }
+ };
+
+ class ExeName : public ComposableParserImpl<ExeName> {
+ std::shared_ptr<std::string> m_name;
+ std::shared_ptr<BoundValueRefBase> m_ref;
+
+ template<typename LambdaT>
+ static auto makeRef(LambdaT const &lambda) -> std::shared_ptr<BoundValueRefBase> {
+ return std::make_shared<BoundLambda<LambdaT>>( lambda) ;
+ }
+
+ public:
+ ExeName() : m_name( std::make_shared<std::string>( "<executable>" ) ) {}
+
+ explicit ExeName( std::string &ref ) : ExeName() {
+ m_ref = std::make_shared<BoundValueRef<std::string>>( ref );
+ }
+
+ template<typename LambdaT>
+ explicit ExeName( LambdaT const& lambda ) : ExeName() {
+ m_ref = std::make_shared<BoundLambda<LambdaT>>( lambda );
+ }
+
+ // The exe name is not parsed out of the normal tokens, but is handled specially
+ auto parse( std::string const&, TokenStream const &tokens ) const -> InternalParseResult override {
+ return InternalParseResult::ok( ParseState( ParseResultType::NoMatch, tokens ) );
+ }
+
+ auto name() const -> std::string { return *m_name; }
+ auto set( std::string const& newName ) -> ParserResult {
+
+ auto lastSlash = newName.find_last_of( "\\/" );
+ auto filename = ( lastSlash == std::string::npos )
+ ? newName
+ : newName.substr( lastSlash+1 );
+
+ *m_name = filename;
+ if( m_ref )
+ return m_ref->setValue( filename );
+ else
+ return ParserResult::ok( ParseResultType::Matched );
+ }
+ };
+
+ class Arg : public ParserRefImpl<Arg> {
+ public:
+ using ParserRefImpl::ParserRefImpl;
+
+ auto parse( std::string const &, TokenStream const &tokens ) const -> InternalParseResult override {
+ auto validationResult = validate();
+ if( !validationResult )
+ return InternalParseResult( validationResult );
+
+ auto remainingTokens = tokens;
+ auto const &token = *remainingTokens;
+ if( token.type != TokenType::Argument )
+ return InternalParseResult::ok( ParseState( ParseResultType::NoMatch, remainingTokens ) );
+
+ assert( !m_ref->isFlag() );
+ auto valueRef = static_cast<detail::BoundValueRefBase*>( m_ref.get() );
+
+ auto result = valueRef->setValue( remainingTokens->token );
+ if( !result )
+ return InternalParseResult( result );
+ else
+ return InternalParseResult::ok( ParseState( ParseResultType::Matched, ++remainingTokens ) );
+ }
+ };
+
+ inline auto normaliseOpt( std::string const &optName ) -> std::string {
+#ifdef CATCH_PLATFORM_WINDOWS
+ if( optName[0] == '/' )
+ return "-" + optName.substr( 1 );
+ else
+#endif
+ return optName;
+ }
+
+ class Opt : public ParserRefImpl<Opt> {
+ protected:
+ std::vector<std::string> m_optNames;
+
+ public:
+ template<typename LambdaT>
+ explicit Opt( LambdaT const &ref ) : ParserRefImpl( std::make_shared<BoundFlagLambda<LambdaT>>( ref ) ) {}
+
+ explicit Opt( bool &ref ) : ParserRefImpl( std::make_shared<BoundFlagRef>( ref ) ) {}
+
+ template<typename LambdaT>
+ Opt( LambdaT const &ref, std::string const &hint ) : ParserRefImpl( ref, hint ) {}
+
+ template<typename T>
+ Opt( T &ref, std::string const &hint ) : ParserRefImpl( ref, hint ) {}
+
+ auto operator[]( std::string const &optName ) -> Opt & {
+ m_optNames.push_back( optName );
+ return *this;
+ }
+
+ auto getHelpColumns() const -> std::vector<HelpColumns> {
+ std::ostringstream oss;
+ bool first = true;
+ for( auto const &opt : m_optNames ) {
+ if (first)
+ first = false;
+ else
+ oss << ", ";
+ oss << opt;
+ }
+ if( !m_hint.empty() )
+ oss << " <" << m_hint << ">";
+ return { { oss.str(), m_description } };
+ }
+
+ auto isMatch( std::string const &optToken ) const -> bool {
+ auto normalisedToken = normaliseOpt( optToken );
+ for( auto const &name : m_optNames ) {
+ if( normaliseOpt( name ) == normalisedToken )
+ return true;
+ }
+ return false;
+ }
+
+ using ParserBase::parse;
+
+ auto parse( std::string const&, TokenStream const &tokens ) const -> InternalParseResult override {
+ auto validationResult = validate();
+ if( !validationResult )
+ return InternalParseResult( validationResult );
+
+ auto remainingTokens = tokens;
+ if( remainingTokens && remainingTokens->type == TokenType::Option ) {
+ auto const &token = *remainingTokens;
+ if( isMatch(token.token ) ) {
+ if( m_ref->isFlag() ) {
+ auto flagRef = static_cast<detail::BoundFlagRefBase*>( m_ref.get() );
+ auto result = flagRef->setFlag( true );
+ if( !result )
+ return InternalParseResult( result );
+ if( result.value() == ParseResultType::ShortCircuitAll )
+ return InternalParseResult::ok( ParseState( result.value(), remainingTokens ) );
+ } else {
+ auto valueRef = static_cast<detail::BoundValueRefBase*>( m_ref.get() );
+ ++remainingTokens;
+ if( !remainingTokens )
+ return InternalParseResult::runtimeError( "Expected argument following " + token.token );
+ auto const &argToken = *remainingTokens;
+ if( argToken.type != TokenType::Argument )
+ return InternalParseResult::runtimeError( "Expected argument following " + token.token );
+ auto result = valueRef->setValue( argToken.token );
+ if( !result )
+ return InternalParseResult( result );
+ if( result.value() == ParseResultType::ShortCircuitAll )
+ return InternalParseResult::ok( ParseState( result.value(), remainingTokens ) );
+ }
+ return InternalParseResult::ok( ParseState( ParseResultType::Matched, ++remainingTokens ) );
+ }
+ }
+ return InternalParseResult::ok( ParseState( ParseResultType::NoMatch, remainingTokens ) );
+ }
+
+ auto validate() const -> Result override {
+ if( m_optNames.empty() )
+ return Result::logicError( "No options supplied to Opt" );
+ for( auto const &name : m_optNames ) {
+ if( name.empty() )
+ return Result::logicError( "Option name cannot be empty" );
+#ifdef CATCH_PLATFORM_WINDOWS
+ if( name[0] != '-' && name[0] != '/' )
+ return Result::logicError( "Option name must begin with '-' or '/'" );
+#else
+ if( name[0] != '-' )
+ return Result::logicError( "Option name must begin with '-'" );
+#endif
+ }
+ return ParserRefImpl::validate();
+ }
+ };
+
+ struct Help : Opt {
+ Help( bool &showHelpFlag )
+ : Opt([&]( bool flag ) {
+ showHelpFlag = flag;
+ return ParserResult::ok( ParseResultType::ShortCircuitAll );
+ })
+ {
+ static_cast<Opt &>( *this )
+ ("display usage information")
+ ["-?"]["-h"]["--help"]
+ .optional();
+ }
+ };
+
+ struct Parser : ParserBase {
+
+ mutable ExeName m_exeName;
+ std::vector<Opt> m_options;
+ std::vector<Arg> m_args;
+
+ auto operator|=( ExeName const &exeName ) -> Parser & {
+ m_exeName = exeName;
+ return *this;
+ }
+
+ auto operator|=( Arg const &arg ) -> Parser & {
+ m_args.push_back(arg);
+ return *this;
+ }
+
+ auto operator|=( Opt const &opt ) -> Parser & {
+ m_options.push_back(opt);
+ return *this;
+ }
+
+ auto operator|=( Parser const &other ) -> Parser & {
+ m_options.insert(m_options.end(), other.m_options.begin(), other.m_options.end());
+ m_args.insert(m_args.end(), other.m_args.begin(), other.m_args.end());
+ return *this;
+ }
+
+ template<typename T>
+ auto operator|( T const &other ) const -> Parser {
+ return Parser( *this ) |= other;
+ }
+
+ // Forward deprecated interface with '+' instead of '|'
+ template<typename T>
+ auto operator+=( T const &other ) -> Parser & { return operator|=( other ); }
+ template<typename T>
+ auto operator+( T const &other ) const -> Parser { return operator|( other ); }
+
+ auto getHelpColumns() const -> std::vector<HelpColumns> {
+ std::vector<HelpColumns> cols;
+ for (auto const &o : m_options) {
+ auto childCols = o.getHelpColumns();
+ cols.insert( cols.end(), childCols.begin(), childCols.end() );
+ }
+ return cols;
+ }
+
+ void writeToStream( std::ostream &os ) const {
+ if (!m_exeName.name().empty()) {
+ os << "usage:\n" << " " << m_exeName.name() << " ";
+ bool required = true, first = true;
+ for( auto const &arg : m_args ) {
+ if (first)
+ first = false;
+ else
+ os << " ";
+ if( arg.isOptional() && required ) {
+ os << "[";
+ required = false;
+ }
+ os << "<" << arg.hint() << ">";
+ if( arg.cardinality() == 0 )
+ os << " ... ";
+ }
+ if( !required )
+ os << "]";
+ if( !m_options.empty() )
+ os << " options";
+ os << "\n\nwhere options are:" << std::endl;
+ }
+
+ auto rows = getHelpColumns();
+ size_t consoleWidth = CATCH_CLARA_CONFIG_CONSOLE_WIDTH;
+ size_t optWidth = 0;
+ for( auto const &cols : rows )
+ optWidth = (std::max)(optWidth, cols.left.size() + 2);
+
+ optWidth = (std::min)(optWidth, consoleWidth/2);
+
+ for( auto const &cols : rows ) {
+ auto row =
+ TextFlow::Column( cols.left ).width( optWidth ).indent( 2 ) +
+ TextFlow::Spacer(4) +
+ TextFlow::Column( cols.right ).width( consoleWidth - 7 - optWidth );
+ os << row << std::endl;
+ }
+ }
+
+ friend auto operator<<( std::ostream &os, Parser const &parser ) -> std::ostream& {
+ parser.writeToStream( os );
+ return os;
+ }
+
+ auto validate() const -> Result override {
+ for( auto const &opt : m_options ) {
+ auto result = opt.validate();
+ if( !result )
+ return result;
+ }
+ for( auto const &arg : m_args ) {
+ auto result = arg.validate();
+ if( !result )
+ return result;
+ }
+ return Result::ok();
+ }
+
+ using ParserBase::parse;
+
+ auto parse( std::string const& exeName, TokenStream const &tokens ) const -> InternalParseResult override {
+
+ struct ParserInfo {
+ ParserBase const* parser = nullptr;
+ size_t count = 0;
+ };
+ const size_t totalParsers = m_options.size() + m_args.size();
+ assert( totalParsers < 512 );
+ // ParserInfo parseInfos[totalParsers]; // <-- this is what we really want to do
+ ParserInfo parseInfos[512];
+
+ {
+ size_t i = 0;
+ for (auto const &opt : m_options) parseInfos[i++].parser = &opt;
+ for (auto const &arg : m_args) parseInfos[i++].parser = &arg;
+ }
+
+ m_exeName.set( exeName );
+
+ auto result = InternalParseResult::ok( ParseState( ParseResultType::NoMatch, tokens ) );
+ while( result.value().remainingTokens() ) {
+ bool tokenParsed = false;
+
+ for( size_t i = 0; i < totalParsers; ++i ) {
+ auto& parseInfo = parseInfos[i];
+ if( parseInfo.parser->cardinality() == 0 || parseInfo.count < parseInfo.parser->cardinality() ) {
+ result = parseInfo.parser->parse(exeName, result.value().remainingTokens());
+ if (!result)
+ return result;
+ if (result.value().type() != ParseResultType::NoMatch) {
+ tokenParsed = true;
+ ++parseInfo.count;
+ break;
+ }
+ }
+ }
+
+ if( result.value().type() == ParseResultType::ShortCircuitAll )
+ return result;
+ if( !tokenParsed )
+ return InternalParseResult::runtimeError( "Unrecognised token: " + result.value().remainingTokens()->token );
+ }
+ // !TBD Check missing required options
+ return result;
+ }
+ };
+
+ template<typename DerivedT>
+ template<typename T>
+ auto ComposableParserImpl<DerivedT>::operator|( T const &other ) const -> Parser {
+ return Parser() | static_cast<DerivedT const &>( *this ) | other;
+ }
+} // namespace detail
+
+// A Combined parser
+using detail::Parser;
+
+// A parser for options
+using detail::Opt;
+
+// A parser for arguments
+using detail::Arg;
+
+// Wrapper for argc, argv from main()
+using detail::Args;
+
+// Specifies the name of the executable
+using detail::ExeName;
+
+// Convenience wrapper for option parser that specifies the help option
+using detail::Help;
+
+// enum of result types from a parse
+using detail::ParseResultType;
+
+// Result type for parser operation
+using detail::ParserResult;
+
+}} // namespace Catch::clara
+
+// end clara.hpp
+#ifdef __clang__
+#pragma clang diagnostic pop
+#endif
+
+// Restore Clara's value for console width, if present
+#ifdef CATCH_TEMP_CLARA_CONFIG_CONSOLE_WIDTH
+#define CATCH_CLARA_TEXTFLOW_CONFIG_CONSOLE_WIDTH CATCH_TEMP_CLARA_CONFIG_CONSOLE_WIDTH
+#undef CATCH_TEMP_CLARA_CONFIG_CONSOLE_WIDTH
+#endif
+
+// end catch_clara.h
+namespace Catch {
+
+ clara::Parser makeCommandLineParser( ConfigData& config );
+
+} // end namespace Catch
+
+// end catch_commandline.h
+#include <fstream>
+#include <ctime>
+
+namespace Catch {
+
+ clara::Parser makeCommandLineParser( ConfigData& config ) {
+
+ using namespace clara;
+
+ auto const setWarning = [&]( std::string const& warning ) {
+ auto warningSet = [&]() {
+ if( warning == "NoAssertions" )
+ return WarnAbout::NoAssertions;
+
+ if ( warning == "NoTests" )
+ return WarnAbout::NoTests;
+
+ return WarnAbout::Nothing;
+ }();
+
+ if (warningSet == WarnAbout::Nothing)
+ return ParserResult::runtimeError( "Unrecognised warning: '" + warning + "'" );
+ config.warnings = static_cast<WarnAbout::What>( config.warnings | warningSet );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const loadTestNamesFromFile = [&]( std::string const& filename ) {
+ std::ifstream f( filename.c_str() );
+ if( !f.is_open() )
+ return ParserResult::runtimeError( "Unable to load input file: '" + filename + "'" );
+
+ std::string line;
+ while( std::getline( f, line ) ) {
+ line = trim(line);
+ if( !line.empty() && !startsWith( line, '#' ) ) {
+ if( !startsWith( line, '"' ) )
+ line = '"' + line + '"';
+ config.testsOrTags.push_back( line + ',' );
+ }
+ }
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const setTestOrder = [&]( std::string const& order ) {
+ if( startsWith( "declared", order ) )
+ config.runOrder = RunTests::InDeclarationOrder;
+ else if( startsWith( "lexical", order ) )
+ config.runOrder = RunTests::InLexicographicalOrder;
+ else if( startsWith( "random", order ) )
+ config.runOrder = RunTests::InRandomOrder;
+ else
+ return clara::ParserResult::runtimeError( "Unrecognised ordering: '" + order + "'" );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const setRngSeed = [&]( std::string const& seed ) {
+ if( seed != "time" )
+ return clara::detail::convertInto( seed, config.rngSeed );
+ config.rngSeed = static_cast<unsigned int>( std::time(nullptr) );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const setColourUsage = [&]( std::string const& useColour ) {
+ auto mode = toLower( useColour );
+
+ if( mode == "yes" )
+ config.useColour = UseColour::Yes;
+ else if( mode == "no" )
+ config.useColour = UseColour::No;
+ else if( mode == "auto" )
+ config.useColour = UseColour::Auto;
+ else
+ return ParserResult::runtimeError( "colour mode must be one of: auto, yes or no. '" + useColour + "' not recognised" );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const setWaitForKeypress = [&]( std::string const& keypress ) {
+ auto keypressLc = toLower( keypress );
+ if( keypressLc == "start" )
+ config.waitForKeypress = WaitForKeypress::BeforeStart;
+ else if( keypressLc == "exit" )
+ config.waitForKeypress = WaitForKeypress::BeforeExit;
+ else if( keypressLc == "both" )
+ config.waitForKeypress = WaitForKeypress::BeforeStartAndExit;
+ else
+ return ParserResult::runtimeError( "keypress argument must be one of: start, exit or both. '" + keypress + "' not recognised" );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const setVerbosity = [&]( std::string const& verbosity ) {
+ auto lcVerbosity = toLower( verbosity );
+ if( lcVerbosity == "quiet" )
+ config.verbosity = Verbosity::Quiet;
+ else if( lcVerbosity == "normal" )
+ config.verbosity = Verbosity::Normal;
+ else if( lcVerbosity == "high" )
+ config.verbosity = Verbosity::High;
+ else
+ return ParserResult::runtimeError( "Unrecognised verbosity, '" + verbosity + "'" );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+ auto const setReporter = [&]( std::string const& reporter ) {
+ IReporterRegistry::FactoryMap const& factories = getRegistryHub().getReporterRegistry().getFactories();
+
+ auto lcReporter = toLower( reporter );
+ auto result = factories.find( lcReporter );
+
+ if( factories.end() != result )
+ config.reporterName = lcReporter;
+ else
+ return ParserResult::runtimeError( "Unrecognized reporter, '" + reporter + "'. Check available with --list-reporters" );
+ return ParserResult::ok( ParseResultType::Matched );
+ };
+
+ auto cli
+ = ExeName( config.processName )
+ | Help( config.showHelp )
+ | Opt( config.listTests )
+ ["-l"]["--list-tests"]
+ ( "list all/matching test cases" )
+ | Opt( config.listTags )
+ ["-t"]["--list-tags"]
+ ( "list all/matching tags" )
+ | Opt( config.showSuccessfulTests )
+ ["-s"]["--success"]
+ ( "include successful tests in output" )
+ | Opt( config.shouldDebugBreak )
+ ["-b"]["--break"]
+ ( "break into debugger on failure" )
+ | Opt( config.noThrow )
+ ["-e"]["--nothrow"]
+ ( "skip exception tests" )
+ | Opt( config.showInvisibles )
+ ["-i"]["--invisibles"]
+ ( "show invisibles (tabs, newlines)" )
+ | Opt( config.outputFilename, "filename" )
+ ["-o"]["--out"]
+ ( "output filename" )
+ | Opt( setReporter, "name" )
+ ["-r"]["--reporter"]
+ ( "reporter to use (defaults to console)" )
+ | Opt( config.name, "name" )
+ ["-n"]["--name"]
+ ( "suite name" )
+ | Opt( [&]( bool ){ config.abortAfter = 1; } )
+ ["-a"]["--abort"]
+ ( "abort at first failure" )
+ | Opt( [&]( int x ){ config.abortAfter = x; }, "no. failures" )
+ ["-x"]["--abortx"]
+ ( "abort after x failures" )
+ | Opt( setWarning, "warning name" )
+ ["-w"]["--warn"]
+ ( "enable warnings" )
+ | Opt( [&]( bool flag ) { config.showDurations = flag ? ShowDurations::Always : ShowDurations::Never; }, "yes|no" )
+ ["-d"]["--durations"]
+ ( "show test durations" )
+ | Opt( loadTestNamesFromFile, "filename" )
+ ["-f"]["--input-file"]
+ ( "load test names to run from a file" )
+ | Opt( config.filenamesAsTags )
+ ["-#"]["--filenames-as-tags"]
+ ( "adds a tag for the filename" )
+ | Opt( config.sectionsToRun, "section name" )
+ ["-c"]["--section"]
+ ( "specify section to run" )
+ | Opt( setVerbosity, "quiet|normal|high" )
+ ["-v"]["--verbosity"]
+ ( "set output verbosity" )
+ | Opt( config.listTestNamesOnly )
+ ["--list-test-names-only"]
+ ( "list all/matching test cases names only" )
+ | Opt( config.listReporters )
+ ["--list-reporters"]
+ ( "list all reporters" )
+ | Opt( setTestOrder, "decl|lex|rand" )
+ ["--order"]
+ ( "test case order (defaults to decl)" )
+ | Opt( setRngSeed, "'time'|number" )
+ ["--rng-seed"]
+ ( "set a specific seed for random numbers" )
+ | Opt( setColourUsage, "yes|no" )
+ ["--use-colour"]
+ ( "should output be colourised" )
+ | Opt( config.libIdentify )
+ ["--libidentify"]
+ ( "report name and version according to libidentify standard" )
+ | Opt( setWaitForKeypress, "start|exit|both" )
+ ["--wait-for-keypress"]
+ ( "waits for a keypress before exiting" )
+ | Opt( config.benchmarkResolutionMultiple, "multiplier" )
+ ["--benchmark-resolution-multiple"]
+ ( "multiple of clock resolution to run benchmarks" )
+
+ | Arg( config.testsOrTags, "test name|pattern|tags" )
+ ( "which test or tests to use" );
+
+ return cli;
+ }
+
+} // end namespace Catch
+// end catch_commandline.cpp
+// start catch_common.cpp
+
+#include <cstring>
+#include <ostream>
+
+namespace Catch {
+
+ bool SourceLineInfo::empty() const noexcept {
+ return file[0] == '\0';
+ }
+ bool SourceLineInfo::operator == ( SourceLineInfo const& other ) const noexcept {
+ return line == other.line && (file == other.file || std::strcmp(file, other.file) == 0);
+ }
+ bool SourceLineInfo::operator < ( SourceLineInfo const& other ) const noexcept {
+ // We can assume that the same file will usually have the same pointer.
+ // Thus, if the pointers are the same, there is no point in calling the strcmp
+ return line < other.line || ( line == other.line && file != other.file && (std::strcmp(file, other.file) < 0));
+ }
+
+ std::ostream& operator << ( std::ostream& os, SourceLineInfo const& info ) {
+#ifndef __GNUG__
+ os << info.file << '(' << info.line << ')';
+#else
+ os << info.file << ':' << info.line;
+#endif
+ return os;
+ }
+
+ std::string StreamEndStop::operator+() const {
+ return std::string();
+ }
+
+ NonCopyable::NonCopyable() = default;
+ NonCopyable::~NonCopyable() = default;
+
+}
+// end catch_common.cpp
+// start catch_config.cpp
+
+namespace Catch {
+
+ Config::Config( ConfigData const& data )
+ : m_data( data ),
+ m_stream( openStream() )
+ {
+ TestSpecParser parser(ITagAliasRegistry::get());
+ if (!data.testsOrTags.empty()) {
+ m_hasTestFilters = true;
+ for( auto const& testOrTags : data.testsOrTags )
+ parser.parse( testOrTags );
+ }
+ m_testSpec = parser.testSpec();
+ }
+
+ std::string const& Config::getFilename() const {
+ return m_data.outputFilename ;
+ }
+
+ bool Config::listTests() const { return m_data.listTests; }
+ bool Config::listTestNamesOnly() const { return m_data.listTestNamesOnly; }
+ bool Config::listTags() const { return m_data.listTags; }
+ bool Config::listReporters() const { return m_data.listReporters; }
+
+ std::string Config::getProcessName() const { return m_data.processName; }
+ std::string const& Config::getReporterName() const { return m_data.reporterName; }
+
+ std::vector<std::string> const& Config::getTestsOrTags() const { return m_data.testsOrTags; }
+ std::vector<std::string> const& Config::getSectionsToRun() const { return m_data.sectionsToRun; }
+
+ TestSpec const& Config::testSpec() const { return m_testSpec; }
+ bool Config::hasTestFilters() const { return m_hasTestFilters; }
+
+ bool Config::showHelp() const { return m_data.showHelp; }
+
+ // IConfig interface
+ bool Config::allowThrows() const { return !m_data.noThrow; }
+ std::ostream& Config::stream() const { return m_stream->stream(); }
+ std::string Config::name() const { return m_data.name.empty() ? m_data.processName : m_data.name; }
+ bool Config::includeSuccessfulResults() const { return m_data.showSuccessfulTests; }
+ bool Config::warnAboutMissingAssertions() const { return !!(m_data.warnings & WarnAbout::NoAssertions); }
+ bool Config::warnAboutNoTests() const { return !!(m_data.warnings & WarnAbout::NoTests); }
+ ShowDurations::OrNot Config::showDurations() const { return m_data.showDurations; }
+ RunTests::InWhatOrder Config::runOrder() const { return m_data.runOrder; }
+ unsigned int Config::rngSeed() const { return m_data.rngSeed; }
+ int Config::benchmarkResolutionMultiple() const { return m_data.benchmarkResolutionMultiple; }
+ UseColour::YesOrNo Config::useColour() const { return m_data.useColour; }
+ bool Config::shouldDebugBreak() const { return m_data.shouldDebugBreak; }
+ int Config::abortAfter() const { return m_data.abortAfter; }
+ bool Config::showInvisibles() const { return m_data.showInvisibles; }
+ Verbosity Config::verbosity() const { return m_data.verbosity; }
+
+ IStream const* Config::openStream() {
+ return Catch::makeStream(m_data.outputFilename);
+ }
+
+} // end namespace Catch
+// end catch_config.cpp
+// start catch_console_colour.cpp
+
+#if defined(__clang__)
+# pragma clang diagnostic push
+# pragma clang diagnostic ignored "-Wexit-time-destructors"
+#endif
+
+// start catch_errno_guard.h
+
+namespace Catch {
+
+ class ErrnoGuard {
+ public:
+ ErrnoGuard();
+ ~ErrnoGuard();
+ private:
+ int m_oldErrno;
+ };
+
+}
+
+// end catch_errno_guard.h
+#include <sstream>
+
+namespace Catch {
+ namespace {
+
+ struct IColourImpl {
+ virtual ~IColourImpl() = default;
+ virtual void use( Colour::Code _colourCode ) = 0;
+ };
+
+ struct NoColourImpl : IColourImpl {
+ void use( Colour::Code ) {}
+
+ static IColourImpl* instance() {
+ static NoColourImpl s_instance;
+ return &s_instance;
+ }
+ };
+
+ } // anon namespace
+} // namespace Catch
+
+#if !defined( CATCH_CONFIG_COLOUR_NONE ) && !defined( CATCH_CONFIG_COLOUR_WINDOWS ) && !defined( CATCH_CONFIG_COLOUR_ANSI )
+# ifdef CATCH_PLATFORM_WINDOWS
+# define CATCH_CONFIG_COLOUR_WINDOWS
+# else
+# define CATCH_CONFIG_COLOUR_ANSI
+# endif
+#endif
+
+#if defined ( CATCH_CONFIG_COLOUR_WINDOWS ) /////////////////////////////////////////
+
+namespace Catch {
+namespace {
+
+ class Win32ColourImpl : public IColourImpl {
+ public:
+ Win32ColourImpl() : stdoutHandle( GetStdHandle(STD_OUTPUT_HANDLE) )
+ {
+ CONSOLE_SCREEN_BUFFER_INFO csbiInfo;
+ GetConsoleScreenBufferInfo( stdoutHandle, &csbiInfo );
+ originalForegroundAttributes = csbiInfo.wAttributes & ~( BACKGROUND_GREEN | BACKGROUND_RED | BACKGROUND_BLUE | BACKGROUND_INTENSITY );
+ originalBackgroundAttributes = csbiInfo.wAttributes & ~( FOREGROUND_GREEN | FOREGROUND_RED | FOREGROUND_BLUE | FOREGROUND_INTENSITY );
+ }
+
+ void use( Colour::Code _colourCode ) override {
+ switch( _colourCode ) {
+ case Colour::None: return setTextAttribute( originalForegroundAttributes );
+ case Colour::White: return setTextAttribute( FOREGROUND_GREEN | FOREGROUND_RED | FOREGROUND_BLUE );
+ case Colour::Red: return setTextAttribute( FOREGROUND_RED );
+ case Colour::Green: return setTextAttribute( FOREGROUND_GREEN );
+ case Colour::Blue: return setTextAttribute( FOREGROUND_BLUE );
+ case Colour::Cyan: return setTextAttribute( FOREGROUND_BLUE | FOREGROUND_GREEN );
+ case Colour::Yellow: return setTextAttribute( FOREGROUND_RED | FOREGROUND_GREEN );
+ case Colour::Grey: return setTextAttribute( 0 );
+
+ case Colour::LightGrey: return setTextAttribute( FOREGROUND_INTENSITY );
+ case Colour::BrightRed: return setTextAttribute( FOREGROUND_INTENSITY | FOREGROUND_RED );
+ case Colour::BrightGreen: return setTextAttribute( FOREGROUND_INTENSITY | FOREGROUND_GREEN );
+ case Colour::BrightWhite: return setTextAttribute( FOREGROUND_INTENSITY | FOREGROUND_GREEN | FOREGROUND_RED | FOREGROUND_BLUE );
+ case Colour::BrightYellow: return setTextAttribute( FOREGROUND_INTENSITY | FOREGROUND_RED | FOREGROUND_GREEN );
+
+ case Colour::Bright: CATCH_INTERNAL_ERROR( "not a colour" );
+
+ default:
+ CATCH_ERROR( "Unknown colour requested" );
+ }
+ }
+
+ private:
+ void setTextAttribute( WORD _textAttribute ) {
+ SetConsoleTextAttribute( stdoutHandle, _textAttribute | originalBackgroundAttributes );
+ }
+ HANDLE stdoutHandle;
+ WORD originalForegroundAttributes;
+ WORD originalBackgroundAttributes;
+ };
+
+ IColourImpl* platformColourInstance() {
+ static Win32ColourImpl s_instance;
+
+ IConfigPtr config = getCurrentContext().getConfig();
+ UseColour::YesOrNo colourMode = config
+ ? config->useColour()
+ : UseColour::Auto;
+ if( colourMode == UseColour::Auto )
+ colourMode = UseColour::Yes;
+ return colourMode == UseColour::Yes
+ ? &s_instance
+ : NoColourImpl::instance();
+ }
+
+} // end anon namespace
+} // end namespace Catch
+
+#elif defined( CATCH_CONFIG_COLOUR_ANSI ) //////////////////////////////////////
+
+#include <unistd.h>
+
+namespace Catch {
+namespace {
+
+ // use POSIX/ ANSI console terminal codes
+ // Thanks to Adam Strzelecki for original contribution
+ // (http://github.com/nanoant)
+ // https://github.com/philsquared/Catch/pull/131
+ class PosixColourImpl : public IColourImpl {
+ public:
+ void use( Colour::Code _colourCode ) override {
+ switch( _colourCode ) {
+ case Colour::None:
+ case Colour::White: return setColour( "[0m" );
+ case Colour::Red: return setColour( "[0;31m" );
+ case Colour::Green: return setColour( "[0;32m" );
+ case Colour::Blue: return setColour( "[0;34m" );
+ case Colour::Cyan: return setColour( "[0;36m" );
+ case Colour::Yellow: return setColour( "[0;33m" );
+ case Colour::Grey: return setColour( "[1;30m" );
+
+ case Colour::LightGrey: return setColour( "[0;37m" );
+ case Colour::BrightRed: return setColour( "[1;31m" );
+ case Colour::BrightGreen: return setColour( "[1;32m" );
+ case Colour::BrightWhite: return setColour( "[1;37m" );
+ case Colour::BrightYellow: return setColour( "[1;33m" );
+
+ case Colour::Bright: CATCH_INTERNAL_ERROR( "not a colour" );
+ default: CATCH_INTERNAL_ERROR( "Unknown colour requested" );
+ }
+ }
+ static IColourImpl* instance() {
+ static PosixColourImpl s_instance;
+ return &s_instance;
+ }
+
+ private:
+ void setColour( const char* _escapeCode ) {
+ getCurrentContext().getConfig()->stream()
+ << '\033' << _escapeCode;
+ }
+ };
+
+ bool useColourOnPlatform() {
+ return
+#ifdef CATCH_PLATFORM_MAC
+ !isDebuggerActive() &&
+#endif
+#if !(defined(__DJGPP__) && defined(__STRICT_ANSI__))
+ isatty(STDOUT_FILENO)
+#else
+ false
+#endif
+ ;
+ }
+ IColourImpl* platformColourInstance() {
+ ErrnoGuard guard;
+ IConfigPtr config = getCurrentContext().getConfig();
+ UseColour::YesOrNo colourMode = config
+ ? config->useColour()
+ : UseColour::Auto;
+ if( colourMode == UseColour::Auto )
+ colourMode = useColourOnPlatform()
+ ? UseColour::Yes
+ : UseColour::No;
+ return colourMode == UseColour::Yes
+ ? PosixColourImpl::instance()
+ : NoColourImpl::instance();
+ }
+
+} // end anon namespace
+} // end namespace Catch
+
+#else // not Windows or ANSI ///////////////////////////////////////////////
+
+namespace Catch {
+
+ static IColourImpl* platformColourInstance() { return NoColourImpl::instance(); }
+
+} // end namespace Catch
+
+#endif // Windows/ ANSI/ None
+
+namespace Catch {
+
+ Colour::Colour( Code _colourCode ) { use( _colourCode ); }
+ Colour::Colour( Colour&& rhs ) noexcept {
+ m_moved = rhs.m_moved;
+ rhs.m_moved = true;
+ }
+ Colour& Colour::operator=( Colour&& rhs ) noexcept {
+ m_moved = rhs.m_moved;
+ rhs.m_moved = true;
+ return *this;
+ }
+
+ Colour::~Colour(){ if( !m_moved ) use( None ); }
+
+ void Colour::use( Code _colourCode ) {
+ static IColourImpl* impl = platformColourInstance();
+ impl->use( _colourCode );
+ }
+
+ std::ostream& operator << ( std::ostream& os, Colour const& ) {
+ return os;
+ }
+
+} // end namespace Catch
+
+#if defined(__clang__)
+# pragma clang diagnostic pop
+#endif
+
+// end catch_console_colour.cpp
+// start catch_context.cpp
+
+namespace Catch {
+
+ class Context : public IMutableContext, NonCopyable {
+
+ public: // IContext
+ IResultCapture* getResultCapture() override {
+ return m_resultCapture;
+ }
+ IRunner* getRunner() override {
+ return m_runner;
+ }
+
+ IConfigPtr const& getConfig() const override {
+ return m_config;
+ }
+
+ ~Context() override;
+
+ public: // IMutableContext
+ void setResultCapture( IResultCapture* resultCapture ) override {
+ m_resultCapture = resultCapture;
+ }
+ void setRunner( IRunner* runner ) override {
+ m_runner = runner;
+ }
+ void setConfig( IConfigPtr const& config ) override {
+ m_config = config;
+ }
+
+ friend IMutableContext& getCurrentMutableContext();
+
+ private:
+ IConfigPtr m_config;
+ IRunner* m_runner = nullptr;
+ IResultCapture* m_resultCapture = nullptr;
+ };
+
+ IMutableContext *IMutableContext::currentContext = nullptr;
+
+ void IMutableContext::createContext()
+ {
+ currentContext = new Context();
+ }
+
+ void cleanUpContext() {
+ delete IMutableContext::currentContext;
+ IMutableContext::currentContext = nullptr;
+ }
+ IContext::~IContext() = default;
+ IMutableContext::~IMutableContext() = default;
+ Context::~Context() = default;
+}
+// end catch_context.cpp
+// start catch_debug_console.cpp
+
+// start catch_debug_console.h
+
+#include <string>
+
+namespace Catch {
+ void writeToDebugConsole( std::string const& text );
+}
+
+// end catch_debug_console.h
+#ifdef CATCH_PLATFORM_WINDOWS
+
+ namespace Catch {
+ void writeToDebugConsole( std::string const& text ) {
+ ::OutputDebugStringA( text.c_str() );
+ }
+ }
+
+#else
+
+ namespace Catch {
+ void writeToDebugConsole( std::string const& text ) {
+ // !TBD: Need a version for Mac/ XCode and other IDEs
+ Catch::cout() << text;
+ }
+ }
+
+#endif // Platform
+// end catch_debug_console.cpp
+// start catch_debugger.cpp
+
+#ifdef CATCH_PLATFORM_MAC
+
+# include <assert.h>
+# include <stdbool.h>
+# include <sys/types.h>
+# include <unistd.h>
+# include <cstddef>
+# include <ostream>
+
+#ifdef __apple_build_version__
+ // These headers will only compile with AppleClang (XCode)
+ // For other compilers (Clang, GCC, ... ) we need to exclude them
+# include <sys/sysctl.h>
+#endif
+
+ namespace Catch {
+ #ifdef __apple_build_version__
+ // The following function is taken directly from the following technical note:
+ // https://developer.apple.com/library/archive/qa/qa1361/_index.html
+
+ // Returns true if the current process is being debugged (either
+ // running under the debugger or has a debugger attached post facto).
+ bool isDebuggerActive(){
+ int mib[4];
+ struct kinfo_proc info;
+ std::size_t size;
+
+ // Initialize the flags so that, if sysctl fails for some bizarre
+ // reason, we get a predictable result.
+
+ info.kp_proc.p_flag = 0;
+
+ // Initialize mib, which tells sysctl the info we want, in this case
+ // we're looking for information about a specific process ID.
+
+ mib[0] = CTL_KERN;
+ mib[1] = KERN_PROC;
+ mib[2] = KERN_PROC_PID;
+ mib[3] = getpid();
+
+ // Call sysctl.
+
+ size = sizeof(info);
+ if( sysctl(mib, sizeof(mib) / sizeof(*mib), &info, &size, nullptr, 0) != 0 ) {
+ Catch::cerr() << "\n** Call to sysctl failed - unable to determine if debugger is active **\n" << std::endl;
+ return false;
+ }
+
+ // We're being debugged if the P_TRACED flag is set.
+
+ return ( (info.kp_proc.p_flag & P_TRACED) != 0 );
+ }
+ #else
+ bool isDebuggerActive() {
+ // We need to find another way to determine this for non-appleclang compilers on macOS
+ return false;
+ }
+ #endif
+ } // namespace Catch
+
+#elif defined(CATCH_PLATFORM_LINUX)
+ #include <fstream>
+ #include <string>
+
+ namespace Catch{
+ // The standard POSIX way of detecting a debugger is to attempt to
+ // ptrace() the process, but this needs to be done from a child and not
+ // this process itself to still allow attaching to this process later
+ // if wanted, so is rather heavy. Under Linux we have the PID of the
+ // "debugger" (which doesn't need to be gdb, of course, it could also
+ // be strace, for example) in /proc/$PID/status, so just get it from
+ // there instead.
+ bool isDebuggerActive(){
+ // Libstdc++ has a bug, where std::ifstream sets errno to 0
+ // This way our users can properly assert over errno values
+ ErrnoGuard guard;
+ std::ifstream in("/proc/self/status");
+ for( std::string line; std::getline(in, line); ) {
+ static const int PREFIX_LEN = 11;
+ if( line.compare(0, PREFIX_LEN, "TracerPid:\t") == 0 ) {
+ // We're traced if the PID is not 0 and no other PID starts
+ // with 0 digit, so it's enough to check for just a single
+ // character.
+ return line.length() > PREFIX_LEN && line[PREFIX_LEN] != '0';
+ }
+ }
+
+ return false;
+ }
+ } // namespace Catch
+#elif defined(_MSC_VER)
+ extern "C" __declspec(dllimport) int __stdcall IsDebuggerPresent();
+ namespace Catch {
+ bool isDebuggerActive() {
+ return IsDebuggerPresent() != 0;
+ }
+ }
+#elif defined(__MINGW32__)
+ extern "C" __declspec(dllimport) int __stdcall IsDebuggerPresent();
+ namespace Catch {
+ bool isDebuggerActive() {
+ return IsDebuggerPresent() != 0;
+ }
+ }
+#else
+ namespace Catch {
+ bool isDebuggerActive() { return false; }
+ }
+#endif // Platform
+// end catch_debugger.cpp
+// start catch_decomposer.cpp
+
+namespace Catch {
+
+ ITransientExpression::~ITransientExpression() = default;
+
+ void formatReconstructedExpression( std::ostream &os, std::string const& lhs, StringRef op, std::string const& rhs ) {
+ if( lhs.size() + rhs.size() < 40 &&
+ lhs.find('\n') == std::string::npos &&
+ rhs.find('\n') == std::string::npos )
+ os << lhs << " " << op << " " << rhs;
+ else
+ os << lhs << "\n" << op << "\n" << rhs;
+ }
+}
+// end catch_decomposer.cpp
+// start catch_enforce.cpp
+
+namespace Catch {
+#if defined(CATCH_CONFIG_DISABLE_EXCEPTIONS) && !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS_CUSTOM_HANDLER)
+ [[noreturn]]
+ void throw_exception(std::exception const& e) {
+ Catch::cerr() << "Catch will terminate because it needed to throw an exception.\n"
+ << "The message was: " << e.what() << '\n';
+ std::terminate();
+ }
+#endif
+} // namespace Catch;
+// end catch_enforce.cpp
+// start catch_enum_values_registry.cpp
+// start catch_enum_values_registry.h
+
+#include <vector>
+#include <memory>
+
+namespace Catch {
+
+ namespace Detail {
+
+ std::unique_ptr<EnumInfo> makeEnumInfo( StringRef enumName, StringRef allValueNames, std::vector<int> const& values );
+
+ class EnumValuesRegistry : public IMutableEnumValuesRegistry {
+
+ std::vector<std::unique_ptr<EnumInfo>> m_enumInfos;
+
+ EnumInfo const& registerEnum( StringRef enumName, StringRef allEnums, std::vector<int> const& values) override;
+ };
+
+ std::vector<std::string> parseEnums( StringRef enums );
+
+ } // Detail
+
+} // Catch
+
+// end catch_enum_values_registry.h
+
+#include <map>
+#include <cassert>
+
+namespace Catch {
+
+ IMutableEnumValuesRegistry::~IMutableEnumValuesRegistry() {}
+
+ namespace Detail {
+
+ std::vector<std::string> parseEnums( StringRef enums ) {
+ auto enumValues = splitStringRef( enums, ',' );
+ std::vector<std::string> parsed;
+ parsed.reserve( enumValues.size() );
+ for( auto const& enumValue : enumValues ) {
+ auto identifiers = splitStringRef( enumValue, ':' );
+ parsed.push_back( Catch::trim( identifiers.back() ) );
+ }
+ return parsed;
+ }
+
+ EnumInfo::~EnumInfo() {}
+
+ StringRef EnumInfo::lookup( int value ) const {
+ for( auto const& valueToName : m_values ) {
+ if( valueToName.first == value )
+ return valueToName.second;
+ }
+ return "{** unexpected enum value **}";
+ }
+
+ std::unique_ptr<EnumInfo> makeEnumInfo( StringRef enumName, StringRef allValueNames, std::vector<int> const& values ) {
+ std::unique_ptr<EnumInfo> enumInfo( new EnumInfo );
+ enumInfo->m_name = enumName;
+ enumInfo->m_values.reserve( values.size() );
+
+ const auto valueNames = Catch::Detail::parseEnums( allValueNames );
+ assert( valueNames.size() == values.size() );
+ std::size_t i = 0;
+ for( auto value : values )
+ enumInfo->m_values.push_back({ value, valueNames[i++] });
+
+ return enumInfo;
+ }
+
+ EnumInfo const& EnumValuesRegistry::registerEnum( StringRef enumName, StringRef allValueNames, std::vector<int> const& values ) {
+ auto enumInfo = makeEnumInfo( enumName, allValueNames, values );
+ EnumInfo* raw = enumInfo.get();
+ m_enumInfos.push_back( std::move( enumInfo ) );
+ return *raw;
+ }
+
+ } // Detail
+} // Catch
+
+// end catch_enum_values_registry.cpp
+// start catch_errno_guard.cpp
+
+#include <cerrno>
+
+namespace Catch {
+ ErrnoGuard::ErrnoGuard():m_oldErrno(errno){}
+ ErrnoGuard::~ErrnoGuard() { errno = m_oldErrno; }
+}
+// end catch_errno_guard.cpp
+// start catch_exception_translator_registry.cpp
+
+// start catch_exception_translator_registry.h
+
+#include <vector>
+#include <string>
+#include <memory>
+
+namespace Catch {
+
+ class ExceptionTranslatorRegistry : public IExceptionTranslatorRegistry {
+ public:
+ ~ExceptionTranslatorRegistry();
+ virtual void registerTranslator( const IExceptionTranslator* translator );
+ std::string translateActiveException() const override;
+ std::string tryTranslators() const;
+
+ private:
+ std::vector<std::unique_ptr<IExceptionTranslator const>> m_translators;
+ };
+}
+
+// end catch_exception_translator_registry.h
+#ifdef __OBJC__
+#import "Foundation/Foundation.h"
+#endif
+
+namespace Catch {
+
+ ExceptionTranslatorRegistry::~ExceptionTranslatorRegistry() {
+ }
+
+ void ExceptionTranslatorRegistry::registerTranslator( const IExceptionTranslator* translator ) {
+ m_translators.push_back( std::unique_ptr<const IExceptionTranslator>( translator ) );
+ }
+
+#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+ std::string ExceptionTranslatorRegistry::translateActiveException() const {
+ try {
+#ifdef __OBJC__
+ // In Objective-C try objective-c exceptions first
+ @try {
+ return tryTranslators();
+ }
+ @catch (NSException *exception) {
+ return Catch::Detail::stringify( [exception description] );
+ }
+#else
+ // Compiling a mixed mode project with MSVC means that CLR
+ // exceptions will be caught in (...) as well. However, these
+ // do not fill-in std::current_exception and thus lead to crash
+ // when attempting rethrow.
+ // /EHa switch also causes structured exceptions to be caught
+ // here, but they fill-in current_exception properly, so
+ // at worst the output should be a little weird, instead of
+ // causing a crash.
+ if (std::current_exception() == nullptr) {
+ return "Non C++ exception. Possibly a CLR exception.";
+ }
+ return tryTranslators();
+#endif
+ }
+ catch( TestFailureException& ) {
+ std::rethrow_exception(std::current_exception());
+ }
+ catch( std::exception& ex ) {
+ return ex.what();
+ }
+ catch( std::string& msg ) {
+ return msg;
+ }
+ catch( const char* msg ) {
+ return msg;
+ }
+ catch(...) {
+ return "Unknown exception";
+ }
+ }
+
+ std::string ExceptionTranslatorRegistry::tryTranslators() const {
+ if (m_translators.empty()) {
+ std::rethrow_exception(std::current_exception());
+ } else {
+ return m_translators[0]->translate(m_translators.begin() + 1, m_translators.end());
+ }
+ }
+
+#else // ^^ Exceptions are enabled // Exceptions are disabled vv
+ std::string ExceptionTranslatorRegistry::translateActiveException() const {
+ CATCH_INTERNAL_ERROR("Attempted to translate active exception under CATCH_CONFIG_DISABLE_EXCEPTIONS!");
+ }
+
+ std::string ExceptionTranslatorRegistry::tryTranslators() const {
+ CATCH_INTERNAL_ERROR("Attempted to use exception translators under CATCH_CONFIG_DISABLE_EXCEPTIONS!");
+ }
+#endif
+
+}
+// end catch_exception_translator_registry.cpp
+// start catch_fatal_condition.cpp
+
+#if defined(__GNUC__)
+# pragma GCC diagnostic push
+# pragma GCC diagnostic ignored "-Wmissing-field-initializers"
+#endif
+
+#if defined( CATCH_CONFIG_WINDOWS_SEH ) || defined( CATCH_CONFIG_POSIX_SIGNALS )
+
+namespace {
+ // Report the error condition
+ void reportFatal( char const * const message ) {
+ Catch::getCurrentContext().getResultCapture()->handleFatalErrorCondition( message );
+ }
+}
+
+#endif // signals/SEH handling
+
+#if defined( CATCH_CONFIG_WINDOWS_SEH )
+
+namespace Catch {
+ struct SignalDefs { DWORD id; const char* name; };
+
+ // There is no 1-1 mapping between signals and windows exceptions.
+ // Windows can easily distinguish between SO and SigSegV,
+ // but SigInt, SigTerm, etc are handled differently.
+ static SignalDefs signalDefs[] = {
+ { static_cast<DWORD>(EXCEPTION_ILLEGAL_INSTRUCTION), "SIGILL - Illegal instruction signal" },
+ { static_cast<DWORD>(EXCEPTION_STACK_OVERFLOW), "SIGSEGV - Stack overflow" },
+ { static_cast<DWORD>(EXCEPTION_ACCESS_VIOLATION), "SIGSEGV - Segmentation violation signal" },
+ { static_cast<DWORD>(EXCEPTION_INT_DIVIDE_BY_ZERO), "Divide by zero error" },
+ };
+
+ LONG CALLBACK FatalConditionHandler::handleVectoredException(PEXCEPTION_POINTERS ExceptionInfo) {
+ for (auto const& def : signalDefs) {
+ if (ExceptionInfo->ExceptionRecord->ExceptionCode == def.id) {
+ reportFatal(def.name);
+ }
+ }
+ // If its not an exception we care about, pass it along.
+ // This stops us from eating debugger breaks etc.
+ return EXCEPTION_CONTINUE_SEARCH;
+ }
+
+ FatalConditionHandler::FatalConditionHandler() {
+ isSet = true;
+ // 32k seems enough for Catch to handle stack overflow,
+ // but the value was found experimentally, so there is no strong guarantee
+ guaranteeSize = 32 * 1024;
+ exceptionHandlerHandle = nullptr;
+ // Register as first handler in current chain
+ exceptionHandlerHandle = AddVectoredExceptionHandler(1, handleVectoredException);
+ // Pass in guarantee size to be filled
+ SetThreadStackGuarantee(&guaranteeSize);
+ }
+
+ void FatalConditionHandler::reset() {
+ if (isSet) {
+ RemoveVectoredExceptionHandler(exceptionHandlerHandle);
+ SetThreadStackGuarantee(&guaranteeSize);
+ exceptionHandlerHandle = nullptr;
+ isSet = false;
+ }
+ }
+
+ FatalConditionHandler::~FatalConditionHandler() {
+ reset();
+ }
+
+bool FatalConditionHandler::isSet = false;
+ULONG FatalConditionHandler::guaranteeSize = 0;
+PVOID FatalConditionHandler::exceptionHandlerHandle = nullptr;
+
+} // namespace Catch
+
+#elif defined( CATCH_CONFIG_POSIX_SIGNALS )
+
+namespace Catch {
+
+ struct SignalDefs {
+ int id;
+ const char* name;
+ };
+
+ // 32kb for the alternate stack seems to be sufficient. However, this value
+ // is experimentally determined, so that's not guaranteed.
+ constexpr static std::size_t sigStackSize = 32768 >= MINSIGSTKSZ ? 32768 : MINSIGSTKSZ;
+
+ static SignalDefs signalDefs[] = {
+ { SIGINT, "SIGINT - Terminal interrupt signal" },
+ { SIGILL, "SIGILL - Illegal instruction signal" },
+ { SIGFPE, "SIGFPE - Floating point error signal" },
+ { SIGSEGV, "SIGSEGV - Segmentation violation signal" },
+ { SIGTERM, "SIGTERM - Termination request signal" },
+ { SIGABRT, "SIGABRT - Abort (abnormal termination) signal" }
+ };
+
+ void FatalConditionHandler::handleSignal( int sig ) {
+ char const * name = "<unknown signal>";
+ for (auto const& def : signalDefs) {
+ if (sig == def.id) {
+ name = def.name;
+ break;
+ }
+ }
+ reset();
+ reportFatal(name);
+ raise( sig );
+ }
+
+ FatalConditionHandler::FatalConditionHandler() {
+ isSet = true;
+ stack_t sigStack;
+ sigStack.ss_sp = altStackMem;
+ sigStack.ss_size = sigStackSize;
+ sigStack.ss_flags = 0;
+ sigaltstack(&sigStack, &oldSigStack);
+ struct sigaction sa = { };
+
+ sa.sa_handler = handleSignal;
+ sa.sa_flags = SA_ONSTACK;
+ for (std::size_t i = 0; i < sizeof(signalDefs)/sizeof(SignalDefs); ++i) {
+ sigaction(signalDefs[i].id, &sa, &oldSigActions[i]);
+ }
+ }
+
+ FatalConditionHandler::~FatalConditionHandler() {
+ reset();
+ }
+
+ void FatalConditionHandler::reset() {
+ if( isSet ) {
+ // Set signals back to previous values -- hopefully nobody overwrote them in the meantime
+ for( std::size_t i = 0; i < sizeof(signalDefs)/sizeof(SignalDefs); ++i ) {
+ sigaction(signalDefs[i].id, &oldSigActions[i], nullptr);
+ }
+ // Return the old stack
+ sigaltstack(&oldSigStack, nullptr);
+ isSet = false;
+ }
+ }
+
+ bool FatalConditionHandler::isSet = false;
+ struct sigaction FatalConditionHandler::oldSigActions[sizeof(signalDefs)/sizeof(SignalDefs)] = {};
+ stack_t FatalConditionHandler::oldSigStack = {};
+ char FatalConditionHandler::altStackMem[sigStackSize] = {};
+
+} // namespace Catch
+
+#else
+
+namespace Catch {
+ void FatalConditionHandler::reset() {}
+}
+
+#endif // signals/SEH handling
+
+#if defined(__GNUC__)
+# pragma GCC diagnostic pop
+#endif
+// end catch_fatal_condition.cpp
+// start catch_generators.cpp
+
+// start catch_random_number_generator.h
+
+#include <algorithm>
+#include <random>
+
+namespace Catch {
+
+ struct IConfig;
+
+ std::mt19937& rng();
+ void seedRng( IConfig const& config );
+ unsigned int rngSeed();
+
+}
+
+// end catch_random_number_generator.h
+#include <limits>
+#include <set>
+
+namespace Catch {
+
+IGeneratorTracker::~IGeneratorTracker() {}
+
+const char* GeneratorException::what() const noexcept {
+ return m_msg;
+}
+
+namespace Generators {
+
+ GeneratorUntypedBase::~GeneratorUntypedBase() {}
+
+ auto acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker& {
+ return getResultCapture().acquireGeneratorTracker( lineInfo );
+ }
+
+} // namespace Generators
+} // namespace Catch
+// end catch_generators.cpp
+// start catch_interfaces_capture.cpp
+
+namespace Catch {
+ IResultCapture::~IResultCapture() = default;
+}
+// end catch_interfaces_capture.cpp
+// start catch_interfaces_config.cpp
+
+namespace Catch {
+ IConfig::~IConfig() = default;
+}
+// end catch_interfaces_config.cpp
+// start catch_interfaces_exception.cpp
+
+namespace Catch {
+ IExceptionTranslator::~IExceptionTranslator() = default;
+ IExceptionTranslatorRegistry::~IExceptionTranslatorRegistry() = default;
+}
+// end catch_interfaces_exception.cpp
+// start catch_interfaces_registry_hub.cpp
+
+namespace Catch {
+ IRegistryHub::~IRegistryHub() = default;
+ IMutableRegistryHub::~IMutableRegistryHub() = default;
+}
+// end catch_interfaces_registry_hub.cpp
+// start catch_interfaces_reporter.cpp
+
+// start catch_reporter_listening.h
+
+namespace Catch {
+
+ class ListeningReporter : public IStreamingReporter {
+ using Reporters = std::vector<IStreamingReporterPtr>;
+ Reporters m_listeners;
+ IStreamingReporterPtr m_reporter = nullptr;
+ ReporterPreferences m_preferences;
+
+ public:
+ ListeningReporter();
+
+ void addListener( IStreamingReporterPtr&& listener );
+ void addReporter( IStreamingReporterPtr&& reporter );
+
+ public: // IStreamingReporter
+
+ ReporterPreferences getPreferences() const override;
+
+ void noMatchingTestCases( std::string const& spec ) override;
+
+ static std::set<Verbosity> getSupportedVerbosities();
+
+ void benchmarkStarting( BenchmarkInfo const& benchmarkInfo ) override;
+ void benchmarkEnded( BenchmarkStats const& benchmarkStats ) override;
+
+ void testRunStarting( TestRunInfo const& testRunInfo ) override;
+ void testGroupStarting( GroupInfo const& groupInfo ) override;
+ void testCaseStarting( TestCaseInfo const& testInfo ) override;
+ void sectionStarting( SectionInfo const& sectionInfo ) override;
+ void assertionStarting( AssertionInfo const& assertionInfo ) override;
+
+ // The return value indicates if the messages buffer should be cleared:
+ bool assertionEnded( AssertionStats const& assertionStats ) override;
+ void sectionEnded( SectionStats const& sectionStats ) override;
+ void testCaseEnded( TestCaseStats const& testCaseStats ) override;
+ void testGroupEnded( TestGroupStats const& testGroupStats ) override;
+ void testRunEnded( TestRunStats const& testRunStats ) override;
+
+ void skipTest( TestCaseInfo const& testInfo ) override;
+ bool isMulti() const override;
+
+ };
+
+} // end namespace Catch
+
+// end catch_reporter_listening.h
+namespace Catch {
+
+ ReporterConfig::ReporterConfig( IConfigPtr const& _fullConfig )
+ : m_stream( &_fullConfig->stream() ), m_fullConfig( _fullConfig ) {}
+
+ ReporterConfig::ReporterConfig( IConfigPtr const& _fullConfig, std::ostream& _stream )
+ : m_stream( &_stream ), m_fullConfig( _fullConfig ) {}
+
+ std::ostream& ReporterConfig::stream() const { return *m_stream; }
+ IConfigPtr ReporterConfig::fullConfig() const { return m_fullConfig; }
+
+ TestRunInfo::TestRunInfo( std::string const& _name ) : name( _name ) {}
+
+ GroupInfo::GroupInfo( std::string const& _name,
+ std::size_t _groupIndex,
+ std::size_t _groupsCount )
+ : name( _name ),
+ groupIndex( _groupIndex ),
+ groupsCounts( _groupsCount )
+ {}
+
+ AssertionStats::AssertionStats( AssertionResult const& _assertionResult,
+ std::vector<MessageInfo> const& _infoMessages,
+ Totals const& _totals )
+ : assertionResult( _assertionResult ),
+ infoMessages( _infoMessages ),
+ totals( _totals )
+ {
+ assertionResult.m_resultData.lazyExpression.m_transientExpression = _assertionResult.m_resultData.lazyExpression.m_transientExpression;
+
+ if( assertionResult.hasMessage() ) {
+ // Copy message into messages list.
+ // !TBD This should have been done earlier, somewhere
+ MessageBuilder builder( assertionResult.getTestMacroName(), assertionResult.getSourceInfo(), assertionResult.getResultType() );
+ builder << assertionResult.getMessage();
+ builder.m_info.message = builder.m_stream.str();
+
+ infoMessages.push_back( builder.m_info );
+ }
+ }
+
+ AssertionStats::~AssertionStats() = default;
+
+ SectionStats::SectionStats( SectionInfo const& _sectionInfo,
+ Counts const& _assertions,
+ double _durationInSeconds,
+ bool _missingAssertions )
+ : sectionInfo( _sectionInfo ),
+ assertions( _assertions ),
+ durationInSeconds( _durationInSeconds ),
+ missingAssertions( _missingAssertions )
+ {}
+
+ SectionStats::~SectionStats() = default;
+
+ TestCaseStats::TestCaseStats( TestCaseInfo const& _testInfo,
+ Totals const& _totals,
+ std::string const& _stdOut,
+ std::string const& _stdErr,
+ bool _aborting )
+ : testInfo( _testInfo ),
+ totals( _totals ),
+ stdOut( _stdOut ),
+ stdErr( _stdErr ),
+ aborting( _aborting )
+ {}
+
+ TestCaseStats::~TestCaseStats() = default;
+
+ TestGroupStats::TestGroupStats( GroupInfo const& _groupInfo,
+ Totals const& _totals,
+ bool _aborting )
+ : groupInfo( _groupInfo ),
+ totals( _totals ),
+ aborting( _aborting )
+ {}
+
+ TestGroupStats::TestGroupStats( GroupInfo const& _groupInfo )
+ : groupInfo( _groupInfo ),
+ aborting( false )
+ {}
+
+ TestGroupStats::~TestGroupStats() = default;
+
+ TestRunStats::TestRunStats( TestRunInfo const& _runInfo,
+ Totals const& _totals,
+ bool _aborting )
+ : runInfo( _runInfo ),
+ totals( _totals ),
+ aborting( _aborting )
+ {}
+
+ TestRunStats::~TestRunStats() = default;
+
+ void IStreamingReporter::fatalErrorEncountered( StringRef ) {}
+ bool IStreamingReporter::isMulti() const { return false; }
+
+ IReporterFactory::~IReporterFactory() = default;
+ IReporterRegistry::~IReporterRegistry() = default;
+
+} // end namespace Catch
+// end catch_interfaces_reporter.cpp
+// start catch_interfaces_runner.cpp
+
+namespace Catch {
+ IRunner::~IRunner() = default;
+}
+// end catch_interfaces_runner.cpp
+// start catch_interfaces_testcase.cpp
+
+namespace Catch {
+ ITestInvoker::~ITestInvoker() = default;
+ ITestCaseRegistry::~ITestCaseRegistry() = default;
+}
+// end catch_interfaces_testcase.cpp
+// start catch_leak_detector.cpp
+
+#ifdef CATCH_CONFIG_WINDOWS_CRTDBG
+#include <crtdbg.h>
+
+namespace Catch {
+
+ LeakDetector::LeakDetector() {
+ int flag = _CrtSetDbgFlag(_CRTDBG_REPORT_FLAG);
+ flag |= _CRTDBG_LEAK_CHECK_DF;
+ flag |= _CRTDBG_ALLOC_MEM_DF;
+ _CrtSetDbgFlag(flag);
+ _CrtSetReportMode(_CRT_WARN, _CRTDBG_MODE_FILE | _CRTDBG_MODE_DEBUG);
+ _CrtSetReportFile(_CRT_WARN, _CRTDBG_FILE_STDERR);
+ // Change this to leaking allocation's number to break there
+ _CrtSetBreakAlloc(-1);
+ }
+}
+
+#else
+
+ Catch::LeakDetector::LeakDetector() {}
+
+#endif
+
+Catch::LeakDetector::~LeakDetector() {
+ Catch::cleanUp();
+}
+// end catch_leak_detector.cpp
+// start catch_list.cpp
+
+// start catch_list.h
+
+#include <set>
+
+namespace Catch {
+
+ std::size_t listTests( Config const& config );
+
+ std::size_t listTestsNamesOnly( Config const& config );
+
+ struct TagInfo {
+ void add( std::string const& spelling );
+ std::string all() const;
+
+ std::set<std::string> spellings;
+ std::size_t count = 0;
+ };
+
+ std::size_t listTags( Config const& config );
+
+ std::size_t listReporters();
+
+ Option<std::size_t> list( std::shared_ptr<Config> const& config );
+
+} // end namespace Catch
+
+// end catch_list.h
+// start catch_text.h
+
+namespace Catch {
+ using namespace clara::TextFlow;
+}
+
+// end catch_text.h
+#include <limits>
+#include <algorithm>
+#include <iomanip>
+
+namespace Catch {
+
+ std::size_t listTests( Config const& config ) {
+ TestSpec testSpec = config.testSpec();
+ if( config.hasTestFilters() )
+ Catch::cout() << "Matching test cases:\n";
+ else {
+ Catch::cout() << "All available test cases:\n";
+ }
+
+ auto matchedTestCases = filterTests( getAllTestCasesSorted( config ), testSpec, config );
+ for( auto const& testCaseInfo : matchedTestCases ) {
+ Colour::Code colour = testCaseInfo.isHidden()
+ ? Colour::SecondaryText
+ : Colour::None;
+ Colour colourGuard( colour );
+
+ Catch::cout() << Column( testCaseInfo.name ).initialIndent( 2 ).indent( 4 ) << "\n";
+ if( config.verbosity() >= Verbosity::High ) {
+ Catch::cout() << Column( Catch::Detail::stringify( testCaseInfo.lineInfo ) ).indent(4) << std::endl;
+ std::string description = testCaseInfo.description;
+ if( description.empty() )
+ description = "(NO DESCRIPTION)";
+ Catch::cout() << Column( description ).indent(4) << std::endl;
+ }
+ if( !testCaseInfo.tags.empty() )
+ Catch::cout() << Column( testCaseInfo.tagsAsString() ).indent( 6 ) << "\n";
+ }
+
+ if( !config.hasTestFilters() )
+ Catch::cout() << pluralise( matchedTestCases.size(), "test case" ) << '\n' << std::endl;
+ else
+ Catch::cout() << pluralise( matchedTestCases.size(), "matching test case" ) << '\n' << std::endl;
+ return matchedTestCases.size();
+ }
+
+ std::size_t listTestsNamesOnly( Config const& config ) {
+ TestSpec testSpec = config.testSpec();
+ std::size_t matchedTests = 0;
+ std::vector<TestCase> matchedTestCases = filterTests( getAllTestCasesSorted( config ), testSpec, config );
+ for( auto const& testCaseInfo : matchedTestCases ) {
+ matchedTests++;
+ if( startsWith( testCaseInfo.name, '#' ) )
+ Catch::cout() << '"' << testCaseInfo.name << '"';
+ else
+ Catch::cout() << testCaseInfo.name;
+ if ( config.verbosity() >= Verbosity::High )
+ Catch::cout() << "\t@" << testCaseInfo.lineInfo;
+ Catch::cout() << std::endl;
+ }
+ return matchedTests;
+ }
+
+ void TagInfo::add( std::string const& spelling ) {
+ ++count;
+ spellings.insert( spelling );
+ }
+
+ std::string TagInfo::all() const {
+ std::string out;
+ for( auto const& spelling : spellings )
+ out += "[" + spelling + "]";
+ return out;
+ }
+
+ std::size_t listTags( Config const& config ) {
+ TestSpec testSpec = config.testSpec();
+ if( config.hasTestFilters() )
+ Catch::cout() << "Tags for matching test cases:\n";
+ else {
+ Catch::cout() << "All available tags:\n";
+ }
+
+ std::map<std::string, TagInfo> tagCounts;
+
+ std::vector<TestCase> matchedTestCases = filterTests( getAllTestCasesSorted( config ), testSpec, config );
+ for( auto const& testCase : matchedTestCases ) {
+ for( auto const& tagName : testCase.getTestCaseInfo().tags ) {
+ std::string lcaseTagName = toLower( tagName );
+ auto countIt = tagCounts.find( lcaseTagName );
+ if( countIt == tagCounts.end() )
+ countIt = tagCounts.insert( std::make_pair( lcaseTagName, TagInfo() ) ).first;
+ countIt->second.add( tagName );
+ }
+ }
+
+ for( auto const& tagCount : tagCounts ) {
+ ReusableStringStream rss;
+ rss << " " << std::setw(2) << tagCount.second.count << " ";
+ auto str = rss.str();
+ auto wrapper = Column( tagCount.second.all() )
+ .initialIndent( 0 )
+ .indent( str.size() )
+ .width( CATCH_CONFIG_CONSOLE_WIDTH-10 );
+ Catch::cout() << str << wrapper << '\n';
+ }
+ Catch::cout() << pluralise( tagCounts.size(), "tag" ) << '\n' << std::endl;
+ return tagCounts.size();
+ }
+
+ std::size_t listReporters() {
+ Catch::cout() << "Available reporters:\n";
+ IReporterRegistry::FactoryMap const& factories = getRegistryHub().getReporterRegistry().getFactories();
+ std::size_t maxNameLen = 0;
+ for( auto const& factoryKvp : factories )
+ maxNameLen = (std::max)( maxNameLen, factoryKvp.first.size() );
+
+ for( auto const& factoryKvp : factories ) {
+ Catch::cout()
+ << Column( factoryKvp.first + ":" )
+ .indent(2)
+ .width( 5+maxNameLen )
+ + Column( factoryKvp.second->getDescription() )
+ .initialIndent(0)
+ .indent(2)
+ .width( CATCH_CONFIG_CONSOLE_WIDTH - maxNameLen-8 )
+ << "\n";
+ }
+ Catch::cout() << std::endl;
+ return factories.size();
+ }
+
+ Option<std::size_t> list( std::shared_ptr<Config> const& config ) {
+ Option<std::size_t> listedCount;
+ getCurrentMutableContext().setConfig( config );
+ if( config->listTests() )
+ listedCount = listedCount.valueOr(0) + listTests( *config );
+ if( config->listTestNamesOnly() )
+ listedCount = listedCount.valueOr(0) + listTestsNamesOnly( *config );
+ if( config->listTags() )
+ listedCount = listedCount.valueOr(0) + listTags( *config );
+ if( config->listReporters() )
+ listedCount = listedCount.valueOr(0) + listReporters();
+ return listedCount;
+ }
+
+} // end namespace Catch
+// end catch_list.cpp
+// start catch_matchers.cpp
+
+namespace Catch {
+namespace Matchers {
+ namespace Impl {
+
+ std::string MatcherUntypedBase::toString() const {
+ if( m_cachedToString.empty() )
+ m_cachedToString = describe();
+ return m_cachedToString;
+ }
+
+ MatcherUntypedBase::~MatcherUntypedBase() = default;
+
+ } // namespace Impl
+} // namespace Matchers
+
+using namespace Matchers;
+using Matchers::Impl::MatcherBase;
+
+} // namespace Catch
+// end catch_matchers.cpp
+// start catch_matchers_floating.cpp
+
+// start catch_polyfills.hpp
+
+namespace Catch {
+ bool isnan(float f);
+ bool isnan(double d);
+}
+
+// end catch_polyfills.hpp
+// start catch_to_string.hpp
+
+#include <string>
+
+namespace Catch {
+ template <typename T>
+ std::string to_string(T const& t) {
+#if defined(CATCH_CONFIG_CPP11_TO_STRING)
+ return std::to_string(t);
+#else
+ ReusableStringStream rss;
+ rss << t;
+ return rss.str();
+#endif
+ }
+} // end namespace Catch
+
+// end catch_to_string.hpp
+#include <cstdlib>
+#include <cstdint>
+#include <cstring>
+
+namespace Catch {
+namespace Matchers {
+namespace Floating {
+enum class FloatingPointKind : uint8_t {
+ Float,
+ Double
+};
+}
+}
+}
+
+namespace {
+
+template <typename T>
+struct Converter;
+
+template <>
+struct Converter<float> {
+ static_assert(sizeof(float) == sizeof(int32_t), "Important ULP matcher assumption violated");
+ Converter(float f) {
+ std::memcpy(&i, &f, sizeof(f));
+ }
+ int32_t i;
+};
+
+template <>
+struct Converter<double> {
+ static_assert(sizeof(double) == sizeof(int64_t), "Important ULP matcher assumption violated");
+ Converter(double d) {
+ std::memcpy(&i, &d, sizeof(d));
+ }
+ int64_t i;
+};
+
+template <typename T>
+auto convert(T t) -> Converter<T> {
+ return Converter<T>(t);
+}
+
+template <typename FP>
+bool almostEqualUlps(FP lhs, FP rhs, int maxUlpDiff) {
+ // Comparison with NaN should always be false.
+ // This way we can rule it out before getting into the ugly details
+ if (Catch::isnan(lhs) || Catch::isnan(rhs)) {
+ return false;
+ }
+
+ auto lc = convert(lhs);
+ auto rc = convert(rhs);
+
+ if ((lc.i < 0) != (rc.i < 0)) {
+ // Potentially we can have +0 and -0
+ return lhs == rhs;
+ }
+
+ auto ulpDiff = std::abs(lc.i - rc.i);
+ return ulpDiff <= maxUlpDiff;
+}
+
+}
+
+namespace Catch {
+namespace Matchers {
+namespace Floating {
+ WithinAbsMatcher::WithinAbsMatcher(double target, double margin)
+ :m_target{ target }, m_margin{ margin } {
+ CATCH_ENFORCE(margin >= 0, "Invalid margin: " << margin << '.'
+ << " Margin has to be non-negative.");
+ }
+
+ // Performs equivalent check of std::fabs(lhs - rhs) <= margin
+ // But without the subtraction to allow for INFINITY in comparison
+ bool WithinAbsMatcher::match(double const& matchee) const {
+ return (matchee + m_margin >= m_target) && (m_target + m_margin >= matchee);
+ }
+
+ std::string WithinAbsMatcher::describe() const {
+ return "is within " + ::Catch::Detail::stringify(m_margin) + " of " + ::Catch::Detail::stringify(m_target);
+ }
+
+ WithinUlpsMatcher::WithinUlpsMatcher(double target, int ulps, FloatingPointKind baseType)
+ :m_target{ target }, m_ulps{ ulps }, m_type{ baseType } {
+ CATCH_ENFORCE(ulps >= 0, "Invalid ULP setting: " << ulps << '.'
+ << " ULPs have to be non-negative.");
+ }
+
+#if defined(__clang__)
+#pragma clang diagnostic push
+// Clang <3.5 reports on the default branch in the switch below
+#pragma clang diagnostic ignored "-Wunreachable-code"
+#endif
+
+ bool WithinUlpsMatcher::match(double const& matchee) const {
+ switch (m_type) {
+ case FloatingPointKind::Float:
+ return almostEqualUlps<float>(static_cast<float>(matchee), static_cast<float>(m_target), m_ulps);
+ case FloatingPointKind::Double:
+ return almostEqualUlps<double>(matchee, m_target, m_ulps);
+ default:
+ CATCH_INTERNAL_ERROR( "Unknown FloatingPointKind value" );
+ }
+ }
+
+#if defined(__clang__)
+#pragma clang diagnostic pop
+#endif
+
+ std::string WithinUlpsMatcher::describe() const {
+ return "is within " + Catch::to_string(m_ulps) + " ULPs of " + ::Catch::Detail::stringify(m_target) + ((m_type == FloatingPointKind::Float)? "f" : "");
+ }
+
+}// namespace Floating
+
+Floating::WithinUlpsMatcher WithinULP(double target, int maxUlpDiff) {
+ return Floating::WithinUlpsMatcher(target, maxUlpDiff, Floating::FloatingPointKind::Double);
+}
+
+Floating::WithinUlpsMatcher WithinULP(float target, int maxUlpDiff) {
+ return Floating::WithinUlpsMatcher(target, maxUlpDiff, Floating::FloatingPointKind::Float);
+}
+
+Floating::WithinAbsMatcher WithinAbs(double target, double margin) {
+ return Floating::WithinAbsMatcher(target, margin);
+}
+
+} // namespace Matchers
+} // namespace Catch
+
+// end catch_matchers_floating.cpp
+// start catch_matchers_generic.cpp
+
+std::string Catch::Matchers::Generic::Detail::finalizeDescription(const std::string& desc) {
+ if (desc.empty()) {
+ return "matches undescribed predicate";
+ } else {
+ return "matches predicate: \"" + desc + '"';
+ }
+}
+// end catch_matchers_generic.cpp
+// start catch_matchers_string.cpp
+
+#include <regex>
+
+namespace Catch {
+namespace Matchers {
+
+ namespace StdString {
+
+ CasedString::CasedString( std::string const& str, CaseSensitive::Choice caseSensitivity )
+ : m_caseSensitivity( caseSensitivity ),
+ m_str( adjustString( str ) )
+ {}
+ std::string CasedString::adjustString( std::string const& str ) const {
+ return m_caseSensitivity == CaseSensitive::No
+ ? toLower( str )
+ : str;
+ }
+ std::string CasedString::caseSensitivitySuffix() const {
+ return m_caseSensitivity == CaseSensitive::No
+ ? " (case insensitive)"
+ : std::string();
+ }
+
+ StringMatcherBase::StringMatcherBase( std::string const& operation, CasedString const& comparator )
+ : m_comparator( comparator ),
+ m_operation( operation ) {
+ }
+
+ std::string StringMatcherBase::describe() const {
+ std::string description;
+ description.reserve(5 + m_operation.size() + m_comparator.m_str.size() +
+ m_comparator.caseSensitivitySuffix().size());
+ description += m_operation;
+ description += ": \"";
+ description += m_comparator.m_str;
+ description += "\"";
+ description += m_comparator.caseSensitivitySuffix();
+ return description;
+ }
+
+ EqualsMatcher::EqualsMatcher( CasedString const& comparator ) : StringMatcherBase( "equals", comparator ) {}
+
+ bool EqualsMatcher::match( std::string const& source ) const {
+ return m_comparator.adjustString( source ) == m_comparator.m_str;
+ }
+
+ ContainsMatcher::ContainsMatcher( CasedString const& comparator ) : StringMatcherBase( "contains", comparator ) {}
+
+ bool ContainsMatcher::match( std::string const& source ) const {
+ return contains( m_comparator.adjustString( source ), m_comparator.m_str );
+ }
+
+ StartsWithMatcher::StartsWithMatcher( CasedString const& comparator ) : StringMatcherBase( "starts with", comparator ) {}
+
+ bool StartsWithMatcher::match( std::string const& source ) const {
+ return startsWith( m_comparator.adjustString( source ), m_comparator.m_str );
+ }
+
+ EndsWithMatcher::EndsWithMatcher( CasedString const& comparator ) : StringMatcherBase( "ends with", comparator ) {}
+
+ bool EndsWithMatcher::match( std::string const& source ) const {
+ return endsWith( m_comparator.adjustString( source ), m_comparator.m_str );
+ }
+
+ RegexMatcher::RegexMatcher(std::string regex, CaseSensitive::Choice caseSensitivity): m_regex(std::move(regex)), m_caseSensitivity(caseSensitivity) {}
+
+ bool RegexMatcher::match(std::string const& matchee) const {
+ auto flags = std::regex::ECMAScript; // ECMAScript is the default syntax option anyway
+ if (m_caseSensitivity == CaseSensitive::Choice::No) {
+ flags |= std::regex::icase;
+ }
+ auto reg = std::regex(m_regex, flags);
+ return std::regex_match(matchee, reg);
+ }
+
+ std::string RegexMatcher::describe() const {
+ return "matches " + ::Catch::Detail::stringify(m_regex) + ((m_caseSensitivity == CaseSensitive::Choice::Yes)? " case sensitively" : " case insensitively");
+ }
+
+ } // namespace StdString
+
+ StdString::EqualsMatcher Equals( std::string const& str, CaseSensitive::Choice caseSensitivity ) {
+ return StdString::EqualsMatcher( StdString::CasedString( str, caseSensitivity) );
+ }
+ StdString::ContainsMatcher Contains( std::string const& str, CaseSensitive::Choice caseSensitivity ) {
+ return StdString::ContainsMatcher( StdString::CasedString( str, caseSensitivity) );
+ }
+ StdString::EndsWithMatcher EndsWith( std::string const& str, CaseSensitive::Choice caseSensitivity ) {
+ return StdString::EndsWithMatcher( StdString::CasedString( str, caseSensitivity) );
+ }
+ StdString::StartsWithMatcher StartsWith( std::string const& str, CaseSensitive::Choice caseSensitivity ) {
+ return StdString::StartsWithMatcher( StdString::CasedString( str, caseSensitivity) );
+ }
+
+ StdString::RegexMatcher Matches(std::string const& regex, CaseSensitive::Choice caseSensitivity) {
+ return StdString::RegexMatcher(regex, caseSensitivity);
+ }
+
+} // namespace Matchers
+} // namespace Catch
+// end catch_matchers_string.cpp
+// start catch_message.cpp
+
+// start catch_uncaught_exceptions.h
+
+namespace Catch {
+ bool uncaught_exceptions();
+} // end namespace Catch
+
+// end catch_uncaught_exceptions.h
+#include <cassert>
+#include <stack>
+
+namespace Catch {
+
+ MessageInfo::MessageInfo( StringRef const& _macroName,
+ SourceLineInfo const& _lineInfo,
+ ResultWas::OfType _type )
+ : macroName( _macroName ),
+ lineInfo( _lineInfo ),
+ type( _type ),
+ sequence( ++globalCount )
+ {}
+
+ bool MessageInfo::operator==( MessageInfo const& other ) const {
+ return sequence == other.sequence;
+ }
+
+ bool MessageInfo::operator<( MessageInfo const& other ) const {
+ return sequence < other.sequence;
+ }
+
+ // This may need protecting if threading support is added
+ unsigned int MessageInfo::globalCount = 0;
+
+ ////////////////////////////////////////////////////////////////////////////
+
+ Catch::MessageBuilder::MessageBuilder( StringRef const& macroName,
+ SourceLineInfo const& lineInfo,
+ ResultWas::OfType type )
+ :m_info(macroName, lineInfo, type) {}
+
+ ////////////////////////////////////////////////////////////////////////////
+
+ ScopedMessage::ScopedMessage( MessageBuilder const& builder )
+ : m_info( builder.m_info ), m_moved()
+ {
+ m_info.message = builder.m_stream.str();
+ getResultCapture().pushScopedMessage( m_info );
+ }
+
+ ScopedMessage::ScopedMessage( ScopedMessage&& old )
+ : m_info( old.m_info ), m_moved()
+ {
+ old.m_moved = true;
+ }
+
+ ScopedMessage::~ScopedMessage() {
+ if ( !uncaught_exceptions() && !m_moved ){
+ getResultCapture().popScopedMessage(m_info);
+ }
+ }
+
+ Capturer::Capturer( StringRef macroName, SourceLineInfo const& lineInfo, ResultWas::OfType resultType, StringRef names ) {
+ auto trimmed = [&] (size_t start, size_t end) {
+ while (names[start] == ',' || isspace(names[start])) {
+ ++start;
+ }
+ while (names[end] == ',' || isspace(names[end])) {
+ --end;
+ }
+ return names.substr(start, end - start + 1);
+ };
+ auto skipq = [&] (size_t start, char quote) {
+ for (auto i = start + 1; i < names.size() ; ++i) {
+ if (names[i] == quote)
+ return i;
+ if (names[i] == '\\')
+ ++i;
+ }
+ CATCH_INTERNAL_ERROR("CAPTURE parsing encountered unmatched quote");
+ };
+
+ size_t start = 0;
+ std::stack<char> openings;
+ for (size_t pos = 0; pos < names.size(); ++pos) {
+ char c = names[pos];
+ switch (c) {
+ case '[':
+ case '{':
+ case '(':
+ // It is basically impossible to disambiguate between
+ // comparison and start of template args in this context
+// case '<':
+ openings.push(c);
+ break;
+ case ']':
+ case '}':
+ case ')':
+// case '>':
+ openings.pop();
+ break;
+ case '"':
+ case '\'':
+ pos = skipq(pos, c);
+ break;
+ case ',':
+ if (start != pos && openings.size() == 0) {
+ m_messages.emplace_back(macroName, lineInfo, resultType);
+ m_messages.back().message = trimmed(start, pos);
+ m_messages.back().message += " := ";
+ start = pos;
+ }
+ }
+ }
+ assert(openings.size() == 0 && "Mismatched openings");
+ m_messages.emplace_back(macroName, lineInfo, resultType);
+ m_messages.back().message = trimmed(start, names.size() - 1);
+ m_messages.back().message += " := ";
+ }
+ Capturer::~Capturer() {
+ if ( !uncaught_exceptions() ){
+ assert( m_captured == m_messages.size() );
+ for( size_t i = 0; i < m_captured; ++i )
+ m_resultCapture.popScopedMessage( m_messages[i] );
+ }
+ }
+
+ void Capturer::captureValue( size_t index, std::string const& value ) {
+ assert( index < m_messages.size() );
+ m_messages[index].message += value;
+ m_resultCapture.pushScopedMessage( m_messages[index] );
+ m_captured++;
+ }
+
+} // end namespace Catch
+// end catch_message.cpp
+// start catch_output_redirect.cpp
+
+// start catch_output_redirect.h
+#ifndef TWOBLUECUBES_CATCH_OUTPUT_REDIRECT_H
+#define TWOBLUECUBES_CATCH_OUTPUT_REDIRECT_H
+
+#include <cstdio>
+#include <iosfwd>
+#include <string>
+
+namespace Catch {
+
+ class RedirectedStream {
+ std::ostream& m_originalStream;
+ std::ostream& m_redirectionStream;
+ std::streambuf* m_prevBuf;
+
+ public:
+ RedirectedStream( std::ostream& originalStream, std::ostream& redirectionStream );
+ ~RedirectedStream();
+ };
+
+ class RedirectedStdOut {
+ ReusableStringStream m_rss;
+ RedirectedStream m_cout;
+ public:
+ RedirectedStdOut();
+ auto str() const -> std::string;
+ };
+
+ // StdErr has two constituent streams in C++, std::cerr and std::clog
+ // This means that we need to redirect 2 streams into 1 to keep proper
+ // order of writes
+ class RedirectedStdErr {
+ ReusableStringStream m_rss;
+ RedirectedStream m_cerr;
+ RedirectedStream m_clog;
+ public:
+ RedirectedStdErr();
+ auto str() const -> std::string;
+ };
+
+ class RedirectedStreams {
+ public:
+ RedirectedStreams(RedirectedStreams const&) = delete;
+ RedirectedStreams& operator=(RedirectedStreams const&) = delete;
+ RedirectedStreams(RedirectedStreams&&) = delete;
+ RedirectedStreams& operator=(RedirectedStreams&&) = delete;
+
+ RedirectedStreams(std::string& redirectedCout, std::string& redirectedCerr);
+ ~RedirectedStreams();
+ private:
+ std::string& m_redirectedCout;
+ std::string& m_redirectedCerr;
+ RedirectedStdOut m_redirectedStdOut;
+ RedirectedStdErr m_redirectedStdErr;
+ };
+
+#if defined(CATCH_CONFIG_NEW_CAPTURE)
+
+ // Windows's implementation of std::tmpfile is terrible (it tries
+ // to create a file inside system folder, thus requiring elevated
+ // privileges for the binary), so we have to use tmpnam(_s) and
+ // create the file ourselves there.
+ class TempFile {
+ public:
+ TempFile(TempFile const&) = delete;
+ TempFile& operator=(TempFile const&) = delete;
+ TempFile(TempFile&&) = delete;
+ TempFile& operator=(TempFile&&) = delete;
+
+ TempFile();
+ ~TempFile();
+
+ std::FILE* getFile();
+ std::string getContents();
+
+ private:
+ std::FILE* m_file = nullptr;
+ #if defined(_MSC_VER)
+ char m_buffer[L_tmpnam] = { 0 };
+ #endif
+ };
+
+ class OutputRedirect {
+ public:
+ OutputRedirect(OutputRedirect const&) = delete;
+ OutputRedirect& operator=(OutputRedirect const&) = delete;
+ OutputRedirect(OutputRedirect&&) = delete;
+ OutputRedirect& operator=(OutputRedirect&&) = delete;
+
+ OutputRedirect(std::string& stdout_dest, std::string& stderr_dest);
+ ~OutputRedirect();
+
+ private:
+ int m_originalStdout = -1;
+ int m_originalStderr = -1;
+ TempFile m_stdoutFile;
+ TempFile m_stderrFile;
+ std::string& m_stdoutDest;
+ std::string& m_stderrDest;
+ };
+
+#endif
+
+} // end namespace Catch
+
+#endif // TWOBLUECUBES_CATCH_OUTPUT_REDIRECT_H
+// end catch_output_redirect.h
+#include <cstdio>
+#include <cstring>
+#include <fstream>
+#include <sstream>
+#include <stdexcept>
+
+#if defined(CATCH_CONFIG_NEW_CAPTURE)
+ #if defined(_MSC_VER)
+ #include <io.h> //_dup and _dup2
+ #define dup _dup
+ #define dup2 _dup2
+ #define fileno _fileno
+ #else
+ #include <unistd.h> // dup and dup2
+ #endif
+#endif
+
+namespace Catch {
+
+ RedirectedStream::RedirectedStream( std::ostream& originalStream, std::ostream& redirectionStream )
+ : m_originalStream( originalStream ),
+ m_redirectionStream( redirectionStream ),
+ m_prevBuf( m_originalStream.rdbuf() )
+ {
+ m_originalStream.rdbuf( m_redirectionStream.rdbuf() );
+ }
+
+ RedirectedStream::~RedirectedStream() {
+ m_originalStream.rdbuf( m_prevBuf );
+ }
+
+ RedirectedStdOut::RedirectedStdOut() : m_cout( Catch::cout(), m_rss.get() ) {}
+ auto RedirectedStdOut::str() const -> std::string { return m_rss.str(); }
+
+ RedirectedStdErr::RedirectedStdErr()
+ : m_cerr( Catch::cerr(), m_rss.get() ),
+ m_clog( Catch::clog(), m_rss.get() )
+ {}
+ auto RedirectedStdErr::str() const -> std::string { return m_rss.str(); }
+
+ RedirectedStreams::RedirectedStreams(std::string& redirectedCout, std::string& redirectedCerr)
+ : m_redirectedCout(redirectedCout),
+ m_redirectedCerr(redirectedCerr)
+ {}
+
+ RedirectedStreams::~RedirectedStreams() {
+ m_redirectedCout += m_redirectedStdOut.str();
+ m_redirectedCerr += m_redirectedStdErr.str();
+ }
+
+#if defined(CATCH_CONFIG_NEW_CAPTURE)
+
+#if defined(_MSC_VER)
+ TempFile::TempFile() {
+ if (tmpnam_s(m_buffer)) {
+ CATCH_RUNTIME_ERROR("Could not get a temp filename");
+ }
+ if (fopen_s(&m_file, m_buffer, "w")) {
+ char buffer[100];
+ if (strerror_s(buffer, errno)) {
+ CATCH_RUNTIME_ERROR("Could not translate errno to a string");
+ }
+ CATCH_RUNTIME_ERROR("Could not open the temp file: '" << m_buffer << "' because: " << buffer);
+ }
+ }
+#else
+ TempFile::TempFile() {
+ m_file = std::tmpfile();
+ if (!m_file) {
+ CATCH_RUNTIME_ERROR("Could not create a temp file.");
+ }
+ }
+
+#endif
+
+ TempFile::~TempFile() {
+ // TBD: What to do about errors here?
+ std::fclose(m_file);
+ // We manually create the file on Windows only, on Linux
+ // it will be autodeleted
+#if defined(_MSC_VER)
+ std::remove(m_buffer);
+#endif
+ }
+
+ FILE* TempFile::getFile() {
+ return m_file;
+ }
+
+ std::string TempFile::getContents() {
+ std::stringstream sstr;
+ char buffer[100] = {};
+ std::rewind(m_file);
+ while (std::fgets(buffer, sizeof(buffer), m_file)) {
+ sstr << buffer;
+ }
+ return sstr.str();
+ }
+
+ OutputRedirect::OutputRedirect(std::string& stdout_dest, std::string& stderr_dest) :
+ m_originalStdout(dup(1)),
+ m_originalStderr(dup(2)),
+ m_stdoutDest(stdout_dest),
+ m_stderrDest(stderr_dest) {
+ dup2(fileno(m_stdoutFile.getFile()), 1);
+ dup2(fileno(m_stderrFile.getFile()), 2);
+ }
+
+ OutputRedirect::~OutputRedirect() {
+ Catch::cout() << std::flush;
+ fflush(stdout);
+ // Since we support overriding these streams, we flush cerr
+ // even though std::cerr is unbuffered
+ Catch::cerr() << std::flush;
+ Catch::clog() << std::flush;
+ fflush(stderr);
+
+ dup2(m_originalStdout, 1);
+ dup2(m_originalStderr, 2);
+
+ m_stdoutDest += m_stdoutFile.getContents();
+ m_stderrDest += m_stderrFile.getContents();
+ }
+
+#endif // CATCH_CONFIG_NEW_CAPTURE
+
+} // namespace Catch
+
+#if defined(CATCH_CONFIG_NEW_CAPTURE)
+ #if defined(_MSC_VER)
+ #undef dup
+ #undef dup2
+ #undef fileno
+ #endif
+#endif
+// end catch_output_redirect.cpp
+// start catch_polyfills.cpp
+
+#include <cmath>
+
+namespace Catch {
+
+#if !defined(CATCH_CONFIG_POLYFILL_ISNAN)
+ bool isnan(float f) {
+ return std::isnan(f);
+ }
+ bool isnan(double d) {
+ return std::isnan(d);
+ }
+#else
+ // For now we only use this for embarcadero
+ bool isnan(float f) {
+ return std::_isnan(f);
+ }
+ bool isnan(double d) {
+ return std::_isnan(d);
+ }
+#endif
+
+} // end namespace Catch
+// end catch_polyfills.cpp
+// start catch_random_number_generator.cpp
+
+namespace Catch {
+
+ std::mt19937& rng() {
+ static std::mt19937 s_rng;
+ return s_rng;
+ }
+
+ void seedRng( IConfig const& config ) {
+ if( config.rngSeed() != 0 ) {
+ std::srand( config.rngSeed() );
+ rng().seed( config.rngSeed() );
+ }
+ }
+
+ unsigned int rngSeed() {
+ return getCurrentContext().getConfig()->rngSeed();
+ }
+}
+// end catch_random_number_generator.cpp
+// start catch_registry_hub.cpp
+
+// start catch_test_case_registry_impl.h
+
+#include <vector>
+#include <set>
+#include <algorithm>
+#include <ios>
+
+namespace Catch {
+
+ class TestCase;
+ struct IConfig;
+
+ std::vector<TestCase> sortTests( IConfig const& config, std::vector<TestCase> const& unsortedTestCases );
+ bool matchTest( TestCase const& testCase, TestSpec const& testSpec, IConfig const& config );
+
+ void enforceNoDuplicateTestCases( std::vector<TestCase> const& functions );
+
+ std::vector<TestCase> filterTests( std::vector<TestCase> const& testCases, TestSpec const& testSpec, IConfig const& config );
+ std::vector<TestCase> const& getAllTestCasesSorted( IConfig const& config );
+
+ class TestRegistry : public ITestCaseRegistry {
+ public:
+ virtual ~TestRegistry() = default;
+
+ virtual void registerTest( TestCase const& testCase );
+
+ std::vector<TestCase> const& getAllTests() const override;
+ std::vector<TestCase> const& getAllTestsSorted( IConfig const& config ) const override;
+
+ private:
+ std::vector<TestCase> m_functions;
+ mutable RunTests::InWhatOrder m_currentSortOrder = RunTests::InDeclarationOrder;
+ mutable std::vector<TestCase> m_sortedFunctions;
+ std::size_t m_unnamedCount = 0;
+ std::ios_base::Init m_ostreamInit; // Forces cout/ cerr to be initialised
+ };
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ class TestInvokerAsFunction : public ITestInvoker {
+ void(*m_testAsFunction)();
+ public:
+ TestInvokerAsFunction( void(*testAsFunction)() ) noexcept;
+
+ void invoke() const override;
+ };
+
+ std::string extractClassName( StringRef const& classOrQualifiedMethodName );
+
+ ///////////////////////////////////////////////////////////////////////////
+
+} // end namespace Catch
+
+// end catch_test_case_registry_impl.h
+// start catch_reporter_registry.h
+
+#include <map>
+
+namespace Catch {
+
+ class ReporterRegistry : public IReporterRegistry {
+
+ public:
+
+ ~ReporterRegistry() override;
+
+ IStreamingReporterPtr create( std::string const& name, IConfigPtr const& config ) const override;
+
+ void registerReporter( std::string const& name, IReporterFactoryPtr const& factory );
+ void registerListener( IReporterFactoryPtr const& factory );
+
+ FactoryMap const& getFactories() const override;
+ Listeners const& getListeners() const override;
+
+ private:
+ FactoryMap m_factories;
+ Listeners m_listeners;
+ };
+}
+
+// end catch_reporter_registry.h
+// start catch_tag_alias_registry.h
+
+// start catch_tag_alias.h
+
+#include <string>
+
+namespace Catch {
+
+ struct TagAlias {
+ TagAlias(std::string const& _tag, SourceLineInfo _lineInfo);
+
+ std::string tag;
+ SourceLineInfo lineInfo;
+ };
+
+} // end namespace Catch
+
+// end catch_tag_alias.h
+#include <map>
+
+namespace Catch {
+
+ class TagAliasRegistry : public ITagAliasRegistry {
+ public:
+ ~TagAliasRegistry() override;
+ TagAlias const* find( std::string const& alias ) const override;
+ std::string expandAliases( std::string const& unexpandedTestSpec ) const override;
+ void add( std::string const& alias, std::string const& tag, SourceLineInfo const& lineInfo );
+
+ private:
+ std::map<std::string, TagAlias> m_registry;
+ };
+
+} // end namespace Catch
+
+// end catch_tag_alias_registry.h
+// start catch_startup_exception_registry.h
+
+#include <vector>
+#include <exception>
+
+namespace Catch {
+
+ class StartupExceptionRegistry {
+ public:
+ void add(std::exception_ptr const& exception) noexcept;
+ std::vector<std::exception_ptr> const& getExceptions() const noexcept;
+ private:
+ std::vector<std::exception_ptr> m_exceptions;
+ };
+
+} // end namespace Catch
+
+// end catch_startup_exception_registry.h
+// start catch_singletons.hpp
+
+namespace Catch {
+
+ struct ISingleton {
+ virtual ~ISingleton();
+ };
+
+ void addSingleton( ISingleton* singleton );
+ void cleanupSingletons();
+
+ template<typename SingletonImplT, typename InterfaceT = SingletonImplT, typename MutableInterfaceT = InterfaceT>
+ class Singleton : SingletonImplT, public ISingleton {
+
+ static auto getInternal() -> Singleton* {
+ static Singleton* s_instance = nullptr;
+ if( !s_instance ) {
+ s_instance = new Singleton;
+ addSingleton( s_instance );
+ }
+ return s_instance;
+ }
+
+ public:
+ static auto get() -> InterfaceT const& {
+ return *getInternal();
+ }
+ static auto getMutable() -> MutableInterfaceT& {
+ return *getInternal();
+ }
+ };
+
+} // namespace Catch
+
+// end catch_singletons.hpp
+namespace Catch {
+
+ namespace {
+
+ class RegistryHub : public IRegistryHub, public IMutableRegistryHub,
+ private NonCopyable {
+
+ public: // IRegistryHub
+ RegistryHub() = default;
+ IReporterRegistry const& getReporterRegistry() const override {
+ return m_reporterRegistry;
+ }
+ ITestCaseRegistry const& getTestCaseRegistry() const override {
+ return m_testCaseRegistry;
+ }
+ IExceptionTranslatorRegistry const& getExceptionTranslatorRegistry() const override {
+ return m_exceptionTranslatorRegistry;
+ }
+ ITagAliasRegistry const& getTagAliasRegistry() const override {
+ return m_tagAliasRegistry;
+ }
+ StartupExceptionRegistry const& getStartupExceptionRegistry() const override {
+ return m_exceptionRegistry;
+ }
+
+ public: // IMutableRegistryHub
+ void registerReporter( std::string const& name, IReporterFactoryPtr const& factory ) override {
+ m_reporterRegistry.registerReporter( name, factory );
+ }
+ void registerListener( IReporterFactoryPtr const& factory ) override {
+ m_reporterRegistry.registerListener( factory );
+ }
+ void registerTest( TestCase const& testInfo ) override {
+ m_testCaseRegistry.registerTest( testInfo );
+ }
+ void registerTranslator( const IExceptionTranslator* translator ) override {
+ m_exceptionTranslatorRegistry.registerTranslator( translator );
+ }
+ void registerTagAlias( std::string const& alias, std::string const& tag, SourceLineInfo const& lineInfo ) override {
+ m_tagAliasRegistry.add( alias, tag, lineInfo );
+ }
+ void registerStartupException() noexcept override {
+ m_exceptionRegistry.add(std::current_exception());
+ }
+ IMutableEnumValuesRegistry& getMutableEnumValuesRegistry() override {
+ return m_enumValuesRegistry;
+ }
+
+ private:
+ TestRegistry m_testCaseRegistry;
+ ReporterRegistry m_reporterRegistry;
+ ExceptionTranslatorRegistry m_exceptionTranslatorRegistry;
+ TagAliasRegistry m_tagAliasRegistry;
+ StartupExceptionRegistry m_exceptionRegistry;
+ Detail::EnumValuesRegistry m_enumValuesRegistry;
+ };
+ }
+
+ using RegistryHubSingleton = Singleton<RegistryHub, IRegistryHub, IMutableRegistryHub>;
+
+ IRegistryHub const& getRegistryHub() {
+ return RegistryHubSingleton::get();
+ }
+ IMutableRegistryHub& getMutableRegistryHub() {
+ return RegistryHubSingleton::getMutable();
+ }
+ void cleanUp() {
+ cleanupSingletons();
+ cleanUpContext();
+ }
+ std::string translateActiveException() {
+ return getRegistryHub().getExceptionTranslatorRegistry().translateActiveException();
+ }
+
+} // end namespace Catch
+// end catch_registry_hub.cpp
+// start catch_reporter_registry.cpp
+
+namespace Catch {
+
+ ReporterRegistry::~ReporterRegistry() = default;
+
+ IStreamingReporterPtr ReporterRegistry::create( std::string const& name, IConfigPtr const& config ) const {
+ auto it = m_factories.find( name );
+ if( it == m_factories.end() )
+ return nullptr;
+ return it->second->create( ReporterConfig( config ) );
+ }
+
+ void ReporterRegistry::registerReporter( std::string const& name, IReporterFactoryPtr const& factory ) {
+ m_factories.emplace(name, factory);
+ }
+ void ReporterRegistry::registerListener( IReporterFactoryPtr const& factory ) {
+ m_listeners.push_back( factory );
+ }
+
+ IReporterRegistry::FactoryMap const& ReporterRegistry::getFactories() const {
+ return m_factories;
+ }
+ IReporterRegistry::Listeners const& ReporterRegistry::getListeners() const {
+ return m_listeners;
+ }
+
+}
+// end catch_reporter_registry.cpp
+// start catch_result_type.cpp
+
+namespace Catch {
+
+ bool isOk( ResultWas::OfType resultType ) {
+ return ( resultType & ResultWas::FailureBit ) == 0;
+ }
+ bool isJustInfo( int flags ) {
+ return flags == ResultWas::Info;
+ }
+
+ ResultDisposition::Flags operator | ( ResultDisposition::Flags lhs, ResultDisposition::Flags rhs ) {
+ return static_cast<ResultDisposition::Flags>( static_cast<int>( lhs ) | static_cast<int>( rhs ) );
+ }
+
+ bool shouldContinueOnFailure( int flags ) { return ( flags & ResultDisposition::ContinueOnFailure ) != 0; }
+ bool shouldSuppressFailure( int flags ) { return ( flags & ResultDisposition::SuppressFail ) != 0; }
+
+} // end namespace Catch
+// end catch_result_type.cpp
+// start catch_run_context.cpp
+
+#include <cassert>
+#include <algorithm>
+#include <sstream>
+
+namespace Catch {
+
+ namespace Generators {
+ struct GeneratorTracker : TestCaseTracking::TrackerBase, IGeneratorTracker {
+ GeneratorBasePtr m_generator;
+
+ GeneratorTracker( TestCaseTracking::NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent )
+ : TrackerBase( nameAndLocation, ctx, parent )
+ {}
+ ~GeneratorTracker();
+
+ static GeneratorTracker& acquire( TrackerContext& ctx, TestCaseTracking::NameAndLocation const& nameAndLocation ) {
+ std::shared_ptr<GeneratorTracker> tracker;
+
+ ITracker& currentTracker = ctx.currentTracker();
+ if( TestCaseTracking::ITrackerPtr childTracker = currentTracker.findChild( nameAndLocation ) ) {
+ assert( childTracker );
+ assert( childTracker->isGeneratorTracker() );
+ tracker = std::static_pointer_cast<GeneratorTracker>( childTracker );
+ }
+ else {
+ tracker = std::make_shared<GeneratorTracker>( nameAndLocation, ctx, ¤tTracker );
+ currentTracker.addChild( tracker );
+ }
+
+ if( !ctx.completedCycle() && !tracker->isComplete() ) {
+ tracker->open();
+ }
+
+ return *tracker;
+ }
+
+ // TrackerBase interface
+ bool isGeneratorTracker() const override { return true; }
+ auto hasGenerator() const -> bool override {
+ return !!m_generator;
+ }
+ void close() override {
+ TrackerBase::close();
+ // Generator interface only finds out if it has another item on atual move
+ if (m_runState == CompletedSuccessfully && m_generator->next()) {
+ m_children.clear();
+ m_runState = Executing;
+ }
+ }
+
+ // IGeneratorTracker interface
+ auto getGenerator() const -> GeneratorBasePtr const& override {
+ return m_generator;
+ }
+ void setGenerator( GeneratorBasePtr&& generator ) override {
+ m_generator = std::move( generator );
+ }
+ };
+ GeneratorTracker::~GeneratorTracker() {}
+ }
+
+ RunContext::RunContext(IConfigPtr const& _config, IStreamingReporterPtr&& reporter)
+ : m_runInfo(_config->name()),
+ m_context(getCurrentMutableContext()),
+ m_config(_config),
+ m_reporter(std::move(reporter)),
+ m_lastAssertionInfo{ StringRef(), SourceLineInfo("",0), StringRef(), ResultDisposition::Normal },
+ m_includeSuccessfulResults( m_config->includeSuccessfulResults() || m_reporter->getPreferences().shouldReportAllAssertions )
+ {
+ m_context.setRunner(this);
+ m_context.setConfig(m_config);
+ m_context.setResultCapture(this);
+ m_reporter->testRunStarting(m_runInfo);
+ }
+
+ RunContext::~RunContext() {
+ m_reporter->testRunEnded(TestRunStats(m_runInfo, m_totals, aborting()));
+ }
+
+ void RunContext::testGroupStarting(std::string const& testSpec, std::size_t groupIndex, std::size_t groupsCount) {
+ m_reporter->testGroupStarting(GroupInfo(testSpec, groupIndex, groupsCount));
+ }
+
+ void RunContext::testGroupEnded(std::string const& testSpec, Totals const& totals, std::size_t groupIndex, std::size_t groupsCount) {
+ m_reporter->testGroupEnded(TestGroupStats(GroupInfo(testSpec, groupIndex, groupsCount), totals, aborting()));
+ }
+
+ Totals RunContext::runTest(TestCase const& testCase) {
+ Totals prevTotals = m_totals;
+
+ std::string redirectedCout;
+ std::string redirectedCerr;
+
+ auto const& testInfo = testCase.getTestCaseInfo();
+
+ m_reporter->testCaseStarting(testInfo);
+
+ m_activeTestCase = &testCase;
+
+ ITracker& rootTracker = m_trackerContext.startRun();
+ assert(rootTracker.isSectionTracker());
+ static_cast<SectionTracker&>(rootTracker).addInitialFilters(m_config->getSectionsToRun());
+ do {
+ m_trackerContext.startCycle();
+ m_testCaseTracker = &SectionTracker::acquire(m_trackerContext, TestCaseTracking::NameAndLocation(testInfo.name, testInfo.lineInfo));
+ runCurrentTest(redirectedCout, redirectedCerr);
+ } while (!m_testCaseTracker->isSuccessfullyCompleted() && !aborting());
+
+ Totals deltaTotals = m_totals.delta(prevTotals);
+ if (testInfo.expectedToFail() && deltaTotals.testCases.passed > 0) {
+ deltaTotals.assertions.failed++;
+ deltaTotals.testCases.passed--;
+ deltaTotals.testCases.failed++;
+ }
+ m_totals.testCases += deltaTotals.testCases;
+ m_reporter->testCaseEnded(TestCaseStats(testInfo,
+ deltaTotals,
+ redirectedCout,
+ redirectedCerr,
+ aborting()));
+
+ m_activeTestCase = nullptr;
+ m_testCaseTracker = nullptr;
+
+ return deltaTotals;
+ }
+
+ IConfigPtr RunContext::config() const {
+ return m_config;
+ }
+
+ IStreamingReporter& RunContext::reporter() const {
+ return *m_reporter;
+ }
+
+ void RunContext::assertionEnded(AssertionResult const & result) {
+ if (result.getResultType() == ResultWas::Ok) {
+ m_totals.assertions.passed++;
+ m_lastAssertionPassed = true;
+ } else if (!result.isOk()) {
+ m_lastAssertionPassed = false;
+ if( m_activeTestCase->getTestCaseInfo().okToFail() )
+ m_totals.assertions.failedButOk++;
+ else
+ m_totals.assertions.failed++;
+ }
+ else {
+ m_lastAssertionPassed = true;
+ }
+
+ // We have no use for the return value (whether messages should be cleared), because messages were made scoped
+ // and should be let to clear themselves out.
+ static_cast<void>(m_reporter->assertionEnded(AssertionStats(result, m_messages, m_totals)));
+
+ if (result.getResultType() != ResultWas::Warning)
+ m_messageScopes.clear();
+
+ // Reset working state
+ resetAssertionInfo();
+ m_lastResult = result;
+ }
+ void RunContext::resetAssertionInfo() {
+ m_lastAssertionInfo.macroName = StringRef();
+ m_lastAssertionInfo.capturedExpression = "{Unknown expression after the reported line}"_sr;
+ }
+
+ bool RunContext::sectionStarted(SectionInfo const & sectionInfo, Counts & assertions) {
+ ITracker& sectionTracker = SectionTracker::acquire(m_trackerContext, TestCaseTracking::NameAndLocation(sectionInfo.name, sectionInfo.lineInfo));
+ if (!sectionTracker.isOpen())
+ return false;
+ m_activeSections.push_back(§ionTracker);
+
+ m_lastAssertionInfo.lineInfo = sectionInfo.lineInfo;
+
+ m_reporter->sectionStarting(sectionInfo);
+
+ assertions = m_totals.assertions;
+
+ return true;
+ }
+ auto RunContext::acquireGeneratorTracker( SourceLineInfo const& lineInfo ) -> IGeneratorTracker& {
+ using namespace Generators;
+ GeneratorTracker& tracker = GeneratorTracker::acquire( m_trackerContext, TestCaseTracking::NameAndLocation( "generator", lineInfo ) );
+ assert( tracker.isOpen() );
+ m_lastAssertionInfo.lineInfo = lineInfo;
+ return tracker;
+ }
+
+ bool RunContext::testForMissingAssertions(Counts& assertions) {
+ if (assertions.total() != 0)
+ return false;
+ if (!m_config->warnAboutMissingAssertions())
+ return false;
+ if (m_trackerContext.currentTracker().hasChildren())
+ return false;
+ m_totals.assertions.failed++;
+ assertions.failed++;
+ return true;
+ }
+
+ void RunContext::sectionEnded(SectionEndInfo const & endInfo) {
+ Counts assertions = m_totals.assertions - endInfo.prevAssertions;
+ bool missingAssertions = testForMissingAssertions(assertions);
+
+ if (!m_activeSections.empty()) {
+ m_activeSections.back()->close();
+ m_activeSections.pop_back();
+ }
+
+ m_reporter->sectionEnded(SectionStats(endInfo.sectionInfo, assertions, endInfo.durationInSeconds, missingAssertions));
+ m_messages.clear();
+ m_messageScopes.clear();
+ }
+
+ void RunContext::sectionEndedEarly(SectionEndInfo const & endInfo) {
+ if (m_unfinishedSections.empty())
+ m_activeSections.back()->fail();
+ else
+ m_activeSections.back()->close();
+ m_activeSections.pop_back();
+
+ m_unfinishedSections.push_back(endInfo);
+ }
+ void RunContext::benchmarkStarting( BenchmarkInfo const& info ) {
+ m_reporter->benchmarkStarting( info );
+ }
+ void RunContext::benchmarkEnded( BenchmarkStats const& stats ) {
+ m_reporter->benchmarkEnded( stats );
+ }
+
+ void RunContext::pushScopedMessage(MessageInfo const & message) {
+ m_messages.push_back(message);
+ }
+
+ void RunContext::popScopedMessage(MessageInfo const & message) {
+ m_messages.erase(std::remove(m_messages.begin(), m_messages.end(), message), m_messages.end());
+ }
+
+ void RunContext::emplaceUnscopedMessage( MessageBuilder const& builder ) {
+ m_messageScopes.emplace_back( builder );
+ }
+
+ std::string RunContext::getCurrentTestName() const {
+ return m_activeTestCase
+ ? m_activeTestCase->getTestCaseInfo().name
+ : std::string();
+ }
+
+ const AssertionResult * RunContext::getLastResult() const {
+ return &(*m_lastResult);
+ }
+
+ void RunContext::exceptionEarlyReported() {
+ m_shouldReportUnexpected = false;
+ }
+
+ void RunContext::handleFatalErrorCondition( StringRef message ) {
+ // First notify reporter that bad things happened
+ m_reporter->fatalErrorEncountered(message);
+
+ // Don't rebuild the result -- the stringification itself can cause more fatal errors
+ // Instead, fake a result data.
+ AssertionResultData tempResult( ResultWas::FatalErrorCondition, { false } );
+ tempResult.message = message;
+ AssertionResult result(m_lastAssertionInfo, tempResult);
+
+ assertionEnded(result);
+
+ handleUnfinishedSections();
+
+ // Recreate section for test case (as we will lose the one that was in scope)
+ auto const& testCaseInfo = m_activeTestCase->getTestCaseInfo();
+ SectionInfo testCaseSection(testCaseInfo.lineInfo, testCaseInfo.name);
+
+ Counts assertions;
+ assertions.failed = 1;
+ SectionStats testCaseSectionStats(testCaseSection, assertions, 0, false);
+ m_reporter->sectionEnded(testCaseSectionStats);
+
+ auto const& testInfo = m_activeTestCase->getTestCaseInfo();
+
+ Totals deltaTotals;
+ deltaTotals.testCases.failed = 1;
+ deltaTotals.assertions.failed = 1;
+ m_reporter->testCaseEnded(TestCaseStats(testInfo,
+ deltaTotals,
+ std::string(),
+ std::string(),
+ false));
+ m_totals.testCases.failed++;
+ testGroupEnded(std::string(), m_totals, 1, 1);
+ m_reporter->testRunEnded(TestRunStats(m_runInfo, m_totals, false));
+ }
+
+ bool RunContext::lastAssertionPassed() {
+ return m_lastAssertionPassed;
+ }
+
+ void RunContext::assertionPassed() {
+ m_lastAssertionPassed = true;
+ ++m_totals.assertions.passed;
+ resetAssertionInfo();
+ m_messageScopes.clear();
+ }
+
+ bool RunContext::aborting() const {
+ return m_totals.assertions.failed >= static_cast<std::size_t>(m_config->abortAfter());
+ }
+
+ void RunContext::runCurrentTest(std::string & redirectedCout, std::string & redirectedCerr) {
+ auto const& testCaseInfo = m_activeTestCase->getTestCaseInfo();
+ SectionInfo testCaseSection(testCaseInfo.lineInfo, testCaseInfo.name);
+ m_reporter->sectionStarting(testCaseSection);
+ Counts prevAssertions = m_totals.assertions;
+ double duration = 0;
+ m_shouldReportUnexpected = true;
+ m_lastAssertionInfo = { "TEST_CASE"_sr, testCaseInfo.lineInfo, StringRef(), ResultDisposition::Normal };
+
+ seedRng(*m_config);
+
+ Timer timer;
+ CATCH_TRY {
+ if (m_reporter->getPreferences().shouldRedirectStdOut) {
+#if !defined(CATCH_CONFIG_EXPERIMENTAL_REDIRECT)
+ RedirectedStreams redirectedStreams(redirectedCout, redirectedCerr);
+
+ timer.start();
+ invokeActiveTestCase();
+#else
+ OutputRedirect r(redirectedCout, redirectedCerr);
+ timer.start();
+ invokeActiveTestCase();
+#endif
+ } else {
+ timer.start();
+ invokeActiveTestCase();
+ }
+ duration = timer.getElapsedSeconds();
+ } CATCH_CATCH_ANON (TestFailureException&) {
+ // This just means the test was aborted due to failure
+ } CATCH_CATCH_ALL {
+ // Under CATCH_CONFIG_FAST_COMPILE, unexpected exceptions under REQUIRE assertions
+ // are reported without translation at the point of origin.
+ if( m_shouldReportUnexpected ) {
+ AssertionReaction dummyReaction;
+ handleUnexpectedInflightException( m_lastAssertionInfo, translateActiveException(), dummyReaction );
+ }
+ }
+ Counts assertions = m_totals.assertions - prevAssertions;
+ bool missingAssertions = testForMissingAssertions(assertions);
+
+ m_testCaseTracker->close();
+ handleUnfinishedSections();
+ m_messages.clear();
+ m_messageScopes.clear();
+
+ SectionStats testCaseSectionStats(testCaseSection, assertions, duration, missingAssertions);
+ m_reporter->sectionEnded(testCaseSectionStats);
+ }
+
+ void RunContext::invokeActiveTestCase() {
+ FatalConditionHandler fatalConditionHandler; // Handle signals
+ m_activeTestCase->invoke();
+ fatalConditionHandler.reset();
+ }
+
+ void RunContext::handleUnfinishedSections() {
+ // If sections ended prematurely due to an exception we stored their
+ // infos here so we can tear them down outside the unwind process.
+ for (auto it = m_unfinishedSections.rbegin(),
+ itEnd = m_unfinishedSections.rend();
+ it != itEnd;
+ ++it)
+ sectionEnded(*it);
+ m_unfinishedSections.clear();
+ }
+
+ void RunContext::handleExpr(
+ AssertionInfo const& info,
+ ITransientExpression const& expr,
+ AssertionReaction& reaction
+ ) {
+ m_reporter->assertionStarting( info );
+
+ bool negated = isFalseTest( info.resultDisposition );
+ bool result = expr.getResult() != negated;
+
+ if( result ) {
+ if (!m_includeSuccessfulResults) {
+ assertionPassed();
+ }
+ else {
+ reportExpr(info, ResultWas::Ok, &expr, negated);
+ }
+ }
+ else {
+ reportExpr(info, ResultWas::ExpressionFailed, &expr, negated );
+ populateReaction( reaction );
+ }
+ }
+ void RunContext::reportExpr(
+ AssertionInfo const &info,
+ ResultWas::OfType resultType,
+ ITransientExpression const *expr,
+ bool negated ) {
+
+ m_lastAssertionInfo = info;
+ AssertionResultData data( resultType, LazyExpression( negated ) );
+
+ AssertionResult assertionResult{ info, data };
+ assertionResult.m_resultData.lazyExpression.m_transientExpression = expr;
+
+ assertionEnded( assertionResult );
+ }
+
+ void RunContext::handleMessage(
+ AssertionInfo const& info,
+ ResultWas::OfType resultType,
+ StringRef const& message,
+ AssertionReaction& reaction
+ ) {
+ m_reporter->assertionStarting( info );
+
+ m_lastAssertionInfo = info;
+
+ AssertionResultData data( resultType, LazyExpression( false ) );
+ data.message = message;
+ AssertionResult assertionResult{ m_lastAssertionInfo, data };
+ assertionEnded( assertionResult );
+ if( !assertionResult.isOk() )
+ populateReaction( reaction );
+ }
+ void RunContext::handleUnexpectedExceptionNotThrown(
+ AssertionInfo const& info,
+ AssertionReaction& reaction
+ ) {
+ handleNonExpr(info, Catch::ResultWas::DidntThrowException, reaction);
+ }
+
+ void RunContext::handleUnexpectedInflightException(
+ AssertionInfo const& info,
+ std::string const& message,
+ AssertionReaction& reaction
+ ) {
+ m_lastAssertionInfo = info;
+
+ AssertionResultData data( ResultWas::ThrewException, LazyExpression( false ) );
+ data.message = message;
+ AssertionResult assertionResult{ info, data };
+ assertionEnded( assertionResult );
+ populateReaction( reaction );
+ }
+
+ void RunContext::populateReaction( AssertionReaction& reaction ) {
+ reaction.shouldDebugBreak = m_config->shouldDebugBreak();
+ reaction.shouldThrow = aborting() || (m_lastAssertionInfo.resultDisposition & ResultDisposition::Normal);
+ }
+
+ void RunContext::handleIncomplete(
+ AssertionInfo const& info
+ ) {
+ m_lastAssertionInfo = info;
+
+ AssertionResultData data( ResultWas::ThrewException, LazyExpression( false ) );
+ data.message = "Exception translation was disabled by CATCH_CONFIG_FAST_COMPILE";
+ AssertionResult assertionResult{ info, data };
+ assertionEnded( assertionResult );
+ }
+ void RunContext::handleNonExpr(
+ AssertionInfo const &info,
+ ResultWas::OfType resultType,
+ AssertionReaction &reaction
+ ) {
+ m_lastAssertionInfo = info;
+
+ AssertionResultData data( resultType, LazyExpression( false ) );
+ AssertionResult assertionResult{ info, data };
+ assertionEnded( assertionResult );
+
+ if( !assertionResult.isOk() )
+ populateReaction( reaction );
+ }
+
+ IResultCapture& getResultCapture() {
+ if (auto* capture = getCurrentContext().getResultCapture())
+ return *capture;
+ else
+ CATCH_INTERNAL_ERROR("No result capture instance");
+ }
+}
+// end catch_run_context.cpp
+// start catch_section.cpp
+
+namespace Catch {
+
+ Section::Section( SectionInfo const& info )
+ : m_info( info ),
+ m_sectionIncluded( getResultCapture().sectionStarted( m_info, m_assertions ) )
+ {
+ m_timer.start();
+ }
+
+ Section::~Section() {
+ if( m_sectionIncluded ) {
+ SectionEndInfo endInfo{ m_info, m_assertions, m_timer.getElapsedSeconds() };
+ if( uncaught_exceptions() )
+ getResultCapture().sectionEndedEarly( endInfo );
+ else
+ getResultCapture().sectionEnded( endInfo );
+ }
+ }
+
+ // This indicates whether the section should be executed or not
+ Section::operator bool() const {
+ return m_sectionIncluded;
+ }
+
+} // end namespace Catch
+// end catch_section.cpp
+// start catch_section_info.cpp
+
+namespace Catch {
+
+ SectionInfo::SectionInfo
+ ( SourceLineInfo const& _lineInfo,
+ std::string const& _name )
+ : name( _name ),
+ lineInfo( _lineInfo )
+ {}
+
+} // end namespace Catch
+// end catch_section_info.cpp
+// start catch_session.cpp
+
+// start catch_session.h
+
+#include <memory>
+
+namespace Catch {
+
+ class Session : NonCopyable {
+ public:
+
+ Session();
+ ~Session() override;
+
+ void showHelp() const;
+ void libIdentify();
+
+ int applyCommandLine( int argc, char const * const * argv );
+ #if defined(CATCH_CONFIG_WCHAR) && defined(WIN32) && defined(UNICODE)
+ int applyCommandLine( int argc, wchar_t const * const * argv );
+ #endif
+
+ void useConfigData( ConfigData const& configData );
+
+ template<typename CharT>
+ int run(int argc, CharT const * const argv[]) {
+ if (m_startupExceptions)
+ return 1;
+ int returnCode = applyCommandLine(argc, argv);
+ if (returnCode == 0)
+ returnCode = run();
+ return returnCode;
+ }
+
+ int run();
+
+ clara::Parser const& cli() const;
+ void cli( clara::Parser const& newParser );
+ ConfigData& configData();
+ Config& config();
+ private:
+ int runInternal();
+
+ clara::Parser m_cli;
+ ConfigData m_configData;
+ std::shared_ptr<Config> m_config;
+ bool m_startupExceptions = false;
+ };
+
+} // end namespace Catch
+
+// end catch_session.h
+// start catch_version.h
+
+#include <iosfwd>
+
+namespace Catch {
+
+ // Versioning information
+ struct Version {
+ Version( Version const& ) = delete;
+ Version& operator=( Version const& ) = delete;
+ Version( unsigned int _majorVersion,
+ unsigned int _minorVersion,
+ unsigned int _patchNumber,
+ char const * const _branchName,
+ unsigned int _buildNumber );
+
+ unsigned int const majorVersion;
+ unsigned int const minorVersion;
+ unsigned int const patchNumber;
+
+ // buildNumber is only used if branchName is not null
+ char const * const branchName;
+ unsigned int const buildNumber;
+
+ friend std::ostream& operator << ( std::ostream& os, Version const& version );
+ };
+
+ Version const& libraryVersion();
+}
+
+// end catch_version.h
+#include <cstdlib>
+#include <iomanip>
+
+namespace Catch {
+
+ namespace {
+ const int MaxExitCode = 255;
+
+ IStreamingReporterPtr createReporter(std::string const& reporterName, IConfigPtr const& config) {
+ auto reporter = Catch::getRegistryHub().getReporterRegistry().create(reporterName, config);
+ CATCH_ENFORCE(reporter, "No reporter registered with name: '" << reporterName << "'");
+
+ return reporter;
+ }
+
+ IStreamingReporterPtr makeReporter(std::shared_ptr<Config> const& config) {
+ if (Catch::getRegistryHub().getReporterRegistry().getListeners().empty()) {
+ return createReporter(config->getReporterName(), config);
+ }
+
+ // On older platforms, returning std::unique_ptr<ListeningReporter>
+ // when the return type is std::unique_ptr<IStreamingReporter>
+ // doesn't compile without a std::move call. However, this causes
+ // a warning on newer platforms. Thus, we have to work around
+ // it a bit and downcast the pointer manually.
+ auto ret = std::unique_ptr<IStreamingReporter>(new ListeningReporter);
+ auto& multi = static_cast<ListeningReporter&>(*ret);
+ auto const& listeners = Catch::getRegistryHub().getReporterRegistry().getListeners();
+ for (auto const& listener : listeners) {
+ multi.addListener(listener->create(Catch::ReporterConfig(config)));
+ }
+ multi.addReporter(createReporter(config->getReporterName(), config));
+ return ret;
+ }
+
+ Catch::Totals runTests(std::shared_ptr<Config> const& config) {
+ auto reporter = makeReporter(config);
+
+ RunContext context(config, std::move(reporter));
+
+ Totals totals;
+
+ context.testGroupStarting(config->name(), 1, 1);
+
+ TestSpec testSpec = config->testSpec();
+
+ auto const& allTestCases = getAllTestCasesSorted(*config);
+ for (auto const& testCase : allTestCases) {
+ bool matching = (!testSpec.hasFilters() && !testCase.isHidden()) ||
+ (testSpec.hasFilters() && matchTest(testCase, testSpec, *config));
+
+ if (!context.aborting() && matching)
+ totals += context.runTest(testCase);
+ else
+ context.reporter().skipTest(testCase);
+ }
+
+ if (config->warnAboutNoTests() && totals.testCases.total() == 0) {
+ ReusableStringStream testConfig;
+
+ bool first = true;
+ for (const auto& input : config->getTestsOrTags()) {
+ if (!first) { testConfig << ' '; }
+ first = false;
+ testConfig << input;
+ }
+
+ context.reporter().noMatchingTestCases(testConfig.str());
+ totals.error = -1;
+ }
+
+ context.testGroupEnded(config->name(), totals, 1, 1);
+ return totals;
+ }
+
+ void applyFilenamesAsTags(Catch::IConfig const& config) {
+ auto& tests = const_cast<std::vector<TestCase>&>(getAllTestCasesSorted(config));
+ for (auto& testCase : tests) {
+ auto tags = testCase.tags;
+
+ std::string filename = testCase.lineInfo.file;
+ auto lastSlash = filename.find_last_of("\\/");
+ if (lastSlash != std::string::npos) {
+ filename.erase(0, lastSlash);
+ filename[0] = '#';
+ }
+
+ auto lastDot = filename.find_last_of('.');
+ if (lastDot != std::string::npos) {
+ filename.erase(lastDot);
+ }
+
+ tags.push_back(std::move(filename));
+ setTags(testCase, tags);
+ }
+ }
+
+ } // anon namespace
+
+ Session::Session() {
+ static bool alreadyInstantiated = false;
+ if( alreadyInstantiated ) {
+ CATCH_TRY { CATCH_INTERNAL_ERROR( "Only one instance of Catch::Session can ever be used" ); }
+ CATCH_CATCH_ALL { getMutableRegistryHub().registerStartupException(); }
+ }
+
+ // There cannot be exceptions at startup in no-exception mode.
+#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+ const auto& exceptions = getRegistryHub().getStartupExceptionRegistry().getExceptions();
+ if ( !exceptions.empty() ) {
+ config();
+ getCurrentMutableContext().setConfig(m_config);
+
+ m_startupExceptions = true;
+ Colour colourGuard( Colour::Red );
+ Catch::cerr() << "Errors occurred during startup!" << '\n';
+ // iterate over all exceptions and notify user
+ for ( const auto& ex_ptr : exceptions ) {
+ try {
+ std::rethrow_exception(ex_ptr);
+ } catch ( std::exception const& ex ) {
+ Catch::cerr() << Column( ex.what() ).indent(2) << '\n';
+ }
+ }
+ }
+#endif
+
+ alreadyInstantiated = true;
+ m_cli = makeCommandLineParser( m_configData );
+ }
+ Session::~Session() {
+ Catch::cleanUp();
+ }
+
+ void Session::showHelp() const {
+ Catch::cout()
+ << "\nCatch v" << libraryVersion() << "\n"
+ << m_cli << std::endl
+ << "For more detailed usage please see the project docs\n" << std::endl;
+ }
+ void Session::libIdentify() {
+ Catch::cout()
+ << std::left << std::setw(16) << "description: " << "A Catch test executable\n"
+ << std::left << std::setw(16) << "category: " << "testframework\n"
+ << std::left << std::setw(16) << "framework: " << "Catch Test\n"
+ << std::left << std::setw(16) << "version: " << libraryVersion() << std::endl;
+ }
+
+ int Session::applyCommandLine( int argc, char const * const * argv ) {
+ if( m_startupExceptions )
+ return 1;
+
+ auto result = m_cli.parse( clara::Args( argc, argv ) );
+ if( !result ) {
+ config();
+ getCurrentMutableContext().setConfig(m_config);
+ Catch::cerr()
+ << Colour( Colour::Red )
+ << "\nError(s) in input:\n"
+ << Column( result.errorMessage() ).indent( 2 )
+ << "\n\n";
+ Catch::cerr() << "Run with -? for usage\n" << std::endl;
+ return MaxExitCode;
+ }
+
+ if( m_configData.showHelp )
+ showHelp();
+ if( m_configData.libIdentify )
+ libIdentify();
+ m_config.reset();
+ return 0;
+ }
+
+#if defined(CATCH_CONFIG_WCHAR) && defined(WIN32) && defined(UNICODE)
+ int Session::applyCommandLine( int argc, wchar_t const * const * argv ) {
+
+ char **utf8Argv = new char *[ argc ];
+
+ for ( int i = 0; i < argc; ++i ) {
+ int bufSize = WideCharToMultiByte( CP_UTF8, 0, argv[i], -1, NULL, 0, NULL, NULL );
+
+ utf8Argv[ i ] = new char[ bufSize ];
+
+ WideCharToMultiByte( CP_UTF8, 0, argv[i], -1, utf8Argv[i], bufSize, NULL, NULL );
+ }
+
+ int returnCode = applyCommandLine( argc, utf8Argv );
+
+ for ( int i = 0; i < argc; ++i )
+ delete [] utf8Argv[ i ];
+
+ delete [] utf8Argv;
+
+ return returnCode;
+ }
+#endif
+
+ void Session::useConfigData( ConfigData const& configData ) {
+ m_configData = configData;
+ m_config.reset();
+ }
+
+ int Session::run() {
+ if( ( m_configData.waitForKeypress & WaitForKeypress::BeforeStart ) != 0 ) {
+ Catch::cout() << "...waiting for enter/ return before starting" << std::endl;
+ static_cast<void>(std::getchar());
+ }
+ int exitCode = runInternal();
+ if( ( m_configData.waitForKeypress & WaitForKeypress::BeforeExit ) != 0 ) {
+ Catch::cout() << "...waiting for enter/ return before exiting, with code: " << exitCode << std::endl;
+ static_cast<void>(std::getchar());
+ }
+ return exitCode;
+ }
+
+ clara::Parser const& Session::cli() const {
+ return m_cli;
+ }
+ void Session::cli( clara::Parser const& newParser ) {
+ m_cli = newParser;
+ }
+ ConfigData& Session::configData() {
+ return m_configData;
+ }
+ Config& Session::config() {
+ if( !m_config )
+ m_config = std::make_shared<Config>( m_configData );
+ return *m_config;
+ }
+
+ int Session::runInternal() {
+ if( m_startupExceptions )
+ return 1;
+
+ if (m_configData.showHelp || m_configData.libIdentify) {
+ return 0;
+ }
+
+ CATCH_TRY {
+ config(); // Force config to be constructed
+
+ seedRng( *m_config );
+
+ if( m_configData.filenamesAsTags )
+ applyFilenamesAsTags( *m_config );
+
+ // Handle list request
+ if( Option<std::size_t> listed = list( m_config ) )
+ return static_cast<int>( *listed );
+
+ auto totals = runTests( m_config );
+ // Note that on unices only the lower 8 bits are usually used, clamping
+ // the return value to 255 prevents false negative when some multiple
+ // of 256 tests has failed
+ return (std::min) (MaxExitCode, (std::max) (totals.error, static_cast<int>(totals.assertions.failed)));
+ }
+#if !defined(CATCH_CONFIG_DISABLE_EXCEPTIONS)
+ catch( std::exception& ex ) {
+ Catch::cerr() << ex.what() << std::endl;
+ return MaxExitCode;
+ }
+#endif
+ }
+
+} // end namespace Catch
+// end catch_session.cpp
+// start catch_singletons.cpp
+
+#include <vector>
+
+namespace Catch {
+
+ namespace {
+ static auto getSingletons() -> std::vector<ISingleton*>*& {
+ static std::vector<ISingleton*>* g_singletons = nullptr;
+ if( !g_singletons )
+ g_singletons = new std::vector<ISingleton*>();
+ return g_singletons;
+ }
+ }
+
+ ISingleton::~ISingleton() {}
+
+ void addSingleton(ISingleton* singleton ) {
+ getSingletons()->push_back( singleton );
+ }
+ void cleanupSingletons() {
+ auto& singletons = getSingletons();
+ for( auto singleton : *singletons )
+ delete singleton;
+ delete singletons;
+ singletons = nullptr;
+ }
+
+} // namespace Catch
+// end catch_singletons.cpp
+// start catch_startup_exception_registry.cpp
+
+namespace Catch {
+void StartupExceptionRegistry::add( std::exception_ptr const& exception ) noexcept {
+ CATCH_TRY {
+ m_exceptions.push_back(exception);
+ } CATCH_CATCH_ALL {
+ // If we run out of memory during start-up there's really not a lot more we can do about it
+ std::terminate();
+ }
+ }
+
+ std::vector<std::exception_ptr> const& StartupExceptionRegistry::getExceptions() const noexcept {
+ return m_exceptions;
+ }
+
+} // end namespace Catch
+// end catch_startup_exception_registry.cpp
+// start catch_stream.cpp
+
+#include <cstdio>
+#include <iostream>
+#include <fstream>
+#include <sstream>
+#include <vector>
+#include <memory>
+
+namespace Catch {
+
+ Catch::IStream::~IStream() = default;
+
+ namespace detail { namespace {
+ template<typename WriterF, std::size_t bufferSize=256>
+ class StreamBufImpl : public std::streambuf {
+ char data[bufferSize];
+ WriterF m_writer;
+
+ public:
+ StreamBufImpl() {
+ setp( data, data + sizeof(data) );
+ }
+
+ ~StreamBufImpl() noexcept {
+ StreamBufImpl::sync();
+ }
+
+ private:
+ int overflow( int c ) override {
+ sync();
+
+ if( c != EOF ) {
+ if( pbase() == epptr() )
+ m_writer( std::string( 1, static_cast<char>( c ) ) );
+ else
+ sputc( static_cast<char>( c ) );
+ }
+ return 0;
+ }
+
+ int sync() override {
+ if( pbase() != pptr() ) {
+ m_writer( std::string( pbase(), static_cast<std::string::size_type>( pptr() - pbase() ) ) );
+ setp( pbase(), epptr() );
+ }
+ return 0;
+ }
+ };
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ struct OutputDebugWriter {
+
+ void operator()( std::string const&str ) {
+ writeToDebugConsole( str );
+ }
+ };
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ class FileStream : public IStream {
+ mutable std::ofstream m_ofs;
+ public:
+ FileStream( StringRef filename ) {
+ m_ofs.open( filename.c_str() );
+ CATCH_ENFORCE( !m_ofs.fail(), "Unable to open file: '" << filename << "'" );
+ }
+ ~FileStream() override = default;
+ public: // IStream
+ std::ostream& stream() const override {
+ return m_ofs;
+ }
+ };
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ class CoutStream : public IStream {
+ mutable std::ostream m_os;
+ public:
+ // Store the streambuf from cout up-front because
+ // cout may get redirected when running tests
+ CoutStream() : m_os( Catch::cout().rdbuf() ) {}
+ ~CoutStream() override = default;
+
+ public: // IStream
+ std::ostream& stream() const override { return m_os; }
+ };
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ class DebugOutStream : public IStream {
+ std::unique_ptr<StreamBufImpl<OutputDebugWriter>> m_streamBuf;
+ mutable std::ostream m_os;
+ public:
+ DebugOutStream()
+ : m_streamBuf( new StreamBufImpl<OutputDebugWriter>() ),
+ m_os( m_streamBuf.get() )
+ {}
+
+ ~DebugOutStream() override = default;
+
+ public: // IStream
+ std::ostream& stream() const override { return m_os; }
+ };
+
+ }} // namespace anon::detail
+
+ ///////////////////////////////////////////////////////////////////////////
+
+ auto makeStream( StringRef const &filename ) -> IStream const* {
+ if( filename.empty() )
+ return new detail::CoutStream();
+ else if( filename[0] == '%' ) {
+ if( filename == "%debug" )
+ return new detail::DebugOutStream();
+ else
+ CATCH_ERROR( "Unrecognised stream: '" << filename << "'" );
+ }
+ else
+ return new detail::FileStream( filename );
+ }
+
+ // This class encapsulates the idea of a pool of ostringstreams that can be reused.
+ struct StringStreams {
+ std::vector<std::unique_ptr<std::ostringstream>> m_streams;
+ std::vector<std::size_t> m_unused;
+ std::ostringstream m_referenceStream; // Used for copy state/ flags from
+
+ auto add() -> std::size_t {
+ if( m_unused.empty() ) {
+ m_streams.push_back( std::unique_ptr<std::ostringstream>( new std::ostringstream ) );
+ return m_streams.size()-1;
+ }
+ else {
+ auto index = m_unused.back();
+ m_unused.pop_back();
+ return index;
+ }
+ }
+
+ void release( std::size_t index ) {
+ m_streams[index]->copyfmt( m_referenceStream ); // Restore initial flags and other state
+ m_unused.push_back(index);
+ }
+ };
+
+ ReusableStringStream::ReusableStringStream()
+ : m_index( Singleton<StringStreams>::getMutable().add() ),
+ m_oss( Singleton<StringStreams>::getMutable().m_streams[m_index].get() )
+ {}
+
+ ReusableStringStream::~ReusableStringStream() {
+ static_cast<std::ostringstream*>( m_oss )->str("");
+ m_oss->clear();
+ Singleton<StringStreams>::getMutable().release( m_index );
+ }
+
+ auto ReusableStringStream::str() const -> std::string {
+ return static_cast<std::ostringstream*>( m_oss )->str();
+ }
+
+ ///////////////////////////////////////////////////////////////////////////
+
+#ifndef CATCH_CONFIG_NOSTDOUT // If you #define this you must implement these functions
+ std::ostream& cout() { return std::cout; }
+ std::ostream& cerr() { return std::cerr; }
+ std::ostream& clog() { return std::clog; }
+#endif
+}
+// end catch_stream.cpp
+// start catch_string_manip.cpp
+
+#include <algorithm>
+#include <ostream>
+#include <cstring>
+#include <cctype>
+#include <vector>
+
+namespace Catch {
+
+ namespace {
+ char toLowerCh(char c) {
+ return static_cast<char>( std::tolower( c ) );
+ }
+ }
+
+ bool startsWith( std::string const& s, std::string const& prefix ) {
+ return s.size() >= prefix.size() && std::equal(prefix.begin(), prefix.end(), s.begin());
+ }
+ bool startsWith( std::string const& s, char prefix ) {
+ return !s.empty() && s[0] == prefix;
+ }
+ bool endsWith( std::string const& s, std::string const& suffix ) {
+ return s.size() >= suffix.size() && std::equal(suffix.rbegin(), suffix.rend(), s.rbegin());
+ }
+ bool endsWith( std::string const& s, char suffix ) {
+ return !s.empty() && s[s.size()-1] == suffix;
+ }
+ bool contains( std::string const& s, std::string const& infix ) {
+ return s.find( infix ) != std::string::npos;
+ }
+ void toLowerInPlace( std::string& s ) {
+ std::transform( s.begin(), s.end(), s.begin(), toLowerCh );
+ }
+ std::string toLower( std::string const& s ) {
+ std::string lc = s;
+ toLowerInPlace( lc );
+ return lc;
+ }
+ std::string trim( std::string const& str ) {
+ static char const* whitespaceChars = "\n\r\t ";
+ std::string::size_type start = str.find_first_not_of( whitespaceChars );
+ std::string::size_type end = str.find_last_not_of( whitespaceChars );
+
+ return start != std::string::npos ? str.substr( start, 1+end-start ) : std::string();
+ }
+
+ bool replaceInPlace( std::string& str, std::string const& replaceThis, std::string const& withThis ) {
+ bool replaced = false;
+ std::size_t i = str.find( replaceThis );
+ while( i != std::string::npos ) {
+ replaced = true;
+ str = str.substr( 0, i ) + withThis + str.substr( i+replaceThis.size() );
+ if( i < str.size()-withThis.size() )
+ i = str.find( replaceThis, i+withThis.size() );
+ else
+ i = std::string::npos;
+ }
+ return replaced;
+ }
+
+ std::vector<StringRef> splitStringRef( StringRef str, char delimiter ) {
+ std::vector<StringRef> subStrings;
+ std::size_t start = 0;
+ for(std::size_t pos = 0; pos < str.size(); ++pos ) {
+ if( str[pos] == delimiter ) {
+ if( pos - start > 1 )
+ subStrings.push_back( str.substr( start, pos-start ) );
+ start = pos+1;
+ }
+ }
+ if( start < str.size() )
+ subStrings.push_back( str.substr( start, str.size()-start ) );
+ return subStrings;
+ }
+
+ pluralise::pluralise( std::size_t count, std::string const& label )
+ : m_count( count ),
+ m_label( label )
+ {}
+
+ std::ostream& operator << ( std::ostream& os, pluralise const& pluraliser ) {
+ os << pluraliser.m_count << ' ' << pluraliser.m_label;
+ if( pluraliser.m_count != 1 )
+ os << 's';
+ return os;
+ }
+
+}
+// end catch_string_manip.cpp
+// start catch_stringref.cpp
+
+#if defined(__clang__)
+# pragma clang diagnostic push
+# pragma clang diagnostic ignored "-Wexit-time-destructors"
+#endif
+
+#include <ostream>
+#include <cstring>
+#include <cstdint>
+
+namespace {
+ const uint32_t byte_2_lead = 0xC0;
+ const uint32_t byte_3_lead = 0xE0;
+ const uint32_t byte_4_lead = 0xF0;
+}
+
+namespace Catch {
+ StringRef::StringRef( char const* rawChars ) noexcept
+ : StringRef( rawChars, static_cast<StringRef::size_type>(std::strlen(rawChars) ) )
+ {}
+
+ StringRef::operator std::string() const {
+ return std::string( m_start, m_size );
+ }
+
+ void StringRef::swap( StringRef& other ) noexcept {
+ std::swap( m_start, other.m_start );
+ std::swap( m_size, other.m_size );
+ std::swap( m_data, other.m_data );
+ }
+
+ auto StringRef::c_str() const -> char const* {
+ if( !isSubstring() )
+ return m_start;
+
+ const_cast<StringRef *>( this )->takeOwnership();
+ return m_data;
+ }
+ auto StringRef::currentData() const noexcept -> char const* {
+ return m_start;
+ }
+
+ auto StringRef::isOwned() const noexcept -> bool {
+ return m_data != nullptr;
+ }
+ auto StringRef::isSubstring() const noexcept -> bool {
+ return m_start[m_size] != '\0';
+ }
+
+ void StringRef::takeOwnership() {
+ if( !isOwned() ) {
+ m_data = new char[m_size+1];
+ memcpy( m_data, m_start, m_size );
+ m_data[m_size] = '\0';
+ }
+ }
+ auto StringRef::substr( size_type start, size_type size ) const noexcept -> StringRef {
+ if( start < m_size )
+ return StringRef( m_start+start, size );
+ else
+ return StringRef();
+ }
+ auto StringRef::operator == ( StringRef const& other ) const noexcept -> bool {
+ return
+ size() == other.size() &&
+ (std::strncmp( m_start, other.m_start, size() ) == 0);
+ }
+ auto StringRef::operator != ( StringRef const& other ) const noexcept -> bool {
+ return !operator==( other );
+ }
+
+ auto StringRef::operator[](size_type index) const noexcept -> char {
+ return m_start[index];
+ }
+
+ auto StringRef::numberOfCharacters() const noexcept -> size_type {
+ size_type noChars = m_size;
+ // Make adjustments for uft encodings
+ for( size_type i=0; i < m_size; ++i ) {
+ char c = m_start[i];
+ if( ( c & byte_2_lead ) == byte_2_lead ) {
+ noChars--;
+ if (( c & byte_3_lead ) == byte_3_lead )
+ noChars--;
+ if( ( c & byte_4_lead ) == byte_4_lead )
+ noChars--;
+ }
+ }
+ return noChars;
+ }
+
+ auto operator + ( StringRef const& lhs, StringRef const& rhs ) -> std::string {
+ std::string str;
+ str.reserve( lhs.size() + rhs.size() );
+ str += lhs;
+ str += rhs;
+ return str;
+ }
+ auto operator + ( StringRef const& lhs, const char* rhs ) -> std::string {
+ return std::string( lhs ) + std::string( rhs );
+ }
+ auto operator + ( char const* lhs, StringRef const& rhs ) -> std::string {
+ return std::string( lhs ) + std::string( rhs );
+ }
+
+ auto operator << ( std::ostream& os, StringRef const& str ) -> std::ostream& {
+ return os.write(str.currentData(), str.size());
+ }
+
+ auto operator+=( std::string& lhs, StringRef const& rhs ) -> std::string& {
+ lhs.append(rhs.currentData(), rhs.size());
+ return lhs;
+ }
+
+} // namespace Catch
+
+#if defined(__clang__)
+# pragma clang diagnostic pop
+#endif
+// end catch_stringref.cpp
+// start catch_tag_alias.cpp
+
+namespace Catch {
+ TagAlias::TagAlias(std::string const & _tag, SourceLineInfo _lineInfo): tag(_tag), lineInfo(_lineInfo) {}
+}
+// end catch_tag_alias.cpp
+// start catch_tag_alias_autoregistrar.cpp
+
+namespace Catch {
+
+ RegistrarForTagAliases::RegistrarForTagAliases(char const* alias, char const* tag, SourceLineInfo const& lineInfo) {
+ CATCH_TRY {
+ getMutableRegistryHub().registerTagAlias(alias, tag, lineInfo);
+ } CATCH_CATCH_ALL {
+ // Do not throw when constructing global objects, instead register the exception to be processed later
+ getMutableRegistryHub().registerStartupException();
+ }
+ }
+
+}
+// end catch_tag_alias_autoregistrar.cpp
+// start catch_tag_alias_registry.cpp
+
+#include <sstream>
+
+namespace Catch {
+
+ TagAliasRegistry::~TagAliasRegistry() {}
+
+ TagAlias const* TagAliasRegistry::find( std::string const& alias ) const {
+ auto it = m_registry.find( alias );
+ if( it != m_registry.end() )
+ return &(it->second);
+ else
+ return nullptr;
+ }
+
+ std::string TagAliasRegistry::expandAliases( std::string const& unexpandedTestSpec ) const {
+ std::string expandedTestSpec = unexpandedTestSpec;
+ for( auto const& registryKvp : m_registry ) {
+ std::size_t pos = expandedTestSpec.find( registryKvp.first );
+ if( pos != std::string::npos ) {
+ expandedTestSpec = expandedTestSpec.substr( 0, pos ) +
+ registryKvp.second.tag +
+ expandedTestSpec.substr( pos + registryKvp.first.size() );
+ }
+ }
+ return expandedTestSpec;
+ }
+
+ void TagAliasRegistry::add( std::string const& alias, std::string const& tag, SourceLineInfo const& lineInfo ) {
+ CATCH_ENFORCE( startsWith(alias, "[@") && endsWith(alias, ']'),
+ "error: tag alias, '" << alias << "' is not of the form [@alias name].\n" << lineInfo );
+
+ CATCH_ENFORCE( m_registry.insert(std::make_pair(alias, TagAlias(tag, lineInfo))).second,
+ "error: tag alias, '" << alias << "' already registered.\n"
+ << "\tFirst seen at: " << find(alias)->lineInfo << "\n"
+ << "\tRedefined at: " << lineInfo );
+ }
+
+ ITagAliasRegistry::~ITagAliasRegistry() {}
+
+ ITagAliasRegistry const& ITagAliasRegistry::get() {
+ return getRegistryHub().getTagAliasRegistry();
+ }
+
+} // end namespace Catch
+// end catch_tag_alias_registry.cpp
+// start catch_test_case_info.cpp
+
+#include <cctype>
+#include <exception>
+#include <algorithm>
+#include <sstream>
+
+namespace Catch {
+
+ namespace {
+ TestCaseInfo::SpecialProperties parseSpecialTag( std::string const& tag ) {
+ if( startsWith( tag, '.' ) ||
+ tag == "!hide" )
+ return TestCaseInfo::IsHidden;
+ else if( tag == "!throws" )
+ return TestCaseInfo::Throws;
+ else if( tag == "!shouldfail" )
+ return TestCaseInfo::ShouldFail;
+ else if( tag == "!mayfail" )
+ return TestCaseInfo::MayFail;
+ else if( tag == "!nonportable" )
+ return TestCaseInfo::NonPortable;
+ else if( tag == "!benchmark" )
+ return static_cast<TestCaseInfo::SpecialProperties>( TestCaseInfo::Benchmark | TestCaseInfo::IsHidden );
+ else
+ return TestCaseInfo::None;
+ }
+ bool isReservedTag( std::string const& tag ) {
+ return parseSpecialTag( tag ) == TestCaseInfo::None && tag.size() > 0 && !std::isalnum( static_cast<unsigned char>(tag[0]) );
+ }
+ void enforceNotReservedTag( std::string const& tag, SourceLineInfo const& _lineInfo ) {
+ CATCH_ENFORCE( !isReservedTag(tag),
+ "Tag name: [" << tag << "] is not allowed.\n"
+ << "Tag names starting with non alphanumeric characters are reserved\n"
+ << _lineInfo );
+ }
+ }
+
+ TestCase makeTestCase( ITestInvoker* _testCase,
+ std::string const& _className,
+ NameAndTags const& nameAndTags,
+ SourceLineInfo const& _lineInfo )
+ {
+ bool isHidden = false;
+
+ // Parse out tags
+ std::vector<std::string> tags;
+ std::string desc, tag;
+ bool inTag = false;
+ std::string _descOrTags = nameAndTags.tags;
+ for (char c : _descOrTags) {
+ if( !inTag ) {
+ if( c == '[' )
+ inTag = true;
+ else
+ desc += c;
+ }
+ else {
+ if( c == ']' ) {
+ TestCaseInfo::SpecialProperties prop = parseSpecialTag( tag );
+ if( ( prop & TestCaseInfo::IsHidden ) != 0 )
+ isHidden = true;
+ else if( prop == TestCaseInfo::None )
+ enforceNotReservedTag( tag, _lineInfo );
+
+ // Merged hide tags like `[.approvals]` should be added as
+ // `[.][approvals]`. The `[.]` is added at later point, so
+ // we only strip the prefix
+ if (startsWith(tag, '.') && tag.size() > 1) {
+ tag.erase(0, 1);
+ }
+ tags.push_back( tag );
+ tag.clear();
+ inTag = false;
+ }
+ else
+ tag += c;
+ }
+ }
+ if( isHidden ) {
+ tags.push_back( "." );
+ }
+
+ TestCaseInfo info( nameAndTags.name, _className, desc, tags, _lineInfo );
+ return TestCase( _testCase, std::move(info) );
+ }
+
+ void setTags( TestCaseInfo& testCaseInfo, std::vector<std::string> tags ) {
+ std::sort(begin(tags), end(tags));
+ tags.erase(std::unique(begin(tags), end(tags)), end(tags));
+ testCaseInfo.lcaseTags.clear();
+
+ for( auto const& tag : tags ) {
+ std::string lcaseTag = toLower( tag );
+ testCaseInfo.properties = static_cast<TestCaseInfo::SpecialProperties>( testCaseInfo.properties | parseSpecialTag( lcaseTag ) );
+ testCaseInfo.lcaseTags.push_back( lcaseTag );
+ }
+ testCaseInfo.tags = std::move(tags);
+ }
+
+ TestCaseInfo::TestCaseInfo( std::string const& _name,
+ std::string const& _className,
+ std::string const& _description,
+ std::vector<std::string> const& _tags,
+ SourceLineInfo const& _lineInfo )
+ : name( _name ),
+ className( _className ),
+ description( _description ),
+ lineInfo( _lineInfo ),
+ properties( None )
+ {
+ setTags( *this, _tags );
+ }
+
+ bool TestCaseInfo::isHidden() const {
+ return ( properties & IsHidden ) != 0;
+ }
+ bool TestCaseInfo::throws() const {
+ return ( properties & Throws ) != 0;
+ }
+ bool TestCaseInfo::okToFail() const {
+ return ( properties & (ShouldFail | MayFail ) ) != 0;
+ }
+ bool TestCaseInfo::expectedToFail() const {
+ return ( properties & (ShouldFail ) ) != 0;
+ }
+
+ std::string TestCaseInfo::tagsAsString() const {
+ std::string ret;
+ // '[' and ']' per tag
+ std::size_t full_size = 2 * tags.size();
+ for (const auto& tag : tags) {
+ full_size += tag.size();
+ }
+ ret.reserve(full_size);
+ for (const auto& tag : tags) {
+ ret.push_back('[');
+ ret.append(tag);
+ ret.push_back(']');
+ }
+
+ return ret;
+ }
+
+ TestCase::TestCase( ITestInvoker* testCase, TestCaseInfo&& info ) : TestCaseInfo( std::move(info) ), test( testCase ) {}
+
+ TestCase TestCase::withName( std::string const& _newName ) const {
+ TestCase other( *this );
+ other.name = _newName;
+ return other;
+ }
+
+ void TestCase::invoke() const {
+ test->invoke();
+ }
+
+ bool TestCase::operator == ( TestCase const& other ) const {
+ return test.get() == other.test.get() &&
+ name == other.name &&
+ className == other.className;
+ }
+
+ bool TestCase::operator < ( TestCase const& other ) const {
+ return name < other.name;
+ }
+
+ TestCaseInfo const& TestCase::getTestCaseInfo() const
+ {
+ return *this;
+ }
+
+} // end namespace Catch
+// end catch_test_case_info.cpp
+// start catch_test_case_registry_impl.cpp
+
+#include <sstream>
+
+namespace Catch {
+
+ std::vector<TestCase> sortTests( IConfig const& config, std::vector<TestCase> const& unsortedTestCases ) {
+
+ std::vector<TestCase> sorted = unsortedTestCases;
+
+ switch( config.runOrder() ) {
+ case RunTests::InLexicographicalOrder:
+ std::sort( sorted.begin(), sorted.end() );
+ break;
+ case RunTests::InRandomOrder:
+ seedRng( config );
+ std::shuffle( sorted.begin(), sorted.end(), rng() );
+ break;
+ case RunTests::InDeclarationOrder:
+ // already in declaration order
+ break;
+ }
+ return sorted;
+ }
+ bool matchTest( TestCase const& testCase, TestSpec const& testSpec, IConfig const& config ) {
+ return testSpec.matches( testCase ) && ( config.allowThrows() || !testCase.throws() );
+ }
+
+ void enforceNoDuplicateTestCases( std::vector<TestCase> const& functions ) {
+ std::set<TestCase> seenFunctions;
+ for( auto const& function : functions ) {
+ auto prev = seenFunctions.insert( function );
+ CATCH_ENFORCE( prev.second,
+ "error: TEST_CASE( \"" << function.name << "\" ) already defined.\n"
+ << "\tFirst seen at " << prev.first->getTestCaseInfo().lineInfo << "\n"
+ << "\tRedefined at " << function.getTestCaseInfo().lineInfo );
+ }
+ }
+
+ std::vector<TestCase> filterTests( std::vector<TestCase> const& testCases, TestSpec const& testSpec, IConfig const& config ) {
+ std::vector<TestCase> filtered;
+ filtered.reserve( testCases.size() );
+ for (auto const& testCase : testCases) {
+ if ((!testSpec.hasFilters() && !testCase.isHidden()) ||
+ (testSpec.hasFilters() && matchTest(testCase, testSpec, config))) {
+ filtered.push_back(testCase);
+ }
+ }
+ return filtered;
+ }
+ std::vector<TestCase> const& getAllTestCasesSorted( IConfig const& config ) {
+ return getRegistryHub().getTestCaseRegistry().getAllTestsSorted( config );
+ }
+
+ void TestRegistry::registerTest( TestCase const& testCase ) {
+ std::string name = testCase.getTestCaseInfo().name;
+ if( name.empty() ) {
+ ReusableStringStream rss;
+ rss << "Anonymous test case " << ++m_unnamedCount;
+ return registerTest( testCase.withName( rss.str() ) );
+ }
+ m_functions.push_back( testCase );
+ }
+
+ std::vector<TestCase> const& TestRegistry::getAllTests() const {
+ return m_functions;
+ }
+ std::vector<TestCase> const& TestRegistry::getAllTestsSorted( IConfig const& config ) const {
+ if( m_sortedFunctions.empty() )
+ enforceNoDuplicateTestCases( m_functions );
+
+ if( m_currentSortOrder != config.runOrder() || m_sortedFunctions.empty() ) {
+ m_sortedFunctions = sortTests( config, m_functions );
+ m_currentSortOrder = config.runOrder();
+ }
+ return m_sortedFunctions;
+ }
+
+ ///////////////////////////////////////////////////////////////////////////
+ TestInvokerAsFunction::TestInvokerAsFunction( void(*testAsFunction)() ) noexcept : m_testAsFunction( testAsFunction ) {}
+
+ void TestInvokerAsFunction::invoke() const {
+ m_testAsFunction();
+ }
+
+ std::string extractClassName( StringRef const& classOrQualifiedMethodName ) {
+ std::string className = classOrQualifiedMethodName;
+ if( startsWith( className, '&' ) )
+ {
+ std::size_t lastColons = className.rfind( "::" );
+ std::size_t penultimateColons = className.rfind( "::", lastColons-1 );
+ if( penultimateColons == std::string::npos )
+ penultimateColons = 1;
+ className = className.substr( penultimateColons, lastColons-penultimateColons );
+ }
+ return className;
+ }
+
+} // end namespace Catch
+// end catch_test_case_registry_impl.cpp
+// start catch_test_case_tracker.cpp
+
+#include <algorithm>
+#include <cassert>
+#include <stdexcept>
+#include <memory>
+#include <sstream>
+
+#if defined(__clang__)
+# pragma clang diagnostic push
+# pragma clang diagnostic ignored "-Wexit-time-destructors"
+#endif
+
+namespace Catch {
+namespace TestCaseTracking {
+
+ NameAndLocation::NameAndLocation( std::string const& _name, SourceLineInfo const& _location )
+ : name( _name ),
+ location( _location )
+ {}
+
+ ITracker::~ITracker() = default;
+
+ ITracker& TrackerContext::startRun() {
+ m_rootTracker = std::make_shared<SectionTracker>( NameAndLocation( "{root}", CATCH_INTERNAL_LINEINFO ), *this, nullptr );
+ m_currentTracker = nullptr;
+ m_runState = Executing;
+ return *m_rootTracker;
+ }
+
+ void TrackerContext::endRun() {
+ m_rootTracker.reset();
+ m_currentTracker = nullptr;
+ m_runState = NotStarted;
+ }
+
+ void TrackerContext::startCycle() {
+ m_currentTracker = m_rootTracker.get();
+ m_runState = Executing;
+ }
+ void TrackerContext::completeCycle() {
+ m_runState = CompletedCycle;
+ }
+
+ bool TrackerContext::completedCycle() const {
+ return m_runState == CompletedCycle;
+ }
+ ITracker& TrackerContext::currentTracker() {
+ return *m_currentTracker;
+ }
+ void TrackerContext::setCurrentTracker( ITracker* tracker ) {
+ m_currentTracker = tracker;
+ }
+
+ TrackerBase::TrackerBase( NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent )
+ : m_nameAndLocation( nameAndLocation ),
+ m_ctx( ctx ),
+ m_parent( parent )
+ {}
+
+ NameAndLocation const& TrackerBase::nameAndLocation() const {
+ return m_nameAndLocation;
+ }
+ bool TrackerBase::isComplete() const {
+ return m_runState == CompletedSuccessfully || m_runState == Failed;
+ }
+ bool TrackerBase::isSuccessfullyCompleted() const {
+ return m_runState == CompletedSuccessfully;
+ }
+ bool TrackerBase::isOpen() const {
+ return m_runState != NotStarted && !isComplete();
+ }
+ bool TrackerBase::hasChildren() const {
+ return !m_children.empty();
+ }
+
+ void TrackerBase::addChild( ITrackerPtr const& child ) {
+ m_children.push_back( child );
+ }
+
+ ITrackerPtr TrackerBase::findChild( NameAndLocation const& nameAndLocation ) {
+ auto it = std::find_if( m_children.begin(), m_children.end(),
+ [&nameAndLocation]( ITrackerPtr const& tracker ){
+ return
+ tracker->nameAndLocation().location == nameAndLocation.location &&
+ tracker->nameAndLocation().name == nameAndLocation.name;
+ } );
+ return( it != m_children.end() )
+ ? *it
+ : nullptr;
+ }
+ ITracker& TrackerBase::parent() {
+ assert( m_parent ); // Should always be non-null except for root
+ return *m_parent;
+ }
+
+ void TrackerBase::openChild() {
+ if( m_runState != ExecutingChildren ) {
+ m_runState = ExecutingChildren;
+ if( m_parent )
+ m_parent->openChild();
+ }
+ }
+
+ bool TrackerBase::isSectionTracker() const { return false; }
+ bool TrackerBase::isGeneratorTracker() const { return false; }
+
+ void TrackerBase::open() {
+ m_runState = Executing;
+ moveToThis();
+ if( m_parent )
+ m_parent->openChild();
+ }
+
+ void TrackerBase::close() {
+
+ // Close any still open children (e.g. generators)
+ while( &m_ctx.currentTracker() != this )
+ m_ctx.currentTracker().close();
+
+ switch( m_runState ) {
+ case NeedsAnotherRun:
+ break;
+
+ case Executing:
+ m_runState = CompletedSuccessfully;
+ break;
+ case ExecutingChildren:
+ if( m_children.empty() || m_children.back()->isComplete() )
+ m_runState = CompletedSuccessfully;
+ break;
+
+ case NotStarted:
+ case CompletedSuccessfully:
+ case Failed:
+ CATCH_INTERNAL_ERROR( "Illogical state: " << m_runState );
+
+ default:
+ CATCH_INTERNAL_ERROR( "Unknown state: " << m_runState );
+ }
+ moveToParent();
+ m_ctx.completeCycle();
+ }
+ void TrackerBase::fail() {
+ m_runState = Failed;
+ if( m_parent )
+ m_parent->markAsNeedingAnotherRun();
+ moveToParent();
+ m_ctx.completeCycle();
+ }
+ void TrackerBase::markAsNeedingAnotherRun() {
+ m_runState = NeedsAnotherRun;
+ }
+
+ void TrackerBase::moveToParent() {
+ assert( m_parent );
+ m_ctx.setCurrentTracker( m_parent );
+ }
+ void TrackerBase::moveToThis() {
+ m_ctx.setCurrentTracker( this );
+ }
+
+ SectionTracker::SectionTracker( NameAndLocation const& nameAndLocation, TrackerContext& ctx, ITracker* parent )
+ : TrackerBase( nameAndLocation, ctx, parent )
+ {
+ if( parent ) {
+ while( !parent->isSectionTracker() )
+ parent = &parent->parent();
+
+ SectionTracker& parentSection = static_cast<SectionTracker&>( *parent );
+ addNextFilters( parentSection.m_filters );
+ }
+ }
+
+ bool SectionTracker::isComplete() const {
+ bool complete = true;
+
+ if ((m_filters.empty() || m_filters[0] == "") ||
+ std::find(m_filters.begin(), m_filters.end(),
+ m_nameAndLocation.name) != m_filters.end())
+ complete = TrackerBase::isComplete();
+ return complete;
+
+ }
+
+ bool SectionTracker::isSectionTracker() const { return true; }
+
+ SectionTracker& SectionTracker::acquire( TrackerContext& ctx, NameAndLocation const& nameAndLocation ) {
+ std::shared_ptr<SectionTracker> section;
+
+ ITracker& currentTracker = ctx.currentTracker();
+ if( ITrackerPtr childTracker = currentTracker.findChild( nameAndLocation ) ) {
+ assert( childTracker );
+ assert( childTracker->isSectionTracker() );
+ section = std::static_pointer_cast<SectionTracker>( childTracker );
+ }
+ else {
+ section = std::make_shared<SectionTracker>( nameAndLocation, ctx, ¤tTracker );
+ currentTracker.addChild( section );
+ }
+ if( !ctx.completedCycle() )
+ section->tryOpen();
+ return *section;
+ }
+
+ void SectionTracker::tryOpen() {
+ if( !isComplete() && (m_filters.empty() || m_filters[0].empty() || m_filters[0] == m_nameAndLocation.name ) )
+ open();
+ }
+
+ void SectionTracker::addInitialFilters( std::vector<std::string> const& filters ) {
+ if( !filters.empty() ) {
+ m_filters.push_back(""); // Root - should never be consulted
+ m_filters.push_back(""); // Test Case - not a section filter
+ m_filters.insert( m_filters.end(), filters.begin(), filters.end() );
+ }
+ }
+ void SectionTracker::addNextFilters( std::vector<std::string> const& filters ) {
+ if( filters.size() > 1 )
+ m_filters.insert( m_filters.end(), ++filters.begin(), filters.end() );
+ }
+
+} // namespace TestCaseTracking
+
+using TestCaseTracking::ITracker;
+using TestCaseTracking::TrackerContext;
+using TestCaseTracking::SectionTracker;
+
+} // namespace Catch
+
+#if defined(__clang__)
+# pragma clang diagnostic pop
+#endif
+// end catch_test_case_tracker.cpp
+// start catch_test_registry.cpp
+
+namespace Catch {
+
+ auto makeTestInvoker( void(*testAsFunction)() ) noexcept -> ITestInvoker* {
+ return new(std::nothrow) TestInvokerAsFunction( testAsFunction );
+ }
+
+ NameAndTags::NameAndTags( StringRef const& name_ , StringRef const& tags_ ) noexcept : name( name_ ), tags( tags_ ) {}
+
+ AutoReg::AutoReg( ITestInvoker* invoker, SourceLineInfo const& lineInfo, StringRef const& classOrMethod, NameAndTags const& nameAndTags ) noexcept {
+ CATCH_TRY {
+ getMutableRegistryHub()
+ .registerTest(
+ makeTestCase(
+ invoker,
+ extractClassName( classOrMethod ),
+ nameAndTags,
+ lineInfo));
+ } CATCH_CATCH_ALL {
+ // Do not throw when constructing global objects, instead register the exception to be processed later
+ getMutableRegistryHub().registerStartupException();
+ }
+ }
+
+ AutoReg::~AutoReg() = default;
+}
+// end catch_test_registry.cpp
+// start catch_test_spec.cpp
+
+#include <algorithm>
+#include <string>
+#include <vector>
+#include <memory>
+
+namespace Catch {
+
+ TestSpec::Pattern::~Pattern() = default;
+ TestSpec::NamePattern::~NamePattern() = default;
+ TestSpec::TagPattern::~TagPattern() = default;
+ TestSpec::ExcludedPattern::~ExcludedPattern() = default;
+
+ TestSpec::NamePattern::NamePattern( std::string const& name )
+ : m_wildcardPattern( toLower( name ), CaseSensitive::No )
+ {}
+ bool TestSpec::NamePattern::matches( TestCaseInfo const& testCase ) const {
+ return m_wildcardPattern.matches( toLower( testCase.name ) );
+ }
+
+ TestSpec::TagPattern::TagPattern( std::string const& tag ) : m_tag( toLower( tag ) ) {}
+ bool TestSpec::TagPattern::matches( TestCaseInfo const& testCase ) const {
+ return std::find(begin(testCase.lcaseTags),
+ end(testCase.lcaseTags),
+ m_tag) != end(testCase.lcaseTags);
+ }
+
+ TestSpec::ExcludedPattern::ExcludedPattern( PatternPtr const& underlyingPattern ) : m_underlyingPattern( underlyingPattern ) {}
+ bool TestSpec::ExcludedPattern::matches( TestCaseInfo const& testCase ) const { return !m_underlyingPattern->matches( testCase ); }
+
+ bool TestSpec::Filter::matches( TestCaseInfo const& testCase ) const {
+ // All patterns in a filter must match for the filter to be a match
+ for( auto const& pattern : m_patterns ) {
+ if( !pattern->matches( testCase ) )
+ return false;
+ }
+ return true;
+ }
+
+ bool TestSpec::hasFilters() const {
+ return !m_filters.empty();
+ }
+ bool TestSpec::matches( TestCaseInfo const& testCase ) const {
+ // A TestSpec matches if any filter matches
+ for( auto const& filter : m_filters )
+ if( filter.matches( testCase ) )
+ return true;
+ return false;
+ }
+}
+// end catch_test_spec.cpp
+// start catch_test_spec_parser.cpp
+
+namespace Catch {
+
+ TestSpecParser::TestSpecParser( ITagAliasRegistry const& tagAliases ) : m_tagAliases( &tagAliases ) {}
+
+ TestSpecParser& TestSpecParser::parse( std::string const& arg ) {
+ m_mode = None;
+ m_exclusion = false;
+ m_start = std::string::npos;
+ m_arg = m_tagAliases->expandAliases( arg );
+ m_escapeChars.clear();
+ for( m_pos = 0; m_pos < m_arg.size(); ++m_pos )
+ visitChar( m_arg[m_pos] );
+ if( m_mode == Name )
+ addPattern<TestSpec::NamePattern>();
+ return *this;
+ }
+ TestSpec TestSpecParser::testSpec() {
+ addFilter();
+ return m_testSpec;
+ }
+
+ void TestSpecParser::visitChar( char c ) {
+ if( m_mode == None ) {
+ switch( c ) {
+ case ' ': return;
+ case '~': m_exclusion = true; return;
+ case '[': return startNewMode( Tag, ++m_pos );
+ case '"': return startNewMode( QuotedName, ++m_pos );
+ case '\\': return escape();
+ default: startNewMode( Name, m_pos ); break;
+ }
+ }
+ if( m_mode == Name ) {
+ if( c == ',' ) {
+ addPattern<TestSpec::NamePattern>();
+ addFilter();
+ }
+ else if( c == '[' ) {
+ if( subString() == "exclude:" )
+ m_exclusion = true;
+ else
+ addPattern<TestSpec::NamePattern>();
+ startNewMode( Tag, ++m_pos );
+ }
+ else if( c == '\\' )
+ escape();
+ }
+ else if( m_mode == EscapedName )
+ m_mode = Name;
+ else if( m_mode == QuotedName && c == '"' )
+ addPattern<TestSpec::NamePattern>();
+ else if( m_mode == Tag && c == ']' )
+ addPattern<TestSpec::TagPattern>();
+ }
+ void TestSpecParser::startNewMode( Mode mode, std::size_t start ) {
+ m_mode = mode;
+ m_start = start;
+ }
+ void TestSpecParser::escape() {
+ if( m_mode == None )
+ m_start = m_pos;
+ m_mode = EscapedName;
+ m_escapeChars.push_back( m_pos );
+ }
+ std::string TestSpecParser::subString() const { return m_arg.substr( m_start, m_pos - m_start ); }
+
+ void TestSpecParser::addFilter() {
+ if( !m_currentFilter.m_patterns.empty() ) {
+ m_testSpec.m_filters.push_back( m_currentFilter );
+ m_currentFilter = TestSpec::Filter();
+ }
+ }
+
+ TestSpec parseTestSpec( std::string const& arg ) {
+ return TestSpecParser( ITagAliasRegistry::get() ).parse( arg ).testSpec();
+ }
+
+} // namespace Catch
+// end catch_test_spec_parser.cpp
+// start catch_timer.cpp
+
+#include <chrono>
+
+static const uint64_t nanosecondsInSecond = 1000000000;
+
+namespace Catch {
+
+ auto getCurrentNanosecondsSinceEpoch() -> uint64_t {
+ return std::chrono::duration_cast<std::chrono::nanoseconds>( std::chrono::high_resolution_clock::now().time_since_epoch() ).count();
+ }
+
+ namespace {
+ auto estimateClockResolution() -> uint64_t {
+ uint64_t sum = 0;
+ static const uint64_t iterations = 1000000;
+
+ auto startTime = getCurrentNanosecondsSinceEpoch();
+
+ for( std::size_t i = 0; i < iterations; ++i ) {
+
+ uint64_t ticks;
+ uint64_t baseTicks = getCurrentNanosecondsSinceEpoch();
+ do {
+ ticks = getCurrentNanosecondsSinceEpoch();
+ } while( ticks == baseTicks );
+
+ auto delta = ticks - baseTicks;
+ sum += delta;
+
+ // If we have been calibrating for over 3 seconds -- the clock
+ // is terrible and we should move on.
+ // TBD: How to signal that the measured resolution is probably wrong?
+ if (ticks > startTime + 3 * nanosecondsInSecond) {
+ return sum / ( i + 1u );
+ }
+ }
+
+ // We're just taking the mean, here. To do better we could take the std. dev and exclude outliers
+ // - and potentially do more iterations if there's a high variance.
+ return sum/iterations;
+ }
+ }
+ auto getEstimatedClockResolution() -> uint64_t {
+ static auto s_resolution = estimateClockResolution();
+ return s_resolution;
+ }
+
+ void Timer::start() {
+ m_nanoseconds = getCurrentNanosecondsSinceEpoch();
+ }
+ auto Timer::getElapsedNanoseconds() const -> uint64_t {
+ return getCurrentNanosecondsSinceEpoch() - m_nanoseconds;
+ }
+ auto Timer::getElapsedMicroseconds() const -> uint64_t {
+ return getElapsedNanoseconds()/1000;
+ }
+ auto Timer::getElapsedMilliseconds() const -> unsigned int {
+ return static_cast<unsigned int>(getElapsedMicroseconds()/1000);
+ }
+ auto Timer::getElapsedSeconds() const -> double {
+ return getElapsedMicroseconds()/1000000.0;
+ }
+
+} // namespace Catch
+// end catch_timer.cpp
+// start catch_tostring.cpp
+
+#if defined(__clang__)
+# pragma clang diagnostic push
+# pragma clang diagnostic ignored "-Wexit-time-destructors"
+# pragma clang diagnostic ignored "-Wglobal-constructors"
+#endif
+
+// Enable specific decls locally
+#if !defined(CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER)
+#define CATCH_CONFIG_ENABLE_CHRONO_STRINGMAKER
+#endif
+
+#include <cmath>
+#include <iomanip>
+
+namespace Catch {
+
+namespace Detail {
+
+ const std::string unprintableString = "{?}";
+
+ namespace {
+ const int hexThreshold = 255;
+
+ struct Endianness {
+ enum Arch { Big, Little };
+
+ static Arch which() {
+ union _{
+ int asInt;
+ char asChar[sizeof (int)];
+ } u;
+
+ u.asInt = 1;
+ return ( u.asChar[sizeof(int)-1] == 1 ) ? Big : Little;
+ }
+ };
+ }
+
+ std::string rawMemoryToString( const void *object, std::size_t size ) {
+ // Reverse order for little endian architectures
+ int i = 0, end = static_cast<int>( size ), inc = 1;
+ if( Endianness::which() == Endianness::Little ) {
+ i = end-1;
+ end = inc = -1;
+ }
+
+ unsigned char const *bytes = static_cast<unsigned char const *>(object);
+ ReusableStringStream rss;
+ rss << "0x" << std::setfill('0') << std::hex;
+ for( ; i != end; i += inc )
+ rss << std::setw(2) << static_cast<unsigned>(bytes[i]);
+ return rss.str();
+ }
+}
+
+template<typename T>
+std::string fpToString( T value, int precision ) {
+ if (Catch::isnan(value)) {
+ return "nan";
+ }
+
+ ReusableStringStream rss;
+ rss << std::setprecision( precision )
+ << std::fixed
+ << value;
+ std::string d = rss.str();
+ std::size_t i = d.find_last_not_of( '0' );
+ if( i != std::string::npos && i != d.size()-1 ) {
+ if( d[i] == '.' )
+ i++;
+ d = d.substr( 0, i+1 );
+ }
+ return d;
+}
+
+//// ======================================================= ////
+//
+// Out-of-line defs for full specialization of StringMaker
+//
+//// ======================================================= ////
+
+std::string StringMaker<std::string>::convert(const std::string& str) {
+ if (!getCurrentContext().getConfig()->showInvisibles()) {
+ return '"' + str + '"';
+ }
+
+ std::string s("\"");
+ for (char c : str) {
+ switch (c) {
+ case '\n':
+ s.append("\\n");
+ break;
+ case '\t':
+ s.append("\\t");
+ break;
+ default:
+ s.push_back(c);
+ break;
+ }
+ }
+ s.append("\"");
+ return s;
+}
+
+#ifdef CATCH_CONFIG_CPP17_STRING_VIEW
+std::string StringMaker<std::string_view>::convert(std::string_view str) {
+ return ::Catch::Detail::stringify(std::string{ str });
+}
+#endif
+
+std::string StringMaker<char const*>::convert(char const* str) {
+ if (str) {
+ return ::Catch::Detail::stringify(std::string{ str });
+ } else {
+ return{ "{null string}" };
+ }
+}
+std::string StringMaker<char*>::convert(char* str) {
+ if (str) {
+ return ::Catch::Detail::stringify(std::string{ str });
+ } else {
+ return{ "{null string}" };
+ }
+}
+
+#ifdef CATCH_CONFIG_WCHAR
+std::string StringMaker<std::wstring>::convert(const std::wstring& wstr) {
+ std::string s;
+ s.reserve(wstr.size());
+ for (auto c : wstr) {
+ s += (c <= 0xff) ? static_cast<char>(c) : '?';
+ }
+ return ::Catch::Detail::stringify(s);
+}
+
+# ifdef CATCH_CONFIG_CPP17_STRING_VIEW
+std::string StringMaker<std::wstring_view>::convert(std::wstring_view str) {
+ return StringMaker<std::wstring>::convert(std::wstring(str));
+}
+# endif
+
+std::string StringMaker<wchar_t const*>::convert(wchar_t const * str) {
+ if (str) {
+ return ::Catch::Detail::stringify(std::wstring{ str });
+ } else {
+ return{ "{null string}" };
+ }
+}
+std::string StringMaker<wchar_t *>::convert(wchar_t * str) {
+ if (str) {
+ return ::Catch::Detail::stringify(std::wstring{ str });
+ } else {
+ return{ "{null string}" };
+ }
+}
+#endif
+
+std::string StringMaker<int>::convert(int value) {
+ return ::Catch::Detail::stringify(static_cast<long long>(value));
+}
+std::string StringMaker<long>::convert(long value) {
+ return ::Catch::Detail::stringify(static_cast<long long>(value));
+}
+std::string StringMaker<long long>::convert(long long value) {
+ ReusableStringStream rss;
+ rss << value;
+ if (value > Detail::hexThreshold) {
+ rss << " (0x" << std::hex << value << ')';
+ }
+ return rss.str();
+}
+
+std::string StringMaker<unsigned int>::convert(unsigned int value) {
+ return ::Catch::Detail::stringify(static_cast<unsigned long long>(value));
+}
+std::string StringMaker<unsigned long>::convert(unsigned long value) {
+ return ::Catch::Detail::stringify(static_cast<unsigned long long>(value));
+}
+std::string StringMaker<unsigned long long>::convert(unsigned long long value) {
+ ReusableStringStream rss;
+ rss << value;
+ if (value > Detail::hexThreshold) {
+ rss << " (0x" << std::hex << value << ')';
+ }
+ return rss.str();
+}
+
+std::string StringMaker<bool>::convert(bool b) {
+ return b ? "true" : "false";
+}
+
+std::string StringMaker<signed char>::convert(signed char value) {
+ if (value == '\r') {
+ return "'\\r'";
+ } else if (value == '\f') {
+ return "'\\f'";
+ } else if (value == '\n') {
+ return "'\\n'";
+ } else if (value == '\t') {
+ return "'\\t'";
+ } else if ('\0' <= value && value < ' ') {
+ return ::Catch::Detail::stringify(static_cast<unsigned int>(value));
+ } else {
+ char chstr[] = "' '";
+ chstr[1] = value;
+ return chstr;
+ }
+}
+std::string StringMaker<char>::convert(char c) {
+ return ::Catch::Detail::stringify(static_cast<signed char>(c));
+}
+std::string StringMaker<unsigned char>::convert(unsigned char c) {
+ return ::Catch::Detail::stringify(static_cast<char>(c));
+}
+
+std::string StringMaker<std::nullptr_t>::convert(std::nullptr_t) {
+ return "nullptr";
+}
+
+int StringMaker<float>::precision = 5;
+
+std::string StringMaker<float>::convert(float value) {
+ return fpToString(value, precision) + 'f';
+}
+
+int StringMaker<double>::precision = 10;
+
+std::string StringMaker<double>::convert(double value) {
+ return fpToString(value, precision);
+}
+
+std::string ratio_string<std::atto>::symbol() { return "a"; }
+std::string ratio_string<std::femto>::symbol() { return "f"; }
+std::string ratio_string<std::pico>::symbol() { return "p"; }
+std::string ratio_string<std::nano>::symbol() { return "n"; }
+std::string ratio_string<std::micro>::symbol() { return "u"; }
+std::string ratio_string<std::milli>::symbol() { return "m"; }
+
+} // end namespace Catch
+
+#if defined(__clang__)
+# pragma clang diagnostic pop
+#endif
+
+// end catch_tostring.cpp
+// start catch_totals.cpp
+
+namespace Catch {
+
+ Counts Counts::operator - ( Counts const& other ) const {
+ Counts diff;
+ diff.passed = passed - other.passed;
+ diff.failed = failed - other.failed;
+ diff.failedButOk = failedButOk - other.failedButOk;
+ return diff;
+ }
+
+ Counts& Counts::operator += ( Counts const& other ) {
+ passed += other.passed;
+ failed += other.failed;
+ failedButOk += other.failedButOk;
+ return *this;
+ }
+
+ std::size_t Counts::total() const {
+ return passed + failed + failedButOk;
+ }
+ bool Counts::allPassed() const {
+ return failed == 0 && failedButOk == 0;
+ }
+ bool Counts::allOk() const {
+ return failed == 0;
+ }
+
+ Totals Totals::operator - ( Totals const& other ) const {
+ Totals diff;
+ diff.assertions = assertions - other.assertions;
+ diff.testCases = testCases - other.testCases;
+ return diff;
+ }
+
+ Totals& Totals::operator += ( Totals const& other ) {
+ assertions += other.assertions;
+ testCases += other.testCases;
+ return *this;
+ }
+
+ Totals Totals::delta( Totals const& prevTotals ) const {
+ Totals diff = *this - prevTotals;
+ if( diff.assertions.failed > 0 )
+ ++diff.testCases.failed;
+ else if( diff.assertions.failedButOk > 0 )
+ ++diff.testCases.failedButOk;
+ else
+ ++diff.testCases.passed;
+ return diff;
+ }
+
+}
+// end catch_totals.cpp
+// start catch_uncaught_exceptions.cpp
+
+#include <exception>
+
+namespace Catch {
+ bool uncaught_exceptions() {
+#if defined(CATCH_CONFIG_CPP17_UNCAUGHT_EXCEPTIONS)
+ return std::uncaught_exceptions() > 0;
+#else
+ return std::uncaught_exception();
+#endif
+ }
+} // end namespace Catch
+// end catch_uncaught_exceptions.cpp
+// start catch_version.cpp
+
+#include <ostream>
+
+namespace Catch {
+
+ Version::Version
+ ( unsigned int _majorVersion,
+ unsigned int _minorVersion,
+ unsigned int _patchNumber,
+ char const * const _branchName,
+ unsigned int _buildNumber )
+ : majorVersion( _majorVersion ),
+ minorVersion( _minorVersion ),
+ patchNumber( _patchNumber ),
+ branchName( _branchName ),
+ buildNumber( _buildNumber )
+ {}
+
+ std::ostream& operator << ( std::ostream& os, Version const& version ) {
+ os << version.majorVersion << '.'
+ << version.minorVersion << '.'
+ << version.patchNumber;
+ // branchName is never null -> 0th char is \0 if it is empty
+ if (version.branchName[0]) {
+ os << '-' << version.branchName
+ << '.' << version.buildNumber;
+ }
+ return os;
+ }
+
+ Version const& libraryVersion() {
+ static Version version( 2, 8, 0, "", 0 );
+ return version;
+ }
+
+}
+// end catch_version.cpp
+// start catch_wildcard_pattern.cpp
+
+#include <sstream>
+
+namespace Catch {
+
+ WildcardPattern::WildcardPattern( std::string const& pattern,
+ CaseSensitive::Choice caseSensitivity )
+ : m_caseSensitivity( caseSensitivity ),
+ m_pattern( adjustCase( pattern ) )
+ {
+ if( startsWith( m_pattern, '*' ) ) {
+ m_pattern = m_pattern.substr( 1 );
+ m_wildcard = WildcardAtStart;
+ }
+ if( endsWith( m_pattern, '*' ) ) {
+ m_pattern = m_pattern.substr( 0, m_pattern.size()-1 );
+ m_wildcard = static_cast<WildcardPosition>( m_wildcard | WildcardAtEnd );
+ }
+ }
+
+ bool WildcardPattern::matches( std::string const& str ) const {
+ switch( m_wildcard ) {
+ case NoWildcard:
+ return m_pattern == adjustCase( str );
+ case WildcardAtStart:
+ return endsWith( adjustCase( str ), m_pattern );
+ case WildcardAtEnd:
+ return startsWith( adjustCase( str ), m_pattern );
+ case WildcardAtBothEnds:
+ return contains( adjustCase( str ), m_pattern );
+ default:
+ CATCH_INTERNAL_ERROR( "Unknown enum" );
+ }
+ }
+
+ std::string WildcardPattern::adjustCase( std::string const& str ) const {
+ return m_caseSensitivity == CaseSensitive::No ? toLower( str ) : str;
+ }
+}
+// end catch_wildcard_pattern.cpp
+// start catch_xmlwriter.cpp
+
+#include <iomanip>
+
+using uchar = unsigned char;
+
+namespace Catch {
+
+namespace {
+
+ size_t trailingBytes(unsigned char c) {
+ if ((c & 0xE0) == 0xC0) {
+ return 2;
+ }
+ if ((c & 0xF0) == 0xE0) {
+ return 3;
+ }
+ if ((c & 0xF8) == 0xF0) {
+ return 4;
+ }
+ CATCH_INTERNAL_ERROR("Invalid multibyte utf-8 start byte encountered");
+ }
+
+ uint32_t headerValue(unsigned char c) {
+ if ((c & 0xE0) == 0xC0) {
+ return c & 0x1F;
+ }
+ if ((c & 0xF0) == 0xE0) {
+ return c & 0x0F;
+ }
+ if ((c & 0xF8) == 0xF0) {
+ return c & 0x07;
+ }
+ CATCH_INTERNAL_ERROR("Invalid multibyte utf-8 start byte encountered");
+ }
+
+ void hexEscapeChar(std::ostream& os, unsigned char c) {
+ std::ios_base::fmtflags f(os.flags());
+ os << "\\x"
+ << std::uppercase << std::hex << std::setfill('0') << std::setw(2)
+ << static_cast<int>(c);
+ os.flags(f);
+ }
+
+} // anonymous namespace
+
+ XmlEncode::XmlEncode( std::string const& str, ForWhat forWhat )
+ : m_str( str ),
+ m_forWhat( forWhat )
+ {}
+
+ void XmlEncode::encodeTo( std::ostream& os ) const {
+ // Apostrophe escaping not necessary if we always use " to write attributes
+ // (see: http://www.w3.org/TR/xml/#syntax)
+
+ for( std::size_t idx = 0; idx < m_str.size(); ++ idx ) {
+ uchar c = m_str[idx];
+ switch (c) {
+ case '<': os << "<"; break;
+ case '&': os << "&"; break;
+
+ case '>':
+ // See: http://www.w3.org/TR/xml/#syntax
+ if (idx > 2 && m_str[idx - 1] == ']' && m_str[idx - 2] == ']')
+ os << ">";
+ else
+ os << c;
+ break;
+
+ case '\"':
+ if (m_forWhat == ForAttributes)
+ os << """;
+ else
+ os << c;
+ break;
+
+ default:
+ // Check for control characters and invalid utf-8
+
+ // Escape control characters in standard ascii
+ // see http://stackoverflow.com/questions/404107/why-are-control-characters-illegal-in-xml-1-0
+ if (c < 0x09 || (c > 0x0D && c < 0x20) || c == 0x7F) {
+ hexEscapeChar(os, c);
+ break;
+ }
+
+ // Plain ASCII: Write it to stream
+ if (c < 0x7F) {
+ os << c;
+ break;
+ }
+
+ // UTF-8 territory
+ // Check if the encoding is valid and if it is not, hex escape bytes.
+ // Important: We do not check the exact decoded values for validity, only the encoding format
+ // First check that this bytes is a valid lead byte:
+ // This means that it is not encoded as 1111 1XXX
+ // Or as 10XX XXXX
+ if (c < 0xC0 ||
+ c >= 0xF8) {
+ hexEscapeChar(os, c);
+ break;
+ }
+
+ auto encBytes = trailingBytes(c);
+ // Are there enough bytes left to avoid accessing out-of-bounds memory?
+ if (idx + encBytes - 1 >= m_str.size()) {
+ hexEscapeChar(os, c);
+ break;
+ }
+ // The header is valid, check data
+ // The next encBytes bytes must together be a valid utf-8
+ // This means: bitpattern 10XX XXXX and the extracted value is sane (ish)
+ bool valid = true;
+ uint32_t value = headerValue(c);
+ for (std::size_t n = 1; n < encBytes; ++n) {
+ uchar nc = m_str[idx + n];
+ valid &= ((nc & 0xC0) == 0x80);
+ value = (value << 6) | (nc & 0x3F);
+ }
+
+ if (
+ // Wrong bit pattern of following bytes
+ (!valid) ||
+ // Overlong encodings
+ (value < 0x80) ||
+ (0x80 <= value && value < 0x800 && encBytes > 2) ||
+ (0x800 < value && value < 0x10000 && encBytes > 3) ||
+ // Encoded value out of range
+ (value >= 0x110000)
+ ) {
+ hexEscapeChar(os, c);
+ break;
+ }
+
+ // If we got here, this is in fact a valid(ish) utf-8 sequence
+ for (std::size_t n = 0; n < encBytes; ++n) {
+ os << m_str[idx + n];
+ }
+ idx += encBytes - 1;
+ break;
+ }
+ }
+ }
+
+ std::ostream& operator << ( std::ostream& os, XmlEncode const& xmlEncode ) {
+ xmlEncode.encodeTo( os );
+ return os;
+ }
+
+ XmlWriter::ScopedElement::ScopedElement( XmlWriter* writer )
+ : m_writer( writer )
+ {}
+
+ XmlWriter::ScopedElement::ScopedElement( ScopedElement&& other ) noexcept
+ : m_writer( other.m_writer ){
+ other.m_writer = nullptr;
+ }
+ XmlWriter::ScopedElement& XmlWriter::ScopedElement::operator=( ScopedElement&& other ) noexcept {
+ if ( m_writer ) {
+ m_writer->endElement();
+ }
+ m_writer = other.m_writer;
+ other.m_writer = nullptr;
+ return *this;
+ }
+
+ XmlWriter::ScopedElement::~ScopedElement() {
+ if( m_writer )
+ m_writer->endElement();
+ }
+
+ XmlWriter::ScopedElement& XmlWriter::ScopedElement::writeText( std::string const& text, bool indent ) {
+ m_writer->writeText( text, indent );
+ return *this;
+ }
+
+ XmlWriter::XmlWriter( std::ostream& os ) : m_os( os )
+ {
+ writeDeclaration();
+ }
+
+ XmlWriter::~XmlWriter() {
+ while( !m_tags.empty() )
+ endElement();
+ }
+
+ XmlWriter& XmlWriter::startElement( std::string const& name ) {
+ ensureTagClosed();
+ newlineIfNecessary();
+ m_os << m_indent << '<' << name;
+ m_tags.push_back( name );
+ m_indent += " ";
+ m_tagIsOpen = true;
+ return *this;
+ }
+
+ XmlWriter::ScopedElement XmlWriter::scopedElement( std::string const& name ) {
+ ScopedElement scoped( this );
+ startElement( name );
+ return scoped;
+ }
+
+ XmlWriter& XmlWriter::endElement() {
+ newlineIfNecessary();
+ m_indent = m_indent.substr( 0, m_indent.size()-2 );
+ if( m_tagIsOpen ) {
+ m_os << "/>";
+ m_tagIsOpen = false;
+ }
+ else {
+ m_os << m_indent << "</" << m_tags.back() << ">";
+ }
+ m_os << std::endl;
+ m_tags.pop_back();
+ return *this;
+ }
+
+ XmlWriter& XmlWriter::writeAttribute( std::string const& name, std::string const& attribute ) {
+ if( !name.empty() && !attribute.empty() )
+ m_os << ' ' << name << "=\"" << XmlEncode( attribute, XmlEncode::ForAttributes ) << '"';
+ return *this;
+ }
+
+ XmlWriter& XmlWriter::writeAttribute( std::string const& name, bool attribute ) {
+ m_os << ' ' << name << "=\"" << ( attribute ? "true" : "false" ) << '"';
+ return *this;
+ }
+
+ XmlWriter& XmlWriter::writeText( std::string const& text, bool indent ) {
+ if( !text.empty() ){
+ bool tagWasOpen = m_tagIsOpen;
+ ensureTagClosed();
+ if( tagWasOpen && indent )
+ m_os << m_indent;
+ m_os << XmlEncode( text );
+ m_needsNewline = true;
+ }
+ return *this;
+ }
+
+ XmlWriter& XmlWriter::writeComment( std::string const& text ) {
+ ensureTagClosed();
+ m_os << m_indent << "<!--" << text << "-->";
+ m_needsNewline = true;
+ return *this;
+ }
+
+ void XmlWriter::writeStylesheetRef( std::string const& url ) {
+ m_os << "<?xml-stylesheet type=\"text/xsl\" href=\"" << url << "\"?>\n";
+ }
+
+ XmlWriter& XmlWriter::writeBlankLine() {
+ ensureTagClosed();
+ m_os << '\n';
+ return *this;
+ }
+
+ void XmlWriter::ensureTagClosed() {
+ if( m_tagIsOpen ) {
+ m_os << ">" << std::endl;
+ m_tagIsOpen = false;
+ }
+ }
+
+ void XmlWriter::writeDeclaration() {
+ m_os << "<?xml version=\"1.0\" encoding=\"UTF-8\"?>\n";
+ }
+
+ void XmlWriter::newlineIfNecessary() {
+ if( m_needsNewline ) {
+ m_os << std::endl;
+ m_needsNewline = false;
+ }
+ }
+}
+// end catch_xmlwriter.cpp
+// start catch_reporter_bases.cpp
+
+#include <cstring>
+#include <cfloat>
+#include <cstdio>
+#include <cassert>
+#include <memory>
+
+namespace Catch {
+ void prepareExpandedExpression(AssertionResult& result) {
+ result.getExpandedExpression();
+ }
+
+ // Because formatting using c++ streams is stateful, drop down to C is required
+ // Alternatively we could use stringstream, but its performance is... not good.
+ std::string getFormattedDuration( double duration ) {
+ // Max exponent + 1 is required to represent the whole part
+ // + 1 for decimal point
+ // + 3 for the 3 decimal places
+ // + 1 for null terminator
+ const std::size_t maxDoubleSize = DBL_MAX_10_EXP + 1 + 1 + 3 + 1;
+ char buffer[maxDoubleSize];
+
+ // Save previous errno, to prevent sprintf from overwriting it
+ ErrnoGuard guard;
+#ifdef _MSC_VER
+ sprintf_s(buffer, "%.3f", duration);
+#else
+ std::sprintf(buffer, "%.3f", duration);
+#endif
+ return std::string(buffer);
+ }
+
+ std::string serializeFilters( std::vector<std::string> const& container ) {
+ ReusableStringStream oss;
+ bool first = true;
+ for (auto&& filter : container)
+ {
+ if (!first)
+ oss << ' ';
+ else
+ first = false;
+
+ oss << filter;
+ }
+ return oss.str();
+ }
+
+ TestEventListenerBase::TestEventListenerBase(ReporterConfig const & _config)
+ :StreamingReporterBase(_config) {}
+
+ std::set<Verbosity> TestEventListenerBase::getSupportedVerbosities() {
+ return { Verbosity::Quiet, Verbosity::Normal, Verbosity::High };
+ }
+
+ void TestEventListenerBase::assertionStarting(AssertionInfo const &) {}
+
+ bool TestEventListenerBase::assertionEnded(AssertionStats const &) {
+ return false;
+ }
+
+} // end namespace Catch
+// end catch_reporter_bases.cpp
+// start catch_reporter_compact.cpp
+
+namespace {
+
+#ifdef CATCH_PLATFORM_MAC
+ const char* failedString() { return "FAILED"; }
+ const char* passedString() { return "PASSED"; }
+#else
+ const char* failedString() { return "failed"; }
+ const char* passedString() { return "passed"; }
+#endif
+
+ // Colour::LightGrey
+ Catch::Colour::Code dimColour() { return Catch::Colour::FileName; }
+
+ std::string bothOrAll( std::size_t count ) {
+ return count == 1 ? std::string() :
+ count == 2 ? "both " : "all " ;
+ }
+
+} // anon namespace
+
+namespace Catch {
+namespace {
+// Colour, message variants:
+// - white: No tests ran.
+// - red: Failed [both/all] N test cases, failed [both/all] M assertions.
+// - white: Passed [both/all] N test cases (no assertions).
+// - red: Failed N tests cases, failed M assertions.
+// - green: Passed [both/all] N tests cases with M assertions.
+void printTotals(std::ostream& out, const Totals& totals) {
+ if (totals.testCases.total() == 0) {
+ out << "No tests ran.";
+ } else if (totals.testCases.failed == totals.testCases.total()) {
+ Colour colour(Colour::ResultError);
+ const std::string qualify_assertions_failed =
+ totals.assertions.failed == totals.assertions.total() ?
+ bothOrAll(totals.assertions.failed) : std::string();
+ out <<
+ "Failed " << bothOrAll(totals.testCases.failed)
+ << pluralise(totals.testCases.failed, "test case") << ", "
+ "failed " << qualify_assertions_failed <<
+ pluralise(totals.assertions.failed, "assertion") << '.';
+ } else if (totals.assertions.total() == 0) {
+ out <<
+ "Passed " << bothOrAll(totals.testCases.total())
+ << pluralise(totals.testCases.total(), "test case")
+ << " (no assertions).";
+ } else if (totals.assertions.failed) {
+ Colour colour(Colour::ResultError);
+ out <<
+ "Failed " << pluralise(totals.testCases.failed, "test case") << ", "
+ "failed " << pluralise(totals.assertions.failed, "assertion") << '.';
+ } else {
+ Colour colour(Colour::ResultSuccess);
+ out <<
+ "Passed " << bothOrAll(totals.testCases.passed)
+ << pluralise(totals.testCases.passed, "test case") <<
+ " with " << pluralise(totals.assertions.passed, "assertion") << '.';
+ }
+}
+
+// Implementation of CompactReporter formatting
+class AssertionPrinter {
+public:
+ AssertionPrinter& operator= (AssertionPrinter const&) = delete;
+ AssertionPrinter(AssertionPrinter const&) = delete;
+ AssertionPrinter(std::ostream& _stream, AssertionStats const& _stats, bool _printInfoMessages)
+ : stream(_stream)
+ , result(_stats.assertionResult)
+ , messages(_stats.infoMessages)
+ , itMessage(_stats.infoMessages.begin())
+ , printInfoMessages(_printInfoMessages) {}
+
+ void print() {
+ printSourceInfo();
+
+ itMessage = messages.begin();
+
+ switch (result.getResultType()) {
+ case ResultWas::Ok:
+ printResultType(Colour::ResultSuccess, passedString());
+ printOriginalExpression();
+ printReconstructedExpression();
+ if (!result.hasExpression())
+ printRemainingMessages(Colour::None);
+ else
+ printRemainingMessages();
+ break;
+ case ResultWas::ExpressionFailed:
+ if (result.isOk())
+ printResultType(Colour::ResultSuccess, failedString() + std::string(" - but was ok"));
+ else
+ printResultType(Colour::Error, failedString());
+ printOriginalExpression();
+ printReconstructedExpression();
+ printRemainingMessages();
+ break;
+ case ResultWas::ThrewException:
+ printResultType(Colour::Error, failedString());
+ printIssue("unexpected exception with message:");
+ printMessage();
+ printExpressionWas();
+ printRemainingMessages();
+ break;
+ case ResultWas::FatalErrorCondition:
+ printResultType(Colour::Error, failedString());
+ printIssue("fatal error condition with message:");
+ printMessage();
+ printExpressionWas();
+ printRemainingMessages();
+ break;
+ case ResultWas::DidntThrowException:
+ printResultType(Colour::Error, failedString());
+ printIssue("expected exception, got none");
+ printExpressionWas();
+ printRemainingMessages();
+ break;
+ case ResultWas::Info:
+ printResultType(Colour::None, "info");
+ printMessage();
+ printRemainingMessages();
+ break;
+ case ResultWas::Warning:
+ printResultType(Colour::None, "warning");
+ printMessage();
+ printRemainingMessages();
+ break;
+ case ResultWas::ExplicitFailure:
+ printResultType(Colour::Error, failedString());
+ printIssue("explicitly");
+ printRemainingMessages(Colour::None);
+ break;
+ // These cases are here to prevent compiler warnings
+ case ResultWas::Unknown:
+ case ResultWas::FailureBit:
+ case ResultWas::Exception:
+ printResultType(Colour::Error, "** internal error **");
+ break;
+ }
+ }
+
+private:
+ void printSourceInfo() const {
+ Colour colourGuard(Colour::FileName);
+ stream << result.getSourceInfo() << ':';
+ }
+
+ void printResultType(Colour::Code colour, std::string const& passOrFail) const {
+ if (!passOrFail.empty()) {
+ {
+ Colour colourGuard(colour);
+ stream << ' ' << passOrFail;
+ }
+ stream << ':';
+ }
+ }
+
+ void printIssue(std::string const& issue) const {
+ stream << ' ' << issue;
+ }
+
+ void printExpressionWas() {
+ if (result.hasExpression()) {
+ stream << ';';
+ {
+ Colour colour(dimColour());
+ stream << " expression was:";
+ }
+ printOriginalExpression();
+ }
+ }
+
+ void printOriginalExpression() const {
+ if (result.hasExpression()) {
+ stream << ' ' << result.getExpression();
+ }
+ }
+
+ void printReconstructedExpression() const {
+ if (result.hasExpandedExpression()) {
+ {
+ Colour colour(dimColour());
+ stream << " for: ";
+ }
+ stream << result.getExpandedExpression();
+ }
+ }
+
+ void printMessage() {
+ if (itMessage != messages.end()) {
+ stream << " '" << itMessage->message << '\'';
+ ++itMessage;
+ }
+ }
+
+ void printRemainingMessages(Colour::Code colour = dimColour()) {
+ if (itMessage == messages.end())
+ return;
+
+ // using messages.end() directly yields (or auto) compilation error:
+ std::vector<MessageInfo>::const_iterator itEnd = messages.end();
+ const std::size_t N = static_cast<std::size_t>(std::distance(itMessage, itEnd));
+
+ {
+ Colour colourGuard(colour);
+ stream << " with " << pluralise(N, "message") << ':';
+ }
+
+ for (; itMessage != itEnd; ) {
+ // If this assertion is a warning ignore any INFO messages
+ if (printInfoMessages || itMessage->type != ResultWas::Info) {
+ stream << " '" << itMessage->message << '\'';
+ if (++itMessage != itEnd) {
+ Colour colourGuard(dimColour());
+ stream << " and";
+ }
+ }
+ }
+ }
+
+private:
+ std::ostream& stream;
+ AssertionResult const& result;
+ std::vector<MessageInfo> messages;
+ std::vector<MessageInfo>::const_iterator itMessage;
+ bool printInfoMessages;
+};
+
+} // anon namespace
+
+ std::string CompactReporter::getDescription() {
+ return "Reports test results on a single line, suitable for IDEs";
+ }
+
+ ReporterPreferences CompactReporter::getPreferences() const {
+ return m_reporterPrefs;
+ }
+
+ void CompactReporter::noMatchingTestCases( std::string const& spec ) {
+ stream << "No test cases matched '" << spec << '\'' << std::endl;
+ }
+
+ void CompactReporter::assertionStarting( AssertionInfo const& ) {}
+
+ bool CompactReporter::assertionEnded( AssertionStats const& _assertionStats ) {
+ AssertionResult const& result = _assertionStats.assertionResult;
+
+ bool printInfoMessages = true;
+
+ // Drop out if result was successful and we're not printing those
+ if( !m_config->includeSuccessfulResults() && result.isOk() ) {
+ if( result.getResultType() != ResultWas::Warning )
+ return false;
+ printInfoMessages = false;
+ }
+
+ AssertionPrinter printer( stream, _assertionStats, printInfoMessages );
+ printer.print();
+
+ stream << std::endl;
+ return true;
+ }
+
+ void CompactReporter::sectionEnded(SectionStats const& _sectionStats) {
+ if (m_config->showDurations() == ShowDurations::Always) {
+ stream << getFormattedDuration(_sectionStats.durationInSeconds) << " s: " << _sectionStats.sectionInfo.name << std::endl;
+ }
+ }
+
+ void CompactReporter::testRunEnded( TestRunStats const& _testRunStats ) {
+ printTotals( stream, _testRunStats.totals );
+ stream << '\n' << std::endl;
+ StreamingReporterBase::testRunEnded( _testRunStats );
+ }
+
+ CompactReporter::~CompactReporter() {}
+
+ CATCH_REGISTER_REPORTER( "compact", CompactReporter )
+
+} // end namespace Catch
+// end catch_reporter_compact.cpp
+// start catch_reporter_console.cpp
+
+#include <cfloat>
+#include <cstdio>
+
+#if defined(_MSC_VER)
+#pragma warning(push)
+#pragma warning(disable:4061) // Not all labels are EXPLICITLY handled in switch
+ // Note that 4062 (not all labels are handled
+ // and default is missing) is enabled
+#endif
+
+namespace Catch {
+
+namespace {
+
+// Formatter impl for ConsoleReporter
+class ConsoleAssertionPrinter {
+public:
+ ConsoleAssertionPrinter& operator= (ConsoleAssertionPrinter const&) = delete;
+ ConsoleAssertionPrinter(ConsoleAssertionPrinter const&) = delete;
+ ConsoleAssertionPrinter(std::ostream& _stream, AssertionStats const& _stats, bool _printInfoMessages)
+ : stream(_stream),
+ stats(_stats),
+ result(_stats.assertionResult),
+ colour(Colour::None),
+ message(result.getMessage()),
+ messages(_stats.infoMessages),
+ printInfoMessages(_printInfoMessages) {
+ switch (result.getResultType()) {
+ case ResultWas::Ok:
+ colour = Colour::Success;
+ passOrFail = "PASSED";
+ //if( result.hasMessage() )
+ if (_stats.infoMessages.size() == 1)
+ messageLabel = "with message";
+ if (_stats.infoMessages.size() > 1)
+ messageLabel = "with messages";
+ break;
+ case ResultWas::ExpressionFailed:
+ if (result.isOk()) {
+ colour = Colour::Success;
+ passOrFail = "FAILED - but was ok";
+ } else {
+ colour = Colour::Error;
+ passOrFail = "FAILED";
+ }
+ if (_stats.infoMessages.size() == 1)
+ messageLabel = "with message";
+ if (_stats.infoMessages.size() > 1)
+ messageLabel = "with messages";
+ break;
+ case ResultWas::ThrewException:
+ colour = Colour::Error;
+ passOrFail = "FAILED";
+ messageLabel = "due to unexpected exception with ";
+ if (_stats.infoMessages.size() == 1)
+ messageLabel += "message";
+ if (_stats.infoMessages.size() > 1)
+ messageLabel += "messages";
+ break;
+ case ResultWas::FatalErrorCondition:
+ colour = Colour::Error;
+ passOrFail = "FAILED";
+ messageLabel = "due to a fatal error condition";
+ break;
+ case ResultWas::DidntThrowException:
+ colour = Colour::Error;
+ passOrFail = "FAILED";
+ messageLabel = "because no exception was thrown where one was expected";
+ break;
+ case ResultWas::Info:
+ messageLabel = "info";
+ break;
+ case ResultWas::Warning:
+ messageLabel = "warning";
+ break;
+ case ResultWas::ExplicitFailure:
+ passOrFail = "FAILED";
+ colour = Colour::Error;
+ if (_stats.infoMessages.size() == 1)
+ messageLabel = "explicitly with message";
+ if (_stats.infoMessages.size() > 1)
+ messageLabel = "explicitly with messages";
+ break;
+ // These cases are here to prevent compiler warnings
+ case ResultWas::Unknown:
+ case ResultWas::FailureBit:
+ case ResultWas::Exception:
+ passOrFail = "** internal error **";
+ colour = Colour::Error;
+ break;
+ }
+ }
+
+ void print() const {
+ printSourceInfo();
+ if (stats.totals.assertions.total() > 0) {
+ printResultType();
+ printOriginalExpression();
+ printReconstructedExpression();
+ } else {
+ stream << '\n';
+ }
+ printMessage();
+ }
+
+private:
+ void printResultType() const {
+ if (!passOrFail.empty()) {
+ Colour colourGuard(colour);
+ stream << passOrFail << ":\n";
+ }
+ }
+ void printOriginalExpression() const {
+ if (result.hasExpression()) {
+ Colour colourGuard(Colour::OriginalExpression);
+ stream << " ";
+ stream << result.getExpressionInMacro();
+ stream << '\n';
+ }
+ }
+ void printReconstructedExpression() const {
+ if (result.hasExpandedExpression()) {
+ stream << "with expansion:\n";
+ Colour colourGuard(Colour::ReconstructedExpression);
+ stream << Column(result.getExpandedExpression()).indent(2) << '\n';
+ }
+ }
+ void printMessage() const {
+ if (!messageLabel.empty())
+ stream << messageLabel << ':' << '\n';
+ for (auto const& msg : messages) {
+ // If this assertion is a warning ignore any INFO messages
+ if (printInfoMessages || msg.type != ResultWas::Info)
+ stream << Column(msg.message).indent(2) << '\n';
+ }
+ }
+ void printSourceInfo() const {
+ Colour colourGuard(Colour::FileName);
+ stream << result.getSourceInfo() << ": ";
+ }
+
+ std::ostream& stream;
+ AssertionStats const& stats;
+ AssertionResult const& result;
+ Colour::Code colour;
+ std::string passOrFail;
+ std::string messageLabel;
+ std::string message;
+ std::vector<MessageInfo> messages;
+ bool printInfoMessages;
+};
+
+std::size_t makeRatio(std::size_t number, std::size_t total) {
+ std::size_t ratio = total > 0 ? CATCH_CONFIG_CONSOLE_WIDTH * number / total : 0;
+ return (ratio == 0 && number > 0) ? 1 : ratio;
+}
+
+std::size_t& findMax(std::size_t& i, std::size_t& j, std::size_t& k) {
+ if (i > j && i > k)
+ return i;
+ else if (j > k)
+ return j;
+ else
+ return k;
+}
+
+struct ColumnInfo {
+ enum Justification { Left, Right };
+ std::string name;
+ int width;
+ Justification justification;
+};
+struct ColumnBreak {};
+struct RowBreak {};
+
+class Duration {
+ enum class Unit {
+ Auto,
+ Nanoseconds,
+ Microseconds,
+ Milliseconds,
+ Seconds,
+ Minutes
+ };
+ static const uint64_t s_nanosecondsInAMicrosecond = 1000;
+ static const uint64_t s_nanosecondsInAMillisecond = 1000 * s_nanosecondsInAMicrosecond;
+ static const uint64_t s_nanosecondsInASecond = 1000 * s_nanosecondsInAMillisecond;
+ static const uint64_t s_nanosecondsInAMinute = 60 * s_nanosecondsInASecond;
+
+ uint64_t m_inNanoseconds;
+ Unit m_units;
+
+public:
+ explicit Duration(uint64_t inNanoseconds, Unit units = Unit::Auto)
+ : m_inNanoseconds(inNanoseconds),
+ m_units(units) {
+ if (m_units == Unit::Auto) {
+ if (m_inNanoseconds < s_nanosecondsInAMicrosecond)
+ m_units = Unit::Nanoseconds;
+ else if (m_inNanoseconds < s_nanosecondsInAMillisecond)
+ m_units = Unit::Microseconds;
+ else if (m_inNanoseconds < s_nanosecondsInASecond)
+ m_units = Unit::Milliseconds;
+ else if (m_inNanoseconds < s_nanosecondsInAMinute)
+ m_units = Unit::Seconds;
+ else
+ m_units = Unit::Minutes;
+ }
+
+ }
+
+ auto value() const -> double {
+ switch (m_units) {
+ case Unit::Microseconds:
+ return m_inNanoseconds / static_cast<double>(s_nanosecondsInAMicrosecond);
+ case Unit::Milliseconds:
+ return m_inNanoseconds / static_cast<double>(s_nanosecondsInAMillisecond);
+ case Unit::Seconds:
+ return m_inNanoseconds / static_cast<double>(s_nanosecondsInASecond);
+ case Unit::Minutes:
+ return m_inNanoseconds / static_cast<double>(s_nanosecondsInAMinute);
+ default:
+ return static_cast<double>(m_inNanoseconds);
+ }
+ }
+ auto unitsAsString() const -> std::string {
+ switch (m_units) {
+ case Unit::Nanoseconds:
+ return "ns";
+ case Unit::Microseconds:
+ return "us";
+ case Unit::Milliseconds:
+ return "ms";
+ case Unit::Seconds:
+ return "s";
+ case Unit::Minutes:
+ return "m";
+ default:
+ return "** internal error **";
+ }
+
+ }
+ friend auto operator << (std::ostream& os, Duration const& duration) -> std::ostream& {
+ return os << duration.value() << " " << duration.unitsAsString();
+ }
+};
+} // end anon namespace
+
+class TablePrinter {
+ std::ostream& m_os;
+ std::vector<ColumnInfo> m_columnInfos;
+ std::ostringstream m_oss;
+ int m_currentColumn = -1;
+ bool m_isOpen = false;
+
+public:
+ TablePrinter( std::ostream& os, std::vector<ColumnInfo> columnInfos )
+ : m_os( os ),
+ m_columnInfos( std::move( columnInfos ) ) {}
+
+ auto columnInfos() const -> std::vector<ColumnInfo> const& {
+ return m_columnInfos;
+ }
+
+ void open() {
+ if (!m_isOpen) {
+ m_isOpen = true;
+ *this << RowBreak();
+ for (auto const& info : m_columnInfos)
+ *this << info.name << ColumnBreak();
+ *this << RowBreak();
+ m_os << Catch::getLineOfChars<'-'>() << "\n";
+ }
+ }
+ void close() {
+ if (m_isOpen) {
+ *this << RowBreak();
+ m_os << std::endl;
+ m_isOpen = false;
+ }
+ }
+
+ template<typename T>
+ friend TablePrinter& operator << (TablePrinter& tp, T const& value) {
+ tp.m_oss << value;
+ return tp;
+ }
+
+ friend TablePrinter& operator << (TablePrinter& tp, ColumnBreak) {
+ auto colStr = tp.m_oss.str();
+ // This takes account of utf8 encodings
+ auto strSize = Catch::StringRef(colStr).numberOfCharacters();
+ tp.m_oss.str("");
+ tp.open();
+ if (tp.m_currentColumn == static_cast<int>(tp.m_columnInfos.size() - 1)) {
+ tp.m_currentColumn = -1;
+ tp.m_os << "\n";
+ }
+ tp.m_currentColumn++;
+
+ auto colInfo = tp.m_columnInfos[tp.m_currentColumn];
+ auto padding = (strSize + 2 < static_cast<std::size_t>(colInfo.width))
+ ? std::string(colInfo.width - (strSize + 2), ' ')
+ : std::string();
+ if (colInfo.justification == ColumnInfo::Left)
+ tp.m_os << colStr << padding << " ";
+ else
+ tp.m_os << padding << colStr << " ";
+ return tp;
+ }
+
+ friend TablePrinter& operator << (TablePrinter& tp, RowBreak) {
+ if (tp.m_currentColumn > 0) {
+ tp.m_os << "\n";
+ tp.m_currentColumn = -1;
+ }
+ return tp;
+ }
+};
+
+ConsoleReporter::ConsoleReporter(ReporterConfig const& config)
+ : StreamingReporterBase(config),
+ m_tablePrinter(new TablePrinter(config.stream(),
+ {
+ { "benchmark name", CATCH_CONFIG_CONSOLE_WIDTH - 32, ColumnInfo::Left },
+ { "iters", 8, ColumnInfo::Right },
+ { "elapsed ns", 14, ColumnInfo::Right },
+ { "average", 14, ColumnInfo::Right }
+ })) {}
+ConsoleReporter::~ConsoleReporter() = default;
+
+std::string ConsoleReporter::getDescription() {
+ return "Reports test results as plain lines of text";
+}
+
+void ConsoleReporter::noMatchingTestCases(std::string const& spec) {
+ stream << "No test cases matched '" << spec << '\'' << std::endl;
+}
+
+void ConsoleReporter::assertionStarting(AssertionInfo const&) {}
+
+bool ConsoleReporter::assertionEnded(AssertionStats const& _assertionStats) {
+ AssertionResult const& result = _assertionStats.assertionResult;
+
+ bool includeResults = m_config->includeSuccessfulResults() || !result.isOk();
+
+ // Drop out if result was successful but we're not printing them.
+ if (!includeResults && result.getResultType() != ResultWas::Warning)
+ return false;
+
+ lazyPrint();
+
+ ConsoleAssertionPrinter printer(stream, _assertionStats, includeResults);
+ printer.print();
+ stream << std::endl;
+ return true;
+}
+
+void ConsoleReporter::sectionStarting(SectionInfo const& _sectionInfo) {
+ m_headerPrinted = false;
+ StreamingReporterBase::sectionStarting(_sectionInfo);
+}
+void ConsoleReporter::sectionEnded(SectionStats const& _sectionStats) {
+ m_tablePrinter->close();
+ if (_sectionStats.missingAssertions) {
+ lazyPrint();
+ Colour colour(Colour::ResultError);
+ if (m_sectionStack.size() > 1)
+ stream << "\nNo assertions in section";
+ else
+ stream << "\nNo assertions in test case";
+ stream << " '" << _sectionStats.sectionInfo.name << "'\n" << std::endl;
+ }
+ if (m_config->showDurations() == ShowDurations::Always) {
+ stream << getFormattedDuration(_sectionStats.durationInSeconds) << " s: " << _sectionStats.sectionInfo.name << std::endl;
+ }
+ if (m_headerPrinted) {
+ m_headerPrinted = false;
+ }
+ StreamingReporterBase::sectionEnded(_sectionStats);
+}
+
+void ConsoleReporter::benchmarkStarting(BenchmarkInfo const& info) {
+ lazyPrintWithoutClosingBenchmarkTable();
+
+ auto nameCol = Column( info.name ).width( static_cast<std::size_t>( m_tablePrinter->columnInfos()[0].width - 2 ) );
+
+ bool firstLine = true;
+ for (auto line : nameCol) {
+ if (!firstLine)
+ (*m_tablePrinter) << ColumnBreak() << ColumnBreak() << ColumnBreak();
+ else
+ firstLine = false;
+
+ (*m_tablePrinter) << line << ColumnBreak();
+ }
+}
+void ConsoleReporter::benchmarkEnded(BenchmarkStats const& stats) {
+ Duration average(stats.elapsedTimeInNanoseconds / stats.iterations);
+ (*m_tablePrinter)
+ << stats.iterations << ColumnBreak()
+ << stats.elapsedTimeInNanoseconds << ColumnBreak()
+ << average << ColumnBreak();
+}
+
+void ConsoleReporter::testCaseEnded(TestCaseStats const& _testCaseStats) {
+ m_tablePrinter->close();
+ StreamingReporterBase::testCaseEnded(_testCaseStats);
+ m_headerPrinted = false;
+}
+void ConsoleReporter::testGroupEnded(TestGroupStats const& _testGroupStats) {
+ if (currentGroupInfo.used) {
+ printSummaryDivider();
+ stream << "Summary for group '" << _testGroupStats.groupInfo.name << "':\n";
+ printTotals(_testGroupStats.totals);
+ stream << '\n' << std::endl;
+ }
+ StreamingReporterBase::testGroupEnded(_testGroupStats);
+}
+void ConsoleReporter::testRunEnded(TestRunStats const& _testRunStats) {
+ printTotalsDivider(_testRunStats.totals);
+ printTotals(_testRunStats.totals);
+ stream << std::endl;
+ StreamingReporterBase::testRunEnded(_testRunStats);
+}
+void ConsoleReporter::testRunStarting(TestRunInfo const& _testInfo) {
+ StreamingReporterBase::testRunStarting(_testInfo);
+ printTestFilters();
+}
+
+void ConsoleReporter::lazyPrint() {
+
+ m_tablePrinter->close();
+ lazyPrintWithoutClosingBenchmarkTable();
+}
+
+void ConsoleReporter::lazyPrintWithoutClosingBenchmarkTable() {
+
+ if (!currentTestRunInfo.used)
+ lazyPrintRunInfo();
+ if (!currentGroupInfo.used)
+ lazyPrintGroupInfo();
+
+ if (!m_headerPrinted) {
+ printTestCaseAndSectionHeader();
+ m_headerPrinted = true;
+ }
+}
+void ConsoleReporter::lazyPrintRunInfo() {
+ stream << '\n' << getLineOfChars<'~'>() << '\n';
+ Colour colour(Colour::SecondaryText);
+ stream << currentTestRunInfo->name
+ << " is a Catch v" << libraryVersion() << " host application.\n"
+ << "Run with -? for options\n\n";
+
+ if (m_config->rngSeed() != 0)
+ stream << "Randomness seeded to: " << m_config->rngSeed() << "\n\n";
+
+ currentTestRunInfo.used = true;
+}
+void ConsoleReporter::lazyPrintGroupInfo() {
+ if (!currentGroupInfo->name.empty() && currentGroupInfo->groupsCounts > 1) {
+ printClosedHeader("Group: " + currentGroupInfo->name);
+ currentGroupInfo.used = true;
+ }
+}
+void ConsoleReporter::printTestCaseAndSectionHeader() {
+ assert(!m_sectionStack.empty());
+ printOpenHeader(currentTestCaseInfo->name);
+
+ if (m_sectionStack.size() > 1) {
+ Colour colourGuard(Colour::Headers);
+
+ auto
+ it = m_sectionStack.begin() + 1, // Skip first section (test case)
+ itEnd = m_sectionStack.end();
+ for (; it != itEnd; ++it)
+ printHeaderString(it->name, 2);
+ }
+
+ SourceLineInfo lineInfo = m_sectionStack.back().lineInfo;
+
+ if (!lineInfo.empty()) {
+ stream << getLineOfChars<'-'>() << '\n';
+ Colour colourGuard(Colour::FileName);
+ stream << lineInfo << '\n';
+ }
+ stream << getLineOfChars<'.'>() << '\n' << std::endl;
+}
+
+void ConsoleReporter::printClosedHeader(std::string const& _name) {
+ printOpenHeader(_name);
+ stream << getLineOfChars<'.'>() << '\n';
+}
+void ConsoleReporter::printOpenHeader(std::string const& _name) {
+ stream << getLineOfChars<'-'>() << '\n';
+ {
+ Colour colourGuard(Colour::Headers);
+ printHeaderString(_name);
+ }
+}
+
+// if string has a : in first line will set indent to follow it on
+// subsequent lines
+void ConsoleReporter::printHeaderString(std::string const& _string, std::size_t indent) {
+ std::size_t i = _string.find(": ");
+ if (i != std::string::npos)
+ i += 2;
+ else
+ i = 0;
+ stream << Column(_string).indent(indent + i).initialIndent(indent) << '\n';
+}
+
+struct SummaryColumn {
+
+ SummaryColumn( std::string _label, Colour::Code _colour )
+ : label( std::move( _label ) ),
+ colour( _colour ) {}
+ SummaryColumn addRow( std::size_t count ) {
+ ReusableStringStream rss;
+ rss << count;
+ std::string row = rss.str();
+ for (auto& oldRow : rows) {
+ while (oldRow.size() < row.size())
+ oldRow = ' ' + oldRow;
+ while (oldRow.size() > row.size())
+ row = ' ' + row;
+ }
+ rows.push_back(row);
+ return *this;
+ }
+
+ std::string label;
+ Colour::Code colour;
+ std::vector<std::string> rows;
+
+};
+
+void ConsoleReporter::printTotals( Totals const& totals ) {
+ if (totals.testCases.total() == 0) {
+ stream << Colour(Colour::Warning) << "No tests ran\n";
+ } else if (totals.assertions.total() > 0 && totals.testCases.allPassed()) {
+ stream << Colour(Colour::ResultSuccess) << "All tests passed";
+ stream << " ("
+ << pluralise(totals.assertions.passed, "assertion") << " in "
+ << pluralise(totals.testCases.passed, "test case") << ')'
+ << '\n';
+ } else {
+
+ std::vector<SummaryColumn> columns;
+ columns.push_back(SummaryColumn("", Colour::None)
+ .addRow(totals.testCases.total())
+ .addRow(totals.assertions.total()));
+ columns.push_back(SummaryColumn("passed", Colour::Success)
+ .addRow(totals.testCases.passed)
+ .addRow(totals.assertions.passed));
+ columns.push_back(SummaryColumn("failed", Colour::ResultError)
+ .addRow(totals.testCases.failed)
+ .addRow(totals.assertions.failed));
+ columns.push_back(SummaryColumn("failed as expected", Colour::ResultExpectedFailure)
+ .addRow(totals.testCases.failedButOk)
+ .addRow(totals.assertions.failedButOk));
+
+ printSummaryRow("test cases", columns, 0);
+ printSummaryRow("assertions", columns, 1);
+ }
+}
+void ConsoleReporter::printSummaryRow(std::string const& label, std::vector<SummaryColumn> const& cols, std::size_t row) {
+ for (auto col : cols) {
+ std::string value = col.rows[row];
+ if (col.label.empty()) {
+ stream << label << ": ";
+ if (value != "0")
+ stream << value;
+ else
+ stream << Colour(Colour::Warning) << "- none -";
+ } else if (value != "0") {
+ stream << Colour(Colour::LightGrey) << " | ";
+ stream << Colour(col.colour)
+ << value << ' ' << col.label;
+ }
+ }
+ stream << '\n';
+}
+
+void ConsoleReporter::printTotalsDivider(Totals const& totals) {
+ if (totals.testCases.total() > 0) {
+ std::size_t failedRatio = makeRatio(totals.testCases.failed, totals.testCases.total());
+ std::size_t failedButOkRatio = makeRatio(totals.testCases.failedButOk, totals.testCases.total());
+ std::size_t passedRatio = makeRatio(totals.testCases.passed, totals.testCases.total());
+ while (failedRatio + failedButOkRatio + passedRatio < CATCH_CONFIG_CONSOLE_WIDTH - 1)
+ findMax(failedRatio, failedButOkRatio, passedRatio)++;
+ while (failedRatio + failedButOkRatio + passedRatio > CATCH_CONFIG_CONSOLE_WIDTH - 1)
+ findMax(failedRatio, failedButOkRatio, passedRatio)--;
+
+ stream << Colour(Colour::Error) << std::string(failedRatio, '=');
+ stream << Colour(Colour::ResultExpectedFailure) << std::string(failedButOkRatio, '=');
+ if (totals.testCases.allPassed())
+ stream << Colour(Colour::ResultSuccess) << std::string(passedRatio, '=');
+ else
+ stream << Colour(Colour::Success) << std::string(passedRatio, '=');
+ } else {
+ stream << Colour(Colour::Warning) << std::string(CATCH_CONFIG_CONSOLE_WIDTH - 1, '=');
+ }
+ stream << '\n';
+}
+void ConsoleReporter::printSummaryDivider() {
+ stream << getLineOfChars<'-'>() << '\n';
+}
+
+void ConsoleReporter::printTestFilters() {
+ if (m_config->testSpec().hasFilters())
+ stream << Colour(Colour::BrightYellow) << "Filters: " << serializeFilters( m_config->getTestsOrTags() ) << '\n';
+}
+
+CATCH_REGISTER_REPORTER("console", ConsoleReporter)
+
+} // end namespace Catch
+
+#if defined(_MSC_VER)
+#pragma warning(pop)
+#endif
+// end catch_reporter_console.cpp
+// start catch_reporter_junit.cpp
+
+#include <cassert>
+#include <sstream>
+#include <ctime>
+#include <algorithm>
+
+namespace Catch {
+
+ namespace {
+ std::string getCurrentTimestamp() {
+ // Beware, this is not reentrant because of backward compatibility issues
+ // Also, UTC only, again because of backward compatibility (%z is C++11)
+ time_t rawtime;
+ std::time(&rawtime);
+ auto const timeStampSize = sizeof("2017-01-16T17:06:45Z");
+
+#ifdef _MSC_VER
+ std::tm timeInfo = {};
+ gmtime_s(&timeInfo, &rawtime);
+#else
+ std::tm* timeInfo;
+ timeInfo = std::gmtime(&rawtime);
+#endif
+
+ char timeStamp[timeStampSize];
+ const char * const fmt = "%Y-%m-%dT%H:%M:%SZ";
+
+#ifdef _MSC_VER
+ std::strftime(timeStamp, timeStampSize, fmt, &timeInfo);
+#else
+ std::strftime(timeStamp, timeStampSize, fmt, timeInfo);
+#endif
+ return std::string(timeStamp);
+ }
+
+ std::string fileNameTag(const std::vector<std::string> &tags) {
+ auto it = std::find_if(begin(tags),
+ end(tags),
+ [] (std::string const& tag) {return tag.front() == '#'; });
+ if (it != tags.end())
+ return it->substr(1);
+ return std::string();
+ }
+ } // anonymous namespace
+
+ JunitReporter::JunitReporter( ReporterConfig const& _config )
+ : CumulativeReporterBase( _config ),
+ xml( _config.stream() )
+ {
+ m_reporterPrefs.shouldRedirectStdOut = true;
+ m_reporterPrefs.shouldReportAllAssertions = true;
+ }
+
+ JunitReporter::~JunitReporter() {}
+
+ std::string JunitReporter::getDescription() {
+ return "Reports test results in an XML format that looks like Ant's junitreport target";
+ }
+
+ void JunitReporter::noMatchingTestCases( std::string const& /*spec*/ ) {}
+
+ void JunitReporter::testRunStarting( TestRunInfo const& runInfo ) {
+ CumulativeReporterBase::testRunStarting( runInfo );
+ xml.startElement( "testsuites" );
+ }
+
+ void JunitReporter::testGroupStarting( GroupInfo const& groupInfo ) {
+ suiteTimer.start();
+ stdOutForSuite.clear();
+ stdErrForSuite.clear();
+ unexpectedExceptions = 0;
+ CumulativeReporterBase::testGroupStarting( groupInfo );
+ }
+
+ void JunitReporter::testCaseStarting( TestCaseInfo const& testCaseInfo ) {
+ m_okToFail = testCaseInfo.okToFail();
+ }
+
+ bool JunitReporter::assertionEnded( AssertionStats const& assertionStats ) {
+ if( assertionStats.assertionResult.getResultType() == ResultWas::ThrewException && !m_okToFail )
+ unexpectedExceptions++;
+ return CumulativeReporterBase::assertionEnded( assertionStats );
+ }
+
+ void JunitReporter::testCaseEnded( TestCaseStats const& testCaseStats ) {
+ stdOutForSuite += testCaseStats.stdOut;
+ stdErrForSuite += testCaseStats.stdErr;
+ CumulativeReporterBase::testCaseEnded( testCaseStats );
+ }
+
+ void JunitReporter::testGroupEnded( TestGroupStats const& testGroupStats ) {
+ double suiteTime = suiteTimer.getElapsedSeconds();
+ CumulativeReporterBase::testGroupEnded( testGroupStats );
+ writeGroup( *m_testGroups.back(), suiteTime );
+ }
+
+ void JunitReporter::testRunEndedCumulative() {
+ xml.endElement();
+ }
+
+ void JunitReporter::writeGroup( TestGroupNode const& groupNode, double suiteTime ) {
+ XmlWriter::ScopedElement e = xml.scopedElement( "testsuite" );
+
+ TestGroupStats const& stats = groupNode.value;
+ xml.writeAttribute( "name", stats.groupInfo.name );
+ xml.writeAttribute( "errors", unexpectedExceptions );
+ xml.writeAttribute( "failures", stats.totals.assertions.failed-unexpectedExceptions );
+ xml.writeAttribute( "tests", stats.totals.assertions.total() );
+ xml.writeAttribute( "hostname", "tbd" ); // !TBD
+ if( m_config->showDurations() == ShowDurations::Never )
+ xml.writeAttribute( "time", "" );
+ else
+ xml.writeAttribute( "time", suiteTime );
+ xml.writeAttribute( "timestamp", getCurrentTimestamp() );
+
+ // Write properties if there are any
+ if (m_config->hasTestFilters() || m_config->rngSeed() != 0) {
+ auto properties = xml.scopedElement("properties");
+ if (m_config->hasTestFilters()) {
+ xml.scopedElement("property")
+ .writeAttribute("name", "filters")
+ .writeAttribute("value", serializeFilters(m_config->getTestsOrTags()));
+ }
+ if (m_config->rngSeed() != 0) {
+ xml.scopedElement("property")
+ .writeAttribute("name", "random-seed")
+ .writeAttribute("value", m_config->rngSeed());
+ }
+ }
+
+ // Write test cases
+ for( auto const& child : groupNode.children )
+ writeTestCase( *child );
+
+ xml.scopedElement( "system-out" ).writeText( trim( stdOutForSuite ), false );
+ xml.scopedElement( "system-err" ).writeText( trim( stdErrForSuite ), false );
+ }
+
+ void JunitReporter::writeTestCase( TestCaseNode const& testCaseNode ) {
+ TestCaseStats const& stats = testCaseNode.value;
+
+ // All test cases have exactly one section - which represents the
+ // test case itself. That section may have 0-n nested sections
+ assert( testCaseNode.children.size() == 1 );
+ SectionNode const& rootSection = *testCaseNode.children.front();
+
+ std::string className = stats.testInfo.className;
+
+ if( className.empty() ) {
+ className = fileNameTag(stats.testInfo.tags);
+ if ( className.empty() )
+ className = "global";
+ }
+
+ if ( !m_config->name().empty() )
+ className = m_config->name() + "." + className;
+
+ writeSection( className, "", rootSection );
+ }
+
+ void JunitReporter::writeSection( std::string const& className,
+ std::string const& rootName,
+ SectionNode const& sectionNode ) {
+ std::string name = trim( sectionNode.stats.sectionInfo.name );
+ if( !rootName.empty() )
+ name = rootName + '/' + name;
+
+ if( !sectionNode.assertions.empty() ||
+ !sectionNode.stdOut.empty() ||
+ !sectionNode.stdErr.empty() ) {
+ XmlWriter::ScopedElement e = xml.scopedElement( "testcase" );
+ if( className.empty() ) {
+ xml.writeAttribute( "classname", name );
+ xml.writeAttribute( "name", "root" );
+ }
+ else {
+ xml.writeAttribute( "classname", className );
+ xml.writeAttribute( "name", name );
+ }
+ xml.writeAttribute( "time", ::Catch::Detail::stringify( sectionNode.stats.durationInSeconds ) );
+
+ writeAssertions( sectionNode );
+
+ if( !sectionNode.stdOut.empty() )
+ xml.scopedElement( "system-out" ).writeText( trim( sectionNode.stdOut ), false );
+ if( !sectionNode.stdErr.empty() )
+ xml.scopedElement( "system-err" ).writeText( trim( sectionNode.stdErr ), false );
+ }
+ for( auto const& childNode : sectionNode.childSections )
+ if( className.empty() )
+ writeSection( name, "", *childNode );
+ else
+ writeSection( className, name, *childNode );
+ }
+
+ void JunitReporter::writeAssertions( SectionNode const& sectionNode ) {
+ for( auto const& assertion : sectionNode.assertions )
+ writeAssertion( assertion );
+ }
+
+ void JunitReporter::writeAssertion( AssertionStats const& stats ) {
+ AssertionResult const& result = stats.assertionResult;
+ if( !result.isOk() ) {
+ std::string elementName;
+ switch( result.getResultType() ) {
+ case ResultWas::ThrewException:
+ case ResultWas::FatalErrorCondition:
+ elementName = "error";
+ break;
+ case ResultWas::ExplicitFailure:
+ elementName = "failure";
+ break;
+ case ResultWas::ExpressionFailed:
+ elementName = "failure";
+ break;
+ case ResultWas::DidntThrowException:
+ elementName = "failure";
+ break;
+
+ // We should never see these here:
+ case ResultWas::Info:
+ case ResultWas::Warning:
+ case ResultWas::Ok:
+ case ResultWas::Unknown:
+ case ResultWas::FailureBit:
+ case ResultWas::Exception:
+ elementName = "internalError";
+ break;
+ }
+
+ XmlWriter::ScopedElement e = xml.scopedElement( elementName );
+
+ xml.writeAttribute( "message", result.getExpandedExpression() );
+ xml.writeAttribute( "type", result.getTestMacroName() );
+
+ ReusableStringStream rss;
+ if( !result.getMessage().empty() )
+ rss << result.getMessage() << '\n';
+ for( auto const& msg : stats.infoMessages )
+ if( msg.type == ResultWas::Info )
+ rss << msg.message << '\n';
+
+ rss << "at " << result.getSourceInfo();
+ xml.writeText( rss.str(), false );
+ }
+ }
+
+ CATCH_REGISTER_REPORTER( "junit", JunitReporter )
+
+} // end namespace Catch
+// end catch_reporter_junit.cpp
+// start catch_reporter_listening.cpp
+
+#include <cassert>
+
+namespace Catch {
+
+ ListeningReporter::ListeningReporter() {
+ // We will assume that listeners will always want all assertions
+ m_preferences.shouldReportAllAssertions = true;
+ }
+
+ void ListeningReporter::addListener( IStreamingReporterPtr&& listener ) {
+ m_listeners.push_back( std::move( listener ) );
+ }
+
+ void ListeningReporter::addReporter(IStreamingReporterPtr&& reporter) {
+ assert(!m_reporter && "Listening reporter can wrap only 1 real reporter");
+ m_reporter = std::move( reporter );
+ m_preferences.shouldRedirectStdOut = m_reporter->getPreferences().shouldRedirectStdOut;
+ }
+
+ ReporterPreferences ListeningReporter::getPreferences() const {
+ return m_preferences;
+ }
+
+ std::set<Verbosity> ListeningReporter::getSupportedVerbosities() {
+ return std::set<Verbosity>{ };
+ }
+
+ void ListeningReporter::noMatchingTestCases( std::string const& spec ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->noMatchingTestCases( spec );
+ }
+ m_reporter->noMatchingTestCases( spec );
+ }
+
+ void ListeningReporter::benchmarkStarting( BenchmarkInfo const& benchmarkInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->benchmarkStarting( benchmarkInfo );
+ }
+ m_reporter->benchmarkStarting( benchmarkInfo );
+ }
+ void ListeningReporter::benchmarkEnded( BenchmarkStats const& benchmarkStats ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->benchmarkEnded( benchmarkStats );
+ }
+ m_reporter->benchmarkEnded( benchmarkStats );
+ }
+
+ void ListeningReporter::testRunStarting( TestRunInfo const& testRunInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->testRunStarting( testRunInfo );
+ }
+ m_reporter->testRunStarting( testRunInfo );
+ }
+
+ void ListeningReporter::testGroupStarting( GroupInfo const& groupInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->testGroupStarting( groupInfo );
+ }
+ m_reporter->testGroupStarting( groupInfo );
+ }
+
+ void ListeningReporter::testCaseStarting( TestCaseInfo const& testInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->testCaseStarting( testInfo );
+ }
+ m_reporter->testCaseStarting( testInfo );
+ }
+
+ void ListeningReporter::sectionStarting( SectionInfo const& sectionInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->sectionStarting( sectionInfo );
+ }
+ m_reporter->sectionStarting( sectionInfo );
+ }
+
+ void ListeningReporter::assertionStarting( AssertionInfo const& assertionInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->assertionStarting( assertionInfo );
+ }
+ m_reporter->assertionStarting( assertionInfo );
+ }
+
+ // The return value indicates if the messages buffer should be cleared:
+ bool ListeningReporter::assertionEnded( AssertionStats const& assertionStats ) {
+ for( auto const& listener : m_listeners ) {
+ static_cast<void>( listener->assertionEnded( assertionStats ) );
+ }
+ return m_reporter->assertionEnded( assertionStats );
+ }
+
+ void ListeningReporter::sectionEnded( SectionStats const& sectionStats ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->sectionEnded( sectionStats );
+ }
+ m_reporter->sectionEnded( sectionStats );
+ }
+
+ void ListeningReporter::testCaseEnded( TestCaseStats const& testCaseStats ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->testCaseEnded( testCaseStats );
+ }
+ m_reporter->testCaseEnded( testCaseStats );
+ }
+
+ void ListeningReporter::testGroupEnded( TestGroupStats const& testGroupStats ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->testGroupEnded( testGroupStats );
+ }
+ m_reporter->testGroupEnded( testGroupStats );
+ }
+
+ void ListeningReporter::testRunEnded( TestRunStats const& testRunStats ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->testRunEnded( testRunStats );
+ }
+ m_reporter->testRunEnded( testRunStats );
+ }
+
+ void ListeningReporter::skipTest( TestCaseInfo const& testInfo ) {
+ for ( auto const& listener : m_listeners ) {
+ listener->skipTest( testInfo );
+ }
+ m_reporter->skipTest( testInfo );
+ }
+
+ bool ListeningReporter::isMulti() const {
+ return true;
+ }
+
+} // end namespace Catch
+// end catch_reporter_listening.cpp
+// start catch_reporter_xml.cpp
+
+#if defined(_MSC_VER)
+#pragma warning(push)
+#pragma warning(disable:4061) // Not all labels are EXPLICITLY handled in switch
+ // Note that 4062 (not all labels are handled
+ // and default is missing) is enabled
+#endif
+
+namespace Catch {
+ XmlReporter::XmlReporter( ReporterConfig const& _config )
+ : StreamingReporterBase( _config ),
+ m_xml(_config.stream())
+ {
+ m_reporterPrefs.shouldRedirectStdOut = true;
+ m_reporterPrefs.shouldReportAllAssertions = true;
+ }
+
+ XmlReporter::~XmlReporter() = default;
+
+ std::string XmlReporter::getDescription() {
+ return "Reports test results as an XML document";
+ }
+
+ std::string XmlReporter::getStylesheetRef() const {
+ return std::string();
+ }
+
+ void XmlReporter::writeSourceInfo( SourceLineInfo const& sourceInfo ) {
+ m_xml
+ .writeAttribute( "filename", sourceInfo.file )
+ .writeAttribute( "line", sourceInfo.line );
+ }
+
+ void XmlReporter::noMatchingTestCases( std::string const& s ) {
+ StreamingReporterBase::noMatchingTestCases( s );
+ }
+
+ void XmlReporter::testRunStarting( TestRunInfo const& testInfo ) {
+ StreamingReporterBase::testRunStarting( testInfo );
+ std::string stylesheetRef = getStylesheetRef();
+ if( !stylesheetRef.empty() )
+ m_xml.writeStylesheetRef( stylesheetRef );
+ m_xml.startElement( "Catch" );
+ if( !m_config->name().empty() )
+ m_xml.writeAttribute( "name", m_config->name() );
+ if (m_config->testSpec().hasFilters())
+ m_xml.writeAttribute( "filters", serializeFilters( m_config->getTestsOrTags() ) );
+ if( m_config->rngSeed() != 0 )
+ m_xml.scopedElement( "Randomness" )
+ .writeAttribute( "seed", m_config->rngSeed() );
+ }
+
+ void XmlReporter::testGroupStarting( GroupInfo const& groupInfo ) {
+ StreamingReporterBase::testGroupStarting( groupInfo );
+ m_xml.startElement( "Group" )
+ .writeAttribute( "name", groupInfo.name );
+ }
+
+ void XmlReporter::testCaseStarting( TestCaseInfo const& testInfo ) {
+ StreamingReporterBase::testCaseStarting(testInfo);
+ m_xml.startElement( "TestCase" )
+ .writeAttribute( "name", trim( testInfo.name ) )
+ .writeAttribute( "description", testInfo.description )
+ .writeAttribute( "tags", testInfo.tagsAsString() );
+
+ writeSourceInfo( testInfo.lineInfo );
+
+ if ( m_config->showDurations() == ShowDurations::Always )
+ m_testCaseTimer.start();
+ m_xml.ensureTagClosed();
+ }
+
+ void XmlReporter::sectionStarting( SectionInfo const& sectionInfo ) {
+ StreamingReporterBase::sectionStarting( sectionInfo );
+ if( m_sectionDepth++ > 0 ) {
+ m_xml.startElement( "Section" )
+ .writeAttribute( "name", trim( sectionInfo.name ) );
+ writeSourceInfo( sectionInfo.lineInfo );
+ m_xml.ensureTagClosed();
+ }
+ }
+
+ void XmlReporter::assertionStarting( AssertionInfo const& ) { }
+
+ bool XmlReporter::assertionEnded( AssertionStats const& assertionStats ) {
+
+ AssertionResult const& result = assertionStats.assertionResult;
+
+ bool includeResults = m_config->includeSuccessfulResults() || !result.isOk();
+
+ if( includeResults || result.getResultType() == ResultWas::Warning ) {
+ // Print any info messages in <Info> tags.
+ for( auto const& msg : assertionStats.infoMessages ) {
+ if( msg.type == ResultWas::Info && includeResults ) {
+ m_xml.scopedElement( "Info" )
+ .writeText( msg.message );
+ } else if ( msg.type == ResultWas::Warning ) {
+ m_xml.scopedElement( "Warning" )
+ .writeText( msg.message );
+ }
+ }
+ }
+
+ // Drop out if result was successful but we're not printing them.
+ if( !includeResults && result.getResultType() != ResultWas::Warning )
+ return true;
+
+ // Print the expression if there is one.
+ if( result.hasExpression() ) {
+ m_xml.startElement( "Expression" )
+ .writeAttribute( "success", result.succeeded() )
+ .writeAttribute( "type", result.getTestMacroName() );
+
+ writeSourceInfo( result.getSourceInfo() );
+
+ m_xml.scopedElement( "Original" )
+ .writeText( result.getExpression() );
+ m_xml.scopedElement( "Expanded" )
+ .writeText( result.getExpandedExpression() );
+ }
+
+ // And... Print a result applicable to each result type.
+ switch( result.getResultType() ) {
+ case ResultWas::ThrewException:
+ m_xml.startElement( "Exception" );
+ writeSourceInfo( result.getSourceInfo() );
+ m_xml.writeText( result.getMessage() );
+ m_xml.endElement();
+ break;
+ case ResultWas::FatalErrorCondition:
+ m_xml.startElement( "FatalErrorCondition" );
+ writeSourceInfo( result.getSourceInfo() );
+ m_xml.writeText( result.getMessage() );
+ m_xml.endElement();
+ break;
+ case ResultWas::Info:
+ m_xml.scopedElement( "Info" )
+ .writeText( result.getMessage() );
+ break;
+ case ResultWas::Warning:
+ // Warning will already have been written
+ break;
+ case ResultWas::ExplicitFailure:
+ m_xml.startElement( "Failure" );
+ writeSourceInfo( result.getSourceInfo() );
+ m_xml.writeText( result.getMessage() );
+ m_xml.endElement();
+ break;
+ default:
+ break;
+ }
+
+ if( result.hasExpression() )
+ m_xml.endElement();
+
+ return true;
+ }
+
+ void XmlReporter::sectionEnded( SectionStats const& sectionStats ) {
+ StreamingReporterBase::sectionEnded( sectionStats );
+ if( --m_sectionDepth > 0 ) {
+ XmlWriter::ScopedElement e = m_xml.scopedElement( "OverallResults" );
+ e.writeAttribute( "successes", sectionStats.assertions.passed );
+ e.writeAttribute( "failures", sectionStats.assertions.failed );
+ e.writeAttribute( "expectedFailures", sectionStats.assertions.failedButOk );
+
+ if ( m_config->showDurations() == ShowDurations::Always )
+ e.writeAttribute( "durationInSeconds", sectionStats.durationInSeconds );
+
+ m_xml.endElement();
+ }
+ }
+
+ void XmlReporter::testCaseEnded( TestCaseStats const& testCaseStats ) {
+ StreamingReporterBase::testCaseEnded( testCaseStats );
+ XmlWriter::ScopedElement e = m_xml.scopedElement( "OverallResult" );
+ e.writeAttribute( "success", testCaseStats.totals.assertions.allOk() );
+
+ if ( m_config->showDurations() == ShowDurations::Always )
+ e.writeAttribute( "durationInSeconds", m_testCaseTimer.getElapsedSeconds() );
+
+ if( !testCaseStats.stdOut.empty() )
+ m_xml.scopedElement( "StdOut" ).writeText( trim( testCaseStats.stdOut ), false );
+ if( !testCaseStats.stdErr.empty() )
+ m_xml.scopedElement( "StdErr" ).writeText( trim( testCaseStats.stdErr ), false );
+
+ m_xml.endElement();
+ }
+
+ void XmlReporter::testGroupEnded( TestGroupStats const& testGroupStats ) {
+ StreamingReporterBase::testGroupEnded( testGroupStats );
+ // TODO: Check testGroupStats.aborting and act accordingly.
+ m_xml.scopedElement( "OverallResults" )
+ .writeAttribute( "successes", testGroupStats.totals.assertions.passed )
+ .writeAttribute( "failures", testGroupStats.totals.assertions.failed )
+ .writeAttribute( "expectedFailures", testGroupStats.totals.assertions.failedButOk );
+ m_xml.endElement();
+ }
+
+ void XmlReporter::testRunEnded( TestRunStats const& testRunStats ) {
+ StreamingReporterBase::testRunEnded( testRunStats );
+ m_xml.scopedElement( "OverallResults" )
+ .writeAttribute( "successes", testRunStats.totals.assertions.passed )
+ .writeAttribute( "failures", testRunStats.totals.assertions.failed )
+ .writeAttribute( "expectedFailures", testRunStats.totals.assertions.failedButOk );
+ m_xml.endElement();
+ }
+
+ CATCH_REGISTER_REPORTER( "xml", XmlReporter )
+
+} // end namespace Catch
+
+#if defined(_MSC_VER)
+#pragma warning(pop)
+#endif
+// end catch_reporter_xml.cpp
+
+namespace Catch {
+ LeakDetector leakDetector;
+}
+
+#ifdef __clang__
+#pragma clang diagnostic pop
+#endif
+
+// end catch_impl.hpp
+#endif
+
+#ifdef CATCH_CONFIG_MAIN
+// start catch_default_main.hpp
+
+#ifndef __OBJC__
+
+#if defined(CATCH_CONFIG_WCHAR) && defined(WIN32) && defined(_UNICODE) && !defined(DO_NOT_USE_WMAIN)
+// Standard C/C++ Win32 Unicode wmain entry point
+extern "C" int wmain (int argc, wchar_t * argv[], wchar_t * []) {
+#else
+// Standard C/C++ main entry point
+int main (int argc, char * argv[]) {
+#endif
+
+ return Catch::Session().run( argc, argv );
+}
+
+#else // __OBJC__
+
+// Objective-C entry point
+int main (int argc, char * const argv[]) {
+#if !CATCH_ARC_ENABLED
+ NSAutoreleasePool * pool = [[NSAutoreleasePool alloc] init];
+#endif
+
+ Catch::registerTestMethods();
+ int result = Catch::Session().run( argc, (char**)argv );
+
+#if !CATCH_ARC_ENABLED
+ [pool drain];
+#endif
+
+ return result;
+}
+
+#endif // __OBJC__
+
+// end catch_default_main.hpp
+#endif
+
+#if !defined(CATCH_CONFIG_IMPL_ONLY)
+
+#ifdef CLARA_CONFIG_MAIN_NOT_DEFINED
+# undef CLARA_CONFIG_MAIN
+#endif
+
+#if !defined(CATCH_CONFIG_DISABLE)
+//////
+// If this config identifier is defined then all CATCH macros are prefixed with CATCH_
+#ifdef CATCH_CONFIG_PREFIX_ALL
+
+#define CATCH_REQUIRE( ... ) INTERNAL_CATCH_TEST( "CATCH_REQUIRE", Catch::ResultDisposition::Normal, __VA_ARGS__ )
+#define CATCH_REQUIRE_FALSE( ... ) INTERNAL_CATCH_TEST( "CATCH_REQUIRE_FALSE", Catch::ResultDisposition::Normal | Catch::ResultDisposition::FalseTest, __VA_ARGS__ )
+
+#define CATCH_REQUIRE_THROWS( ... ) INTERNAL_CATCH_THROWS( "CATCH_REQUIRE_THROWS", Catch::ResultDisposition::Normal, __VA_ARGS__ )
+#define CATCH_REQUIRE_THROWS_AS( expr, exceptionType ) INTERNAL_CATCH_THROWS_AS( "CATCH_REQUIRE_THROWS_AS", exceptionType, Catch::ResultDisposition::Normal, expr )
+#define CATCH_REQUIRE_THROWS_WITH( expr, matcher ) INTERNAL_CATCH_THROWS_STR_MATCHES( "CATCH_REQUIRE_THROWS_WITH", Catch::ResultDisposition::Normal, matcher, expr )
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CATCH_REQUIRE_THROWS_MATCHES( expr, exceptionType, matcher ) INTERNAL_CATCH_THROWS_MATCHES( "CATCH_REQUIRE_THROWS_MATCHES", exceptionType, Catch::ResultDisposition::Normal, matcher, expr )
+#endif// CATCH_CONFIG_DISABLE_MATCHERS
+#define CATCH_REQUIRE_NOTHROW( ... ) INTERNAL_CATCH_NO_THROW( "CATCH_REQUIRE_NOTHROW", Catch::ResultDisposition::Normal, __VA_ARGS__ )
+
+#define CATCH_CHECK( ... ) INTERNAL_CATCH_TEST( "CATCH_CHECK", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CATCH_CHECK_FALSE( ... ) INTERNAL_CATCH_TEST( "CATCH_CHECK_FALSE", Catch::ResultDisposition::ContinueOnFailure | Catch::ResultDisposition::FalseTest, __VA_ARGS__ )
+#define CATCH_CHECKED_IF( ... ) INTERNAL_CATCH_IF( "CATCH_CHECKED_IF", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CATCH_CHECKED_ELSE( ... ) INTERNAL_CATCH_ELSE( "CATCH_CHECKED_ELSE", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CATCH_CHECK_NOFAIL( ... ) INTERNAL_CATCH_TEST( "CATCH_CHECK_NOFAIL", Catch::ResultDisposition::ContinueOnFailure | Catch::ResultDisposition::SuppressFail, __VA_ARGS__ )
+
+#define CATCH_CHECK_THROWS( ... ) INTERNAL_CATCH_THROWS( "CATCH_CHECK_THROWS", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CATCH_CHECK_THROWS_AS( expr, exceptionType ) INTERNAL_CATCH_THROWS_AS( "CATCH_CHECK_THROWS_AS", exceptionType, Catch::ResultDisposition::ContinueOnFailure, expr )
+#define CATCH_CHECK_THROWS_WITH( expr, matcher ) INTERNAL_CATCH_THROWS_STR_MATCHES( "CATCH_CHECK_THROWS_WITH", Catch::ResultDisposition::ContinueOnFailure, matcher, expr )
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CATCH_CHECK_THROWS_MATCHES( expr, exceptionType, matcher ) INTERNAL_CATCH_THROWS_MATCHES( "CATCH_CHECK_THROWS_MATCHES", exceptionType, Catch::ResultDisposition::ContinueOnFailure, matcher, expr )
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+#define CATCH_CHECK_NOTHROW( ... ) INTERNAL_CATCH_NO_THROW( "CATCH_CHECK_NOTHROW", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CATCH_CHECK_THAT( arg, matcher ) INTERNAL_CHECK_THAT( "CATCH_CHECK_THAT", matcher, Catch::ResultDisposition::ContinueOnFailure, arg )
+
+#define CATCH_REQUIRE_THAT( arg, matcher ) INTERNAL_CHECK_THAT( "CATCH_REQUIRE_THAT", matcher, Catch::ResultDisposition::Normal, arg )
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+
+#define CATCH_INFO( msg ) INTERNAL_CATCH_INFO( "CATCH_INFO", msg )
+#define CATCH_UNSCOPED_INFO( msg ) INTERNAL_CATCH_UNSCOPED_INFO( "CATCH_UNSCOPED_INFO", msg )
+#define CATCH_WARN( msg ) INTERNAL_CATCH_MSG( "CATCH_WARN", Catch::ResultWas::Warning, Catch::ResultDisposition::ContinueOnFailure, msg )
+#define CATCH_CAPTURE( ... ) INTERNAL_CATCH_CAPTURE( INTERNAL_CATCH_UNIQUE_NAME(capturer), "CATCH_CAPTURE",__VA_ARGS__ )
+
+#define CATCH_TEST_CASE( ... ) INTERNAL_CATCH_TESTCASE( __VA_ARGS__ )
+#define CATCH_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define CATCH_METHOD_AS_TEST_CASE( method, ... ) INTERNAL_CATCH_METHOD_AS_TEST_CASE( method, __VA_ARGS__ )
+#define CATCH_REGISTER_TEST_CASE( Function, ... ) INTERNAL_CATCH_REGISTER_TESTCASE( Function, __VA_ARGS__ )
+#define CATCH_SECTION( ... ) INTERNAL_CATCH_SECTION( __VA_ARGS__ )
+#define CATCH_DYNAMIC_SECTION( ... ) INTERNAL_CATCH_DYNAMIC_SECTION( __VA_ARGS__ )
+#define CATCH_FAIL( ... ) INTERNAL_CATCH_MSG( "CATCH_FAIL", Catch::ResultWas::ExplicitFailure, Catch::ResultDisposition::Normal, __VA_ARGS__ )
+#define CATCH_FAIL_CHECK( ... ) INTERNAL_CATCH_MSG( "CATCH_FAIL_CHECK", Catch::ResultWas::ExplicitFailure, Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CATCH_SUCCEED( ... ) INTERNAL_CATCH_MSG( "CATCH_SUCCEED", Catch::ResultWas::Ok, Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+
+#define CATCH_ANON_TEST_CASE() INTERNAL_CATCH_TESTCASE()
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define CATCH_TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define CATCH_TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG( __VA_ARGS__ )
+#define CATCH_TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE( __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ )
+#else
+#define CATCH_TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG( __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE( __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) )
+#endif
+
+#if !defined(CATCH_CONFIG_RUNTIME_STATIC_REQUIRE)
+#define CATCH_STATIC_REQUIRE( ... ) static_assert( __VA_ARGS__ , #__VA_ARGS__ ); CATCH_SUCCEED( #__VA_ARGS__ )
+#define CATCH_STATIC_REQUIRE_FALSE( ... ) static_assert( !(__VA_ARGS__), "!(" #__VA_ARGS__ ")" ); CATCH_SUCCEED( #__VA_ARGS__ )
+#else
+#define CATCH_STATIC_REQUIRE( ... ) CATCH_REQUIRE( __VA_ARGS__ )
+#define CATCH_STATIC_REQUIRE_FALSE( ... ) CATCH_REQUIRE_FALSE( __VA_ARGS__ )
+#endif
+
+// "BDD-style" convenience wrappers
+#define CATCH_SCENARIO( ... ) CATCH_TEST_CASE( "Scenario: " __VA_ARGS__ )
+#define CATCH_SCENARIO_METHOD( className, ... ) INTERNAL_CATCH_TEST_CASE_METHOD( className, "Scenario: " __VA_ARGS__ )
+#define CATCH_GIVEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " Given: " << desc )
+#define CATCH_AND_GIVEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( "And given: " << desc )
+#define CATCH_WHEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " When: " << desc )
+#define CATCH_AND_WHEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " And when: " << desc )
+#define CATCH_THEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " Then: " << desc )
+#define CATCH_AND_THEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " And: " << desc )
+
+// If CATCH_CONFIG_PREFIX_ALL is not defined then the CATCH_ prefix is not required
+#else
+
+#define REQUIRE( ... ) INTERNAL_CATCH_TEST( "REQUIRE", Catch::ResultDisposition::Normal, __VA_ARGS__ )
+#define REQUIRE_FALSE( ... ) INTERNAL_CATCH_TEST( "REQUIRE_FALSE", Catch::ResultDisposition::Normal | Catch::ResultDisposition::FalseTest, __VA_ARGS__ )
+
+#define REQUIRE_THROWS( ... ) INTERNAL_CATCH_THROWS( "REQUIRE_THROWS", Catch::ResultDisposition::Normal, __VA_ARGS__ )
+#define REQUIRE_THROWS_AS( expr, exceptionType ) INTERNAL_CATCH_THROWS_AS( "REQUIRE_THROWS_AS", exceptionType, Catch::ResultDisposition::Normal, expr )
+#define REQUIRE_THROWS_WITH( expr, matcher ) INTERNAL_CATCH_THROWS_STR_MATCHES( "REQUIRE_THROWS_WITH", Catch::ResultDisposition::Normal, matcher, expr )
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define REQUIRE_THROWS_MATCHES( expr, exceptionType, matcher ) INTERNAL_CATCH_THROWS_MATCHES( "REQUIRE_THROWS_MATCHES", exceptionType, Catch::ResultDisposition::Normal, matcher, expr )
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+#define REQUIRE_NOTHROW( ... ) INTERNAL_CATCH_NO_THROW( "REQUIRE_NOTHROW", Catch::ResultDisposition::Normal, __VA_ARGS__ )
+
+#define CHECK( ... ) INTERNAL_CATCH_TEST( "CHECK", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CHECK_FALSE( ... ) INTERNAL_CATCH_TEST( "CHECK_FALSE", Catch::ResultDisposition::ContinueOnFailure | Catch::ResultDisposition::FalseTest, __VA_ARGS__ )
+#define CHECKED_IF( ... ) INTERNAL_CATCH_IF( "CHECKED_IF", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CHECKED_ELSE( ... ) INTERNAL_CATCH_ELSE( "CHECKED_ELSE", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CHECK_NOFAIL( ... ) INTERNAL_CATCH_TEST( "CHECK_NOFAIL", Catch::ResultDisposition::ContinueOnFailure | Catch::ResultDisposition::SuppressFail, __VA_ARGS__ )
+
+#define CHECK_THROWS( ... ) INTERNAL_CATCH_THROWS( "CHECK_THROWS", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define CHECK_THROWS_AS( expr, exceptionType ) INTERNAL_CATCH_THROWS_AS( "CHECK_THROWS_AS", exceptionType, Catch::ResultDisposition::ContinueOnFailure, expr )
+#define CHECK_THROWS_WITH( expr, matcher ) INTERNAL_CATCH_THROWS_STR_MATCHES( "CHECK_THROWS_WITH", Catch::ResultDisposition::ContinueOnFailure, matcher, expr )
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CHECK_THROWS_MATCHES( expr, exceptionType, matcher ) INTERNAL_CATCH_THROWS_MATCHES( "CHECK_THROWS_MATCHES", exceptionType, Catch::ResultDisposition::ContinueOnFailure, matcher, expr )
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+#define CHECK_NOTHROW( ... ) INTERNAL_CATCH_NO_THROW( "CHECK_NOTHROW", Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CHECK_THAT( arg, matcher ) INTERNAL_CHECK_THAT( "CHECK_THAT", matcher, Catch::ResultDisposition::ContinueOnFailure, arg )
+
+#define REQUIRE_THAT( arg, matcher ) INTERNAL_CHECK_THAT( "REQUIRE_THAT", matcher, Catch::ResultDisposition::Normal, arg )
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+
+#define INFO( msg ) INTERNAL_CATCH_INFO( "INFO", msg )
+#define UNSCOPED_INFO( msg ) INTERNAL_CATCH_UNSCOPED_INFO( "UNSCOPED_INFO", msg )
+#define WARN( msg ) INTERNAL_CATCH_MSG( "WARN", Catch::ResultWas::Warning, Catch::ResultDisposition::ContinueOnFailure, msg )
+#define CAPTURE( ... ) INTERNAL_CATCH_CAPTURE( INTERNAL_CATCH_UNIQUE_NAME(capturer), "CAPTURE",__VA_ARGS__ )
+
+#define TEST_CASE( ... ) INTERNAL_CATCH_TESTCASE( __VA_ARGS__ )
+#define TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define METHOD_AS_TEST_CASE( method, ... ) INTERNAL_CATCH_METHOD_AS_TEST_CASE( method, __VA_ARGS__ )
+#define REGISTER_TEST_CASE( Function, ... ) INTERNAL_CATCH_REGISTER_TESTCASE( Function, __VA_ARGS__ )
+#define SECTION( ... ) INTERNAL_CATCH_SECTION( __VA_ARGS__ )
+#define DYNAMIC_SECTION( ... ) INTERNAL_CATCH_DYNAMIC_SECTION( __VA_ARGS__ )
+#define FAIL( ... ) INTERNAL_CATCH_MSG( "FAIL", Catch::ResultWas::ExplicitFailure, Catch::ResultDisposition::Normal, __VA_ARGS__ )
+#define FAIL_CHECK( ... ) INTERNAL_CATCH_MSG( "FAIL_CHECK", Catch::ResultWas::ExplicitFailure, Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define SUCCEED( ... ) INTERNAL_CATCH_MSG( "SUCCEED", Catch::ResultWas::Ok, Catch::ResultDisposition::ContinueOnFailure, __VA_ARGS__ )
+#define ANON_TEST_CASE() INTERNAL_CATCH_TESTCASE()
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG( __VA_ARGS__ )
+#define TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE( __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ )
+#else
+#define TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ ) )
+#define TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG( __VA_ARGS__ ) )
+#define TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ ) )
+#define TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) )
+#define TEMPLATE_PRODUCT_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE( __VA_ARGS__ ) )
+#define TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( __VA_ARGS__ ) )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, __VA_ARGS__ ) )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, __VA_ARGS__ ) )
+#endif
+
+#if !defined(CATCH_CONFIG_RUNTIME_STATIC_REQUIRE)
+#define STATIC_REQUIRE( ... ) static_assert( __VA_ARGS__, #__VA_ARGS__ ); SUCCEED( #__VA_ARGS__ )
+#define STATIC_REQUIRE_FALSE( ... ) static_assert( !(__VA_ARGS__), "!(" #__VA_ARGS__ ")" ); SUCCEED( "!(" #__VA_ARGS__ ")" )
+#else
+#define STATIC_REQUIRE( ... ) REQUIRE( __VA_ARGS__ )
+#define STATIC_REQUIRE_FALSE( ... ) REQUIRE_FALSE( __VA_ARGS__ )
+#endif
+
+#endif
+
+#define CATCH_TRANSLATE_EXCEPTION( signature ) INTERNAL_CATCH_TRANSLATE_EXCEPTION( signature )
+
+// "BDD-style" convenience wrappers
+#define SCENARIO( ... ) TEST_CASE( "Scenario: " __VA_ARGS__ )
+#define SCENARIO_METHOD( className, ... ) INTERNAL_CATCH_TEST_CASE_METHOD( className, "Scenario: " __VA_ARGS__ )
+
+#define GIVEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " Given: " << desc )
+#define AND_GIVEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( "And given: " << desc )
+#define WHEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " When: " << desc )
+#define AND_WHEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " And when: " << desc )
+#define THEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " Then: " << desc )
+#define AND_THEN( desc ) INTERNAL_CATCH_DYNAMIC_SECTION( " And: " << desc )
+
+using Catch::Detail::Approx;
+
+#else // CATCH_CONFIG_DISABLE
+
+//////
+// If this config identifier is defined then all CATCH macros are prefixed with CATCH_
+#ifdef CATCH_CONFIG_PREFIX_ALL
+
+#define CATCH_REQUIRE( ... ) (void)(0)
+#define CATCH_REQUIRE_FALSE( ... ) (void)(0)
+
+#define CATCH_REQUIRE_THROWS( ... ) (void)(0)
+#define CATCH_REQUIRE_THROWS_AS( expr, exceptionType ) (void)(0)
+#define CATCH_REQUIRE_THROWS_WITH( expr, matcher ) (void)(0)
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CATCH_REQUIRE_THROWS_MATCHES( expr, exceptionType, matcher ) (void)(0)
+#endif// CATCH_CONFIG_DISABLE_MATCHERS
+#define CATCH_REQUIRE_NOTHROW( ... ) (void)(0)
+
+#define CATCH_CHECK( ... ) (void)(0)
+#define CATCH_CHECK_FALSE( ... ) (void)(0)
+#define CATCH_CHECKED_IF( ... ) if (__VA_ARGS__)
+#define CATCH_CHECKED_ELSE( ... ) if (!(__VA_ARGS__))
+#define CATCH_CHECK_NOFAIL( ... ) (void)(0)
+
+#define CATCH_CHECK_THROWS( ... ) (void)(0)
+#define CATCH_CHECK_THROWS_AS( expr, exceptionType ) (void)(0)
+#define CATCH_CHECK_THROWS_WITH( expr, matcher ) (void)(0)
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CATCH_CHECK_THROWS_MATCHES( expr, exceptionType, matcher ) (void)(0)
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+#define CATCH_CHECK_NOTHROW( ... ) (void)(0)
+
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CATCH_CHECK_THAT( arg, matcher ) (void)(0)
+
+#define CATCH_REQUIRE_THAT( arg, matcher ) (void)(0)
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+
+#define CATCH_INFO( msg ) (void)(0)
+#define CATCH_UNSCOPED_INFO( msg ) (void)(0)
+#define CATCH_WARN( msg ) (void)(0)
+#define CATCH_CAPTURE( msg ) (void)(0)
+
+#define CATCH_TEST_CASE( ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+#define CATCH_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+#define CATCH_METHOD_AS_TEST_CASE( method, ... )
+#define CATCH_REGISTER_TEST_CASE( Function, ... ) (void)(0)
+#define CATCH_SECTION( ... )
+#define CATCH_DYNAMIC_SECTION( ... )
+#define CATCH_FAIL( ... ) (void)(0)
+#define CATCH_FAIL_CHECK( ... ) (void)(0)
+#define CATCH_SUCCEED( ... ) (void)(0)
+
+#define CATCH_ANON_TEST_CASE() INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define CATCH_TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(__VA_ARGS__)
+#define CATCH_TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(__VA_ARGS__)
+#define CATCH_TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION(className, __VA_ARGS__)
+#define CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION(className, __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE( ... ) CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#else
+#define CATCH_TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(__VA_ARGS__) )
+#define CATCH_TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(__VA_ARGS__) )
+#define CATCH_TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION(className, __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION(className, __VA_ARGS__ ) )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE( ... ) CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) CATCH_TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define CATCH_TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) CATCH_TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#endif
+
+// "BDD-style" convenience wrappers
+#define CATCH_SCENARIO( ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+#define CATCH_SCENARIO_METHOD( className, ... ) INTERNAL_CATCH_TESTCASE_METHOD_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ), className )
+#define CATCH_GIVEN( desc )
+#define CATCH_AND_GIVEN( desc )
+#define CATCH_WHEN( desc )
+#define CATCH_AND_WHEN( desc )
+#define CATCH_THEN( desc )
+#define CATCH_AND_THEN( desc )
+
+#define CATCH_STATIC_REQUIRE( ... ) (void)(0)
+#define CATCH_STATIC_REQUIRE_FALSE( ... ) (void)(0)
+
+// If CATCH_CONFIG_PREFIX_ALL is not defined then the CATCH_ prefix is not required
+#else
+
+#define REQUIRE( ... ) (void)(0)
+#define REQUIRE_FALSE( ... ) (void)(0)
+
+#define REQUIRE_THROWS( ... ) (void)(0)
+#define REQUIRE_THROWS_AS( expr, exceptionType ) (void)(0)
+#define REQUIRE_THROWS_WITH( expr, matcher ) (void)(0)
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define REQUIRE_THROWS_MATCHES( expr, exceptionType, matcher ) (void)(0)
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+#define REQUIRE_NOTHROW( ... ) (void)(0)
+
+#define CHECK( ... ) (void)(0)
+#define CHECK_FALSE( ... ) (void)(0)
+#define CHECKED_IF( ... ) if (__VA_ARGS__)
+#define CHECKED_ELSE( ... ) if (!(__VA_ARGS__))
+#define CHECK_NOFAIL( ... ) (void)(0)
+
+#define CHECK_THROWS( ... ) (void)(0)
+#define CHECK_THROWS_AS( expr, exceptionType ) (void)(0)
+#define CHECK_THROWS_WITH( expr, matcher ) (void)(0)
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CHECK_THROWS_MATCHES( expr, exceptionType, matcher ) (void)(0)
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+#define CHECK_NOTHROW( ... ) (void)(0)
+
+#if !defined(CATCH_CONFIG_DISABLE_MATCHERS)
+#define CHECK_THAT( arg, matcher ) (void)(0)
+
+#define REQUIRE_THAT( arg, matcher ) (void)(0)
+#endif // CATCH_CONFIG_DISABLE_MATCHERS
+
+#define INFO( msg ) (void)(0)
+#define UNSCOPED_INFO( msg ) (void)(0)
+#define WARN( msg ) (void)(0)
+#define CAPTURE( msg ) (void)(0)
+
+#define TEST_CASE( ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+#define TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+#define METHOD_AS_TEST_CASE( method, ... )
+#define REGISTER_TEST_CASE( Function, ... ) (void)(0)
+#define SECTION( ... )
+#define DYNAMIC_SECTION( ... )
+#define FAIL( ... ) (void)(0)
+#define FAIL_CHECK( ... ) (void)(0)
+#define SUCCEED( ... ) (void)(0)
+#define ANON_TEST_CASE() INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ))
+
+#ifndef CATCH_CONFIG_TRADITIONAL_MSVC_PREPROCESSOR
+#define TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(__VA_ARGS__)
+#define TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(__VA_ARGS__)
+#define TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION(className, __VA_ARGS__)
+#define TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION(className, __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE( ... ) TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#else
+#define TEMPLATE_TEST_CASE( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_NO_REGISTRATION(__VA_ARGS__) )
+#define TEMPLATE_TEST_CASE_SIG( ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_SIG_NO_REGISTRATION(__VA_ARGS__) )
+#define TEMPLATE_TEST_CASE_METHOD( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_NO_REGISTRATION(className, __VA_ARGS__ ) )
+#define TEMPLATE_TEST_CASE_METHOD_SIG( className, ... ) INTERNAL_CATCH_EXPAND_VARGS( INTERNAL_CATCH_TEMPLATE_TEST_CASE_METHOD_SIG_NO_REGISTRATION(className, __VA_ARGS__ ) )
+#define TEMPLATE_PRODUCT_TEST_CASE( ... ) TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_SIG( ... ) TEMPLATE_TEST_CASE( __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD( className, ... ) TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#define TEMPLATE_PRODUCT_TEST_CASE_METHOD_SIG( className, ... ) TEMPLATE_TEST_CASE_METHOD( className, __VA_ARGS__ )
+#endif
+
+#define STATIC_REQUIRE( ... ) (void)(0)
+#define STATIC_REQUIRE_FALSE( ... ) (void)(0)
+
+#endif
+
+#define CATCH_TRANSLATE_EXCEPTION( signature ) INTERNAL_CATCH_TRANSLATE_EXCEPTION_NO_REG( INTERNAL_CATCH_UNIQUE_NAME( catch_internal_ExceptionTranslator ), signature )
+
+// "BDD-style" convenience wrappers
+#define SCENARIO( ... ) INTERNAL_CATCH_TESTCASE_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ) )
+#define SCENARIO_METHOD( className, ... ) INTERNAL_CATCH_TESTCASE_METHOD_NO_REGISTRATION(INTERNAL_CATCH_UNIQUE_NAME( ____C_A_T_C_H____T_E_S_T____ ), className )
+
+#define GIVEN( desc )
+#define AND_GIVEN( desc )
+#define WHEN( desc )
+#define AND_WHEN( desc )
+#define THEN( desc )
+#define AND_THEN( desc )
+
+using Catch::Detail::Approx;
+
+#endif
+
+#endif // ! CATCH_CONFIG_IMPL_ONLY
+
+// start catch_reenable_warnings.h
+
+
+#ifdef __clang__
+# ifdef __ICC // icpc defines the __clang__ macro
+# pragma warning(pop)
+# else
+# pragma clang diagnostic pop
+# endif
+#elif defined __GNUC__
+# pragma GCC diagnostic pop
+#endif
+
+// end catch_reenable_warnings.h
+// end catch.hpp
+#endif // TWOBLUECUBES_SINGLE_INCLUDE_CATCH_HPP_INCLUDED
+
--- /dev/null
+Boost Software License - Version 1.0 - August 17th, 2003
+
+Permission is hereby granted, free of charge, to any person or organization
+obtaining a copy of the software and accompanying documentation covered by
+this license (the "Software") to use, reproduce, display, distribute,
+execute, and transmit the Software, and to prepare derivative works of the
+Software, and to permit third-parties to whom the Software is furnished to
+do so, all subject to the following:
+
+The copyright notices in the Software and this entire statement, including
+the above license grant, this restriction and the following disclaimer,
+must be included in all copies of the Software, in whole or in part, and
+all derivative works of the Software, unless such copies or derivative
+works are solely in the form of machine-executable object code generated by
+a source language processor.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE, TITLE AND NON-INFRINGEMENT. IN NO EVENT
+SHALL THE COPYRIGHT HOLDERS OR ANYONE DISTRIBUTING THE SOFTWARE BE LIABLE
+FOR ANY DAMAGES OR OTHER LIABILITY, WHETHER IN CONTRACT, TORT OR OTHERWISE,
+ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER
+DEALINGS IN THE SOFTWARE.
--- /dev/null
+#pragma once
+
+#include "catch.hpp"
+#include "utils.h"
+#include <chrono>
+#include <cstdio>
+#include <exception>
+#include <fstream>
+#include <iostream>
+#include <ostream>
+#include <sstream>
+#include <string>
+#include <iomanip>
+
+#define SPDLOG_ACTIVE_LEVEL SPDLOG_LEVEL_DEBUG
+
+#include "spdlog/spdlog.h"
+#include "spdlog/async.h"
+#include "spdlog/sinks/basic_file_sink.h"
+#include "spdlog/sinks/daily_file_sink.h"
+#include "spdlog/sinks/null_sink.h"
+#include "spdlog/sinks/ostream_sink.h"
+#include "spdlog/sinks/rotating_file_sink.h"
+#include "spdlog/sinks/stdout_color_sinks.h"
+#include "spdlog/details/pattern_formatter.h"
\ No newline at end of file
--- /dev/null
+#define CATCH_CONFIG_MAIN
+#include "catch.hpp"
\ No newline at end of file
--- /dev/null
+test_sources = files([
+ 'test_file_helper.cpp',
+ 'test_file_logging.cpp',
+ 'test_daily_logger.cpp',
+ 'test_misc.cpp',
+ 'test_pattern_formatter.cpp',
+ 'test_async.cpp',
+ 'test_registry.cpp',
+ 'test_macros.cpp',
+ 'utils.cpp',
+ 'main.cpp',
+ 'test_mpmc_q.cpp',
+ 'test_dup_filter.cpp',
+ 'test_fmt_helper.cpp',
+ 'test_stdout_api.cpp',
+ 'test_backtrace.cpp',
+ 'test_create_dir.cpp'
+])
+
+if not get_option('no_exceptions')
+ test_sources += 'test_errors.cpp'
+endif
+
+global_test_deps = []
+
+# -----------------------------------------------------
+# --- Add the systemd test if libsystemd is found ---
+# -----------------------------------------------------
+
+systemd_dep = dependency('libsystemd', required: false)
+
+if systemd_dep.found()
+ test_sources += 'test_systemd.cpp'
+ global_test_deps += systemd_dep
+endif
+
+# --------------------------------------
+# --- Build the test executables ---
+# --------------------------------------
+if get_option('enable_tests')
+ test_exe = executable('spdlog-utests', test_sources, dependencies: global_test_deps + [spdlog_dep])
+ test('test_spdlog', test_exe, is_parallel : false)
+endif
+
+if get_option('enable_tests_ho')
+ test_exe = executable('spdlog-utests-ho', test_sources, dependencies: global_test_deps + [spdlog_headeronly_dep])
+ test('test_spdlog-ho', test_exe, is_parallel : false)
+endif
\ No newline at end of file
--- /dev/null
+#include "includes.h"
+#include "spdlog/async.h"
+#include "spdlog/sinks/basic_file_sink.h"
+#include "test_sink.h"
+
+TEST_CASE("basic async test ", "[async]")
+{
+ using namespace spdlog;
+ auto test_sink = std::make_shared<sinks::test_sink_mt>();
+ size_t overrun_counter = 0;
+ size_t queue_size = 128;
+ size_t messages = 256;
+ {
+ auto tp = std::make_shared<details::thread_pool>(queue_size, 1);
+ auto logger = std::make_shared<async_logger>("as", test_sink, tp, async_overflow_policy::block);
+ for (size_t i = 0; i < messages; i++)
+ {
+ logger->info("Hello message #{}", i);
+ }
+ logger->flush();
+ overrun_counter = tp->overrun_counter();
+ }
+ REQUIRE(test_sink->msg_counter() == messages);
+ REQUIRE(test_sink->flush_counter() == 1);
+ REQUIRE(overrun_counter == 0);
+}
+
+TEST_CASE("discard policy ", "[async]")
+{
+ using namespace spdlog;
+ auto test_sink = std::make_shared<sinks::test_sink_mt>();
+ test_sink->set_delay(std::chrono::milliseconds(1));
+ size_t queue_size = 4;
+ size_t messages = 1024;
+
+ auto tp = std::make_shared<details::thread_pool>(queue_size, 1);
+ auto logger = std::make_shared<async_logger>("as", test_sink, tp, async_overflow_policy::overrun_oldest);
+ for (size_t i = 0; i < messages; i++)
+ {
+ logger->info("Hello message");
+ }
+ REQUIRE(test_sink->msg_counter() < messages);
+ REQUIRE(tp->overrun_counter() > 0);
+}
+
+TEST_CASE("discard policy using factory ", "[async]")
+{
+ using namespace spdlog;
+ size_t queue_size = 4;
+ size_t messages = 1024;
+ spdlog::init_thread_pool(queue_size, 1);
+
+ auto logger = spdlog::create_async_nb<sinks::test_sink_mt>("as2");
+ auto test_sink = std::static_pointer_cast<sinks::test_sink_mt>(logger->sinks()[0]);
+ test_sink->set_delay(std::chrono::milliseconds(1));
+
+ for (size_t i = 0; i < messages; i++)
+ {
+ logger->info("Hello message");
+ }
+
+ REQUIRE(test_sink->msg_counter() < messages);
+ spdlog::drop_all();
+}
+
+TEST_CASE("flush", "[async]")
+{
+ using namespace spdlog;
+ auto test_sink = std::make_shared<sinks::test_sink_mt>();
+ size_t queue_size = 256;
+ size_t messages = 256;
+ {
+ auto tp = std::make_shared<details::thread_pool>(queue_size, 1);
+ auto logger = std::make_shared<async_logger>("as", test_sink, tp, async_overflow_policy::block);
+ for (size_t i = 0; i < messages; i++)
+ {
+ logger->info("Hello message #{}", i);
+ }
+
+ logger->flush();
+ }
+ // std::this_thread::sleep_for(std::chrono::milliseconds(250));
+ REQUIRE(test_sink->msg_counter() == messages);
+ REQUIRE(test_sink->flush_counter() == 1);
+}
+
+TEST_CASE("async periodic flush", "[async]")
+{
+ using namespace spdlog;
+
+ auto logger = spdlog::create_async<sinks::test_sink_mt>("as");
+
+ auto test_sink = std::static_pointer_cast<sinks::test_sink_mt>(logger->sinks()[0]);
+
+ spdlog::flush_every(std::chrono::seconds(1));
+ std::this_thread::sleep_for(std::chrono::milliseconds(1100));
+ REQUIRE(test_sink->flush_counter() == 1);
+ spdlog::flush_every(std::chrono::seconds(0));
+ spdlog::drop_all();
+}
+
+TEST_CASE("tp->wait_empty() ", "[async]")
+{
+ using namespace spdlog;
+ auto test_sink = std::make_shared<sinks::test_sink_mt>();
+ test_sink->set_delay(std::chrono::milliseconds(5));
+ size_t messages = 100;
+
+ auto tp = std::make_shared<details::thread_pool>(messages, 2);
+ auto logger = std::make_shared<async_logger>("as", test_sink, tp, async_overflow_policy::block);
+ for (size_t i = 0; i < messages; i++)
+ {
+ logger->info("Hello message #{}", i);
+ }
+ logger->flush();
+ tp.reset();
+
+ REQUIRE(test_sink->msg_counter() == messages);
+ REQUIRE(test_sink->flush_counter() == 1);
+}
+
+TEST_CASE("multi threads", "[async]")
+{
+ using namespace spdlog;
+ auto test_sink = std::make_shared<sinks::test_sink_mt>();
+ size_t queue_size = 128;
+ size_t messages = 256;
+ size_t n_threads = 10;
+ {
+ auto tp = std::make_shared<details::thread_pool>(queue_size, 1);
+ auto logger = std::make_shared<async_logger>("as", test_sink, tp, async_overflow_policy::block);
+
+ std::vector<std::thread> threads;
+ for (size_t i = 0; i < n_threads; i++)
+ {
+ threads.emplace_back([logger, messages] {
+ for (size_t j = 0; j < messages; j++)
+ {
+ logger->info("Hello message #{}", j);
+ }
+ });
+ logger->flush();
+ }
+
+ for (auto &t : threads)
+ {
+ t.join();
+ }
+ }
+
+ REQUIRE(test_sink->msg_counter() == messages * n_threads);
+ REQUIRE(test_sink->flush_counter() == n_threads);
+}
+
+TEST_CASE("to_file", "[async]")
+{
+ prepare_logdir();
+ size_t messages = 1024;
+ size_t tp_threads = 1;
+ std::string filename = "test_logs/async_test.log";
+ {
+ auto file_sink = std::make_shared<spdlog::sinks::basic_file_sink_mt>(filename, true);
+ auto tp = std::make_shared<spdlog::details::thread_pool>(messages, tp_threads);
+ auto logger = std::make_shared<spdlog::async_logger>("as", std::move(file_sink), std::move(tp));
+
+ for (size_t j = 0; j < messages; j++)
+ {
+ logger->info("Hello message #{}", j);
+ }
+ }
+
+ REQUIRE(count_lines(filename) == messages);
+ auto contents = file_contents(filename);
+ REQUIRE(ends_with(contents, std::string("Hello message #1023\n")));
+}
+
+TEST_CASE("to_file multi-workers", "[async]")
+{
+ prepare_logdir();
+ size_t messages = 1024 * 10;
+ size_t tp_threads = 10;
+ std::string filename = "test_logs/async_test.log";
+ {
+ auto file_sink = std::make_shared<spdlog::sinks::basic_file_sink_mt>(filename, true);
+ auto tp = std::make_shared<spdlog::details::thread_pool>(messages, tp_threads);
+ auto logger = std::make_shared<spdlog::async_logger>("as", std::move(file_sink), std::move(tp));
+
+ for (size_t j = 0; j < messages; j++)
+ {
+ logger->info("Hello message #{}", j);
+ }
+ }
+
+ REQUIRE(count_lines(filename) == messages);
+}
--- /dev/null
+#include "includes.h"
+#include "test_sink.h"
+#include "spdlog/async.h"
+
+TEST_CASE("bactrace1", "[bactrace]")
+{
+
+ using spdlog::sinks::test_sink_st;
+ auto test_sink = std::make_shared<test_sink_st>();
+ size_t backtrace_size = 5;
+
+ spdlog::logger logger("test-backtrace", test_sink);
+ logger.set_pattern("%v");
+ logger.enable_backtrace(backtrace_size);
+
+ logger.info("info message");
+ for (int i = 0; i < 100; i++)
+ logger.debug("debug message {}", i);
+
+ REQUIRE(test_sink->lines().size() == 1);
+ REQUIRE(test_sink->lines()[0] == "info message");
+
+ logger.dump_backtrace();
+ REQUIRE(test_sink->lines().size() == backtrace_size + 3);
+ REQUIRE(test_sink->lines()[1] == "****************** Backtrace Start ******************");
+ REQUIRE(test_sink->lines()[2] == "debug message 95");
+ REQUIRE(test_sink->lines()[3] == "debug message 96");
+ REQUIRE(test_sink->lines()[4] == "debug message 97");
+ REQUIRE(test_sink->lines()[5] == "debug message 98");
+ REQUIRE(test_sink->lines()[6] == "debug message 99");
+ REQUIRE(test_sink->lines()[7] == "****************** Backtrace End ********************");
+}
+
+TEST_CASE("bactrace-async", "[bactrace]")
+{
+ using spdlog::sinks::test_sink_mt;
+ auto test_sink = std::make_shared<test_sink_mt>();
+ using spdlog::details::os::sleep_for_millis;
+
+ size_t backtrace_size = 5;
+
+ spdlog::init_thread_pool(120, 1);
+ auto logger = std::make_shared<spdlog::async_logger>("test-bactrace-async", test_sink, spdlog::thread_pool());
+ logger->set_pattern("%v");
+ logger->enable_backtrace(backtrace_size);
+
+ logger->info("info message");
+ for (int i = 0; i < 100; i++)
+ logger->debug("debug message {}", i);
+
+ sleep_for_millis(10);
+ REQUIRE(test_sink->lines().size() == 1);
+ REQUIRE(test_sink->lines()[0] == "info message");
+
+ logger->dump_backtrace();
+ sleep_for_millis(100); // give time for the async dump to complete
+ REQUIRE(test_sink->lines().size() == backtrace_size + 3);
+ REQUIRE(test_sink->lines()[1] == "****************** Backtrace Start ******************");
+ REQUIRE(test_sink->lines()[2] == "debug message 95");
+ REQUIRE(test_sink->lines()[3] == "debug message 96");
+ REQUIRE(test_sink->lines()[4] == "debug message 97");
+ REQUIRE(test_sink->lines()[5] == "debug message 98");
+ REQUIRE(test_sink->lines()[6] == "debug message 99");
+ REQUIRE(test_sink->lines()[7] == "****************** Backtrace End ********************");
+}
--- /dev/null
+/*
+ * This content is released under the MIT License as specified in https://raw.githubusercontent.com/gabime/spdlog/master/LICENSE
+ */
+#include "includes.h"
+
+using spdlog::details::os::create_dir;
+using spdlog::details::os::path_exists;
+
+bool try_create_dir(const char *path, const char *normalized_path)
+{
+ auto rv = create_dir(path);
+ REQUIRE(rv == true);
+ return path_exists(normalized_path);
+}
+
+TEST_CASE("create_dir", "[create_dir]")
+{
+ prepare_logdir();
+
+ REQUIRE(try_create_dir("test_logs/dir1/dir1", "test_logs/dir1/dir1"));
+ REQUIRE(try_create_dir("test_logs/dir1/dir1", "test_logs/dir1/dir1")); // test existing
+ REQUIRE(try_create_dir("test_logs/dir1///dir2//", "test_logs/dir1/dir2"));
+ REQUIRE(try_create_dir("./test_logs/dir1/dir3", "test_logs/dir1/dir3"));
+ REQUIRE(try_create_dir("test_logs/../test_logs/dir1/dir4", "test_logs/dir1/dir4"));
+
+#ifdef WIN32
+ // test backslash folder separator
+ REQUIRE(try_create_dir("test_logs\\dir1\\dir222", "test_logs\\dir1\\dir222"));
+ REQUIRE(try_create_dir("test_logs\\dir1\\dir223\\", "test_logs\\dir1\\dir223\\"));
+ REQUIRE(try_create_dir(".\\test_logs\\dir1\\dir2\\dir99\\..\\dir23", "test_logs\\dir1\\dir2\\dir23"));
+ REQUIRE(try_create_dir("test_logs\\..\\test_logs\\dir1\\dir5", "test_logs\\dir1\\dir5"));
+#endif
+}
+
+TEST_CASE("create_invalid_dir", "[create_dir]")
+{
+ REQUIRE(create_dir("") == false);
+ REQUIRE(create_dir(spdlog::filename_t{}) == false);
+#ifdef __linux__
+ REQUIRE(create_dir("/proc/spdlog-utest") == false);
+#endif
+}
+
+TEST_CASE("dir_name", "[create_dir]")
+{
+ using spdlog::details::os::dir_name;
+ REQUIRE(dir_name("").empty());
+ REQUIRE(dir_name("dir").empty());
+
+#ifdef WIN32
+ REQUIRE(dir_name(R"(dir\)") == "dir");
+ REQUIRE(dir_name(R"(dir\\\)") == R"(dir\\)");
+ REQUIRE(dir_name(R"(dir\file)") == "dir");
+ REQUIRE(dir_name(R"(dir/file)") == "dir");
+ REQUIRE(dir_name(R"(dir\file.txt)") == "dir");
+ REQUIRE(dir_name(R"(dir/file)") == "dir");
+ REQUIRE(dir_name(R"(dir\file.txt\)") == R"(dir\file.txt)");
+ REQUIRE(dir_name(R"(dir/file.txt/)") == R"(dir\file.txt)");
+ REQUIRE(dir_name(R"(\dir\file.txt)") == R"(\dir)");
+ REQUIRE(dir_name(R"(/dir/file.txt)") == R"(\dir)");
+ REQUIRE(dir_name(R"(\\dir\file.txt)") == R"(\\dir)");
+ REQUIRE(dir_name(R"(//dir/file.txt)") == R"(\\dir)");
+ REQUIRE(dir_name(R"(..\file.txt)") == "..");
+ REQUIRE(dir_name(R"(../file.txt)") == "..");
+ REQUIRE(dir_name(R"(.\file.txt)") == ".");
+ REQUIRE(dir_name(R"(./file.txt)") == ".");
+ REQUIRE(dir_name(R"(c:\\a\b\c\d\file.txt)") == R"(c:\\a\b\c\d)");
+ REQUIRE(dir_name(R"(c://a/b/c/d/file.txt)") == R"(c:\\a\b\c\d)");
+#else
+ REQUIRE(dir_name("dir/") == "dir");
+ REQUIRE(dir_name("dir///") == "dir//");
+ REQUIRE(dir_name("dir/file") == "dir");
+ REQUIRE(dir_name("dir/file.txt") == "dir");
+ REQUIRE(dir_name("dir/file.txt/") == "dir/file.txt");
+ REQUIRE(dir_name("/dir/file.txt") == "/dir");
+ REQUIRE(dir_name("//dir/file.txt") == "//dir");
+ REQUIRE(dir_name("../file.txt") == "..");
+ REQUIRE(dir_name("./file.txt") == ".");
+#endif
+}
--- /dev/null
+/*
+ * This content is released under the MIT License as specified in https://raw.githubusercontent.com/gabime/spdlog/master/LICENSE
+ */
+#include "includes.h"
+
+TEST_CASE("daily_logger with dateonly calculator", "[daily_logger]")
+{
+ using sink_type = spdlog::sinks::daily_file_sink<std::mutex, spdlog::sinks::daily_filename_calculator>;
+
+ prepare_logdir();
+
+ // calculate filename (time based)
+ std::string basename = "test_logs/daily_dateonly";
+ std::tm tm = spdlog::details::os::localtime();
+ spdlog::memory_buf_t w;
+ fmt::format_to(w, "{}_{:04d}-{:02d}-{:02d}", basename, tm.tm_year + 1900, tm.tm_mon + 1, tm.tm_mday);
+
+ auto logger = spdlog::create<sink_type>("logger", basename, 0, 0);
+ for (int i = 0; i < 10; ++i)
+ {
+
+ logger->info("Test message {}", i);
+ }
+ logger->flush();
+
+ auto filename = fmt::to_string(w);
+ REQUIRE(count_lines(filename) == 10);
+}
+
+struct custom_daily_file_name_calculator
+{
+ static spdlog::filename_t calc_filename(const spdlog::filename_t &basename, const tm &now_tm)
+ {
+ spdlog::memory_buf_t w;
+ fmt::format_to(w, "{}{:04d}{:02d}{:02d}", basename, now_tm.tm_year + 1900, now_tm.tm_mon + 1, now_tm.tm_mday);
+ return fmt::to_string(w);
+ }
+};
+
+TEST_CASE("daily_logger with custom calculator", "[daily_logger]")
+{
+ using sink_type = spdlog::sinks::daily_file_sink<std::mutex, custom_daily_file_name_calculator>;
+
+ prepare_logdir();
+
+ // calculate filename (time based)
+ std::string basename = "test_logs/daily_dateonly";
+ std::tm tm = spdlog::details::os::localtime();
+ spdlog::memory_buf_t w;
+ fmt::format_to(w, "{}{:04d}{:02d}{:02d}", basename, tm.tm_year + 1900, tm.tm_mon + 1, tm.tm_mday);
+
+ auto logger = spdlog::create<sink_type>("logger", basename, 0, 0);
+ for (int i = 0; i < 10; ++i)
+ {
+ logger->info("Test message {}", i);
+ }
+
+ logger->
+
+ flush();
+
+ auto filename = fmt::to_string(w);
+ REQUIRE(count_lines(filename) == 10);
+}
+
+/*
+ * File name calculations
+ */
+
+TEST_CASE("rotating_file_sink::calc_filename1", "[rotating_file_sink]]")
+{
+ auto filename = spdlog::sinks::rotating_file_sink_st::calc_filename("rotated.txt", 3);
+ REQUIRE(filename == "rotated.3.txt");
+}
+
+TEST_CASE("rotating_file_sink::calc_filename2", "[rotating_file_sink]]")
+{
+ auto filename = spdlog::sinks::rotating_file_sink_st::calc_filename("rotated", 3);
+ REQUIRE(filename == "rotated.3");
+}
+
+TEST_CASE("rotating_file_sink::calc_filename3", "[rotating_file_sink]]")
+{
+ auto filename = spdlog::sinks::rotating_file_sink_st::calc_filename("rotated.txt", 0);
+ REQUIRE(filename == "rotated.txt");
+}
+
+// regex supported only from gcc 4.9 and above
+#if defined(_MSC_VER) || !(__GNUC__ <= 4 && __GNUC_MINOR__ < 9)
+
+#include <regex>
+
+TEST_CASE("daily_file_sink::daily_filename_calculator", "[daily_file_sink]]")
+{
+ // daily_YYYY-MM-DD_hh-mm.txt
+ auto filename = spdlog::sinks::daily_filename_calculator::calc_filename("daily.txt", spdlog::details::os::localtime());
+ // date regex based on https://www.regular-expressions.info/dates.html
+ std::regex re(R"(^daily_(19|20)\d\d-(0[1-9]|1[012])-(0[1-9]|[12][0-9]|3[01])\.txt$)");
+ std::smatch match;
+ REQUIRE(std::regex_match(filename, match, re));
+}
+#endif
+
+/* Test removal of old files */
+static spdlog::details::log_msg create_msg(std::chrono::seconds offset)
+{
+ using spdlog::log_clock;
+ spdlog::details::log_msg msg{"test", spdlog::level::info, "Hello Message"};
+ msg.time = log_clock::now() + offset;
+ return msg;
+}
+
+static void test_rotate(int days_to_run, uint16_t max_days, uint16_t expected_n_files)
+{
+ using spdlog::log_clock;
+ using spdlog::details::log_msg;
+ using spdlog::sinks::daily_file_sink_st;
+ using namespace spdlog::details;
+
+ prepare_logdir();
+
+ std::string basename = "test_logs/daily_rotate.txt";
+ daily_file_sink_st sink{basename, 2, 30, true, max_days};
+
+ // simulate messages with 24 intervals
+
+ for (int i = 0; i < days_to_run; i++)
+ {
+ auto offset = std::chrono::seconds{24 * 3600 * i};
+ sink.log(create_msg(offset));
+ }
+
+ REQUIRE(count_files("test_logs") == static_cast<size_t>(expected_n_files));
+}
+
+TEST_CASE("daily_logger rotate", "[daily_file_sink]")
+{
+ int days_to_run = 1;
+ test_rotate(days_to_run, 0, 1);
+ test_rotate(days_to_run, 1, 1);
+ test_rotate(days_to_run, 3, 1);
+ test_rotate(days_to_run, 10, 1);
+
+ days_to_run = 10;
+ test_rotate(days_to_run, 0, 10);
+ test_rotate(days_to_run, 1, 1);
+ test_rotate(days_to_run, 3, 3);
+ test_rotate(days_to_run, 9, 9);
+ test_rotate(days_to_run, 10, 10);
+ test_rotate(days_to_run, 11, 10);
+ test_rotate(days_to_run, 20, 10);
+}
\ No newline at end of file
--- /dev/null
+#include "includes.h"
+#include "spdlog/sinks/dup_filter_sink.h"
+#include "test_sink.h"
+
+using namespace spdlog;
+using namespace spdlog::sinks;
+
+TEST_CASE("dup_filter_test1", "[dup_filter_sink]")
+{
+ dup_filter_sink_st dup_sink{std::chrono::seconds{5}};
+ auto test_sink = std::make_shared<test_sink_mt>();
+ dup_sink.add_sink(test_sink);
+
+ for (int i = 0; i < 10; i++)
+ {
+ dup_sink.log(spdlog::details::log_msg{"test", spdlog::level::info, "message1"});
+ }
+
+ REQUIRE(test_sink->msg_counter() == 1);
+}
+
+TEST_CASE("dup_filter_test2", "[dup_filter_sink]")
+{
+ dup_filter_sink_st dup_sink{std::chrono::seconds{0}};
+ auto test_sink = std::make_shared<test_sink_mt>();
+ dup_sink.add_sink(test_sink);
+
+ for (int i = 0; i < 10; i++)
+ {
+ dup_sink.log(spdlog::details::log_msg{"test", spdlog::level::info, "message1"});
+ std::this_thread::sleep_for(std::chrono::milliseconds(5));
+ }
+
+ REQUIRE(test_sink->msg_counter() == 10);
+}
+
+TEST_CASE("dup_filter_test3", "[dup_filter_sink]")
+{
+ dup_filter_sink_st dup_sink{std::chrono::seconds{1}};
+ auto test_sink = std::make_shared<test_sink_mt>();
+ dup_sink.add_sink(test_sink);
+
+ for (int i = 0; i < 10; i++)
+ {
+ dup_sink.log(spdlog::details::log_msg{"test", spdlog::level::info, "message1"});
+ dup_sink.log(spdlog::details::log_msg{"test", spdlog::level::info, "message2"});
+ }
+
+ REQUIRE(test_sink->msg_counter() == 20);
+}
+
+TEST_CASE("dup_filter_test4", "[dup_filter_sink]")
+{
+ dup_filter_sink_mt dup_sink{std::chrono::milliseconds{10}};
+ auto test_sink = std::make_shared<test_sink_mt>();
+ dup_sink.add_sink(test_sink);
+
+ dup_sink.log(spdlog::details::log_msg{"test", spdlog::level::info, "message"});
+ std::this_thread::sleep_for(std::chrono::milliseconds(50));
+ dup_sink.log(spdlog::details::log_msg{"test", spdlog::level::info, "message"});
+ REQUIRE(test_sink->msg_counter() == 2);
+}
+
+TEST_CASE("dup_filter_test5", "[dup_filter_sink]")
+{
+ dup_filter_sink_mt dup_sink{std::chrono::seconds{5}};
+ auto test_sink = std::make_shared<test_sink_mt>();
+ dup_sink.add_sink(test_sink);
+
+ dup_sink.log(spdlog::details::log_msg{"test", spdlog::level::info, "message1"});
+ dup_sink.log(spdlog::details::log_msg{"test", spdlog::level::info, "message1"});
+ dup_sink.log(spdlog::details::log_msg{"test", spdlog::level::info, "message1"});
+ dup_sink.log(spdlog::details::log_msg{"test", spdlog::level::info, "message2"});
+
+ REQUIRE(test_sink->msg_counter() == 3); // skip 2 messages but log the "skipped.." message before message2
+}
--- /dev/null
+/*
+ * This content is released under the MIT License as specified in https://raw.githubusercontent.com/gabime/spdlog/master/LICENSE
+ */
+#include "includes.h"
+
+#include <iostream>
+
+class failing_sink : public spdlog::sinks::base_sink<std::mutex>
+{
+public:
+ failing_sink() = default;
+ ~failing_sink() final = default;
+
+protected:
+ void sink_it_(const spdlog::details::log_msg &) final
+ {
+ throw std::runtime_error("some error happened during log");
+ }
+
+ void flush_() final
+ {
+ throw std::runtime_error("some error happened during flush");
+ }
+};
+
+TEST_CASE("default_error_handler", "[errors]]")
+{
+ prepare_logdir();
+ std::string filename = "test_logs/simple_log.txt";
+
+ auto logger = spdlog::create<spdlog::sinks::basic_file_sink_mt>("test-error", filename, true);
+ logger->set_pattern("%v");
+ logger->info("Test message {} {}", 1);
+ logger->info("Test message {}", 2);
+ logger->flush();
+
+ REQUIRE(file_contents(filename) == std::string("Test message 2\n"));
+ REQUIRE(count_lines(filename) == 1);
+}
+
+struct custom_ex
+{};
+TEST_CASE("custom_error_handler", "[errors]]")
+{
+ prepare_logdir();
+ std::string filename = "test_logs/simple_log.txt";
+ auto logger = spdlog::create<spdlog::sinks::basic_file_sink_mt>("logger", filename, true);
+ logger->flush_on(spdlog::level::info);
+ logger->set_error_handler([=](const std::string &) { throw custom_ex(); });
+ logger->info("Good message #1");
+
+ REQUIRE_THROWS_AS(logger->info("Bad format msg {} {}", "xxx"), custom_ex);
+ logger->info("Good message #2");
+ REQUIRE(count_lines(filename) == 2);
+}
+
+TEST_CASE("default_error_handler2", "[errors]]")
+{
+ spdlog::drop_all();
+ auto logger = spdlog::create<failing_sink>("failed_logger");
+ logger->set_error_handler([=](const std::string &) { throw custom_ex(); });
+ REQUIRE_THROWS_AS(logger->info("Some message"), custom_ex);
+}
+
+TEST_CASE("flush_error_handler", "[errors]]")
+{
+ spdlog::drop_all();
+ auto logger = spdlog::create<failing_sink>("failed_logger");
+ logger->set_error_handler([=](const std::string &) { throw custom_ex(); });
+ REQUIRE_THROWS_AS(logger->flush(), custom_ex);
+}
+
+TEST_CASE("async_error_handler", "[errors]]")
+{
+ prepare_logdir();
+ std::string err_msg("log failed with some msg");
+
+ std::string filename = "test_logs/simple_async_log.txt";
+ {
+ spdlog::init_thread_pool(128, 1);
+ auto logger = spdlog::create_async<spdlog::sinks::basic_file_sink_mt>("logger", filename, true);
+ logger->set_error_handler([=](const std::string &) {
+ std::ofstream ofs("test_logs/custom_err.txt");
+ if (!ofs)
+ {
+ throw std::runtime_error("Failed open test_logs/custom_err.txt");
+ }
+ ofs << err_msg;
+ });
+ logger->info("Good message #1");
+ logger->info("Bad format msg {} {}", "xxx");
+ logger->info("Good message #2");
+ spdlog::drop("logger"); // force logger to drain the queue and shutdown
+ }
+ spdlog::init_thread_pool(128, 1);
+ REQUIRE(count_lines(filename) == 2);
+ REQUIRE(file_contents("test_logs/custom_err.txt") == err_msg);
+}
+
+// Make sure async error handler is executed
+TEST_CASE("async_error_handler2", "[errors]]")
+{
+ prepare_logdir();
+ std::string err_msg("This is async handler error message");
+ {
+ spdlog::details::os::create_dir("test_logs");
+ spdlog::init_thread_pool(128, 1);
+ auto logger = spdlog::create_async<failing_sink>("failed_logger");
+ logger->set_error_handler([=](const std::string &) {
+ std::ofstream ofs("test_logs/custom_err2.txt");
+ if (!ofs)
+ throw std::runtime_error("Failed open test_logs/custom_err2.txt");
+ ofs << err_msg;
+ });
+ logger->info("Hello failure");
+ spdlog::drop("failed_logger"); // force logger to drain the queue and shutdown
+ }
+
+ spdlog::init_thread_pool(128, 1);
+ REQUIRE(file_contents("test_logs/custom_err2.txt") == err_msg);
+}
--- /dev/null
+/*
+ * This content is released under the MIT License as specified in https://raw.githubusercontent.com/gabime/spdlog/master/LICENSE
+ */
+#include "includes.h"
+
+using spdlog::details::file_helper;
+using spdlog::details::log_msg;
+
+static const std::string target_filename = "test_logs/file_helper_test.txt";
+
+static void write_with_helper(file_helper &helper, size_t howmany)
+{
+ spdlog::memory_buf_t formatted;
+ fmt::format_to(formatted, "{}", std::string(howmany, '1'));
+ helper.write(formatted);
+ helper.flush();
+}
+
+TEST_CASE("file_helper_filename", "[file_helper::filename()]]")
+{
+ prepare_logdir();
+
+ file_helper helper;
+ helper.open(target_filename);
+ REQUIRE(helper.filename() == target_filename);
+}
+
+TEST_CASE("file_helper_size", "[file_helper::size()]]")
+{
+ prepare_logdir();
+ size_t expected_size = 123;
+ {
+ file_helper helper;
+ helper.open(target_filename);
+ write_with_helper(helper, expected_size);
+ REQUIRE(static_cast<size_t>(helper.size()) == expected_size);
+ }
+ REQUIRE(get_filesize(target_filename) == expected_size);
+}
+
+TEST_CASE("file_helper_reopen", "[file_helper::reopen()]]")
+{
+ prepare_logdir();
+ file_helper helper;
+ helper.open(target_filename);
+ write_with_helper(helper, 12);
+ REQUIRE(helper.size() == 12);
+ helper.reopen(true);
+ REQUIRE(helper.size() == 0);
+}
+
+TEST_CASE("file_helper_reopen2", "[file_helper::reopen(false)]]")
+{
+ prepare_logdir();
+ size_t expected_size = 14;
+ file_helper helper;
+ helper.open(target_filename);
+ write_with_helper(helper, expected_size);
+ REQUIRE(helper.size() == expected_size);
+ helper.reopen(false);
+ REQUIRE(helper.size() == expected_size);
+}
+
+static void test_split_ext(const char *fname, const char *expect_base, const char *expect_ext)
+{
+ spdlog::filename_t filename(fname);
+ spdlog::filename_t expected_base(expect_base);
+ spdlog::filename_t expected_ext(expect_ext);
+
+#ifdef _WIN32 // replace folder sep
+ std::replace(filename.begin(), filename.end(), '/', '\\');
+ std::replace(expected_base.begin(), expected_base.end(), '/', '\\');
+#endif
+ spdlog::filename_t basename, ext;
+ std::tie(basename, ext) = file_helper::split_by_extension(filename);
+ REQUIRE(basename == expected_base);
+ REQUIRE(ext == expected_ext);
+}
+
+TEST_CASE("file_helper_split_by_extension", "[file_helper::split_by_extension()]]")
+{
+ test_split_ext("mylog.txt", "mylog", ".txt");
+ test_split_ext(".mylog.txt", ".mylog", ".txt");
+ test_split_ext(".mylog", ".mylog", "");
+ test_split_ext("/aaa/bb.d/mylog", "/aaa/bb.d/mylog", "");
+ test_split_ext("/aaa/bb.d/mylog.txt", "/aaa/bb.d/mylog", ".txt");
+ test_split_ext("aaa/bbb/ccc/mylog.txt", "aaa/bbb/ccc/mylog", ".txt");
+ test_split_ext("aaa/bbb/ccc/mylog.", "aaa/bbb/ccc/mylog.", "");
+ test_split_ext("aaa/bbb/ccc/.mylog.txt", "aaa/bbb/ccc/.mylog", ".txt");
+ test_split_ext("/aaa/bbb/ccc/mylog.txt", "/aaa/bbb/ccc/mylog", ".txt");
+ test_split_ext("/aaa/bbb/ccc/.mylog", "/aaa/bbb/ccc/.mylog", "");
+ test_split_ext("../mylog.txt", "../mylog", ".txt");
+ test_split_ext(".././mylog.txt", ".././mylog", ".txt");
+ test_split_ext(".././mylog.txt/xxx", ".././mylog.txt/xxx", "");
+ test_split_ext("/mylog.txt", "/mylog", ".txt");
+ test_split_ext("//mylog.txt", "//mylog", ".txt");
+ test_split_ext("", "", "");
+ test_split_ext(".", ".", "");
+ test_split_ext("..txt", ".", ".txt");
+}
--- /dev/null
+/*
+ * This content is released under the MIT License as specified in https://raw.githubusercontent.com/gabime/spdlog/master/LICENSE
+ */
+#include "includes.h"
+
+TEST_CASE("simple_file_logger", "[simple_logger]]")
+{
+ prepare_logdir();
+ std::string filename = "test_logs/simple_log";
+
+ auto logger = spdlog::create<spdlog::sinks::basic_file_sink_mt>("logger", filename);
+ logger->set_pattern("%v");
+
+ logger->info("Test message {}", 1);
+ logger->info("Test message {}", 2);
+
+ logger->flush();
+ REQUIRE(file_contents(filename) == std::string("Test message 1\nTest message 2\n"));
+ REQUIRE(count_lines(filename) == 2);
+}
+
+TEST_CASE("flush_on", "[flush_on]]")
+{
+ prepare_logdir();
+ std::string filename = "test_logs/simple_log";
+
+ auto logger = spdlog::create<spdlog::sinks::basic_file_sink_mt>("logger", filename);
+ logger->set_pattern("%v");
+ logger->set_level(spdlog::level::trace);
+ logger->flush_on(spdlog::level::info);
+ logger->trace("Should not be flushed");
+ REQUIRE(count_lines(filename) == 0);
+
+ logger->info("Test message {}", 1);
+ logger->info("Test message {}", 2);
+
+ REQUIRE(file_contents(filename) == std::string("Should not be flushed\nTest message 1\nTest message 2\n"));
+ REQUIRE(count_lines(filename) == 3);
+}
+
+TEST_CASE("rotating_file_logger1", "[rotating_logger]]")
+{
+ prepare_logdir();
+ size_t max_size = 1024 * 10;
+ std::string basename = "test_logs/rotating_log";
+ auto logger = spdlog::rotating_logger_mt("logger", basename, max_size, 0);
+
+ for (int i = 0; i < 10; ++i)
+ {
+ logger->info("Test message {}", i);
+ }
+
+ logger->flush();
+ auto filename = basename;
+ REQUIRE(count_lines(filename) == 10);
+}
+
+TEST_CASE("rotating_file_logger2", "[rotating_logger]]")
+{
+ prepare_logdir();
+ size_t max_size = 1024 * 10;
+ std::string basename = "test_logs/rotating_log";
+
+ {
+ // make an initial logger to create the first output file
+ auto logger = spdlog::rotating_logger_mt("logger", basename, max_size, 2, true);
+ for (int i = 0; i < 10; ++i)
+ {
+ logger->info("Test message {}", i);
+ }
+ // drop causes the logger destructor to be called, which is required so the
+ // next logger can rename the first output file.
+ spdlog::drop(logger->name());
+ }
+
+ auto logger = spdlog::rotating_logger_mt("logger", basename, max_size, 2, true);
+ for (int i = 0; i < 10; ++i)
+ {
+ logger->info("Test message {}", i);
+ }
+
+ logger->flush();
+ auto filename = basename;
+ REQUIRE(count_lines(filename) == 10);
+ for (int i = 0; i < 1000; i++)
+ {
+
+ logger->info("Test message {}", i);
+ }
+
+ logger->flush();
+ REQUIRE(get_filesize(filename) <= max_size);
+ auto filename1 = basename + ".1";
+ REQUIRE(get_filesize(filename1) <= max_size);
+}
--- /dev/null
+
+#include "includes.h"
+#include "spdlog/details/fmt_helper.h"
+
+using spdlog::memory_buf_t;
+
+void test_pad2(int n, const char *expected)
+{
+ memory_buf_t buf;
+ spdlog::details::fmt_helper::pad2(n, buf);
+ REQUIRE(fmt::to_string(buf) == expected);
+}
+
+void test_pad3(uint32_t n, const char *expected)
+{
+ memory_buf_t buf;
+ spdlog::details::fmt_helper::pad3(n, buf);
+ REQUIRE(fmt::to_string(buf) == expected);
+}
+
+void test_pad6(std::size_t n, const char *expected)
+{
+ memory_buf_t buf;
+ spdlog::details::fmt_helper::pad6(n, buf);
+ REQUIRE(fmt::to_string(buf) == expected);
+}
+
+void test_pad9(std::size_t n, const char *expected)
+{
+ memory_buf_t buf;
+ spdlog::details::fmt_helper::pad9(n, buf);
+ REQUIRE(fmt::to_string(buf) == expected);
+}
+
+TEST_CASE("pad2", "[fmt_helper]")
+{
+ test_pad2(0, "00");
+ test_pad2(3, "03");
+ test_pad2(23, "23");
+ test_pad2(123, "123");
+ test_pad2(1234, "1234");
+ test_pad2(-5, "-5");
+}
+
+TEST_CASE("pad3", "[fmt_helper]")
+{
+ test_pad3(0, "000");
+ test_pad3(3, "003");
+ test_pad3(23, "023");
+ test_pad3(123, "123");
+ test_pad3(1234, "1234");
+}
+
+TEST_CASE("pad6", "[fmt_helper]")
+{
+ test_pad6(0, "000000");
+ test_pad6(3, "000003");
+ test_pad6(23, "000023");
+ test_pad6(123, "000123");
+ test_pad6(1234, "001234");
+ test_pad6(12345, "012345");
+ test_pad6(123456, "123456");
+}
+
+TEST_CASE("pad9", "[fmt_helper]")
+{
+ test_pad9(0, "000000000");
+ test_pad9(3, "000000003");
+ test_pad9(23, "000000023");
+ test_pad9(123, "000000123");
+ test_pad9(1234, "000001234");
+ test_pad9(12345, "000012345");
+ test_pad9(123456, "000123456");
+ test_pad9(1234567, "001234567");
+ test_pad9(12345678, "012345678");
+ test_pad9(123456789, "123456789");
+ test_pad9(1234567891, "1234567891");
+}
--- /dev/null
+/*
+ * This content is released under the MIT License as specified in https://raw.githubusercontent.com/gabime/spdlog/master/LICENSE
+ */
+
+#include "includes.h"
+
+#if SPDLOG_ACTIVE_LEVEL != SPDLOG_LEVEL_DEBUG
+#error "Invalid SPDLOG_ACTIVE_LEVEL in test. Should be SPDLOG_LEVEL_DEBUG"
+#endif
+
+TEST_CASE("debug and trace w/o format string", "[macros]]")
+{
+
+ prepare_logdir();
+ std::string filename = "test_logs/simple_log";
+
+ auto logger = spdlog::create<spdlog::sinks::basic_file_sink_mt>("logger", filename);
+ logger->set_pattern("%v");
+ logger->set_level(spdlog::level::trace);
+
+ SPDLOG_LOGGER_TRACE(logger, "Test message 1");
+ SPDLOG_LOGGER_DEBUG(logger, "Test message 2");
+ logger->flush();
+
+ REQUIRE(ends_with(file_contents(filename), "Test message 2\n"));
+ REQUIRE(count_lines(filename) == 1);
+
+ spdlog::set_default_logger(logger);
+
+ SPDLOG_TRACE("Test message 3");
+ SPDLOG_DEBUG("Test message {}", 4);
+ logger->flush();
+
+ REQUIRE(ends_with(file_contents(filename), "Test message 4\n"));
+ REQUIRE(count_lines(filename) == 2);
+}
+
+TEST_CASE("disable param evaluation", "[macros]")
+{
+ SPDLOG_TRACE("Test message {}", throw std::runtime_error("Should not be evaluated"));
+}
+
+TEST_CASE("pass logger pointer", "[macros]")
+{
+ auto logger = spdlog::create<spdlog::sinks::null_sink_mt>("refmacro");
+ auto &ref = *logger;
+ SPDLOG_LOGGER_TRACE(&ref, "Test message 1");
+ SPDLOG_LOGGER_DEBUG(&ref, "Test message 2");
+}
+
+// ensure that even if right macro level is on- don't evaluate if the logger's level is not high enough
+// TEST_CASE("disable param evaluation2", "[macros]")
+//{
+// auto logger = std::make_shared<spdlog::logger>("test-macro");
+// logger->set_level(spdlog::level::off);
+// int x = 0;
+// SPDLOG_LOGGER_DEBUG(logger, "Test message {}", ++x);
+// REQUIRE(x == 0);
+//}
--- /dev/null
+#include "includes.h"
+#include "test_sink.h"
+#include "spdlog/fmt/bin_to_hex.h"
+
+template<class T>
+std::string log_info(const T &what, spdlog::level::level_enum logger_level = spdlog::level::info)
+{
+
+ std::ostringstream oss;
+ auto oss_sink = std::make_shared<spdlog::sinks::ostream_sink_mt>(oss);
+
+ spdlog::logger oss_logger("oss", oss_sink);
+ oss_logger.set_level(logger_level);
+ oss_logger.set_pattern("%v");
+ oss_logger.info(what);
+
+ return oss.str().substr(0, oss.str().length() - strlen(spdlog::details::os::default_eol));
+}
+
+TEST_CASE("basic_logging ", "[basic_logging]")
+{
+ // const char
+ REQUIRE(log_info("Hello") == "Hello");
+ REQUIRE(log_info("") == "");
+
+ // std::string
+ REQUIRE(log_info(std::string("Hello")) == "Hello");
+ REQUIRE(log_info(std::string()) == std::string());
+
+ // Numbers
+ REQUIRE(log_info(5) == "5");
+ REQUIRE(log_info(5.6) == "5.6");
+
+ // User defined class
+ // REQUIRE(log_info(some_logged_class("some_val")) == "some_val");
+}
+
+TEST_CASE("log_levels", "[log_levels]")
+{
+ REQUIRE(log_info("Hello", spdlog::level::err) == "");
+ REQUIRE(log_info("Hello", spdlog::level::critical) == "");
+ REQUIRE(log_info("Hello", spdlog::level::info) == "Hello");
+ REQUIRE(log_info("Hello", spdlog::level::debug) == "Hello");
+ REQUIRE(log_info("Hello", spdlog::level::trace) == "Hello");
+}
+
+TEST_CASE("level_to_string_view", "[convert_to_string_view")
+{
+ REQUIRE(spdlog::level::to_string_view(spdlog::level::trace) == "trace");
+ REQUIRE(spdlog::level::to_string_view(spdlog::level::debug) == "debug");
+ REQUIRE(spdlog::level::to_string_view(spdlog::level::info) == "info");
+ REQUIRE(spdlog::level::to_string_view(spdlog::level::warn) == "warning");
+ REQUIRE(spdlog::level::to_string_view(spdlog::level::err) == "error");
+ REQUIRE(spdlog::level::to_string_view(spdlog::level::critical) == "critical");
+ REQUIRE(spdlog::level::to_string_view(spdlog::level::off) == "off");
+}
+
+TEST_CASE("to_short_c_str", "[convert_to_short_c_str]")
+{
+ REQUIRE(std::string(spdlog::level::to_short_c_str(spdlog::level::trace)) == "T");
+ REQUIRE(std::string(spdlog::level::to_short_c_str(spdlog::level::debug)) == "D");
+ REQUIRE(std::string(spdlog::level::to_short_c_str(spdlog::level::info)) == "I");
+ REQUIRE(std::string(spdlog::level::to_short_c_str(spdlog::level::warn)) == "W");
+ REQUIRE(std::string(spdlog::level::to_short_c_str(spdlog::level::err)) == "E");
+ REQUIRE(std::string(spdlog::level::to_short_c_str(spdlog::level::critical)) == "C");
+ REQUIRE(std::string(spdlog::level::to_short_c_str(spdlog::level::off)) == "O");
+}
+
+TEST_CASE("to_level_enum", "[convert_to_level_enum]")
+{
+ REQUIRE(spdlog::level::from_str("trace") == spdlog::level::trace);
+ REQUIRE(spdlog::level::from_str("debug") == spdlog::level::debug);
+ REQUIRE(spdlog::level::from_str("info") == spdlog::level::info);
+ REQUIRE(spdlog::level::from_str("warning") == spdlog::level::warn);
+ REQUIRE(spdlog::level::from_str("error") == spdlog::level::err);
+ REQUIRE(spdlog::level::from_str("critical") == spdlog::level::critical);
+ REQUIRE(spdlog::level::from_str("off") == spdlog::level::off);
+ REQUIRE(spdlog::level::from_str("null") == spdlog::level::off);
+}
+
+TEST_CASE("periodic flush", "[periodic_flush]")
+{
+ using namespace spdlog;
+
+ auto logger = spdlog::create<sinks::test_sink_mt>("periodic_flush");
+
+ auto test_sink = std::static_pointer_cast<sinks::test_sink_mt>(logger->sinks()[0]);
+
+ spdlog::flush_every(std::chrono::seconds(1));
+ std::this_thread::sleep_for(std::chrono::milliseconds(1250));
+ REQUIRE(test_sink->flush_counter() == 1);
+ spdlog::flush_every(std::chrono::seconds(0));
+ spdlog::drop_all();
+}
+
+TEST_CASE("clone-logger", "[clone]")
+{
+ using namespace spdlog;
+ auto test_sink = std::make_shared<sinks::test_sink_mt>();
+ auto logger = std::make_shared<spdlog::logger>("orig", test_sink);
+ logger->set_pattern("%v");
+ auto cloned = logger->clone("clone");
+
+ REQUIRE(cloned->name() == "clone");
+ REQUIRE(logger->sinks() == cloned->sinks());
+ REQUIRE(logger->level() == cloned->level());
+ REQUIRE(logger->flush_level() == cloned->flush_level());
+ logger->info("Some message 1");
+ cloned->info("Some message 2");
+
+ REQUIRE(test_sink->lines().size() == 2);
+ REQUIRE(test_sink->lines()[0] == "Some message 1");
+ REQUIRE(test_sink->lines()[1] == "Some message 2");
+
+ spdlog::drop_all();
+}
+
+TEST_CASE("clone async", "[clone]")
+{
+ using namespace spdlog;
+
+ spdlog::init_thread_pool(4, 1);
+ auto test_sink = std::make_shared<sinks::test_sink_st>();
+ auto logger = std::make_shared<spdlog::async_logger>("orig", test_sink, spdlog::thread_pool());
+ logger->set_pattern("%v");
+ auto cloned = logger->clone("clone");
+
+ REQUIRE(cloned->name() == "clone");
+ REQUIRE(logger->sinks() == cloned->sinks());
+ REQUIRE(logger->level() == cloned->level());
+ REQUIRE(logger->flush_level() == cloned->flush_level());
+
+ logger->info("Some message 1");
+ cloned->info("Some message 2");
+
+ spdlog::details::os::sleep_for_millis(10);
+
+ REQUIRE(test_sink->lines().size() == 2);
+ REQUIRE(test_sink->lines()[0] == "Some message 1");
+ REQUIRE(test_sink->lines()[1] == "Some message 2");
+
+ spdlog::drop_all();
+}
+
+TEST_CASE("to_hex", "[to_hex]")
+{
+ std::ostringstream oss;
+ auto oss_sink = std::make_shared<spdlog::sinks::ostream_sink_mt>(oss);
+ spdlog::logger oss_logger("oss", oss_sink);
+
+ std::vector<unsigned char> v{9, 0xa, 0xb, 0xc, 0xff, 0xff};
+ oss_logger.info("{}", spdlog::to_hex(v));
+
+ auto output = oss.str();
+ REQUIRE(ends_with(output, "0000: 09 0a 0b 0c ff ff" + std::string(spdlog::details::os::default_eol)));
+}
+
+TEST_CASE("to_hex_upper", "[to_hex]")
+{
+ std::ostringstream oss;
+ auto oss_sink = std::make_shared<spdlog::sinks::ostream_sink_mt>(oss);
+ spdlog::logger oss_logger("oss", oss_sink);
+
+ std::vector<unsigned char> v{9, 0xa, 0xb, 0xc, 0xff, 0xff};
+ oss_logger.info("{:X}", spdlog::to_hex(v));
+
+ auto output = oss.str();
+ REQUIRE(ends_with(output, "0000: 09 0A 0B 0C FF FF" + std::string(spdlog::details::os::default_eol)));
+}
+
+TEST_CASE("to_hex_no_delimiter", "[to_hex]")
+{
+ std::ostringstream oss;
+ auto oss_sink = std::make_shared<spdlog::sinks::ostream_sink_mt>(oss);
+ spdlog::logger oss_logger("oss", oss_sink);
+
+ std::vector<unsigned char> v{9, 0xa, 0xb, 0xc, 0xff, 0xff};
+ oss_logger.info("{:sX}", spdlog::to_hex(v));
+
+ auto output = oss.str();
+ REQUIRE(ends_with(output, "0000: 090A0B0CFFFF" + std::string(spdlog::details::os::default_eol)));
+}
+
+TEST_CASE("default logger API", "[default logger]")
+{
+ std::ostringstream oss;
+ auto oss_sink = std::make_shared<spdlog::sinks::ostream_sink_mt>(oss);
+
+ spdlog::set_default_logger(std::make_shared<spdlog::logger>("oss", oss_sink));
+ spdlog::set_pattern("*** %v");
+
+ spdlog::default_logger()->set_level(spdlog::level::trace);
+ spdlog::trace("hello trace");
+ REQUIRE(oss.str() == "*** hello trace" + std::string(spdlog::details::os::default_eol));
+
+ oss.str("");
+ spdlog::debug("hello debug");
+ REQUIRE(oss.str() == "*** hello debug" + std::string(spdlog::details::os::default_eol));
+
+ oss.str("");
+ spdlog::info("Hello");
+ REQUIRE(oss.str() == "*** Hello" + std::string(spdlog::details::os::default_eol));
+
+ oss.str("");
+ spdlog::warn("Hello again {}", 2);
+ REQUIRE(oss.str() == "*** Hello again 2" + std::string(spdlog::details::os::default_eol));
+
+ oss.str("");
+ spdlog::error(123);
+ REQUIRE(oss.str() == "*** 123" + std::string(spdlog::details::os::default_eol));
+
+ oss.str("");
+ spdlog::critical(std::string("some string"));
+ REQUIRE(oss.str() == "*** some string" + std::string(spdlog::details::os::default_eol));
+
+ oss.str("");
+ spdlog::set_level(spdlog::level::info);
+ spdlog::debug("should not be logged");
+ REQUIRE(oss.str().empty());
+ spdlog::drop_all();
+ spdlog::set_pattern("%v");
+}
--- /dev/null
+#include "includes.h"
+
+using namespace std::chrono;
+using std::chrono::milliseconds;
+using test_clock = std::chrono::high_resolution_clock;
+
+static milliseconds millis_from(const test_clock::time_point &tp0)
+{
+ return std::chrono::duration_cast<milliseconds>(test_clock::now() - tp0);
+}
+TEST_CASE("dequeue-empty-nowait", "[mpmc_blocking_q]")
+{
+ size_t q_size = 100;
+ milliseconds tolerance_wait(10);
+ spdlog::details::mpmc_blocking_queue<int> q(q_size);
+ int popped_item;
+
+ auto start = test_clock::now();
+ auto rv = q.dequeue_for(popped_item, milliseconds::zero());
+ auto delta_ms = millis_from(start);
+
+ REQUIRE(rv == false);
+ INFO("Delta " << delta_ms.count() << " millis");
+ REQUIRE(delta_ms <= tolerance_wait);
+}
+
+TEST_CASE("dequeue-empty-wait", "[mpmc_blocking_q]")
+{
+
+ size_t q_size = 100;
+ milliseconds wait_ms(250);
+ milliseconds tolerance_wait(250);
+
+ spdlog::details::mpmc_blocking_queue<int> q(q_size);
+ int popped_item;
+ auto start = test_clock::now();
+ auto rv = q.dequeue_for(popped_item, wait_ms);
+ auto delta_ms = millis_from(start);
+
+ REQUIRE(rv == false);
+
+ INFO("Delta " << delta_ms.count() << " millis");
+ REQUIRE(delta_ms >= wait_ms - tolerance_wait);
+ REQUIRE(delta_ms <= wait_ms + tolerance_wait);
+}
+
+TEST_CASE("enqueue_nowait", "[mpmc_blocking_q]")
+{
+
+ size_t q_size = 1;
+ spdlog::details::mpmc_blocking_queue<int> q(q_size);
+ milliseconds tolerance_wait(10);
+
+ q.enqueue(1);
+ REQUIRE(q.overrun_counter() == 0);
+
+ auto start = test_clock::now();
+ q.enqueue_nowait(2);
+ auto delta_ms = millis_from(start);
+
+ INFO("Delta " << delta_ms.count() << " millis");
+ REQUIRE(delta_ms <= tolerance_wait);
+ REQUIRE(q.overrun_counter() == 1);
+}
+
+TEST_CASE("bad_queue", "[mpmc_blocking_q]")
+{
+ size_t q_size = 0;
+ spdlog::details::mpmc_blocking_queue<int> q(q_size);
+ q.enqueue_nowait(1);
+ REQUIRE(q.overrun_counter() == 1);
+ int i;
+ REQUIRE(q.dequeue_for(i, milliseconds(0)) == false);
+}
+
+TEST_CASE("empty_queue", "[mpmc_blocking_q]")
+{
+ size_t q_size = 10;
+ spdlog::details::mpmc_blocking_queue<int> q(q_size);
+ int i;
+ REQUIRE(q.dequeue_for(i, milliseconds(10)) == false);
+}
+
+TEST_CASE("full_queue", "[mpmc_blocking_q]")
+{
+ size_t q_size = 100;
+ spdlog::details::mpmc_blocking_queue<int> q(q_size);
+ for (int i = 0; i < static_cast<int>(q_size); i++)
+ {
+ q.enqueue(std::move(i));
+ }
+
+ q.enqueue_nowait(123456);
+ REQUIRE(q.overrun_counter() == 1);
+
+ for (int i = 1; i < static_cast<int>(q_size); i++)
+ {
+ int item = -1;
+ q.dequeue_for(item, milliseconds(0));
+ REQUIRE(item == i);
+ }
+
+ // last item pushed has overridden the oldest.
+ int item = -1;
+ q.dequeue_for(item, milliseconds(0));
+ REQUIRE(item == 123456);
+}
--- /dev/null
+#include "includes.h"
+#include "test_sink.h"
+
+using spdlog::memory_buf_t;
+
+// log to str and return it
+template<typename... Args>
+static std::string log_to_str(const std::string &msg, const Args &... args)
+{
+ std::ostringstream oss;
+ auto oss_sink = std::make_shared<spdlog::sinks::ostream_sink_mt>(oss);
+ spdlog::logger oss_logger("pattern_tester", oss_sink);
+ oss_logger.set_level(spdlog::level::info);
+
+ oss_logger.set_formatter(std::unique_ptr<spdlog::formatter>(new spdlog::pattern_formatter(args...)));
+
+ oss_logger.info(msg);
+ return oss.str();
+}
+
+TEST_CASE("custom eol", "[pattern_formatter]")
+{
+ std::string msg = "Hello custom eol test";
+ std::string eol = ";)";
+ REQUIRE(log_to_str(msg, "%v", spdlog::pattern_time_type::local, ";)") == msg + eol);
+}
+
+TEST_CASE("empty format", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "", spdlog::pattern_time_type::local, "") == "");
+}
+
+TEST_CASE("empty format2", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "", spdlog::pattern_time_type::local, "\n") == "\n");
+}
+
+TEST_CASE("level", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%l] %v", spdlog::pattern_time_type::local, "\n") == "[info] Some message\n");
+}
+
+TEST_CASE("short level", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%L] %v", spdlog::pattern_time_type::local, "\n") == "[I] Some message\n");
+}
+
+TEST_CASE("name", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%n] %v", spdlog::pattern_time_type::local, "\n") == "[pattern_tester] Some message\n");
+}
+
+TEST_CASE("date MM/DD/YY ", "[pattern_formatter]")
+{
+ auto now_tm = spdlog::details::os::localtime();
+ std::stringstream oss;
+ oss << std::setfill('0') << std::setw(2) << now_tm.tm_mon + 1 << "/" << std::setw(2) << now_tm.tm_mday << "/" << std::setw(2)
+ << (now_tm.tm_year + 1900) % 1000 << " Some message\n";
+ REQUIRE(log_to_str("Some message", "%D %v", spdlog::pattern_time_type::local, "\n") == oss.str());
+}
+
+TEST_CASE("color range test1", "[pattern_formatter]")
+{
+ auto formatter = std::make_shared<spdlog::pattern_formatter>("%^%v%$", spdlog::pattern_time_type::local, "\n");
+
+ memory_buf_t buf;
+ fmt::format_to(buf, "Hello");
+ memory_buf_t formatted;
+ std::string logger_name = "test";
+ spdlog::details::log_msg msg(logger_name, spdlog::level::info, spdlog::string_view_t(buf.data(), buf.size()));
+ formatter->format(msg, formatted);
+ REQUIRE(msg.color_range_start == 0);
+ REQUIRE(msg.color_range_end == 5);
+ REQUIRE(log_to_str("hello", "%^%v%$", spdlog::pattern_time_type::local, "\n") == "hello\n");
+}
+
+TEST_CASE("color range test2", "[pattern_formatter]")
+{
+ auto formatter = std::make_shared<spdlog::pattern_formatter>("%^%$", spdlog::pattern_time_type::local, "\n");
+ std::string logger_name = "test";
+ spdlog::details::log_msg msg(logger_name, spdlog::level::info, "");
+ memory_buf_t formatted;
+ formatter->format(msg, formatted);
+ REQUIRE(msg.color_range_start == 0);
+ REQUIRE(msg.color_range_end == 0);
+ REQUIRE(log_to_str("", "%^%$", spdlog::pattern_time_type::local, "\n") == "\n");
+}
+
+TEST_CASE("color range test3", "[pattern_formatter]")
+{
+ auto formatter = std::make_shared<spdlog::pattern_formatter>("%^***%$");
+ std::string logger_name = "test";
+ spdlog::details::log_msg msg(logger_name, spdlog::level::info, "ignored");
+ memory_buf_t formatted;
+ formatter->format(msg, formatted);
+ REQUIRE(msg.color_range_start == 0);
+ REQUIRE(msg.color_range_end == 3);
+}
+
+TEST_CASE("color range test4", "[pattern_formatter]")
+{
+ auto formatter = std::make_shared<spdlog::pattern_formatter>("XX%^YYY%$", spdlog::pattern_time_type::local, "\n");
+ std::string logger_name = "test";
+ spdlog::details::log_msg msg(logger_name, spdlog::level::info, "ignored");
+
+ memory_buf_t formatted;
+ formatter->format(msg, formatted);
+ REQUIRE(msg.color_range_start == 2);
+ REQUIRE(msg.color_range_end == 5);
+ REQUIRE(log_to_str("ignored", "XX%^YYY%$", spdlog::pattern_time_type::local, "\n") == "XXYYY\n");
+}
+
+TEST_CASE("color range test5", "[pattern_formatter]")
+{
+ auto formatter = std::make_shared<spdlog::pattern_formatter>("**%^");
+ std::string logger_name = "test";
+ spdlog::details::log_msg msg(logger_name, spdlog::level::info, "ignored");
+ memory_buf_t formatted;
+ formatter->format(msg, formatted);
+ REQUIRE(msg.color_range_start == 2);
+ REQUIRE(msg.color_range_end == 0);
+}
+
+TEST_CASE("color range test6", "[pattern_formatter]")
+{
+ auto formatter = std::make_shared<spdlog::pattern_formatter>("**%$");
+ std::string logger_name = "test";
+ spdlog::details::log_msg msg(logger_name, spdlog::level::info, "ignored");
+ memory_buf_t formatted;
+ formatter->format(msg, formatted);
+ REQUIRE(msg.color_range_start == 0);
+ REQUIRE(msg.color_range_end == 2);
+}
+
+//
+// Test padding
+//
+
+TEST_CASE("level_left_padded", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%8l] %v", spdlog::pattern_time_type::local, "\n") == "[ info] Some message\n");
+ REQUIRE(log_to_str("Some message", "[%8!l] %v", spdlog::pattern_time_type::local, "\n") == "[ info] Some message\n");
+}
+
+TEST_CASE("level_right_padded", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%-8l] %v", spdlog::pattern_time_type::local, "\n") == "[info ] Some message\n");
+ REQUIRE(log_to_str("Some message", "[%-8!l] %v", spdlog::pattern_time_type::local, "\n") == "[info ] Some message\n");
+}
+
+TEST_CASE("level_center_padded", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%=8l] %v", spdlog::pattern_time_type::local, "\n") == "[ info ] Some message\n");
+ REQUIRE(log_to_str("Some message", "[%=8!l] %v", spdlog::pattern_time_type::local, "\n") == "[ info ] Some message\n");
+}
+
+TEST_CASE("short level_left_padded", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%3L] %v", spdlog::pattern_time_type::local, "\n") == "[ I] Some message\n");
+ REQUIRE(log_to_str("Some message", "[%3!L] %v", spdlog::pattern_time_type::local, "\n") == "[ I] Some message\n");
+}
+
+TEST_CASE("short level_right_padded", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%-3L] %v", spdlog::pattern_time_type::local, "\n") == "[I ] Some message\n");
+ REQUIRE(log_to_str("Some message", "[%-3!L] %v", spdlog::pattern_time_type::local, "\n") == "[I ] Some message\n");
+}
+
+TEST_CASE("short level_center_padded", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%=3L] %v", spdlog::pattern_time_type::local, "\n") == "[ I ] Some message\n");
+ REQUIRE(log_to_str("Some message", "[%=3!L] %v", spdlog::pattern_time_type::local, "\n") == "[ I ] Some message\n");
+}
+
+TEST_CASE("left_padded_short", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%3n] %v", spdlog::pattern_time_type::local, "\n") == "[pattern_tester] Some message\n");
+ REQUIRE(log_to_str("Some message", "[%3!n] %v", spdlog::pattern_time_type::local, "\n") == "[pat] Some message\n");
+}
+
+TEST_CASE("right_padded_short", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%-3n] %v", spdlog::pattern_time_type::local, "\n") == "[pattern_tester] Some message\n");
+ REQUIRE(log_to_str("Some message", "[%-3!n] %v", spdlog::pattern_time_type::local, "\n") == "[pat] Some message\n");
+}
+
+TEST_CASE("center_padded_short", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%=3n] %v", spdlog::pattern_time_type::local, "\n") == "[pattern_tester] Some message\n");
+ REQUIRE(log_to_str("Some message", "[%=3!n] %v", spdlog::pattern_time_type::local, "\n") == "[pat] Some message\n");
+}
+
+TEST_CASE("left_padded_huge", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%-300n] %v", spdlog::pattern_time_type::local, "\n") ==
+ "[pattern_tester ] Some message\n");
+
+ REQUIRE(log_to_str("Some message", "[%-300!n] %v", spdlog::pattern_time_type::local, "\n") ==
+ "[pattern_tester ] Some message\n");
+}
+
+TEST_CASE("left_padded_max", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("Some message", "[%-64n] %v", spdlog::pattern_time_type::local, "\n") ==
+ "[pattern_tester ] Some message\n");
+
+ REQUIRE(log_to_str("Some message", "[%-64!n] %v", spdlog::pattern_time_type::local, "\n") ==
+ "[pattern_tester ] Some message\n");
+}
+
+// Test padding + truncate flag
+
+TEST_CASE("paddinng_truncate", "[pattern_formatter]")
+{
+ REQUIRE(log_to_str("123456", "%6!v", spdlog::pattern_time_type::local, "\n") == "123456\n");
+ REQUIRE(log_to_str("123456", "%5!v", spdlog::pattern_time_type::local, "\n") == "12345\n");
+ REQUIRE(log_to_str("123456", "%7!v", spdlog::pattern_time_type::local, "\n") == " 123456\n");
+
+ REQUIRE(log_to_str("123456", "%-6!v", spdlog::pattern_time_type::local, "\n") == "123456\n");
+ REQUIRE(log_to_str("123456", "%-5!v", spdlog::pattern_time_type::local, "\n") == "12345\n");
+ REQUIRE(log_to_str("123456", "%-7!v", spdlog::pattern_time_type::local, "\n") == "123456 \n");
+
+ REQUIRE(log_to_str("123456", "%=6!v", spdlog::pattern_time_type::local, "\n") == "123456\n");
+ REQUIRE(log_to_str("123456", "%=5!v", spdlog::pattern_time_type::local, "\n") == "12345\n");
+ REQUIRE(log_to_str("123456", "%=7!v", spdlog::pattern_time_type::local, "\n") == "123456 \n");
+
+ REQUIRE(log_to_str("123456", "%0!v", spdlog::pattern_time_type::local, "\n") == "\n");
+}
+
+TEST_CASE("paddinng_truncate_funcname", "[pattern_formatter]")
+{
+ spdlog::sinks::test_sink_st test_sink;
+
+ const char *pattern = "%v [%5!!]";
+ auto formatter = std::unique_ptr<spdlog::formatter>(new spdlog::pattern_formatter(pattern));
+ test_sink.set_formatter(std::move(formatter));
+
+ spdlog::details::log_msg msg1{spdlog::source_loc{"ignored", 1, "func"}, "test_logger", spdlog::level::info, "message"};
+ test_sink.log(msg1);
+
+ spdlog::details::log_msg msg2{spdlog::source_loc{"ignored", 1, "function"}, "test_logger", spdlog::level::info, "message"};
+ test_sink.log(msg2);
+
+ auto lines = test_sink.lines();
+ REQUIRE(lines[0] == "message [ func]");
+ REQUIRE(lines[1] == "message [funct]");
+}
+
+TEST_CASE("clone-default-formatter", "[pattern_formatter]")
+{
+ auto formatter_1 = std::make_shared<spdlog::pattern_formatter>();
+ auto formatter_2 = formatter_1->clone();
+ std::string logger_name = "test";
+ spdlog::details::log_msg msg(logger_name, spdlog::level::info, "some message");
+
+ memory_buf_t formatted_1;
+ memory_buf_t formatted_2;
+ formatter_1->format(msg, formatted_1);
+ formatter_2->format(msg, formatted_2);
+
+ REQUIRE(fmt::to_string(formatted_1) == fmt::to_string(formatted_2));
+}
+
+TEST_CASE("clone-default-formatter2", "[pattern_formatter]")
+{
+ auto formatter_1 = std::make_shared<spdlog::pattern_formatter>("%+");
+ auto formatter_2 = formatter_1->clone();
+ std::string logger_name = "test";
+ spdlog::details::log_msg msg(logger_name, spdlog::level::info, "some message");
+
+ memory_buf_t formatted_1;
+ memory_buf_t formatted_2;
+ formatter_1->format(msg, formatted_1);
+ formatter_2->format(msg, formatted_2);
+
+ REQUIRE(fmt::to_string(formatted_1) == fmt::to_string(formatted_2));
+}
+
+TEST_CASE("clone-formatter", "[pattern_formatter]")
+{
+ auto formatter_1 = std::make_shared<spdlog::pattern_formatter>("%D %X [%] [%n] %v");
+ auto formatter_2 = formatter_1->clone();
+ std::string logger_name = "test";
+ spdlog::details::log_msg msg(logger_name, spdlog::level::info, "some message");
+
+ memory_buf_t formatted_1;
+ memory_buf_t formatted_2;
+ formatter_1->format(msg, formatted_1);
+ formatter_2->format(msg, formatted_2);
+ REQUIRE(fmt::to_string(formatted_1) == fmt::to_string(formatted_2));
+}
+
+TEST_CASE("clone-formatter-2", "[pattern_formatter]")
+{
+ using spdlog::pattern_time_type;
+ auto formatter_1 = std::make_shared<spdlog::pattern_formatter>("%D %X [%] [%n] %v", pattern_time_type::utc, "xxxxxx\n");
+ auto formatter_2 = formatter_1->clone();
+ std::string logger_name = "test2";
+ spdlog::details::log_msg msg(logger_name, spdlog::level::info, "some message");
+
+ memory_buf_t formatted_1;
+ memory_buf_t formatted_2;
+ formatter_1->format(msg, formatted_1);
+ formatter_2->format(msg, formatted_2);
+ REQUIRE(fmt::to_string(formatted_1) == fmt::to_string(formatted_2));
+}
+
+//
+// Test source location formatting
+//
+
+#ifdef _WIN32
+static const char *test_path = "\\a\\b\\myfile.cpp";
+#else
+static const char *test_path = "/a/b//myfile.cpp";
+#endif
+
+TEST_CASE("short filename formatter-1", "[pattern_formatter]")
+{
+ spdlog::pattern_formatter formatter("%s", spdlog::pattern_time_type::local, "");
+ memory_buf_t formatted;
+ std::string logger_name = "logger-name";
+ spdlog::source_loc source_loc{test_path, 123, "some_func()"};
+ spdlog::details::log_msg msg(source_loc, "logger-name", spdlog::level::info, "Hello");
+ formatter.format(msg, formatted);
+ REQUIRE(fmt::to_string(formatted) == "myfile.cpp");
+}
+
+TEST_CASE("short filename formatter-2", "[pattern_formatter]")
+{
+ spdlog::pattern_formatter formatter("%s:%#", spdlog::pattern_time_type::local, "");
+ memory_buf_t formatted;
+ std::string logger_name = "logger-name";
+ spdlog::source_loc source_loc{"myfile.cpp", 123, "some_func()"};
+ spdlog::details::log_msg msg(source_loc, "logger-name", spdlog::level::info, "Hello");
+ formatter.format(msg, formatted);
+ REQUIRE(fmt::to_string(formatted) == "myfile.cpp:123");
+}
+
+TEST_CASE("short filename formatter-3", "[pattern_formatter]")
+{
+ spdlog::pattern_formatter formatter("%s %v", spdlog::pattern_time_type::local, "");
+ memory_buf_t formatted;
+ std::string logger_name = "logger-name";
+ spdlog::source_loc source_loc{"", 123, "some_func()"};
+ spdlog::details::log_msg msg(source_loc, "logger-name", spdlog::level::info, "Hello");
+ formatter.format(msg, formatted);
+ REQUIRE(fmt::to_string(formatted) == " Hello");
+}
+
+TEST_CASE("full filename formatter", "[pattern_formatter]")
+{
+ spdlog::pattern_formatter formatter("%g", spdlog::pattern_time_type::local, "");
+ memory_buf_t formatted;
+ std::string logger_name = "logger-name";
+ spdlog::source_loc source_loc{test_path, 123, "some_func()"};
+ spdlog::details::log_msg msg(source_loc, "logger-name", spdlog::level::info, "Hello");
+ formatter.format(msg, formatted);
+ REQUIRE(fmt::to_string(formatted) == test_path);
+}
--- /dev/null
+#include "includes.h"
+
+static const char *tested_logger_name = "null_logger";
+static const char *tested_logger_name2 = "null_logger2";
+
+#ifndef SPDLOG_NO_EXCEPTIONS
+TEST_CASE("register_drop", "[registry]")
+{
+ spdlog::drop_all();
+ spdlog::create<spdlog::sinks::null_sink_mt>(tested_logger_name);
+ REQUIRE(spdlog::get(tested_logger_name) != nullptr);
+ // Throw if registering existing name
+ REQUIRE_THROWS_AS(spdlog::create<spdlog::sinks::null_sink_mt>(tested_logger_name), spdlog::spdlog_ex);
+}
+
+TEST_CASE("explicit register", "[registry]")
+{
+ spdlog::drop_all();
+ auto logger = std::make_shared<spdlog::logger>(tested_logger_name, std::make_shared<spdlog::sinks::null_sink_st>());
+ spdlog::register_logger(logger);
+ REQUIRE(spdlog::get(tested_logger_name) != nullptr);
+ // Throw if registering existing name
+ REQUIRE_THROWS_AS(spdlog::create<spdlog::sinks::null_sink_mt>(tested_logger_name), spdlog::spdlog_ex);
+}
+#endif
+
+TEST_CASE("apply_all", "[registry]")
+{
+ spdlog::drop_all();
+ auto logger = std::make_shared<spdlog::logger>(tested_logger_name, std::make_shared<spdlog::sinks::null_sink_st>());
+ spdlog::register_logger(logger);
+ auto logger2 = std::make_shared<spdlog::logger>(tested_logger_name2, std::make_shared<spdlog::sinks::null_sink_st>());
+ spdlog::register_logger(logger2);
+
+ int counter = 0;
+ spdlog::apply_all([&counter](std::shared_ptr<spdlog::logger>) { counter++; });
+ REQUIRE(counter == 2);
+
+ counter = 0;
+ spdlog::drop(tested_logger_name2);
+ spdlog::apply_all([&counter](std::shared_ptr<spdlog::logger> l) {
+ REQUIRE(l->name() == tested_logger_name);
+ counter++;
+ });
+ REQUIRE(counter == 1);
+}
+
+TEST_CASE("drop", "[registry]")
+{
+ spdlog::drop_all();
+ spdlog::create<spdlog::sinks::null_sink_mt>(tested_logger_name);
+ spdlog::drop(tested_logger_name);
+ REQUIRE_FALSE(spdlog::get(tested_logger_name));
+}
+
+TEST_CASE("drop-default", "[registry]")
+{
+ spdlog::set_default_logger(spdlog::null_logger_st(tested_logger_name));
+ spdlog::drop(tested_logger_name);
+ REQUIRE_FALSE(spdlog::default_logger());
+ REQUIRE_FALSE(spdlog::get(tested_logger_name));
+}
+
+TEST_CASE("drop_all", "[registry]")
+{
+ spdlog::drop_all();
+ spdlog::create<spdlog::sinks::null_sink_mt>(tested_logger_name);
+ spdlog::create<spdlog::sinks::null_sink_mt>(tested_logger_name2);
+ spdlog::drop_all();
+ REQUIRE_FALSE(spdlog::get(tested_logger_name));
+ REQUIRE_FALSE(spdlog::get(tested_logger_name2));
+ REQUIRE_FALSE(spdlog::default_logger());
+}
+
+TEST_CASE("drop non existing", "[registry]")
+{
+ spdlog::drop_all();
+ spdlog::create<spdlog::sinks::null_sink_mt>(tested_logger_name);
+ spdlog::drop("some_name");
+ REQUIRE_FALSE(spdlog::get("some_name"));
+ REQUIRE(spdlog::get(tested_logger_name));
+ spdlog::drop_all();
+}
+
+TEST_CASE("default logger", "[registry]")
+{
+ spdlog::drop_all();
+ spdlog::set_default_logger(spdlog::null_logger_st(tested_logger_name));
+ REQUIRE(spdlog::get(tested_logger_name) == spdlog::default_logger());
+ spdlog::drop_all();
+}
+
+TEST_CASE("set_default_logger(nullptr)", "[registry]")
+{
+ spdlog::set_default_logger(nullptr);
+ REQUIRE_FALSE(spdlog::default_logger());
+}
+
+TEST_CASE("disable automatic registration", "[registry]")
+{
+ // set some global parameters
+ spdlog::level::level_enum log_level = spdlog::level::level_enum::warn;
+ spdlog::set_level(log_level);
+ // but disable automatic registration
+ spdlog::set_automatic_registration(false);
+ auto logger1 = spdlog::create<spdlog::sinks::daily_file_sink_st>(tested_logger_name, "filename", 11, 59);
+ auto logger2 = spdlog::create_async<spdlog::sinks::stdout_color_sink_mt>(tested_logger_name2);
+ // loggers should not be part of the registry
+ REQUIRE_FALSE(spdlog::get(tested_logger_name));
+ REQUIRE_FALSE(spdlog::get(tested_logger_name2));
+ // but make sure they are still initialized according to global defaults
+ REQUIRE(logger1->level() == log_level);
+ REQUIRE(logger2->level() == log_level);
+ spdlog::set_level(spdlog::level::info);
+ spdlog::set_automatic_registration(true);
+}
--- /dev/null
+//
+// Copyright(c) 2018 Gabi Melman.
+// Distributed under the MIT License (http://opensource.org/licenses/MIT)
+//
+
+#pragma once
+
+#include "spdlog/details/null_mutex.h"
+#include "spdlog/sinks/base_sink.h"
+#include "spdlog/fmt/fmt.h"
+#include <chrono>
+#include <mutex>
+#include <thread>
+
+namespace spdlog {
+namespace sinks {
+
+template<class Mutex>
+class test_sink : public base_sink<Mutex>
+{
+ const size_t lines_to_save = 100;
+
+public:
+ size_t msg_counter()
+ {
+ std::lock_guard<Mutex> lock(base_sink<Mutex>::mutex_);
+ return msg_counter_;
+ }
+
+ size_t flush_counter()
+ {
+ std::lock_guard<Mutex> lock(base_sink<Mutex>::mutex_);
+ return flush_counter_;
+ }
+
+ void set_delay(std::chrono::milliseconds delay)
+ {
+ std::lock_guard<Mutex> lock(base_sink<Mutex>::mutex_);
+ delay_ = delay;
+ }
+
+ // return last output without the eol
+ std::vector<std::string> lines()
+ {
+ std::lock_guard<Mutex> lock(base_sink<Mutex>::mutex_);
+ return lines_;
+ }
+
+protected:
+ void sink_it_(const details::log_msg &msg) override
+ {
+ memory_buf_t formatted;
+ base_sink<Mutex>::formatter_->format(msg, formatted);
+ // save the line without the eol
+ auto eol_len = strlen(details::os::default_eol);
+ if (lines_.size() < lines_to_save)
+ {
+ lines_.emplace_back(formatted.begin(), formatted.end() - eol_len);
+ }
+ msg_counter_++;
+ std::this_thread::sleep_for(delay_);
+ }
+
+ void flush_() override
+ {
+ flush_counter_++;
+ }
+
+ size_t msg_counter_{0};
+ size_t flush_counter_{0};
+ std::chrono::milliseconds delay_{std::chrono::milliseconds::zero()};
+ std::vector<std::string> lines_;
+};
+
+using test_sink_mt = test_sink<std::mutex>;
+using test_sink_st = test_sink<details::null_mutex>;
+
+} // namespace sinks
+} // namespace spdlog
--- /dev/null
+/*
+ * This content is released under the MIT License as specified in https://raw.githubusercontent.com/gabime/spdlog/master/LICENSE
+ */
+#include "includes.h"
+#include "spdlog/sinks/stdout_sinks.h"
+#include "spdlog/sinks/stdout_color_sinks.h"
+TEST_CASE("stdout_st", "[stdout]")
+{
+ auto l = spdlog::stdout_logger_st("test");
+ l->set_pattern("%+");
+ l->set_level(spdlog::level::trace);
+ l->trace("Test stdout_st");
+ spdlog::drop_all();
+}
+
+TEST_CASE("stdout_mt", "[stdout]")
+{
+ auto l = spdlog::stdout_logger_mt("test");
+ l->set_pattern("%+");
+ l->set_level(spdlog::level::debug);
+ l->debug("Test stdout_mt");
+ spdlog::drop_all();
+}
+
+TEST_CASE("stderr_st", "[stderr]")
+{
+ auto l = spdlog::stderr_logger_st("test");
+ l->set_pattern("%+");
+ l->info("Test stderr_st");
+ spdlog::drop_all();
+}
+
+TEST_CASE("stderr_mt", "[stderr]")
+{
+ auto l = spdlog::stderr_logger_mt("test");
+ l->set_pattern("%+");
+ l->info("Test stderr_mt");
+ l->warn("Test stderr_mt");
+ l->error("Test stderr_mt");
+ l->critical("Test stderr_mt");
+ spdlog::drop_all();
+}
+
+// color loggers
+TEST_CASE("stdout_color_st", "[stdout]")
+{
+ auto l = spdlog::stdout_color_st("test");
+ l->set_pattern("%+");
+ l->info("Test stdout_color_st");
+ spdlog::drop_all();
+}
+
+TEST_CASE("stdout_color_mt", "[stdout]")
+{
+ auto l = spdlog::stdout_color_mt("test");
+ l->set_pattern("%+");
+ l->set_level(spdlog::level::trace);
+ l->trace("Test stdout_color_mt");
+ spdlog::drop_all();
+}
+
+TEST_CASE("stderr_color_st", "[stderr]")
+{
+ auto l = spdlog::stderr_color_st("test");
+ l->set_pattern("%+");
+ l->set_level(spdlog::level::debug);
+ l->debug("Test stderr_color_st");
+ spdlog::drop_all();
+}
+
+TEST_CASE("stderr_color_mt", "[stderr]")
+{
+ auto l = spdlog::stderr_color_mt("test");
+ l->set_pattern("%+");
+ l->info("Test stderr_color_mt");
+ l->warn("Test stderr_color_mt");
+ l->error("Test stderr_color_mt");
+ l->critical("Test stderr_color_mt");
+ spdlog::drop_all();
+}
+
+#ifdef SPDLOG_WCHAR_TO_UTF8_SUPPORT
+
+TEST_CASE("wchar_api", "[stdout]")
+{
+ auto l = spdlog::stdout_logger_st("wchar_logger");
+ l->set_pattern("%+");
+ l->set_level(spdlog::level::trace);
+ l->trace(L"Test wchar_api");
+ l->trace(L"Test wchar_api {}", L"param");
+ l->trace(L"Test wchar_api {}", 1);
+ l->trace(L"Test wchar_api {}", std::wstring{L"wstring param"});
+ l->trace(std::wstring{L"Test wchar_api wstring"});
+ SPDLOG_LOGGER_DEBUG(l, L"Test SPDLOG_LOGGER_DEBUG {}", L"param");
+ spdlog::drop_all();
+}
+
+#endif
\ No newline at end of file
--- /dev/null
+#include "includes.h"
+#include "spdlog/sinks/systemd_sink.h"
+
+TEST_CASE("systemd", "[all]")
+{
+ auto systemd_sink = std::make_shared<spdlog::sinks::systemd_sink_st>();
+ spdlog::logger logger("spdlog_systemd_test", systemd_sink);
+ logger.set_level(spdlog::level::trace);
+ logger.trace("test spdlog trace");
+ logger.debug("test spdlog debug");
+ SPDLOG_LOGGER_INFO((&logger), "test spdlog info");
+ SPDLOG_LOGGER_WARN((&logger), "test spdlog warn");
+ SPDLOG_LOGGER_ERROR((&logger), "test spdlog error");
+ SPDLOG_LOGGER_CRITICAL((&logger), "test spdlog critical");
+}
--- /dev/null
+#include "includes.h"
+
+#ifndef _WIN32
+#include <sys/types.h>
+#include <dirent.h>
+#endif
+
+void prepare_logdir()
+{
+ spdlog::drop_all();
+#ifdef _WIN32
+ system("rmdir /S /Q test_logs");
+#else
+ auto rv = system("rm -rf test_logs");
+ if (rv != 0)
+ {
+ throw std::runtime_error("Failed to rm -rf test_logs");
+ }
+#endif
+}
+
+std::string file_contents(const std::string &filename)
+{
+ std::ifstream ifs(filename);
+ if (!ifs)
+ {
+ throw std::runtime_error("Failed open file ");
+ }
+ return std::string((std::istreambuf_iterator<char>(ifs)), (std::istreambuf_iterator<char>()));
+}
+
+std::size_t count_lines(const std::string &filename)
+{
+ std::ifstream ifs(filename);
+ if (!ifs)
+ {
+ throw std::runtime_error("Failed open file ");
+ }
+
+ std::string line;
+ size_t counter = 0;
+ while (std::getline(ifs, line))
+ counter++;
+ return counter;
+}
+
+std::size_t get_filesize(const std::string &filename)
+{
+ std::ifstream ifs(filename, std::ifstream::ate | std::ifstream::binary);
+ if (!ifs)
+ {
+ throw std::runtime_error("Failed open file ");
+ }
+
+ return static_cast<std::size_t>(ifs.tellg());
+}
+
+// source: https://stackoverflow.com/a/2072890/192001
+bool ends_with(std::string const &value, std::string const &ending)
+{
+ if (ending.size() > value.size())
+ {
+ return false;
+ }
+ return std::equal(ending.rbegin(), ending.rend(), value.rbegin());
+}
+
+#ifdef _WIN32
+// Based on: https://stackoverflow.com/a/37416569/192001
+std::size_t count_files(const std::string &folder)
+{
+ size_t counter = 0;
+ WIN32_FIND_DATA ffd;
+
+ // Start iterating over the files in the folder directory.
+ HANDLE hFind = ::FindFirstFileA((folder + "\\*").c_str(), &ffd);
+ if (hFind != INVALID_HANDLE_VALUE)
+ {
+ do // Managed to locate and create an handle to that folder.
+ {
+ if (ffd.cFileName[0] != '.')
+ counter++;
+ } while (::FindNextFile(hFind, &ffd) != 0);
+ ::FindClose(hFind);
+ }
+ else
+ {
+ throw std::runtime_error("Failed open folder " + folder);
+ }
+
+ return counter;
+}
+#else
+// Based on: https://stackoverflow.com/a/2802255/192001
+std::size_t count_files(const std::string &folder)
+{
+ size_t counter = 0;
+ DIR *dp = opendir(folder.c_str());
+ if (dp == nullptr)
+ {
+ throw std::runtime_error("Failed open folder " + folder);
+ }
+
+ struct dirent *ep;
+ while ((ep = readdir(dp)) != nullptr)
+ {
+ if (ep->d_name[0] != '.')
+ counter++;
+ }
+ (void)closedir(dp);
+ return counter;
+}
+#endif
--- /dev/null
+#pragma once
+
+#include <cstddef>
+#include <string>
+
+std::size_t count_lines(const std::string &filename);
+
+std::size_t count_files(const std::string &folder);
+
+void prepare_logdir();
+
+std::string file_contents(const std::string &filename);
+
+std::size_t count_lines(const std::string &filename);
+
+std::size_t get_filesize(const std::string &filename);
+
+bool ends_with(std::string const &value, std::string const &ending);
\ No newline at end of file
projects / spdlog.git / commitdiff